diff --git a/NzbDrone.5.1.ReSharper b/NzbDrone.5.1.ReSharper index 3f5dfa8c2..f86d34090 100644 --- a/NzbDrone.5.1.ReSharper +++ b/NzbDrone.5.1.ReSharper @@ -129,7 +129,7 @@ - + diff --git a/NzbDrone.Core.Test/DbConfigControllerTest.cs b/NzbDrone.Core.Test/DbConfigControllerTest.cs index 456c46a3c..0c3fa2ff4 100644 --- a/NzbDrone.Core.Test/DbConfigControllerTest.cs +++ b/NzbDrone.Core.Test/DbConfigControllerTest.cs @@ -6,6 +6,7 @@ using MbUnit.Framework; using MbUnit.Framework.ContractVerifiers; using Moq; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; using SubSonic.Repository; diff --git a/NzbDrone.Core.Test/IndexerProviderTest.cs b/NzbDrone.Core.Test/IndexerProviderTest.cs index da057daf3..2f015ca18 100644 --- a/NzbDrone.Core.Test/IndexerProviderTest.cs +++ b/NzbDrone.Core.Test/IndexerProviderTest.cs @@ -7,6 +7,7 @@ using MbUnit.Framework; using MbUnit.Framework.ContractVerifiers; using Moq; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; using SubSonic.Repository; diff --git a/NzbDrone.Core.Test/MediaFileProviderTests.cs b/NzbDrone.Core.Test/MediaFileProviderTests.cs index 1498ea563..2efe88388 100644 --- a/NzbDrone.Core.Test/MediaFileProviderTests.cs +++ b/NzbDrone.Core.Test/MediaFileProviderTests.cs @@ -11,6 +11,7 @@ using Ninject; using Ninject.Moq; using NzbDrone.Core.Model; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; using NzbDrone.Core.Repository.Quality; using SubSonic.Repository; @@ -70,7 +71,7 @@ namespace NzbDrone.Core.Test //Currently can't verify this since the list of episodes are loaded //Dynamically by SubSonic //Assert.AreEqual(fakeEpisode, result.Episodes[0]); - + Assert.AreEqual(fakeEpisode.SeriesId, result.SeriesId); Assert.AreEqual(QualityTypes.BDRip, result.Quality); Assert.AreEqual(Parser.NormalizePath(fileName), result.Path); @@ -162,34 +163,6 @@ namespace NzbDrone.Core.Test } - [Test] - [Row("Season {season}\\S{season:00}E{episode:00} - {title} - {quality}", "Season 6\\S06E08 - Lethal Inspection - hdtv")] - [Row("Season {season}\\{series} - {season:##}{episode:00} - {title} - {quality}", "Season 6\\Futurama - 608 - Lethal Inspection - hdtv")] - [Row("Season {season}\\{series} - {season:##}{episode:00} - {title}", "Season 6\\Futurama - 608 - Lethal Inspection")] - public void test_file_path_generation(string patern, string path) - { - var fakeConfig = new Mock(); - fakeConfig.Setup(c => c.EpisodeNameFormat).Returns(patern); - - var kernel = new MockingKernel(); - kernel.Bind().ToConstant(fakeConfig.Object); - kernel.Bind().To(); - - var fakeEpisode = new EpisodeModel - { - SeasonNumber = 6, - EpisodeNumber = 8, - EpisodeTitle = "Lethal Inspection", - Quality = QualityTypes.HDTV, - SeriesTitle = "Futurama" - }; - - //Act - var result = kernel.Get().GenerateEpisodePath(fakeEpisode); - - //Assert - Assert.AreEqual(path.ToLowerInvariant(), result.ToLowerInvariant()); - } } diff --git a/NzbDrone.Core.Test/MockLib.cs b/NzbDrone.Core.Test/MockLib.cs index b05505196..4713adb3a 100644 --- a/NzbDrone.Core.Test/MockLib.cs +++ b/NzbDrone.Core.Test/MockLib.cs @@ -9,6 +9,7 @@ using Moq; using NLog; using NzbDrone.Core.Instrumentation; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using SubSonic.DataProviders; using SubSonic.Repository; using TvdbLib; diff --git a/NzbDrone.Core.Test/NzbDrone.Core.Test.csproj b/NzbDrone.Core.Test/NzbDrone.Core.Test.csproj index 158e24a14..88db4a0eb 100644 --- a/NzbDrone.Core.Test/NzbDrone.Core.Test.csproj +++ b/NzbDrone.Core.Test/NzbDrone.Core.Test.csproj @@ -86,7 +86,6 @@ - diff --git a/NzbDrone.Core.Test/ParserTest.cs b/NzbDrone.Core.Test/ParserTest.cs index a7a464260..adb25142d 100644 --- a/NzbDrone.Core.Test/ParserTest.cs +++ b/NzbDrone.Core.Test/ParserTest.cs @@ -13,6 +13,7 @@ namespace NzbDrone.Core.Test public class ParserTest { [Test] + [Row("Sonny.With.a.Chance.S02E15", 2,15)] [Row("Two.and.a.Half.Me.103.720p.HDTV.X264-DIMENSION", 1, 3)] [Row("Two.and.a.Half.Me.113.720p.HDTV.X264-DIMENSION", 1, 13)] [Row("Two.and.a.Half.Me.1013.720p.HDTV.X264-DIMENSION", 10, 13)] @@ -29,9 +30,8 @@ namespace NzbDrone.Core.Test public void episode_parse(string path, int season, int episode) { var result = Parser.ParseEpisodeInfo(path); - Assert.Count(1, result); - Assert.AreEqual(season, result[0].SeasonNumber); - Assert.AreEqual(episode, result[0].EpisodeNumber); + Assert.AreEqual(season, result.SeasonNumber); + Assert.AreEqual(episode, result.Episodes[0]); } [Test] @@ -60,15 +60,15 @@ namespace NzbDrone.Core.Test [Row("Sonny.With.a.Chance.S02E15.xvid", QualityTypes.TV)] [Row("Sonny.With.a.Chance.S02E15.divx", QualityTypes.TV)] [Row("Sonny.With.a.Chance.S02E15", QualityTypes.Unknown)] - [Row("S01E04 - So Old - Playdate - 720p TV.mkv", QualityTypes.HDTV)] - [Row("S22E03 - MoneyBART - HD TV.mkv", QualityTypes.HDTV)] - [Row("S01E03 - Come Fly With Me - 720p BluRay.mkv", QualityTypes.Bluray720)] - [Row("S01E03 - Come Fly With Me - 1080p BluRay.mkv", QualityTypes.Bluray1080)] - [Row("S11E06 - D-Yikes! - 720p WEB-DL.mkv", QualityTypes.WEBDL)] + [Row("Chuck - S01E04 - So Old - Playdate - 720p TV.mkv", QualityTypes.HDTV)] + [Row("Chuck - S22E03 - MoneyBART - HD TV.mkv", QualityTypes.HDTV)] + [Row("Chuck - S01E03 - Come Fly With Me - 720p BluRay.mkv", QualityTypes.Bluray720)] + [Row("Chuck - S01E03 - Come Fly With Me - 1080p BluRay.mkv", QualityTypes.Bluray1080)] + [Row("Chuck - S11E06 - D-Yikes! - 720p WEB-DL.mkv", QualityTypes.WEBDL)] [Row("WEEDS.S03E01-06.DUAL.BDRip.XviD.AC3.-HELLYWOOD.avi", QualityTypes.BDRip)] public void quality_parse(string path, object quality) { - var result = Parser.ParseQuality(path); + var result = Parser.ParseEpisodeInfo(path).Quality; Assert.AreEqual(quality, result); } diff --git a/NzbDrone.Core.Test/ParserTest.cs.orig b/NzbDrone.Core.Test/ParserTest.cs.orig new file mode 100644 index 000000000..050d1b478 --- /dev/null +++ b/NzbDrone.Core.Test/ParserTest.cs.orig @@ -0,0 +1,91 @@ +using System; +using System.Collections.Generic; +using System.Text; +using Gallio.Framework; +using MbUnit.Framework; +using MbUnit.Framework.ContractVerifiers; +using NzbDrone.Core.Repository.Quality; + +namespace NzbDrone.Core.Test +{ + [TestFixture] + // ReSharper disable InconsistentNaming + public class ParserTest + { + [Test] +<<<<<<< HEAD +======= + [Row("Sonny.With.a.Chance.S02E15", 2,15)] + [Row("WEEDS.S03E01-06.DUAL.BDRip.XviD.AC3.-HELLYWOOD", 3, 1)] +>>>>>>> 2d9285eee29d96b6eedee98e358aa76c32c2998f + [Row("Two.and.a.Half.Me.103.720p.HDTV.X264-DIMENSION", 1, 3)] + [Row("Two.and.a.Half.Me.113.720p.HDTV.X264-DIMENSION", 1, 13)] + [Row("Two.and.a.Half.Me.1013.720p.HDTV.X264-DIMENSION", 10, 13)] + [Row("Chuck.4x05.HDTV.XviD-LOL", 4, 5)] + [Row("The.Girls.Next.Door.S03E06.DVDRip.XviD-WiDE", 3, 6)] + [Row("Degrassi.S10E27.WS.DSR.XviD-2HD", 10, 27)] + [Row(@"z:\tv shows\battlestar galactica (2003)\Season 3\S03E05 - Collaborators.mkv", 3, 5)] + [Row(@"z:\tv shows\modern marvels\Season 16\S16E03 - The Potato.mkv", 16, 3)] + [Row(@"z:\tv shows\robot chicken\Specials\S00E16 - Dear Consumer - SD TV.avi", 0, 16)] + [Row(@"Parenthood.2010.S02E14.HDTV.XviD-LOL", 2, 14)] + [Row(@"Hawaii Five 0 S01E19 720p WEB DL DD5 1 H 264 NT", 1, 19)] + [Row(@"The Event S01E14 A Message Back 720p WEB DL DD5 1 H264 SURFER", 1, 14)] + [Row(@"Adam Hills In Gordon St Tonight S01E07 WS PDTV XviD FUtV", 1, 7)] + public void episode_parse(string path, int season, int episode) + { + var result = Parser.ParseEpisodeInfo(path); + Assert.AreEqual(season, result.SeasonNumber); + Assert.AreEqual(episode, result.Episodes[0]); + } + + [Test] + [Row("The.Office.US.S03E01E02.DUAL.BDRip.XviD.AC3.-HELLYWOOD", 3, 1, 2)] + [Row("WEEDS.S03E01-06.DUAL.BDRip.XviD.AC3.-HELLYWOOD", 3, 1, 6)] + public void episode_parse_multi(string path, int season, int episodeOne, int episodeTwo) + { + var result = Parser.ParseEpisodeInfo(path); + Assert.Count(2, result); + Assert.AreEqual(season, result[0].SeasonNumber); + Assert.AreEqual(episodeOne, result[0].EpisodeNumber); + Assert.AreEqual(episodeTwo, result[1].EpisodeNumber); + } + + [Test] + [Row("WEEDS.S03E01-06.DUAL.BDRip.XviD.AC3.-HELLYWOOD", QualityTypes.BDRip)] + [Row("WEEDS.S03E01-06.DUAL.BDRip.AC3.-HELLYWOOD", QualityTypes.BDRip)] + [Row("Two.and.a.Half.Men.S08E05.720p.HDTV.X264-DIMENSION", QualityTypes.HDTV)] + [Row("Chuck.S04E05.HDTV.XviD-LOL", QualityTypes.TV)] + [Row("The.Girls.Next.Door.S03E06.DVDRip.XviD-WiDE", QualityTypes.DVD)] + [Row("Degrassi.S10E27.WS.DSR.XviD-2HD", QualityTypes.TV)] + [Row("Sonny.With.a.Chance.S02E15.720p.WEB-DL.DD5.1.H.264-SURFER", QualityTypes.WEBDL)] + [Row("Sonny.With.a.Chance.S02E15.720p", QualityTypes.HDTV)] + [Row("Sonny.With.a.Chance.S02E15.mkv", QualityTypes.HDTV)] + [Row("Sonny.With.a.Chance.S02E15.avi", QualityTypes.TV)] + [Row("Sonny.With.a.Chance.S02E15.xvid", QualityTypes.TV)] + [Row("Sonny.With.a.Chance.S02E15.divx", QualityTypes.TV)] + [Row("Sonny.With.a.Chance.S02E15", QualityTypes.Unknown)] + [Row("Chuck - S01E04 - So Old - Playdate - 720p TV.mkv", QualityTypes.HDTV)] + [Row("Chuck - S22E03 - MoneyBART - HD TV.mkv", QualityTypes.HDTV)] + [Row("Chuck - S01E03 - Come Fly With Me - 720p BluRay.mkv", QualityTypes.Bluray720)] + [Row("Chuck - S01E03 - Come Fly With Me - 1080p BluRay.mkv", QualityTypes.Bluray1080)] + [Row("Chuck - S11E06 - D-Yikes! - 720p WEB-DL.mkv", QualityTypes.WEBDL)] + [Row("WEEDS.S03E01-06.DUAL.BDRip.XviD.AC3.-HELLYWOOD.avi", QualityTypes.BDRip)] + public void quality_parse(string path, object quality) + { + var result = Parser.ParseEpisodeInfo(path).Quality; + Assert.AreEqual(quality, result); + } + + [Test] + [Row(@"c:\test\", @"c:\test")] + [Row(@"c:\\test\\", @"c:\test")] + [Row(@"C:\\Test\\", @"C:\Test")] + [Row(@"C:\\Test\\Test\", @"C:\Test\Test")] + [Row(@"\\Testserver\Test\", @"\\Testserver\Test")] + public void Normalize_Path(string dirty, string clean) + { + var result = Parser.NormalizePath(dirty); + Assert.AreEqual(clean, result); + } + } +} diff --git a/NzbDrone.Core.Test/RepoTest.cs b/NzbDrone.Core.Test/RepoTest.cs index 42f165b83..8d112ee18 100644 --- a/NzbDrone.Core.Test/RepoTest.cs +++ b/NzbDrone.Core.Test/RepoTest.cs @@ -65,7 +65,6 @@ namespace NzbDrone.Core.Test public void enteties_toString() { Console.WriteLine(new Episode().ToString()); - Console.WriteLine(new EpisodeModel().ToString()); } [Test] diff --git a/NzbDrone.Core.Test/RssProviderTest.cs b/NzbDrone.Core.Test/RssProviderTest.cs deleted file mode 100644 index bf95ed775..000000000 --- a/NzbDrone.Core.Test/RssProviderTest.cs +++ /dev/null @@ -1,34 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Security.Policy; -using System.Text; -using Gallio.Framework; -using MbUnit.Framework; -using MbUnit.Framework.ContractVerifiers; -using Moq; -using NzbDrone.Core.Model; -using NzbDrone.Core.Providers; -using Rss; - -namespace NzbDrone.Core.Test -{ - [TestFixture] - public class RssProviderTest - { - [Test] - public void GetFeed() - { - //Setup - var feedInfo = new FeedInfoModel("NzbMatrix", @"Files\Feed.nzbmatrix.com.xml"); - var target = new RssProvider(); - - //Act - var enumerable = target.GetFeed(feedInfo); - var result = new List(); - result.AddRange(enumerable); - - //Assert - Assert.GreaterThan(result.Count, 1); //Assert that the number of Items in the feed is greater than 1 - } - } -} diff --git a/NzbDrone.Core.Test/SabControllerTest.cs b/NzbDrone.Core.Test/SabControllerTest.cs index 36f347f2e..8bc5cc433 100644 --- a/NzbDrone.Core.Test/SabControllerTest.cs +++ b/NzbDrone.Core.Test/SabControllerTest.cs @@ -7,6 +7,7 @@ using MbUnit.Framework; using MbUnit.Framework.ContractVerifiers; using Moq; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using SubSonic.Repository; namespace NzbDrone.Core.Test diff --git a/NzbDrone.Core.Test/SeriesProviderTest.cs b/NzbDrone.Core.Test/SeriesProviderTest.cs index 12c7ae557..f0a338062 100644 --- a/NzbDrone.Core.Test/SeriesProviderTest.cs +++ b/NzbDrone.Core.Test/SeriesProviderTest.cs @@ -54,6 +54,36 @@ namespace NzbDrone.Core.Test Assert.AreEqual(fakeSeries, mappedSeries); } + [Test] + public void Add_new_series() + { + var repo = MockLib.GetEmptyRepository(); + + var kernel = new MockingKernel(); + kernel.Bind().To(); + kernel.Bind().ToConstant(repo); + + string path = "C:\\Test\\"; + int tvDbId = 1234; + int qualityProfileId = 2; + + //Act + var seriesProvider = kernel.Get(); + seriesProvider.AddSeries(path, tvDbId, qualityProfileId); + + + //Assert + var series = seriesProvider.GetAllSeries(); + Assert.IsNotEmpty(series); + Assert.Count(1, series); + Assert.AreEqual(path, series.First().Path); + Assert.AreEqual(tvDbId, series.First().SeriesId); + Assert.AreEqual(qualityProfileId, series.First().QualityProfileId); + + } + + + [Test] [Row(new object[] { "That's Life - 2x03 -The Devil and Miss DeLucca", "That's Life" })] [Row(new object[] { "Van.Duin.Op.Zn.Best.S02E05.DUTCH.WS.PDTV.XViD-DiFFERENT", "Van Duin Op Zn Best" })] diff --git a/NzbDrone.Core/CentralDispatch.cs b/NzbDrone.Core/CentralDispatch.cs index fb2a8e6b3..c52648ca9 100644 --- a/NzbDrone.Core/CentralDispatch.cs +++ b/NzbDrone.Core/CentralDispatch.cs @@ -8,6 +8,7 @@ using NLog.Config; using NLog.Targets; using NzbDrone.Core.Instrumentation; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Providers.Fakes; using NzbDrone.Core.Repository; using NzbDrone.Core.Repository.Quality; @@ -37,17 +38,16 @@ namespace NzbDrone.Core _startupPath = AppPath; //Sqlite - string connectionString = String.Format("Data Source={0};Version=3;", Path.Combine(AppPath, "nzbdrone.db")); + var AppDataPath = new DirectoryInfo(Path.Combine(AppPath, "App_Data", "nzbdrone.db")); + if (!AppDataPath.Exists) AppDataPath.Create(); + + string connectionString = String.Format("Data Source={0};Version=3;", Path.Combine(AppDataPath.FullName, "nzbdrone.db")); var dbProvider = ProviderFactory.GetProvider(connectionString, "System.Data.SQLite"); - //SQLExpress - //string connectionString = String.Format(@"server=.\SQLExpress; database=NzbDrone; Trusted_Connection=True;"); - //var dbProvider = ProviderFactory.GetProvider(connectionString, "System.Data.SqlClient"); - - //Sqlite - string logConnectionString = String.Format("Data Source={0};Version=3;", Path.Combine(AppPath, "log.db")); + string logConnectionString = String.Format("Data Source={0};Version=3;", Path.Combine(AppDataPath.FullName, "log.db")); var logDbProvider = ProviderFactory.GetProvider(logConnectionString, "System.Data.SQLite"); + //SQLExpress //string logConnectionString = String.Format(@"server=.\SQLExpress; database=NzbDroneLogs; Trusted_Connection=True;"); //var logDbProvider = ProviderFactory.GetProvider(logConnectionString, "System.Data.SqlClient"); @@ -55,8 +55,9 @@ namespace NzbDrone.Core //dbProvider.ExecuteQuery(new QueryCommand("VACUUM", dbProvider)); dbProvider.Log = new NlogWriter(); - + _kernel.Bind().To().InSingletonScope(); + _kernel.Bind().To().InSingletonScope(); _kernel.Bind().To(); _kernel.Bind().To(); _kernel.Bind().To(); @@ -67,14 +68,10 @@ namespace NzbDrone.Core _kernel.Bind().To(); _kernel.Bind().To(); _kernel.Bind().To(); - _kernel.Bind().To(); _kernel.Bind().To(); _kernel.Bind().To(); _kernel.Bind().To().InSingletonScope(); _kernel.Bind().To().InSingletonScope(); - _kernel.Bind().To().InSingletonScope(); - _kernel.Bind().To().InSingletonScope(); - _kernel.Bind().To().InSingletonScope(); _kernel.Bind().To().InSingletonScope(); _kernel.Bind().To().InSingletonScope(); _kernel.Bind().To().InSingletonScope(); diff --git a/NzbDrone.Core/Helpers/SceneNameHelper.cs b/NzbDrone.Core/Helpers/SceneNameHelper.cs index 60dcd98ff..91afad92f 100644 --- a/NzbDrone.Core/Helpers/SceneNameHelper.cs +++ b/NzbDrone.Core/Helpers/SceneNameHelper.cs @@ -8,7 +8,7 @@ namespace NzbDrone.Core.Helpers { public static class SceneNameHelper { - private static List _sceneNameMappings = new List + private static readonly List SceneNameMappings = new List { new SceneNameModel { SeriesId = 72546, Name = "CSI" }, new SceneNameModel { SeriesId = 73696, Name = "CSI New York" }, @@ -76,7 +76,7 @@ namespace NzbDrone.Core.Helpers public static int FindByName(string cleanSeriesName) { - var map = _sceneNameMappings.Find(s => Parser.NormalizeTitle(s.Name) == cleanSeriesName); + var map = SceneNameMappings.Find(s => Parser.NormalizeTitle(s.Name) == cleanSeriesName); if (map == null) return 0; @@ -88,7 +88,7 @@ namespace NzbDrone.Core.Helpers { List results = new List(); - var maps = _sceneNameMappings.Where(s => s.SeriesId == seriesId); + var maps = SceneNameMappings.Where(s => s.SeriesId == seriesId); foreach (var map in maps) results.Add(map.Name); diff --git a/NzbDrone.Core/Libraries/RSS.NET.XML b/NzbDrone.Core/Libraries/RSS.NET.XML deleted file mode 100644 index e60b7797a..000000000 --- a/NzbDrone.Core/Libraries/RSS.NET.XML +++ /dev/null @@ -1,1388 +0,0 @@ - - - - RSS.NET - - - - The contents of a RssFeed - - - Initialize a new instance of the RssFeed class. - - - Initialize a new instance of the RssFeed class with a specified encoding. - - - Returns a string representation of the current Object. - The Url of the feed - - - Reads the specified RSS feed - The url or filename of the RSS feed - The contents of the feed - - - Reads the specified RSS feed - The specified way to connect to the web server - The contents of the feed - - - Reads the specified RSS feed - The cached version of the feed - The current contents of the feed - Will not download the feed if it has not been modified - - - Reads the specified RSS feed - The specified way to connect to the web server - The cached version of the feed - The current contents of the feed - Will not download the feed if it has not been modified - - - Writes the RSS feed to the specified stream. - specified Stream - The Stream cannot be written to. - Feed must contain at least one channel. - Channel must contain at least one item. - - - Writes the RSS feed to the specified file. - The encoding is ISO-8859-1. - The filename is empty, contains only white space, or contains one or more invalid characters. - Access is denied. - The filename is a (null c#, Nothing vb) reference. - The directory to write to is not found. - The filename includes an incorrect or invalid syntax for file name, directory name, or volume label syntax. - The caller does not have the required permission. - specified file (including path) If the file exists, it will be truncated with the new content. - Feed must contain at least one channel. - Channel must contain at least one item. - - - The channels that are contained in the feed. - - - The modules that the feed adhears to. - - - A collection of all exceptions encountered during the reading of the feed. - - - The Version of the feed. - - - The server generated hash of the feed. - - - The server generated last modfified date and time of the feed. - - - Indicates this feed has not been changed on the server, and the local copy was returned. - - - Location of the feed - - - Encoding of the feed - - - Provide information regarding the location of the subject matter of the channel in a taxonomy - - - Base class for all RSS elements - - - Initialize a new instance of the RssElement class - - - Initialize a new instance of the RssCategory class - - - Actual categorization given for this item, within the chosen taxonomy - - - URL of external taxonomy - - - A strongly typed collection of objects - - - Adds a specified channel to this collection. - The channel to add. - The zero-based index of the added channel. - - - Determines whether the RssChannelCollection contains a specific element. - The RssChannel to locate in the RssChannelCollection. - true if the RssChannelCollection contains the specified value; otherwise, false. - - - Copies the entire RssChannelCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional RssChannel Array that is the destination of the elements copied from RssChannelCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source RssChannelCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified RssChannel and returns the zero-based index of the first occurrence within the entire RssChannelCollection. - The RssChannel to locate in the RssChannelCollection. - The zero-based index of the first occurrence of RssChannel within the entire RssChannelCollection, if found; otherwise, -1. - - - Inserts a channel into this collection at a specified index. - The zero-based index of the collection at which to insert the channel. - The channel to insert into this collection. - - - Removes a specified channel from this collection. - The channel to remove. - - - Gets or sets the channel at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - A channel at each valid index. - This method is an indexer that can be used to access the collection. - index is not a valid index. - - - A reference to an attachment to the item - - - Initialize a new instance of the RssEnclosure class. - - - Where the enclosure is located - - - The size of the enclosure, in bytes - -1 represents a null. - - - A standard Multipurpose Internet Mail Extensions (MIME) type - - - Grouping of related content items on a site - - - Initialize a new instance of the RssChannel class. - - - Returns a string representation of the current Object. - The channel's title, description, or "RssChannel" if the title and description are blank. - - - The name of the channel - Maximum length is 100 characters (For RSS 0.91) - - - URL of the website named in the title - Maximum length is 500 characters (For RSS 0.91) - - - Description of the channel - Maximum length is 500 characters (For RSS 0.91) - - - Language the channel is written in - - - A link and description for a graphic icon that represent a channel - - - Copyright notice for content in the channel - Maximum length is 100 (For RSS 0.91) - - - The email address of the managing editor of the channel, the person to contact for editorial inquiries - - Maximum length is 100 (For RSS 0.91) - The suggested format for email addresses in RSS elements is - bull@mancuso.com (Bull Mancuso) - - - - The email address of the webmaster for the channel - - Person to contact if there are technical problems - Maximum length is 100 (For RSS 0.91) - The suggested format for email addresses in RSS elements is - bull@mancuso.com (Bull Mancuso) - - - - The PICS rating for the channel - Maximum length is 500 (For RSS 0.91) - - - The publication date for the content in the channel, expressed as the coordinated universal time (UTC) - - - The date-time the last time the content of the channel changed, expressed as the coordinated universal time (UTC) - - - One or more categories the channel belongs to. - - - A string indicating the program used to generate the channel - - - A URL, points to the documentation for the format used in the RSS file - Maximum length is 500 (For RSS 0.91). - - - Provides information about an HTTP GET feature, typically for a search or subscription - - - Readers should not read the channel during days listed. (UTC) - Days are listed in the array in the following order: - Monday - Tuesday - Wednesday - Thursday - Friday - Saturday - Sunday - Monday - - - - Readers should not read the channel during hours listed (UTC) - Represents a time in UTC - 1. - - - Allow processes to register with a cloud to be notified of updates to the channel - - - The number of minutes that a channel can be cached. - - - All items within the channel - - - People in a photo - - - A strongly typed collection of objects - - - Adds a specified item to this collection. - The item to add. - The zero-based index of the added item. - - - Determines whether the RssModuleItemCollection contains a specific element. - The RssModuleItem to locate in the RssModuleItemCollection. - true if the RssModuleItemCollection contains the specified value; otherwise, false. - - - Copies the entire RssModuleItemCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional RssModuleItem Array that is the destination of the elements copied from RssModuleItemCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source RssModuleItemCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified RssModuleItem and returns the zero-based index of the first occurrence within the entire RssModuleItemCollection. - The RssModuleItem to locate in the RssModuleItemCollection. - The zero-based index of the first occurrence of RssModuleItem within the entire RssModuleItemCollection, if found; otherwise, -1. - - - Inserts an item into this collection at a specified index. - The zero-based index of the collection at which to insert the item. - The item to insert into this collection. - - - Removes a specified item from this collection. - The item to remove. - - - Bind a particular item to this module - Hash code of the item - - - Check if a particular item is bound to this module - Hash code of the item - true if this item is bound to this module, otherwise false - - - Gets or sets the item at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - An item at each valid index. - This method is an indexer that can be used to access the collection. - index is not a valid index. - - - Initialize a new instance of the RssPhotoAlbumItemPhotoPeople class - - - Initialize a new instance of the RssPhotoAlbumItemPhotoPeople class - Name of person - - - Add a person to the photo - Name of person - The zero-based index of the added item - - - A collection of photos in a category - - - A strongly typed collection of objects - - - Adds a specified item to this collection. - The item to add. - The zero-based index of the added item. - - - Determines whether the RssModuleItemCollectionCollection contains a specific element. - The RssModuleItemCollection to locate in the RssModuleItemCollectionCollection. - true if the RssModuleItemCollectionCollection contains the specified value; otherwise, false. - - - Copies the entire RssModuleItemCollectionCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional RssModuleItemCollection Array that is the destination of the elements copied from RssModuleItemCollectionCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source RssModuleItemCollectionCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified RssModuleItemCollection and returns the zero-based index of the first occurrence within the entire RssModuleItemCollectionCollection. - The RssModuleItemCollection to locate in the RssModuleItemCollectionCollection. - The zero-based index of the first occurrence of RssModuleItemCollection within the entire RssModuleItemCollectionCollection, if found; otherwise, -1. - - - Inserts an item into this collection at a specified index. - The zero-based index of the collection at which to insert the item. - The item to insert into this collection. - - - Removes a specified item from this collection. - The item to remove. - - - Gets or sets the item at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - An item at each valid index. - This method is an indexer that can be used to access the collection. - index is not a valid index. - - - Initialize a new instance of the RssPhotoAlbumItemPhoto class - - - Adds a sepecified photo to this collection. - The photo to add. - The zero-based index of the added item. - - - A photo in the category - - - Initialize a new instance of the RssPhotoAlbumItemPhoto class - Date of the Photo - Description of the photo. - Direct link of the photo. - - - Initialize a new instance of the RssPhotoAlbumItemPhoto class - Date of the Photo - Description of the photo. - People to add to the photo. - Direct link of the photo. - - - Adds a specified item to this collection. - Date of the Photo - Description of the photo. - People to add to the photo. - Direct link of the photo. - The zero-based index of the added item. - - - Adds a specified item to this collection. - Date of the Photo - Description of the photo. - Direct link of the photo. - The zero-based index of the added item. - - - Initialize a new instance of the RssPhotoAlbumItemPhoto class - Date of the Photo - Description of the photo. - Direct link of the photo. - - - Initialize a new instance of the RssPhotoAlbumItemPhoto class - Date of the Photo - Description of the photo. - People to add to the photo. - Direct link of the photo. - - - Adds a specified item to this collection. - Date of the Photo - Description of the photo. - People to add to the photo. - Direct link of the photo. - The zero-based index of the added item. - - - Adds a specified item to this collection. - Date of the Photo - Description of the photo. - Direct link of the photo. - The zero-based index of the added item. - - - A collection of categories in a photo album - - - Initialize a new instance of the RssPhotoAlbumItemPhoto class - - - Adds a sepecified category to this collection. - The category to add. - The zero-based index of the added item. - - - A Photo Album category - - - Initialize a new instance of the RssPhotoAlbumItem class - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - - - Adds a specified category to this collection. - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - The zero-based index of the added item. - - - Initialize a new instance of the RssPhotoAlbumItem class - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - - - Adds a specified category to this collection. - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - The zero-based index of the added item. - - - Initialize a new instance of the RssPhotoAlbumItem class - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - - - Adds a specified category to this collection. - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - The zero-based index of the added item. - - - Initialize a new instance of the RssPhotoAlbumItem class - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - - - Adds a specified category to this collection. - Name of the category. - Description of the category. - From date of the category. - To date of the category. - Photos of the category. - The zero-based index of the added item. - - - RSS syndication for Robert A. Wlodarczyk's Photo Album application (to be sold by Inno Thinx LLC) - - - Base class for all RSS modules - - - Initialize a new instance of the RssModule class - - - Bind a particular channel to this module - Hash code of the channel - - - Check if a particular channel is bound to this module - Hash code of the channel - true if this channel is bound to this module, otherwise false - - - Collection of RSSModuleItem that are to be placed in the channel - - - Collection of RSSModuleItemCollection that are to be placed in the channel item - - - Prefix for the given module namespace - - - URL for the given module namespace - - - Initialize a new instance of the RssPhotoAlbum class - Link to the Photo Album - The category of the Photo Album to add - - - Initialize a new instance of the RssPhotoAlbum class - Link to the Photo Album - A collection of categories in the Photo Album to add - - - Link element for channel - - - Contains default values and methods for maintaining data consistency - - - Default value for a string in all RSS classes - empty string - If an element in the RSS class library has the value of RssDefault.String, consider the element as "not entered", "null", or empty. - - - Default value for an int in all RSS classes - -1 - If an element in the RSS class library has the value of RssDefault.Int, consider the element as "not entered", "null", or empty. - - - Default value for a DateTime in all RSS classes - DateTime.MinValue - If an element in the RSS class library has the value of RssDefault.DateTime, consider the element as "not entered", "null", or empty. - - - Default value for a Uri in all RSS classes - gopher://rss-net.sf.net - If an element in the RSS class library has the value of RssDefault.Uri, consider the element as "not entered", "null", or empty. - - - Verifies the string passed is not null - string to verify - RssDefault.String if input is null, otherwise input - Method is used in properties to prevent a null value - - - Verifies the int passed is greater than or equal to -1 - int to verify - RssDefault.Int if int is less than -1, else input - Method is used in properties to prevent values less than -1 - - - Verifies the Uri passed is not null - Uri to verify - RssDefault.Uri if input is null, otherwise input - Method is used in all properties to prevent a null value - - - Represents Null, False, and True - Source: Microsoft c# example - - - A DBBool containing 'Null'. - One of three possible DBBool values. - - - A DBBool containing 'False'. - One of three possible DBBool values. - - - A DBBool containing 'True'. - One of three possible DBBool values. - - - Private field that stores –1, 0, 1 for False, Null, True. - - - Private instance constructor. The value parameter must be –1, 0, or 1. - - - Implicit conversion from bool to DBBool. Maps true to DBBool.True and false to DBBool.False. - a DBBool - - - Explicit conversion from DBBool to bool. - The given DBBool is Null - a DBBool - true or false - - - Equality operator. - a DBBool - a DBBool - Returns Null if either operand is Null, otherwise returns True or False. - - - Inequality operator. - a DBBool - a DBBool - Returns Null if either operand is Null, otherwise returns True or False. - - - Logical negation operator. - a DBBool - Returns True if the operand is False, Null if the operand is Null, or False if the operand is True. - - - Logical AND operator. - a DBBool - a DBBool - Returns False if either operand is False, otherwise Null if either operand is Null, otherwise True. - - - Logical OR operator. - a DBBool - a DBBool - Returns True if either operand is True, otherwise Null if either operand is Null, otherwise False. - - - Definitely true operator. - a DBBool - Returns true if the operand is True, false otherwise. - - - Definitely false operator. - a DBBool - Returns true if the operand is False, false otherwise. - - - Determines whether two DBBool instances are equal. - The object to check. - True if the two DBBools are equal. - - - Serves as a hash function for a particular type, suitable for use in hashing algorithms and data structures like a hash table. - A hash code for the current DBBool. - - - Returns a string representation of the current Object. - Object has not been initialized. - A string containing DBBool.False, DBBool.Null, or DBBool.True - - - Properties to examine the value of a DBBool. - Return true if this DBBool has the given value, false otherwise. - - - Properties to examine the value of a DBBool. - Return true if this DBBool has the given value, false otherwise. - - - Properties to examine the value of a DBBool. - Return true if this DBBool has the given value, false otherwise. - - - A strongly typed collection of objects - - - Adds a specified item to this collection. - The item to add. - The zero-based index of the added item. - - - Determines whether the RssModuleCollection contains a specific element. - The RssModule to locate in the RssModuleCollection. - true if the RssModuleCollection contains the specified value; otherwise, false. - - - Copies the entire RssModuleCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional RssModule Array that is the destination of the elements copied from RssModuleCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source RssModuleCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified RssModule and returns the zero-based index of the first occurrence within the entire RssModuleCollection. - The RssModule to locate in the RssModuleCollection. - The zero-based index of the first occurrence of RssModule within the entire RssModuleCollection, if found; otherwise, -1. - - - Inserts an item into this collection at a specified index. - The zero-based index of the collection at which to insert the item. - The item to insert into this collection. - - - Removes a specified item from this collection. - The item to remove. - - - Gets or sets the item at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - An item at each valid index. - This method is an indexer that can be used to access the collection. - index is not a valid index. - - - A strongly typed collection of objects - - - Adds a specified item to this collection. - The item to add. - The zero-based index of the added item. - - - Determines whether the RssItemCollection contains a specific element. - The RssItem to locate in the RssItemCollection. - true if the RssItemCollection contains the specified value; otherwise, false. - - - Copies the entire RssItemCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional RssItem Array that is the destination of the elements copied from RssItemCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source RssItemCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified RssItem and returns the zero-based index of the first occurrence within the entire RssItemCollection. - The RssItem to locate in the RssItemCollection. - The zero-based index of the first occurrence of RssItem within the entire RssItemCollection, if found; otherwise, -1. - - - Inserts an item into this collection at a specified index. - The zero-based index of the collection at which to insert the item. - The item to insert into this collection. - - - Removes a specified item from this collection. - The item to remove. - - - The latest pubDate in the items collection - The latest pubDate -or- RssDefault.DateTime if all item pubDates are not defined - - - The oldest pubDate in the items collection - The oldest pubDate -or- RssDefault.DateTime if all item pubDates are not defined - - - Calculates the oldest and latest pubdates - - - Gets or sets the item at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - An item at each valid index. - This method is an indexer that can be used to access the collection. - index is not a valid index. - - - Allow processes to register with a cloud to be notified of updates to the channel. - - - Initialize a new instance of the RssCloud class. - - - Domain name or IP address of the cloud - - - TCP port that the cloud is running on - - - Location of its responder - - - Name of the procedure to call to request notification - - - Protocol used - - - A strongly typed collection of objects - - - Adds a specified feed to this collection. - The feed to add. - The zero-based index of the added feed. - - - Determines whether the RssFeedCollection contains a specific element. - The RssFeed to locate in the RssFeedCollection. - true if the RssFeedCollection contains the specified value; otherwise, false. - - - Copies the entire RssFeedCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional RssFeed Array that is the destination of the elements copied from RssFeedCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source RssFeedCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified RssFeed and returns the zero-based index of the first occurrence within the entire RssFeedCollection. - The RssFeed to locate in the RssFeedCollection. - The zero-based index of the first occurrence of RssFeed within the entire RssFeedCollection, if found; otherwise, -1. - - - Inserts a feed into this collection at a specified index. - The zero-based index of the collection at which to insert the feed. - The feed to insert into this collection. - - - Removes a specified category from this collection. - The category to remove. - - - Gets or sets the feed at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - A feed at each valid index. - This method is an indexer that can be used to access the collection. - index is not a valid index. - - - Gets or sets the feed with the given name.In C#, this property is the indexer for the class. - The url of the feed to access. - A feed at each valid url. If the feed does not exist, null. - This method is an indexer that can be used to access the collection. - - - A RSS module that adds elements at the channel level that are common to weblogs. - - - Initialize a new instance of the - The URL of an OPML file containing the blogroll for the site. - The URL of an OPML file containing the author's RSS subscriptions. - - The URL of a weblog that the author of the weblog is promoting per Mark Pilgrim's description. - "http://diveintomark.org/archives/2002/09/17.html#blink_and_youll_miss_it" - - - The URL of a changes.xml file. When the feed that contains this element updates, it pings a server that updates this file. The presence of this element says to aggregators that they only have to read the changes file to see if this feed has updated. If several feeds point to the same changes file, the aggregator has to do less polling, resulting in better use of server bandwidth, and the Internet as a whole; and resulting in faster scans. Everyone wins. For more technical information, see the howto on the XML-RPC site. - "http://www.xmlrpc.com/weblogsComForRss" - - - - All valid Rss Cloud protocols, including Null - - - Not defined - - - Protocol is not supported - - - xml-rpc - - - soap - - - http-post - - - All RSS versions - - - Not defined - - - Version is not directly supported - - - RDF Site Summary (RSS) 0.9 - - - Rich Site Summary (RSS) 0.91 - - - Rich Site Summary (RSS) 0.92 - - - RDF Site Summary (RSS) 1.0 - - - Really Simple Syndication (RSS) 2.0 - - - Writes an RSS XML file. - Represents a writer that provides a fast, non-cached, forward-only way of generating streams or files containing RSS XML data that conforms to the W3C Extensible Markup Language (XML) 1.0 and the Namespaces in XML recommendations. - - - Creates an instance of the RssWriter class using the specified TextWriter. - specified TextWriter - - - Creates an instance of the RssWriter class using the specified Stream and Encoding. - The encoding is not supported or the stream cannot be written to. - Stream to output to - The encoding to use. If encoding is (null c#, Nothing vb) it writes out the stream as UTF-8. - - - Creates an instance of the RssWriter class using the specified Stream. - The encoding is ISO-8859-1. - The Stream cannot be written to. - specified Stream - - - Creates an instance of the RssWriter class using the specified file and Encoding. - The encoding is not supported; the filename is empty, contains only white space, or contains one or more invalid characters. - Access is denied. - The filename is a (null c#, Nothing vb) reference. - The directory to write to is not found. - The filename includes an incorrect or invalid syntax for file name, directory name, or volume label syntax. - The caller does not have the required permission. - specified file (including path) If the file exists, it will be truncated with the new content. - specified Encoding - - - Creates an instance of the RssWriter class using the specified file. - The encoding is ISO-8859-1. - The filename is empty, contains only white space, or contains one or more invalid characters. - Access is denied. - The filename is a (null c#, Nothing vb) reference. - The directory to write to is not found. - The filename includes an incorrect or invalid syntax for file name, directory name, or volume label syntax. - The caller does not have the required permission. - specified file (including path) If the file exists, it will be truncated with the new content. - - - Writes the begining data to the RSS file - This routine is called from the WriteChannel and WriteItem subs - RDF Site Summary (RSS) 1.0 is not currently supported. - - - Closes instance of RssWriter. - Writes end elements, and releases connections - Occurs if the RssWriter is already closed or the caller is attempting to close before writing a channel. - - - Writes an RSS channel - RssWriter has been closed, and can not be written to. - Channel must be instanciated with data, before calling Write. - RSS channel to write - - - Writes an RSS item - Either the RssWriter has already been closed, or the caller is attempting to write an RSS item before an RSS channel. - Item must be instanciated with data, before calling Write. - RSS item to write - - - Writes an element with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an element with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an element with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an element with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an element with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an attribute with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an attribute with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an attribute with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an attribute with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Writes an attribute with the specified local name and value - the localname of the element - the value of the element - boolean that determines if input cannot be null - - - Gets or sets the RSS version to write. - Can't change version number after data has been written. - - - Gets or sets the of the XML output. - Can't change XML formatting after data has been written. - - - Gets or sets how indentation to write for each level in the hierarchy when XmlFormat is set to - Can't change XML formatting after data has been written. - Setting this property to a negative value. - - - RSS modules - - - Reads an RSS file. - Provides fast, non-cached, forward-only access to RSS data. - - - Initializes a new instance of the RssReader class with the specified URL or filename. - The URL or filename for the file containing the RSS data. - Occures when unable to retrieve file containing the RSS data. - - - Creates an instance of the RssReader class using the specified TextReader. - specified TextReader - Occures when unable to retrieve file containing the RSS data. - - - Creates an instance of the RssReader class using the specified Stream. - Occures when unable to retrieve file containing the RSS data. - Stream to read from - - - Reads the next RssElement from the stream. - An RSS Element - RssReader has been closed, and can not be read. - RSS file not found. - Invalid XML syntax in RSS file. - Unable to read an RssElement. Reached the end of the stream. - - - Closes connection to file. - This method also releases any resources held while reading. - - - A collection of all exceptions the RssReader class has encountered. - - - Gets the RSS version of the stream. - One of the values. - - - Globally unique identifier - - - Initialize a new instance of the RssGuid class. - - - If true, a url that can be opened in a web browser that points to the item - - - Globally unique identifier value - - - A link and description for a graphic that represent a channel - - - Initialize a new instance of the RssImage class. - - - The URL of a GIF, JPEG or PNG image that represents the channel. - Maximum length is 500 (For RSS 0.91). - - - Describes the image, it's used in the ALT attribute of the HTML img tag when the channel is rendered in HTML. - Maximum length is 100 (For RSS 0.91). - - - The URL of the site, when the channel is rendered, the image is a link to the site. - Maximum length is 500 (For RSS 0.91). - - - Contains text that is included in the TITLE attribute of the link formed around the image in the HTML rendering. - - - Width of image in pixels - Maximum value for height is 400 (For RSS 0.91) - - - Height of image in pixels - Maximum value for width is 144 (For RSS 0.91) - - - A module may contain any number of items (either channel-based or item-based). - - - Initialize a new instance of the RssModuleItem class - - - Initialize a new instance of the RssModuleItem class - The name of this RssModuleItem. - - - Initialize a new instance of the RssModuleItem class - The name of this RssModuleItem. - Is text required for this RssModuleItem? - - - Initialize a new instance of the RssModuleItem class - The name of this RssModuleItem. - The text contained within this RssModuleItem. - - - Initialize a new instance of the RssModuleItem class - The name of this RssModuleItem. - Is text required for this RssModuleItem? - The text contained within this RssModuleItem. - - - Initialize a new instance of the RssModuleItem class - The name of this RssModuleItem. - The text contained within this RssModuleItem. - The sub-elements of this RssModuleItem (if any exist). - - - Initialize a new instance of the RssModuleItem class - The name of this RssModuleItem. - Is text required for this RssModuleItem? - The text contained within this RssModuleItem. - The sub-elements of this RssModuleItem (if any exist). - - - Returns a string representation of the current Object. - The item's title, description, or "RssModuleItem" if the title and description are blank. - - - - The name of this RssModuleItem. - - - - - The text contained within this RssModuleItem. - - - - - The sub-elements of this RssModuleItem (if any exist). - - - - - Is text for this element required? - - - - Describes an items source - - - Initialize a new instance of the RssSource class - - - Name of the RSS channel that the item came from - - - URL of the original RSS feed from which the item was republished - - - A strongly typed collection of objects - - - Adds a specified exception to this collection. - The exception to add. - The zero-based index of the added exception -or- -1 if the exception already exists. - - - Determines whether the ExceptionCollection contains a specific element. - The Exception to locate in the ExceptionCollection. - true if the ExceptionCollection contains the specified value; otherwise, false. - - - Copies the entire ExceptionCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional Exception Array that is the destination of the elements copied from ExceptionCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source ExceptionCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified Exception and returns the zero-based index of the first occurrence within the entire ExceptionCollection. - The Exception to locate in the ExceptionCollection. - The zero-based index of the first occurrence of RssChannel within the entire ExceptionCollection, if found; otherwise, -1. - - - Inserts an Exception into this collection at a specified index. - The zero-based index of the collection at which to insert the Exception. - The Exception to insert into this collection. - - - Removes a specified Exception from this collection. - The Exception to remove. - - - Gets or sets the exception at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - A exception at each valid index. - This method is an indexer that can be used to access the collection. - - - Returns the last exception added through the Add method. - The last exception -or- null if no exceptions exist - - - A strongly typed collection of objects - - - Adds a specified category to this collection. - The category to add. - The zero-based index of the added category. - - - Determines whether the RssCategoryCollection contains a specific element. - The RssCategory to locate in the RssCategoryCollection. - true if the RssCategoryCollection contains the specified value; otherwise, false. - - - Copies the entire RssCategoryCollection to a compatible one-dimensional , starting at the specified index of the target array. - The one-dimensional RssCategory Array that is the destination of the elements copied from RssCategoryCollection. The Array must have zero-based indexing. - The zero-based index in array at which copying begins. - array is a null reference (Nothing in Visual Basic). - index is less than zero. - array is multidimensional. -or- index is equal to or greater than the length of array.-or-The number of elements in the source RssCategoryCollection is greater than the available space from index to the end of the destination array. - - - Searches for the specified RssCategory and returns the zero-based index of the first occurrence within the entire RssCategoryCollection. - The RssCategory to locate in the RssCategoryCollection. - The zero-based index of the first occurrence of RssCategory within the entire RssCategoryCollection, if found; otherwise, -1. - - - Inserts an category into this collection at a specified index. - The zero-based index of the collection at which to insert the category. - The category to insert into this collection. - - - Removes a specified category from this collection. - The category to remove. - - - Gets or sets the category at a specified index.In C#, this property is the indexer for the class. - The index of the collection to access. - A category at each valid index. - This method is an indexer that can be used to access the collection. - index is not a valid index. - - - A RSS module that adds elements at the channel or item level that specifies which Creative Commons license applies. - - - Initialize a new instance of the - - If present as a sub-element of channel, indicates that the content of the RSS file is available under a license, indicated by a URL, which is the value of the license element. A list of some licenses that may be used in this context is on the Creative Commons website on this page, however the license element may point to licenses not authored by Creative Commons. - You may also use the license element as a sub-element of item. When used this way it applies only to the content of that item. If an item has a license, and the channel does too, the license on the item applies, i.e. the inner license overrides the outer one. - Multiple license elements are allowed, in either context, indicating that the content is available under multiple licenses. - "http://www.creativecommons.org/licenses/" - - If present as a sub-element of channel then true, otherwise false - - - A channel may contain any number of items, each of which links to more information about the item, with an optional description - - - Initialize a new instance of the RssItem class - - - Returns a string representation of the current Object. - The item's title, description, or "RssItem" if the title and description are blank. - - - Title of the item - Maximum length is 100 (For RSS 0.91) - - - URL of the item - Maximum length is 500 (For RSS 0.91) - - - Item synopsis - Maximum length is 500 (For RSS 0.91) - - - Email address of the author of the item - - - Provide information regarding the location of the subject matter of the channel in a taxonomy - - - URL of a page for comments relating to the item - - - Describes an items source - - - A reference to an attachment to the item - - - A string that uniquely identifies the item - - - Indicates when the item was published - - - Multi-purpose channel element for the purpose of allowing users to submit queries back to the publisher's site - Typically for a search or subscription - - - Initialize a new instance of the RssTextInput class - - - The label of the submit button in the text input area - Maximum length is 100 (For RSS 0.91) - - - Explains the text input area - Maximum length is 500 (For RSS 0.91) - - - The name of the text object in the text input area - Maximum length is 20 (For RSS 0.91). - - - The URL of the script that processes text input requests - Maximum length is 500 (For RSS 0.91) - - - diff --git a/NzbDrone.Core/Libraries/RSS.NET.dll b/NzbDrone.Core/Libraries/RSS.NET.dll deleted file mode 100644 index 10dd1f774..000000000 Binary files a/NzbDrone.Core/Libraries/RSS.NET.dll and /dev/null differ diff --git a/NzbDrone.Core/Model/EpisodeModel.cs b/NzbDrone.Core/Model/EpisodeModel.cs deleted file mode 100644 index 2d0d16826..000000000 --- a/NzbDrone.Core/Model/EpisodeModel.cs +++ /dev/null @@ -1,19 +0,0 @@ -using NzbDrone.Core.Repository.Quality; -using SubSonic.SqlGeneration.Schema; - -namespace NzbDrone.Core.Model -{ - public class EpisodeModel - { - public string SeriesTitle { get; set; } - public int SeriesId { get; set; } - public string EpisodeTitle { get; set; } - public int EpisodeId { get; set; } - public int SeasonNumber { get; set; } - public int EpisodeNumber { get; set; } - public QualityTypes Quality { get; set; } - public string Path { get; set; } - public long Size { get; set; } - public bool Proper { get; set; } - } -} \ No newline at end of file diff --git a/NzbDrone.Core/Model/EpisodeParseResult.cs b/NzbDrone.Core/Model/EpisodeParseResult.cs index cafde35f4..f52ef7ad5 100644 --- a/NzbDrone.Core/Model/EpisodeParseResult.cs +++ b/NzbDrone.Core/Model/EpisodeParseResult.cs @@ -1,18 +1,25 @@ -using NzbDrone.Core.Repository.Quality; -using SubSonic.SqlGeneration.Schema; +using System; +using System.Collections.Generic; +using NzbDrone.Core.Repository.Quality; namespace NzbDrone.Core.Model { public class EpisodeParseResult { internal string SeriesTitle { get; set; } + public int SeriesId { get; set; } + internal int SeasonNumber { get; set; } - internal int EpisodeNumber { get; set; } + internal List Episodes { get; set; } internal int Year { get; set; } + public bool Proper { get; set; } + + public QualityTypes Quality { get; set; } + public override string ToString() { - return string.Format("Series:{0} Season:{1} Episode:{2}", SeriesTitle, SeasonNumber, EpisodeNumber); + return string.Format("Series:{0} Season:{1} Episode:{2}", SeriesTitle, SeasonNumber, String.Join(",", Episodes)); } } diff --git a/NzbDrone.Core/Model/FeedInfoModel.cs b/NzbDrone.Core/Model/FeedInfoModel.cs deleted file mode 100644 index 98c979b6d..000000000 --- a/NzbDrone.Core/Model/FeedInfoModel.cs +++ /dev/null @@ -1,53 +0,0 @@ -using System; -using System.Collections.Generic; -using System.IO; -using System.Linq; -using System.Text; - -namespace NzbDrone.Core.Model -{ - public class FeedInfoModel - { - public FeedInfoModel(string name, string url) - { - Name = name ?? "UN-NAMED"; - Url = ParseUrl(url); - } - - public string Name { get; private set; } - public string Url { get; private set; } - - private static string ParseUrl(string url) - { - Uri uri; - if (!Uri.TryCreate(url, UriKind.Absolute, out uri)) - { - uri = new Uri(new Uri(CentralDispatch.ExecutablePath + Path.DirectorySeparatorChar), url); - } - return uri.IsFile ? uri.AbsolutePath.Replace("%20", " ") : uri.AbsoluteUri; - } - - public override bool Equals(object obj) - { - if (ReferenceEquals(null, obj)) return false; - if (ReferenceEquals(this, obj)) return true; - if (obj.GetType() != typeof(FeedInfoModel)) return false; - return Equals((FeedInfoModel) obj); - } - - public bool Equals(FeedInfoModel other) - { - if (ReferenceEquals(null, other)) return false; - if (ReferenceEquals(this, other)) return true; - return Equals(other.Name, Name) && Equals(other.Url, Url); - } - - public override int GetHashCode() - { - unchecked - { - return ((Name != null ? Name.GetHashCode() : 0)*397) ^ (Url != null ? Url.GetHashCode() : 0); - } - } - } -} diff --git a/NzbDrone.Core/Model/NzbInfoModel.cs b/NzbDrone.Core/Model/NzbInfoModel.cs index 8c92611e3..7722d3f3b 100644 --- a/NzbDrone.Core/Model/NzbInfoModel.cs +++ b/NzbDrone.Core/Model/NzbInfoModel.cs @@ -9,14 +9,8 @@ namespace NzbDrone.Core.Model { public class NzbInfoModel { - public string Id { get; set; } public string Title { get; set; } - public string TitleFix { get; set; } - public NzbSiteModel Site { get; set; } public Uri Link { get; set; } - public string Description { get; set; } - public bool Proper { get; set; } - public QualityTypes Quality { get; set; } public bool IsPassworded() { diff --git a/NzbDrone.Core/Model/NzbSiteModel.cs b/NzbDrone.Core/Model/NzbSiteModel.cs deleted file mode 100644 index f7be4741b..000000000 --- a/NzbDrone.Core/Model/NzbSiteModel.cs +++ /dev/null @@ -1,37 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Linq; -using System.Text; -using System.Text.RegularExpressions; - -namespace NzbDrone.Core.Model -{ - public class NzbSiteModel - { - private static readonly IList Sites = new List - { - new NzbSiteModel {Name = "newzbin", Url = "newzbin.com", Pattern = @"\d{7,10}"}, - new NzbSiteModel {Name = "nzbmatrix", Url = "nzbmatrix.com", Pattern = @"\d{6,10}"}, - new NzbSiteModel {Name = "nzbsDotOrg", Url = "nzbs.org", Pattern = @"\d{5,10}"}, - new NzbSiteModel {Name = "nzbsrus", Url = "nzbsrus.com", Pattern = @"\d{6,10}"}, - new NzbSiteModel {Name = "lilx", Url = "lilx.net", Pattern = @"\d{6,10}"}, - }; - - public string Name { get; set; } - public string Pattern { get; set; } - public string Url { get; set; } - - // TODO: use HttpUtility.ParseQueryString(); - // https://nzbmatrix.com/api-nzb-download.php?id=626526 - public string ParseId(string url) - { - return Regex.Match(url, Pattern).Value; - } - - public static NzbSiteModel Parse(string url) - { - return Sites.Where(site => url.Contains(site.Url)).SingleOrDefault() ?? - new NzbSiteModel { Name = "unknown", Pattern = @"\d{6,10}" }; - } - } -} diff --git a/NzbDrone.Core/Model/Season.cs b/NzbDrone.Core/Model/Season.cs deleted file mode 100644 index 42e5ad1fd..000000000 --- a/NzbDrone.Core/Model/Season.cs +++ /dev/null @@ -1,21 +0,0 @@ -using System.Collections.Generic; -using SubSonic.SqlGeneration.Schema; - -namespace NzbDrone.Core.Repository -{ - public class Season - { - [SubSonicPrimaryKey(false)] - public virtual long SeasonId { get; set; } - public long SeriesId { get; set; } - public int SeasonNumber { get; set; } - public bool Monitored { get; set; } - public string Folder { get; set; } - - [SubSonicToManyRelation] - public virtual List Episodes { get; private set; } - - [SubSonicToOneRelation(ThisClassContainsJoinKey = true)] - public virtual Series Series { get; private set; } - } -} \ No newline at end of file diff --git a/NzbDrone.Core/Model/SeasonModel.cs b/NzbDrone.Core/Model/SeasonModel.cs deleted file mode 100644 index c23be62cf..000000000 --- a/NzbDrone.Core/Model/SeasonModel.cs +++ /dev/null @@ -1,15 +0,0 @@ -using NzbDrone.Core.Repository.Quality; -using SubSonic.SqlGeneration.Schema; - -namespace NzbDrone.Core.Model -{ - public class SeasonModel - { - public string SeriesTitle { get; set; } - public int SeriesId { get; set; } - public int SeasonNumber { get; set; } - public QualityTypes Quality { get; set; } - public long Size { get; set; } - public bool Proper { get; set; } - } -} \ No newline at end of file diff --git a/NzbDrone.Core/Model/SeasonParseResult.cs b/NzbDrone.Core/Model/SeasonParseResult.cs index 4f45ce305..1a246173a 100644 --- a/NzbDrone.Core/Model/SeasonParseResult.cs +++ b/NzbDrone.Core/Model/SeasonParseResult.cs @@ -9,6 +9,8 @@ namespace NzbDrone.Core.Model internal int SeasonNumber { get; set; } internal int Year { get; set; } + public QualityTypes Quality { get; set; } + public override string ToString() { return string.Format("Series:{0} Season:{1}", SeriesTitle, SeasonNumber); diff --git a/NzbDrone.Core/Model/SeriesMappingModel.cs b/NzbDrone.Core/Model/SeriesMappingModel.cs deleted file mode 100644 index 91522c3f6..000000000 --- a/NzbDrone.Core/Model/SeriesMappingModel.cs +++ /dev/null @@ -1,14 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Linq; -using System.Text; - -namespace NzbDrone.Core.Model -{ - public class SeriesMappingModel - { - public string Path { get; set; } - public int TvDbId { get; set; } - public int QualityProfileId { get; set; } - } -} diff --git a/NzbDrone.Core/NzbDrone.Core.csproj b/NzbDrone.Core/NzbDrone.Core.csproj index ae6c4afd0..1ef76a287 100644 --- a/NzbDrone.Core/NzbDrone.Core.csproj +++ b/NzbDrone.Core/NzbDrone.Core.csproj @@ -31,7 +31,7 @@ true - AnyCPU + x86 true full false @@ -137,10 +137,6 @@ False Libraries\NLog.Extended.dll - - False - Libraries\RSS.NET.dll - D:\OpenSource\sabscripts\SABSync\References\SubSonic.Core.dll @@ -168,22 +164,18 @@ - - - - - - + - + + @@ -194,9 +186,7 @@ - - @@ -204,9 +194,6 @@ - - - @@ -224,12 +211,12 @@ - + - + - + @@ -247,9 +234,9 @@ - - - + + + @@ -283,15 +270,12 @@ - - - diff --git a/NzbDrone.Core/Parser.cs b/NzbDrone.Core/Parser.cs index 5f348c232..9ba9a1f01 100644 --- a/NzbDrone.Core/Parser.cs +++ b/NzbDrone.Core/Parser.cs @@ -8,7 +8,6 @@ using NLog; using NzbDrone.Core.Model; using NzbDrone.Core.Providers; using NzbDrone.Core.Repository.Quality; -using Rss; namespace NzbDrone.Core { @@ -34,12 +33,10 @@ namespace NzbDrone.Core /// /// Title of the report /// List of episodes contained to the post - internal static List ParseEpisodeInfo(string title) + internal static EpisodeParseResult ParseEpisodeInfo(string title) { Logger.Trace("Parsing string '{0}'", title); - var result = new List(); - foreach (var regex in ReportTitleRegex) { var match = regex.Matches(title); @@ -55,31 +52,88 @@ namespace NzbDrone.Core year = 0; } - foreach (Match matchGroup in match) - { - var seasonNumber = Convert.ToInt32(matchGroup.Groups["season"].Value); foreach (Capture episode in matchGroup.Groups["episode"].Captures) { - var parsedEpisode = new EpisodeParseResult - { - SeriesTitle = seriesName, - SeasonNumber = seasonNumber, - EpisodeNumber = Convert.ToInt32(episode.Value), - Year = year - }; +using System; +using System.Collections.Generic; +using System.IO; +using System.Linq; +using System.Text; +using System.Text.RegularExpressions; +using NLog; +using NzbDrone.Core.Model; +using NzbDrone.Core.Providers; +using NzbDrone.Core.Repository.Quality; +namespace NzbDrone.Core +{ + internal static class Parser + { + private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); - result.Add(parsedEpisode); - Logger.Trace("Episode Parsed. {0}", parsedEpisode); - } + private static readonly Regex[] ReportTitleRegex = new[] + { + new Regex(@"(?.+?)?\W?(?<year>\d+?)?\WS?(?<season>\d+)(?:\-|\.|[a-z])(?<episode>\d+)\W(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled), + new Regex(@"(?<title>.+?)?\W?(?<year>\d+?)?\WS?(?<season>\d+)(?<episode>\d{2})\W(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled) //Supports 103/113 naming + }; + + private static readonly Regex[] SeasonReportTitleRegex = new[] + { + new Regex(@"(?<title>.+?)?\W?(?<year>\d{4}?)?\W(?:S|Season)?\W?(?<season>\d+)(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled), + }; + + private static readonly Regex NormalizeRegex = new Regex(@"((\s|^)the(\s|$))|((\s|^)and(\s|$))|[^a-z]", RegexOptions.IgnoreCase | RegexOptions.Compiled); + + /// <summary> + /// Parses a post title into list of episodes it contains + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>List of episodes contained to the post</returns> + internal static EpisodeParseResult ParseEpisodeInfo(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; } - break; //Break out of the for loop, we don't want to process every REGEX for each item otherwise we'll get duplicates + + var parsedEpisode = new EpisodeParseResult + { + Proper = title.ToLower().Contains("proper"), + SeriesTitle = seriesName, + SeasonNumber = Convert.ToInt32(match[0].Groups["season"].Value), + Year = year, + Episodes = new List<int>() + }; + + foreach (Match matchGroup in match) + { + parsedEpisode.Episodes.Add(Convert.ToInt32(matchGroup.Groups["episode"].Value)); + + } + + parsedEpisode.Quality = ParseQuality(title); + + Logger.Trace("Episode Parsed. {0}", parsedEpisode); + + return parsedEpisode; } } - return result; + return null; } /// <summary> @@ -115,7 +169,8 @@ namespace NzbDrone.Core Year = year }; - + + result.Quality = ParseQuality(title); Logger.Trace("Season Parsed. {0}", result); return result; @@ -167,7 +222,7 @@ namespace NzbDrone.Core return title.ToLower().Contains("proper"); } - internal static QualityTypes ParseQuality(string name) + private static QualityTypes ParseQuality(string name) { Logger.Trace("Trying to parse quality for {0}", name); @@ -259,17 +314,472 @@ namespace NzbDrone.Core return info.FullName.Trim('/', '\\', ' '); } - public static NzbInfoModel ParseNzbInfo(FeedInfoModel feed, RssItem item) - { - NzbSiteModel site = NzbSiteModel.Parse(feed.Url.ToLower()); - return new NzbInfoModel - { - Id = site.ParseId(item.Link.ToString()), - Title = item.Title, - Site = site, - Link = item.Link, - Description = item.Description - }; - } + + } +} +using System; +using System.Collections.Generic; +using System.IO; +using System.Linq; +using System.Text; +using System.Text.RegularExpressions; +using NLog; +using NzbDrone.Core.Model; +using NzbDrone.Core.Providers; +using NzbDrone.Core.Repository.Quality; + +namespace NzbDrone.Core +{ + internal static class Parser + { + private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); + + private static readonly Regex[] ReportTitleRegex = new[] + { + new Regex(@"(?<title>.+?)?\W?(?<year>\d+?)?\WS?(?<season>\d+)(?:\-|\.|[a-z])(?<episode>\d+)\W(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled), + new Regex(@"(?<title>.+?)?\W?(?<year>\d+?)?\WS?(?<season>\d+)(?<episode>\d{2})\W(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled) //Supports 103/113 naming + }; + + private static readonly Regex[] SeasonReportTitleRegex = new[] + { + new Regex(@"(?<title>.+?)?\W?(?<year>\d{4}?)?\W(?:S|Season)?\W?(?<season>\d+)(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled), + }; + + private static readonly Regex NormalizeRegex = new Regex(@"((\s|^)the(\s|$))|((\s|^)and(\s|$))|[^a-z]", RegexOptions.IgnoreCase | RegexOptions.Compiled); + + /// <summary> + /// Parses a post title into list of episodes it contains + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>List of episodes contained to the post</returns> + internal static EpisodeParseResult ParseEpisodeInfo(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + var parsedEpisode = new EpisodeParseResult + { + Proper = title.ToLower().Contains("proper"), + SeriesTitle = seriesName, + SeasonNumber = Convert.ToInt32(match[0].Groups["season"].Value), + Year = year, + Episodes = new List<int>() + }; + + foreach (Match matchGroup in match) + { + parsedEpisode.Episodes.Add(Convert.ToInt32(matchGroup.Groups["episode"].Value)); + + } + + parsedEpisode.Quality = ParseQuality(title); + + Logger.Trace("Episode Parsed. {0}", parsedEpisode); + + return parsedEpisode; + } + } + + return null; + } + + /// <summary> + /// Parses a post title into season it contains + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>Season information contained in the post</returns> + internal static SeasonParseResult ParseSeasonInfo(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + var seasonNumber = Convert.ToInt32(match[0].Groups["season"].Value); + + var result = new SeasonParseResult + { + SeriesTitle = seriesName, + SeasonNumber = seasonNumber, + Year = year + }; + + + result.Quality = ParseQuality(title); + + Logger.Trace("Season Parsed. {0}", result); + return result; + } + } + + return null; //Return null + } + + /// <summary> + /// Parses a post title to find the series that relates to it + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>Normalized Series Name</returns> + internal static string ParseSeriesName(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + Logger.Trace("Series Parsed. {0}", seriesName); + return seriesName; + } + } + + return String.Empty; + } + + /// <summary> + /// Parses proper status out of a report title + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns></returns> + internal static bool ParseProper(string title) + { + return title.ToLower().Contains("proper"); + } + + private static QualityTypes ParseQuality(string name) + { + Logger.Trace("Trying to parse quality for {0}", name); + + var result = QualityTypes.Unknown; + name = name.ToLowerInvariant(); + + if (name.Contains("dvd")) + return QualityTypes.DVD; + + if (name.Contains("bdrip") || name.Contains("brrip")) + { + return QualityTypes.BDRip; + } + + if (name.Contains("xvid") || name.Contains("divx")) + { + if (name.Contains("bluray")) + { + return QualityTypes.BDRip; + } + + return QualityTypes.TV; + } + + if (name.Contains("bluray")) + { + if (name.Contains("720p")) + return QualityTypes.Bluray720; + + if (name.Contains("1080p")) + return QualityTypes.Bluray1080; + + return QualityTypes.Bluray720; + } + if (name.Contains("web-dl")) + return QualityTypes.WEBDL; + if (name.Contains("x264") || name.Contains("h264") || name.Contains("720p")) + return QualityTypes.HDTV; + + //Based on extension + if (result == QualityTypes.Unknown) + { + switch (new FileInfo(name).Extension.ToLower()) + { + case ".avi": + case ".xvid": + case ".wmv": + { + result = QualityTypes.TV; + break; + } + case ".mkv": + { + result = QualityTypes.HDTV; + break; + } + } + } + + Logger.Trace("Quality Parsed:{0} Title:", result, name); + return result; + } + + /// <summary> + /// Normalizes the title. removing all non-word characters as well as common tokens + /// such as 'the' and 'and' + /// </summary> + /// <param name="title">title</param> + /// <returns></returns> + internal static string NormalizeTitle(string title) + { + return NormalizeRegex.Replace(title, String.Empty).ToLower(); + } + + //Note: changing case on path is a problem for running on mono/*nix + //Not going to change the casing any more... Looks Ugly in UI anyways :P + public static string NormalizePath(string path) + { + if (String.IsNullOrEmpty(path)) + throw new ArgumentException("Path can not be null or empty"); + + var info = new FileInfo(path); + + if (info.FullName.StartsWith(@"\\")) //UNC + { + return info.FullName.TrimEnd('/', '\\', ' '); + } + + return info.FullName.Trim('/', '\\', ' '); + } + + + } +} + + Proper = title.ToLower().Contains("proper"), + SeriesTitle = seriesName, + SeasonNumber = Convert.ToInt32(match[0].Groups["season"].Value), + Year = year, + Episodes = new List<int>() + }; + + foreach (Match matchGroup in match) + { + parsedEpisode.Episodes.Add(Convert.ToInt32(matchGroup.Groups["episode"].Value)); + + } + + parsedEpisode.Quality = ParseQuality(title); + Logger.Trace("Episode Parsed. {0}", parsedEpisode); + + return parsedEpisode; + } + } + + return null; + } + + /// <summary> + /// Parses a post title into season it contains + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>Season information contained in the post</returns> + internal static SeasonParseResult ParseSeasonInfo(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + var seasonNumber = Convert.ToInt32(match[0].Groups["season"].Value); + + var result = new SeasonParseResult + { + SeriesTitle = seriesName, + SeasonNumber = seasonNumber, + Year = year + }; + + + result.Quality = ParseQuality(title); + + Logger.Trace("Season Parsed. {0}", result); + return result; + } + } + + return null; //Return null + } + + /// <summary> + /// Parses a post title to find the series that relates to it + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>Normalized Series Name</returns> + internal static string ParseSeriesName(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + Logger.Trace("Series Parsed. {0}", seriesName); + return seriesName; + } + } + + return String.Empty; + } + + /// <summary> + /// Parses proper status out of a report title + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns></returns> + internal static bool ParseProper(string title) + { + return title.ToLower().Contains("proper"); + } + + private static QualityTypes ParseQuality(string name) + { + Logger.Trace("Trying to parse quality for {0}", name); + + var result = QualityTypes.Unknown; + name = name.ToLowerInvariant(); + + if (name.Contains("dvd")) + return QualityTypes.DVD; + + if (name.Contains("bdrip") || name.Contains("brrip")) + { + return QualityTypes.BDRip; + } + + if (name.Contains("xvid") || name.Contains("divx")) + { + if (name.Contains("bluray")) + { + return QualityTypes.BDRip; + } + + return QualityTypes.TV; + } + + if (name.Contains("bluray")) + { + if (name.Contains("720p")) + return QualityTypes.Bluray720; + + if (name.Contains("1080p")) + return QualityTypes.Bluray1080; + + return QualityTypes.Bluray720; + } + if (name.Contains("web-dl")) + return QualityTypes.WEBDL; + if (name.Contains("x264") || name.Contains("h264") || name.Contains("720p")) + return QualityTypes.HDTV; + + //Based on extension + if (result == QualityTypes.Unknown) + { + switch (new FileInfo(name).Extension.ToLower()) + { + case ".avi": + case ".xvid": + case ".wmv": + { + result = QualityTypes.TV; + break; + } + case ".mkv": + { + result = QualityTypes.HDTV; + break; + } + } + } + + Logger.Trace("Quality Parsed:{0} Title:", result, name); + return result; + } + + /// <summary> + /// Normalizes the title. removing all non-word characters as well as common tokens + /// such as 'the' and 'and' + /// </summary> + /// <param name="title">title</param> + /// <returns></returns> + internal static string NormalizeTitle(string title) + { + return NormalizeRegex.Replace(title, String.Empty).ToLower(); + } + + //Note: changing case on path is a problem for running on mono/*nix + //Not going to change the casing any more... Looks Ugly in UI anyways :P + public static string NormalizePath(string path) + { + if (String.IsNullOrEmpty(path)) + throw new ArgumentException("Path can not be null or empty"); + + var info = new FileInfo(path); + + if (info.FullName.StartsWith(@"\\")) //UNC + { + return info.FullName.TrimEnd('/', '\\', ' '); + } + + return info.FullName.Trim('/', '\\', ' '); + } + + } } diff --git a/NzbDrone.Core/Parser.cs.orig b/NzbDrone.Core/Parser.cs.orig new file mode 100644 index 000000000..856d9b8c4 --- /dev/null +++ b/NzbDrone.Core/Parser.cs.orig @@ -0,0 +1,282 @@ +using System; +using System.Collections.Generic; +using System.IO; +using System.Linq; +using System.Text; +using System.Text.RegularExpressions; +using NLog; +using NzbDrone.Core.Model; +using NzbDrone.Core.Providers; +using NzbDrone.Core.Repository.Quality; + +namespace NzbDrone.Core +{ + internal static class Parser + { + private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); + + private static readonly Regex[] ReportTitleRegex = new[] + { + new Regex(@"(?<title>.+?)?\W?(?<year>\d+?)?\WS?(?<season>\d+)((?:\-|\.|[a-z])(?<episode>\d+))+\W(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled), + new Regex(@"(?<title>.+?)?\W?(?<year>\d+?)?\WS?(?<season>\d+)(?<episode>\d{2})\W(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled) //Supports 103/113 naming + }; + + private static readonly Regex[] SeasonReportTitleRegex = new[] + { + new Regex(@"(?<title>.+?)?\W?(?<year>\d{4}?)?\W(?:S|Season)?\W?(?<season>\d+)(?!\\)", RegexOptions.IgnoreCase | RegexOptions.Compiled), + }; + + private static readonly Regex NormalizeRegex = new Regex(@"((\s|^)the(\s|$))|((\s|^)and(\s|$))|[^a-z]", RegexOptions.IgnoreCase | RegexOptions.Compiled); + + /// <summary> + /// Parses a post title into list of episodes it contains + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>List of episodes contained to the post</returns> + internal static EpisodeParseResult ParseEpisodeInfo(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + var parsedEpisode = new EpisodeParseResult + { + Proper = title.ToLower().Contains("proper"), + SeriesTitle = seriesName, + SeasonNumber = Convert.ToInt32(match[0].Groups["season"].Value), + Year = year, + Episodes = new List<int>() + }; + + foreach (Match matchGroup in match) + { + parsedEpisode.Episodes.Add(Convert.ToInt32(matchGroup.Groups["episode"].Value)); + +<<<<<<< HEAD + var seasonNumber = Convert.ToInt32(matchGroup.Groups["season"].Value); + + foreach (Capture episode in matchGroup.Groups["episode"].Captures) + { + var parsedEpisode = new EpisodeParseResult + { + SeriesTitle = seriesName, + SeasonNumber = seasonNumber, + EpisodeNumber = Convert.ToInt32(episode.Value), + Year = year + }; + + + result.Add(parsedEpisode); + Logger.Trace("Episode Parsed. {0}", parsedEpisode); + } + } + break; //Break out of the for loop, we don't want to process every REGEX for each item otherwise we'll get duplicates +======= + } + + parsedEpisode.Quality = ParseQuality(title); + + Logger.Trace("Episode Parsed. {0}", parsedEpisode); + + return parsedEpisode; +>>>>>>> 2d9285eee29d96b6eedee98e358aa76c32c2998f + } + } + + return null; + } + + /// <summary> + /// Parses a post title into season it contains + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>Season information contained in the post</returns> + internal static SeasonParseResult ParseSeasonInfo(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + var seasonNumber = Convert.ToInt32(match[0].Groups["season"].Value); + + var result = new SeasonParseResult + { + SeriesTitle = seriesName, + SeasonNumber = seasonNumber, + Year = year + }; + + + result.Quality = ParseQuality(title); + + Logger.Trace("Season Parsed. {0}", result); + return result; + } + } + + return null; //Return null + } + + /// <summary> + /// Parses a post title to find the series that relates to it + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns>Normalized Series Name</returns> + internal static string ParseSeriesName(string title) + { + Logger.Trace("Parsing string '{0}'", title); + + foreach (var regex in ReportTitleRegex) + { + var match = regex.Matches(title); + + if (match.Count != 0) + { + var seriesName = NormalizeTitle(match[0].Groups["title"].Value); + var year = 0; + Int32.TryParse(match[0].Groups["year"].Value, out year); + + if (year < 1900 || year > DateTime.Now.Year + 1) + { + year = 0; + } + + Logger.Trace("Series Parsed. {0}", seriesName); + return seriesName; + } + } + + return String.Empty; + } + + /// <summary> + /// Parses proper status out of a report title + /// </summary> + /// <param name="title">Title of the report</param> + /// <returns></returns> + internal static bool ParseProper(string title) + { + return title.ToLower().Contains("proper"); + } + + private static QualityTypes ParseQuality(string name) + { + Logger.Trace("Trying to parse quality for {0}", name); + + var result = QualityTypes.Unknown; + name = name.ToLowerInvariant(); + + if (name.Contains("dvd")) + return QualityTypes.DVD; + + if (name.Contains("bdrip") || name.Contains("brrip")) + { + return QualityTypes.BDRip; + } + + if (name.Contains("xvid") || name.Contains("divx")) + { + if (name.Contains("bluray")) + { + return QualityTypes.BDRip; + } + + return QualityTypes.TV; + } + + if (name.Contains("bluray")) + { + if (name.Contains("720p")) + return QualityTypes.Bluray720; + + if (name.Contains("1080p")) + return QualityTypes.Bluray1080; + + return QualityTypes.Bluray720; + } + if (name.Contains("web-dl")) + return QualityTypes.WEBDL; + if (name.Contains("x264") || name.Contains("h264") || name.Contains("720p")) + return QualityTypes.HDTV; + + //Based on extension + if (result == QualityTypes.Unknown) + { + switch (new FileInfo(name).Extension.ToLower()) + { + case ".avi": + case ".xvid": + case ".wmv": + { + result = QualityTypes.TV; + break; + } + case ".mkv": + { + result = QualityTypes.HDTV; + break; + } + } + } + + Logger.Trace("Quality Parsed:{0} Title:", result, name); + return result; + } + + /// <summary> + /// Normalizes the title. removing all non-word characters as well as common tokens + /// such as 'the' and 'and' + /// </summary> + /// <param name="title">title</param> + /// <returns></returns> + internal static string NormalizeTitle(string title) + { + return NormalizeRegex.Replace(title, String.Empty).ToLower(); + } + + //Note: changing case on path is a problem for running on mono/*nix + //Not going to change the casing any more... Looks Ugly in UI anyways :P + public static string NormalizePath(string path) + { + if (String.IsNullOrEmpty(path)) + throw new ArgumentException("Path can not be null or empty"); + + var info = new FileInfo(path); + + if (info.FullName.StartsWith(@"\\")) //UNC + { + return info.FullName.TrimEnd('/', '\\', ' '); + } + + return info.FullName.Trim('/', '\\', ' '); + } + + + } +} diff --git a/NzbDrone.Core/Providers/BacklogProvider.cs b/NzbDrone.Core/Providers/BacklogProvider.cs deleted file mode 100644 index a4bda3e4b..000000000 --- a/NzbDrone.Core/Providers/BacklogProvider.cs +++ /dev/null @@ -1,281 +0,0 @@ -using System; -using System.Collections.Generic; -using System.IO; -using System.Linq; -using System.Text; -using System.Threading; -using NLog; -using NzbDrone.Core.Helpers; -using NzbDrone.Core.Model; -using NzbDrone.Core.Model.Notification; -using NzbDrone.Core.Repository; -using Rss; - -namespace NzbDrone.Core.Providers -{ - public class BacklogProvider : IBacklogProvider - { - private readonly ISeriesProvider _seriesProvider; - private readonly INotificationProvider _notificationProvider; - private readonly IConfigProvider _configProvider; - private readonly IIndexerProvider _indexerProvider; - private readonly IRssProvider _rssProvider; - private readonly IRssItemProcessingProvider _rssItemProcessor; - - private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); - private List<Series> _seriesList; - private Thread _backlogThread; - private ProgressNotification _backlogSearchNotification; - - public BacklogProvider(ISeriesProvider seriesProvider, INotificationProvider notificationProvider, - IConfigProvider configProvider, IIndexerProvider indexerProvider, - IRssProvider rssProvider, IRssItemProcessingProvider _rssItemProcessor) - { - _seriesProvider = seriesProvider; - _notificationProvider = notificationProvider; - _configProvider = configProvider; - _indexerProvider = indexerProvider; - _rssProvider = rssProvider; - - _seriesList = new List<Series>(); - } - - #region IBacklogProvider Members - - public bool StartSearch() - { - Logger.Debug("Backlog Search Requested"); - if (_backlogThread == null || !_backlogThread.IsAlive) - { - Logger.Debug("Initializing Backlog Search"); - _backlogThread = new Thread(PerformSearch) - { - Name = "BacklogSearch", - Priority = ThreadPriority.Lowest - }; - - _seriesList.AddRange(_seriesProvider.GetAllSeries()); - _backlogThread.Start(); - } - else - { - Logger.Warn("Backlog Search already in progress. Ignoring request."); - - //return false if backlog search was already running - return false; - } - - //return true if backlog search has started - return true; - } - - public bool StartSearch(int seriesId) - { - //Get the series - //Start new Thread if one isn't already started - - Logger.Debug("Backlog Search Requested"); - if (_backlogThread == null || !_backlogThread.IsAlive) - { - Logger.Debug("Initializing Backlog Search"); - _backlogThread = new Thread(PerformSearch) - { - Name = "BacklogSearch", - Priority = ThreadPriority.Lowest - }; - - var series = _seriesProvider.GetSeries(seriesId); - - if (series == null) - { - Logger.Debug("Invalid Series - Not starting Backlog Search"); - return false; - } - - _seriesList.Add(series); - _backlogThread.Start(); - } - else - { - Logger.Warn("Backlog Search already in progress. Ignoring request."); - - //return false if backlog search was already running - return false; - } - - //return true if backlog search has started - return true; - } - - #endregion - - private void PerformSearch() - { - try - { - using (_backlogSearchNotification = new ProgressNotification("Series Scan")) - { - _notificationProvider.Register(_backlogSearchNotification); - _backlogSearchNotification.CurrentStatus = "Starting Backlog Search"; - _backlogSearchNotification.ProgressMax = _seriesList.Count; - - foreach (var series in _seriesList) - { - BackLogSeries(series); - } - - _backlogSearchNotification.CurrentStatus = "Backlog Search Completed"; - Logger.Info("Backlog Search has successfully completed."); - Thread.Sleep(3000); - _backlogSearchNotification.Status = ProgressNotificationStatus.Completed; - } - } - - catch (Exception ex) - { - Logger.WarnException(ex.Message, ex); - } - } - - private void BackLogSeries(Series series) - { - try - { - //Do the searching here - _backlogSearchNotification.CurrentStatus = String.Format("Backlog Searching For: {0}", series.Title); - - var sceneNames = SceneNameHelper.FindById(series.SeriesId); - - if (sceneNames.Count < 1) - sceneNames.Add(series.Title); - - foreach (var season in series.Seasons) - { - BackLogSeason(sceneNames, season); - } - //Done searching for each episode - } - - catch (Exception ex) - { - Logger.WarnException(ex.Message, ex); - } - - _backlogSearchNotification.ProgressValue++; - } - - private void BackLogSeason(List<string> sceneNames, Season season) - { - var episodesWithoutFiles = season.Episodes.Where(e => e.EpisodeFileId == 0); - - if (season.Episodes.Count() == episodesWithoutFiles.Count()) - { - //Whole season needs to be grabbed, look for the whole season first - //Lookup scene name using seriesId - - foreach (var sceneName in sceneNames) - { - var searchString = String.Format("{0} Season {1}", sceneName, - season.SeasonNumber); - - foreach (var i in _indexerProvider.EnabledIndexers()) - { - //Get the users URL - GetUsersUrl(i, searchString); - - //If the url still contains '{' & '}' the user probably hasn't configured the indexer settings - if (i.ApiUrl.Contains("{") && i.ApiUrl.Contains("}")) - { - Logger.Debug("Unable to Sync {0}. User Information has not been configured.", i.IndexerName); - continue; //Skip this indexer - } - - var indexer = new FeedInfoModel(i.IndexerName, i.ApiUrl); - - var feedItems = _rssProvider.GetFeed(indexer); - - if (feedItems.Count() == 0) - { - Logger.Debug("Failed to download Backlog Search URL: {0}", indexer.Name); - continue; //No need to process anything else - } - - foreach (RssItem item in feedItems) - { - NzbInfoModel nzb = Parser.ParseNzbInfo(indexer, item); - QueueSeasonIfWanted(nzb, i); - } - - } - } - } - } - - private void GetUsersUrl(Indexer indexer, string searchString) - { - if (indexer.IndexerName == "NzbMatrix") - { - var nzbMatrixUsername = _configProvider.GetValue("NzbMatrixUsername", String.Empty, false); - var nzbMatrixApiKey = _configProvider.GetValue("NzbMatrixApiKey", String.Empty, false); - var retention = Convert.ToInt32(_configProvider.GetValue("Retention", String.Empty, false)); - - if (!String.IsNullOrEmpty(nzbMatrixUsername) && !String.IsNullOrEmpty(nzbMatrixApiKey)) - indexer.ApiUrl = indexer.ApiUrl.Replace("{USERNAME}", nzbMatrixUsername).Replace("{APIKEY}", nzbMatrixApiKey).Replace("{AGE}", retention.ToString()).Replace("{TERM}", searchString); - - //Todo: Perform validation at the config level so a user is unable to enable a provider until user details are provided - return; - } - - if (indexer.IndexerName == "NzbsOrg") - { - var nzbsOrgUId = _configProvider.GetValue("NzbsOrgUId", String.Empty, false); - var nzbsOrgHash = _configProvider.GetValue("NzbsOrgHash", String.Empty, false); - - if (!String.IsNullOrEmpty(nzbsOrgUId) && !String.IsNullOrEmpty(nzbsOrgHash)) - indexer.RssUrl = indexer.RssUrl.Replace("{UID}", nzbsOrgUId).Replace("{HASH}", nzbsOrgHash); - - //Todo: Perform validation at the config level so a user is unable to enable a provider until user details are provided - return; - } - - if (indexer.IndexerName == "NzbsOrg") - { - var nzbsrusUId = _configProvider.GetValue("NzbsrusUId", String.Empty, false); - var nzbsrusHash = _configProvider.GetValue("NzbsrusHash", String.Empty, false); - - if (!String.IsNullOrEmpty(nzbsrusUId) && !String.IsNullOrEmpty(nzbsrusHash)) - indexer.RssUrl = indexer.RssUrl.Replace("{UID}", nzbsrusUId).Replace("{HASH}", nzbsrusHash); - - //Todo: Perform validation at the config level so a user is unable to enable a provider until user details are provided - return; - } - - return; //Currently other providers do not require user information to be substituted, simply return - } - - private void QueueSeasonIfWanted(NzbInfoModel nzb, Indexer indexer) - { - //Do we want this item? - try - { - if (nzb.IsPassworded()) - { - Logger.Debug("Skipping Passworded Report {0}", nzb.Title); - return; - } - - //Need to get REGEX that will handle "Show Name Season 1 quality" - nzb.TitleFix = String.Empty; - nzb.TitleFix = String.Format("{0} [{1}]", nzb.TitleFix, nzb.Quality); //Add Quality to the titleFix - - //Check that we want this quality - var quality = Parser.ParseQuality(nzb.Title); - } - - catch (Exception ex) - { - Logger.DebugException(ex.Message, ex); - } - } - } -} diff --git a/NzbDrone.Core/Providers/ConfigProvider.cs b/NzbDrone.Core/Providers/Core/ConfigProvider.cs similarity index 84% rename from NzbDrone.Core/Providers/ConfigProvider.cs rename to NzbDrone.Core/Providers/Core/ConfigProvider.cs index 9851eaab2..dfd0c01c2 100644 --- a/NzbDrone.Core/Providers/ConfigProvider.cs +++ b/NzbDrone.Core/Providers/Core/ConfigProvider.cs @@ -3,7 +3,7 @@ using NLog; using NzbDrone.Core.Repository; using SubSonic.Repository; -namespace NzbDrone.Core.Providers +namespace NzbDrone.Core.Providers.Core { public class ConfigProvider : IConfigProvider { @@ -163,11 +163,36 @@ namespace NzbDrone.Core.Providers set { SetValue("BlackholeDirectory", value); } } + public bool UseSeasonFolder + { + get { return GetValueBoolean("Sorting_SeasonFolder", true); } + + set { SetValue("Sorting_SeasonFolder", value); } + } + + public int DefaultQualityProfile + { + get { return GetValueInt("DefaultQualityProfile", 1); } + + set { SetValue("DefaultQualityProfile", value); } + } + + private string GetValue(string key) { return GetValue(key, String.Empty, false); } + private bool GetValueBoolean(string key, bool defaultValue = false) + { + return Convert.ToBoolean(GetValue(key, defaultValue, false)); + } + + private int GetValueInt(string key, int defaultValue = 0) + { + return Convert.ToInt16(GetValue(key, defaultValue, false)); + } + public string GetValue(string key, object defaultValue, bool makePermanent) { string value; @@ -185,6 +210,16 @@ namespace NzbDrone.Core.Providers return value; } + public void SetValue(string key, Boolean value) + { + SetValue(key, value.ToString()); + } + + public void SetValue(string key, int value) + { + SetValue(key, value.ToString()); + } + public void SetValue(string key, string value) { if (String.IsNullOrEmpty(key)) diff --git a/NzbDrone.Core/Providers/DiskProvider.cs b/NzbDrone.Core/Providers/Core/DiskProvider.cs similarity index 87% rename from NzbDrone.Core/Providers/DiskProvider.cs rename to NzbDrone.Core/Providers/Core/DiskProvider.cs index 529440563..4921ec98e 100644 --- a/NzbDrone.Core/Providers/DiskProvider.cs +++ b/NzbDrone.Core/Providers/Core/DiskProvider.cs @@ -1,7 +1,7 @@ using System; using System.IO; -namespace NzbDrone.Core.Providers +namespace NzbDrone.Core.Providers.Core { public class DiskProvider : IDiskProvider { @@ -49,12 +49,6 @@ namespace NzbDrone.Core.Providers File.Move(sourcePath, destinationPath); } - public string GetFolderName(string path) - { - var di = new DirectoryInfo(path); - return di.Name; - } - #endregion } } \ No newline at end of file diff --git a/NzbDrone.Core/Providers/HttpProvider.cs b/NzbDrone.Core/Providers/Core/HttpProvider.cs similarity index 98% rename from NzbDrone.Core/Providers/HttpProvider.cs rename to NzbDrone.Core/Providers/Core/HttpProvider.cs index 8fc7b587e..b07c18071 100644 --- a/NzbDrone.Core/Providers/HttpProvider.cs +++ b/NzbDrone.Core/Providers/Core/HttpProvider.cs @@ -2,7 +2,7 @@ using System.Net; using NLog; -namespace NzbDrone.Core.Providers +namespace NzbDrone.Core.Providers.Core { internal class HttpProvider : IHttpProvider { diff --git a/NzbDrone.Core/Providers/IConfigProvider.cs b/NzbDrone.Core/Providers/Core/IConfigProvider.cs similarity index 89% rename from NzbDrone.Core/Providers/IConfigProvider.cs rename to NzbDrone.Core/Providers/Core/IConfigProvider.cs index 8c8c223c6..536753af2 100644 --- a/NzbDrone.Core/Providers/IConfigProvider.cs +++ b/NzbDrone.Core/Providers/Core/IConfigProvider.cs @@ -1,6 +1,6 @@ using System; -namespace NzbDrone.Core.Providers +namespace NzbDrone.Core.Providers.Core { public interface IConfigProvider { @@ -25,6 +25,8 @@ namespace NzbDrone.Core.Providers String SyncFrequency { get; set; } String SabTvPriority { get; set; } String ApiKey { get; set; } + bool UseSeasonFolder { get; set; } + int DefaultQualityProfile { get; set; } string GetValue(string key, object defaultValue, bool makePermanent); void SetValue(string key, string value); diff --git a/NzbDrone.Core/Providers/IDiskProvider.cs b/NzbDrone.Core/Providers/Core/IDiskProvider.cs similarity index 85% rename from NzbDrone.Core/Providers/IDiskProvider.cs rename to NzbDrone.Core/Providers/Core/IDiskProvider.cs index 242721f27..e0d115bc8 100644 --- a/NzbDrone.Core/Providers/IDiskProvider.cs +++ b/NzbDrone.Core/Providers/Core/IDiskProvider.cs @@ -1,7 +1,7 @@ using System; using System.IO; -namespace NzbDrone.Core.Providers +namespace NzbDrone.Core.Providers.Core { public interface IDiskProvider { @@ -13,6 +13,5 @@ namespace NzbDrone.Core.Providers long GetSize(string path); void DeleteFile(string path); void RenameFile(string sourcePath, string destinationPath); - string GetFolderName(string path); } } \ No newline at end of file diff --git a/NzbDrone.Core/Providers/IHttpProvider.cs b/NzbDrone.Core/Providers/Core/IHttpProvider.cs similarity index 88% rename from NzbDrone.Core/Providers/IHttpProvider.cs rename to NzbDrone.Core/Providers/Core/IHttpProvider.cs index 3b8d78702..e10a6849a 100644 --- a/NzbDrone.Core/Providers/IHttpProvider.cs +++ b/NzbDrone.Core/Providers/Core/IHttpProvider.cs @@ -1,4 +1,4 @@ -namespace NzbDrone.Core.Providers +namespace NzbDrone.Core.Providers.Core { public interface IHttpProvider { diff --git a/NzbDrone.Core/Providers/EpisodeProvider.cs b/NzbDrone.Core/Providers/EpisodeProvider.cs index b5781d1d9..8dda15aa6 100644 --- a/NzbDrone.Core/Providers/EpisodeProvider.cs +++ b/NzbDrone.Core/Providers/EpisodeProvider.cs @@ -65,76 +65,53 @@ namespace NzbDrone.Core.Providers /// <summary> /// Comprehensive check on whether or not this episode is needed. /// </summary> - /// <param name="episode">Episode that needs to be checked</param> + /// <param name="parsedReport">Episode that needs to be checked</param> /// <returns></returns> - public bool IsNeeded(EpisodeModel episode) + public bool IsNeeded(EpisodeParseResult parsedReport) { - //IsSeasonIgnored - //IsQualityWanted - //EpisodeFileExists - //IsInHistory - //IsOnDisk? (How to handle episodes that are downloaded manually?) - - if (IsSeasonIgnored(episode)) - return false; - - //Quickly check if this quality is wanted at all (We will later check if the quality is still needed) - if (!_series.QualityWanted(episode.SeriesId, episode.Quality)) + foreach (var episode in parsedReport.Episodes) { - Logger.Debug("Quality [{0}] is not wanted for: {1}", episode.Quality, episode.SeriesTitle); - return false; - } + var episodeInfo = GetEpisode(parsedReport.SeriesId, parsedReport.SeasonNumber, episode); - //Check to see if there is an episode file for this episode - var dbEpisode = GetEpisode(episode.SeriesId, episode.SeasonNumber, episode.EpisodeNumber); - - if (dbEpisode == null) - { - //Todo: How do we want to handle this really? Episode could be released before information is on TheTvDB (Parks and Rec did this a lot in the first season, from experience) - throw new NotImplementedException("Episode was not found in the database"); - } - - episode.EpisodeId = dbEpisode.EpisodeId; - - var file = dbEpisode.EpisodeFile; - - if (file != null) - { - //If not null we need to see if this episode has the quality as the download (or if it is better) - if (file.Quality == episode.Quality) + if (episodeInfo == null) { - //If the episodeFile is a Proper we don't need to download again - if (file.Proper) - return false; + //Todo: How do we want to handle this really? Episode could be released before information is on TheTvDB + //(Parks and Rec did this a lot in the first season, from experience) + //Keivan: Should automatically add the episode to db with minimal information. then update the description/title when avilable. + throw new NotImplementedException("Episode was not found in the database"); } - //There will never be a time when the episode quality is less than what we have and we want it... ever.... I think. - if (file.Quality > episode.Quality) - return false; + var file = episodeInfo.EpisodeFile; - //Now we need to handle upgrades and actually pay attention to the Cutoff Value - if (file.Quality < episode.Quality) + if (file != null) { - var series = _series.GetSeries(episode.SeriesId); - var quality = _quality.Find(series.QualityProfileId); + //If not null we need to see if this episode has the quality as the download (or if it is better) + if (file.Quality == parsedReport.Quality && file.Proper) continue; - if (quality.Cutoff <= file.Quality) + //There will never be a time when the episode quality is less than what we have and we want it... ever.... I think. + if (file.Quality > parsedReport.Quality) continue; + + //Now we need to handle upgrades and actually pay attention to the Cutoff Value + if (file.Quality < parsedReport.Quality) { - //If the episodeFile is a Proper we don't need to download again - if (file.Proper) - return false; + var quality = _quality.Find(episodeInfo.Series.QualityProfileId); + + if (quality.Cutoff <= file.Quality && file.Proper) continue; } } + + //IsInHistory? (NZBDrone) + if (_history.Exists(episodeInfo.EpisodeId, parsedReport.Quality, parsedReport.Proper)) + { + Logger.Debug("Episode in history: {0}", episode.ToString()); + continue; + } + + return true;//If we get to this point and the file has not yet been rejected then accept it } - //IsInHistory? (NZBDrone) - if (_history.Exists(dbEpisode.EpisodeId, episode.Quality, episode.Proper)) - { - Logger.Debug("Episode in history: {0}", episode.ToString()); - return false; - } + return false; - return true;//If we get to this point and the file has not yet been rejected then accept it } public void RefreshEpisodeInfo(int seriesId) @@ -270,7 +247,7 @@ namespace NzbDrone.Core.Providers _sonicRepo.Update(episode); } - private bool IsSeasonIgnored(EpisodeModel episode) + private bool IsSeasonIgnored(EpisodeParseResult episode) { //Check if this Season is ignored if (_seasons.IsIgnored(episode.SeriesId, episode.SeasonNumber)) diff --git a/NzbDrone.Core/Providers/ExternalNotificationProvider.cs b/NzbDrone.Core/Providers/ExternalNotificationProvider.cs index e4c9fcbd7..5c397d268 100644 --- a/NzbDrone.Core/Providers/ExternalNotificationProvider.cs +++ b/NzbDrone.Core/Providers/ExternalNotificationProvider.cs @@ -5,6 +5,7 @@ using System.Text; using NLog; using NzbDrone.Core.Helpers; using NzbDrone.Core.Model; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; namespace NzbDrone.Core.Providers diff --git a/NzbDrone.Core/Providers/Feed/FeedProviderBase.cs b/NzbDrone.Core/Providers/Feed/FeedProviderBase.cs new file mode 100644 index 000000000..1d826901c --- /dev/null +++ b/NzbDrone.Core/Providers/Feed/FeedProviderBase.cs @@ -0,0 +1,118 @@ +using System.ServiceModel.Syndication; +using System.Xml; +using NLog; +using NzbDrone.Core.Model; +using NzbDrone.Core.Providers.Core; + +namespace NzbDrone.Core.Providers.Feed +{ + abstract class FeedProviderBase + { + protected readonly ISeriesProvider _seriesProvider; + protected readonly ISeasonProvider _seasonProvider; + protected readonly IEpisodeProvider _episodeProvider; + protected readonly IConfigProvider _configProvider; + protected static readonly Logger Logger = LogManager.GetCurrentClassLogger(); + + protected FeedProviderBase(ISeriesProvider seriesProvider, ISeasonProvider seasonProvider, IEpisodeProvider episodeProvider, IConfigProvider configProvider) + { + _seriesProvider = seriesProvider; + _seasonProvider = seasonProvider; + _episodeProvider = episodeProvider; + _configProvider = configProvider; + } + + + /// <summary> + /// Gets the source URL for the feed + /// </summary> + protected abstract string[] URL { get; } + + /// <summary> + /// Gets the name for this feed + /// </summary> + protected abstract string Name { get; } + + + /// <summary> + /// Generates direct link to download an NZB + /// </summary> + /// <param name="item">RSS Feed item to generate the link for</param> + /// <returns>Download link URL</returns> + protected abstract string NzbDownloadUrl(SyndicationItem item); + + + /// <summary> + /// Parses the RSS feed item and. + /// </summary> + /// <param name="item">RSS feed item to parse</param> + /// <returns>Detailed episode info</returns> + protected EpisodeParseResult ParseFeed(SyndicationItem item) + { + var episodeParseResult = Parser.ParseEpisodeInfo(item.Title.ToString()); + var seriesInfo = _seriesProvider.FindSeries(episodeParseResult.SeriesTitle); + + if (seriesInfo != null) + { + episodeParseResult.SeriesId = seriesInfo.SeriesId; + episodeParseResult.SeriesTitle = seriesInfo.Title; + return episodeParseResult; + } + + Logger.Debug("Unable to map {0} to any of series in database", episodeParseResult.SeriesTitle); + return null; + + } + + + + /// <summary> + /// Fetches RSS feed and process each news item. + /// </summary> + public void Fetch() + { + Logger.Info("Fetching feeds from " + Name); + + foreach (var url in URL) + { + Logger.Debug("Downloading RSS " + url); + var feed = SyndicationFeed.Load(XmlReader.Create(url)).Items; + + foreach (var item in feed) + { + ProcessItem(item); + } + } + + Logger.Info("Finished processing feeds from " + Name); + } + + private void ProcessItem(SyndicationItem feedItem) + { + Logger.Info("Processing RSS feed item " + feedItem.Title); + + var parseResult = ParseFeed(feedItem); + + if (!_seriesProvider.IsMonitored(parseResult.SeriesId)) + { + Logger.Debug("{0} is present in the DB but not tracked. skipping.", parseResult.SeriesTitle); + } + + if (!_seriesProvider.QualityWanted(parseResult.SeriesId, parseResult.Quality)) + { + Logger.Debug("Post doesn't meet the quality requirements [{0}]. skipping.", parseResult.Quality); + } + + if (_seasonProvider.IsIgnored(parseResult.SeriesId, parseResult.SeasonNumber)) + { + Logger.Debug("Season {0} is currently set to ignore. skipping.", parseResult.SeasonNumber); + } + + if (!_episodeProvider.IsNeeded(parseResult)) + { + Logger.Debug("Episode {0} is not needed. skipping.", parseResult); + } + } + } + +} diff --git a/NzbDrone.Core/Providers/Feed/NzbsOrgFeedProvider.cs b/NzbDrone.Core/Providers/Feed/NzbsOrgFeedProvider.cs new file mode 100644 index 000000000..74ace542f --- /dev/null +++ b/NzbDrone.Core/Providers/Feed/NzbsOrgFeedProvider.cs @@ -0,0 +1,35 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.ServiceModel.Syndication; +using System.Text; +using NzbDrone.Core.Providers.Core; + +namespace NzbDrone.Core.Providers.Feed +{ + class NzbsOrgFeedProvider : FeedProviderBase + { + public NzbsOrgFeedProvider(ISeriesProvider seriesProvider, ISeasonProvider seasonProvider, IEpisodeProvider episodeProvider, IConfigProvider configProvider) + : base(seriesProvider, seasonProvider, episodeProvider, configProvider) + { + } + + protected override string[] URL + { + get + { + return new[] { string.Format("http://nzbs.org/rss.php?type=1&i={0}&h={1}", _configProvider.NzbsOrgUId, _configProvider.NzbsOrgHash) }; + } + } + + protected override string Name + { + get { return "Nzbs.Org"; } + } + + protected override string NzbDownloadUrl(SyndicationItem item) + { + return item.Id.Replace("action=view", "action=getnzb"); + } + } +} diff --git a/NzbDrone.Core/Providers/IEpisodeProvider.cs b/NzbDrone.Core/Providers/IEpisodeProvider.cs index c9d1104e5..9f2caf81c 100644 --- a/NzbDrone.Core/Providers/IEpisodeProvider.cs +++ b/NzbDrone.Core/Providers/IEpisodeProvider.cs @@ -17,7 +17,7 @@ namespace NzbDrone.Core.Providers /// </summary> /// <param name="episode">Episode that needs to be checked</param> /// <returns></returns> - bool IsNeeded(EpisodeModel episode); + bool IsNeeded(EpisodeParseResult episode); void RefreshEpisodeInfo(int seriesId); void RefreshEpisodeInfo(Season season); diff --git a/NzbDrone.Core/Providers/IMediaFileProvider.cs b/NzbDrone.Core/Providers/IMediaFileProvider.cs index 608637d06..3a499cd47 100644 --- a/NzbDrone.Core/Providers/IMediaFileProvider.cs +++ b/NzbDrone.Core/Providers/IMediaFileProvider.cs @@ -13,7 +13,6 @@ namespace NzbDrone.Core.Providers List<EpisodeFile> Scan(Series series); List<EpisodeFile> Scan(Series series, string path); EpisodeFile ImportFile(Series series, string filePath); - string GenerateEpisodePath(EpisodeModel episode); void CleanUp(List<EpisodeFile> files); void DeleteFromDb(int fileId); void DeleteFromDisk(int fileId, string path); diff --git a/NzbDrone.Core/Providers/IRssItemProcessingProvider.cs b/NzbDrone.Core/Providers/IRssItemProcessingProvider.cs deleted file mode 100644 index 32911e591..000000000 --- a/NzbDrone.Core/Providers/IRssItemProcessingProvider.cs +++ /dev/null @@ -1,17 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Linq; -using System.Text; -using NzbDrone.Core.Model; -using NzbDrone.Core.Repository; - -namespace NzbDrone.Core.Providers -{ - public interface IRssItemProcessingProvider - { - //This interface will contain methods to process individual RSS Feed Items (Queue if wanted) - - void DownloadIfWanted(NzbInfoModel nzb, Indexer indexer); - string GetTitleFix(List<EpisodeParseResult> episodes, int seriesId); - } -} diff --git a/NzbDrone.Core/Providers/IRssProvider.cs b/NzbDrone.Core/Providers/IRssProvider.cs deleted file mode 100644 index 85e52f952..000000000 --- a/NzbDrone.Core/Providers/IRssProvider.cs +++ /dev/null @@ -1,14 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Linq; -using System.Text; -using NzbDrone.Core.Model; -using Rss; - -namespace NzbDrone.Core.Providers -{ - public interface IRssProvider - { - IEnumerable<RssItem> GetFeed(FeedInfoModel feedInfo); - } -} diff --git a/NzbDrone.Core/Providers/IRssSyncProvider.cs b/NzbDrone.Core/Providers/IRssSyncProvider.cs index aa033924f..448807815 100644 --- a/NzbDrone.Core/Providers/IRssSyncProvider.cs +++ b/NzbDrone.Core/Providers/IRssSyncProvider.cs @@ -9,4 +9,12 @@ namespace NzbDrone.Core.Providers { void Begin(); } + + class RssSyncProvider : IRssSyncProvider + { + public void Begin() + { + + } + } } diff --git a/NzbDrone.Core/Providers/ISeriesProvider.cs b/NzbDrone.Core/Providers/ISeriesProvider.cs index 84763b350..1d09f77f2 100644 --- a/NzbDrone.Core/Providers/ISeriesProvider.cs +++ b/NzbDrone.Core/Providers/ISeriesProvider.cs @@ -19,12 +19,12 @@ namespace NzbDrone.Core.Providers /// <returns>Whether or not the show is monitored</returns> bool IsMonitored(long id); TvdbSeries MapPathToSeries(string path); - TvdbSeries MapPathToSeries(int tvDbId); - void AddSeries(string path, TvdbSeries series, int qualityProfileId); + void AddSeries(string path, int tvDbSeriesId, int qualityProfileId); Series FindSeries(string cleanTitle); bool QualityWanted(int seriesId, QualityTypes quality); void UpdateSeries(Series series); void DeleteSeries(int seriesId); bool SeriesPathExists(string cleanPath); + Series UpdateSeriesInfo(int seriesId); } } \ No newline at end of file diff --git a/NzbDrone.Core/Providers/ISyncProvider.cs b/NzbDrone.Core/Providers/ISyncProvider.cs index 0aa902b8c..dbbdb3a64 100644 --- a/NzbDrone.Core/Providers/ISyncProvider.cs +++ b/NzbDrone.Core/Providers/ISyncProvider.cs @@ -6,9 +6,8 @@ namespace NzbDrone.Core.Providers { public interface ISyncProvider { - bool BeginSyncUnmappedFolders(List<SeriesMappingModel> unmapped); - bool BeginAddNewSeries(string dir, int seriesId, string seriesName, int qualityProfileId); - bool BeginAddExistingSeries(string path, int seriesId, int qualityProfileId); + List<String> GetUnmappedFolders(string path); + bool BeginUpdateNewSeries(); } } \ No newline at end of file diff --git a/NzbDrone.Core/Providers/IndexerProvider.cs b/NzbDrone.Core/Providers/IndexerProvider.cs index d7f044d81..4c1c036d8 100644 --- a/NzbDrone.Core/Providers/IndexerProvider.cs +++ b/NzbDrone.Core/Providers/IndexerProvider.cs @@ -5,6 +5,7 @@ using System.Linq; using System.Text; using NLog; using NzbDrone.Core.Model; +using NzbDrone.Core.Providers.Core; using SubSonic.Repository; using NzbDrone.Core.Repository; diff --git a/NzbDrone.Core/Providers/MediaFileProvider.cs b/NzbDrone.Core/Providers/MediaFileProvider.cs index 592d96ba5..61659ea46 100644 --- a/NzbDrone.Core/Providers/MediaFileProvider.cs +++ b/NzbDrone.Core/Providers/MediaFileProvider.cs @@ -6,6 +6,7 @@ using System.Text; using System.Text.RegularExpressions; using NLog; using NzbDrone.Core.Model; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; using SubSonic.Repository; @@ -76,18 +77,17 @@ namespace NzbDrone.Core.Providers //Stores the list of episodes to add to the EpisodeFile var episodes = new List<Episode>(); - foreach (var parsedEpisode in episodesInFile) + foreach (var episodeNumber in episodesInFile.Episodes) { - EpisodeParseResult closureEpisode = parsedEpisode; - var episode = _episodeProvider.GetEpisode(series.SeriesId, closureEpisode.SeasonNumber, - closureEpisode.EpisodeNumber); + var episode = _episodeProvider.GetEpisode(series.SeriesId, episodesInFile.SeasonNumber, episodeNumber); + if (episode != null) { episodes.Add(episode); } else - Logger.Warn("Unable to find Series:{0} Season:{1} Episode:{2} in the database. File:{3}", series.Title, closureEpisode.SeasonNumber, closureEpisode.EpisodeNumber, filePath); + Logger.Warn("Unable to find Series:{0} Season:{1} Episode:{2} in the database. File:{3}", series.Title, episodesInFile.SeasonNumber, episodeNumber, filePath); } //Return null if no Episodes exist in the DB for the parsed episodes from file @@ -108,7 +108,7 @@ namespace NzbDrone.Core.Providers episodeFile.SeriesId = series.SeriesId; episodeFile.Path = Parser.NormalizePath(filePath); episodeFile.Size = size; - episodeFile.Quality = Parser.ParseQuality(filePath); + episodeFile.Quality = episodesInFile.Quality; episodeFile.Proper = Parser.ParseProper(filePath); var fileId = (int)_repository.Add(episodeFile); @@ -145,19 +145,7 @@ namespace NzbDrone.Core.Providers } } - public string GenerateEpisodePath(EpisodeModel episode) - { - var episodeNamePattern = _configProvider.EpisodeNameFormat; - - episodeNamePattern = episodeNamePattern.Replace("{series}", "{0}"); - episodeNamePattern = episodeNamePattern.Replace("{episode", "{1"); - episodeNamePattern = episodeNamePattern.Replace("{season", "{2"); - episodeNamePattern = episodeNamePattern.Replace("{title}", "{3}"); - episodeNamePattern = episodeNamePattern.Replace("{quality}", "{4}"); - - return String.Format(episodeNamePattern, episode.SeriesTitle, episode.EpisodeNumber, episode.SeasonNumber, episode.EpisodeTitle, episode.Quality); - } - + public void DeleteFromDb(int fileId) { _repository.Delete<EpisodeFile>(fileId); diff --git a/NzbDrone.Core/Providers/PostProcessingProvider.cs b/NzbDrone.Core/Providers/PostProcessingProvider.cs index 15f8c46a2..7eed8f415 100644 --- a/NzbDrone.Core/Providers/PostProcessingProvider.cs +++ b/NzbDrone.Core/Providers/PostProcessingProvider.cs @@ -5,22 +5,21 @@ using System.Linq; using System.Text; using System.Xml.Linq; using NzbDrone.Core.Helpers; +using NzbDrone.Core.Providers.Core; namespace NzbDrone.Core.Providers { public class PostProcessingProvider : IPostProcessingProvider { private readonly ISeriesProvider _seriesProvider; - private readonly IConfigProvider _configProvider; private readonly IMediaFileProvider _mediaFileProvider; private readonly IRenameProvider _renameProvider; - public PostProcessingProvider(ISeriesProvider seriesProvider, IConfigProvider configProvider, + public PostProcessingProvider(ISeriesProvider seriesProvider, IMediaFileProvider mediaFileProvider, IRenameProvider renameProvider) { _seriesProvider = seriesProvider; - _configProvider = configProvider; - _mediaFileProvider = mediaFileProvider; + _mediaFileProvider = mediaFileProvider; _renameProvider = renameProvider; } diff --git a/NzbDrone.Core/Providers/RenameProvider.cs b/NzbDrone.Core/Providers/RenameProvider.cs index d8e334405..570bf8898 100644 --- a/NzbDrone.Core/Providers/RenameProvider.cs +++ b/NzbDrone.Core/Providers/RenameProvider.cs @@ -7,6 +7,7 @@ using System.Threading; using NLog; using NzbDrone.Core.Helpers; using NzbDrone.Core.Model; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; namespace NzbDrone.Core.Providers diff --git a/NzbDrone.Core/Providers/RssItemProcessingProvider.cs b/NzbDrone.Core/Providers/RssItemProcessingProvider.cs deleted file mode 100644 index 8553e85cd..000000000 --- a/NzbDrone.Core/Providers/RssItemProcessingProvider.cs +++ /dev/null @@ -1,386 +0,0 @@ -using System; -using System.Collections.Generic; -using System.IO; -using System.Linq; -using System.Text; -using NLog; -using NzbDrone.Core.Helpers; -using NzbDrone.Core.Model; -using NzbDrone.Core.Repository; - -namespace NzbDrone.Core.Providers -{ - public class RssItemProcessingProvider : IRssItemProcessingProvider - { - private ISeriesProvider _seriesProvider; - private ISeasonProvider _seasonProvider; - private IEpisodeProvider _episodeProvider; - private IHistoryProvider _historyProvider; - private IDownloadProvider _sabProvider; - private IConfigProvider _configProvider; - private IHttpProvider _httpProvider; - private IDiskProvider _diskProvider; - - private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); - - public RssItemProcessingProvider(ISeriesProvider seriesProvider, ISeasonProvider seasonProvider, - IEpisodeProvider episodeProvider, IHistoryProvider historyProvider, - IDownloadProvider sabProvider, IConfigProvider configProvider, - IHttpProvider httpProvider, IDiskProvider diskProvider) - { - _seriesProvider = seriesProvider; - _seasonProvider = seasonProvider; - _episodeProvider = episodeProvider; - _historyProvider = historyProvider; - _sabProvider = sabProvider; - _configProvider = configProvider; - _httpProvider = httpProvider; - _diskProvider = diskProvider; - } - - #region IRssItemProcessingProvider Members - - public void DownloadIfWanted(NzbInfoModel nzb, Indexer indexer) - { - //Do we want this item? - try - { - if (nzb.IsPassworded()) - { - Logger.Debug("Skipping Passworded Report {0}", nzb.Title); - return; - } - - var episodeParseResults = Parser.ParseEpisodeInfo(nzb.Title); - - if (episodeParseResults.Count() > 0) - { - ProcessStandardItem(nzb, indexer, episodeParseResults); - return; - } - - //Handles Full Season NZBs - var seasonParseResult = Parser.ParseSeasonInfo(nzb.Title); - - if (seasonParseResult != null) - { - ProcessFullSeasonItem(nzb, indexer, seasonParseResult); - return; - } - - Logger.Debug("Unsupported Title: {0}", nzb.Title); - } - - catch (Exception ex) - { - Logger.Error("Unsupported Title: {0}", nzb.Title); - Logger.ErrorException("Error Parsing/Processing NZB: " + ex.Message, ex); - } - } - - public string GetTitleFix(List<EpisodeParseResult> episodes, int seriesId) - { - var series = _seriesProvider.GetSeries(seriesId); - - int seasonNumber = 0; - string episodeNumbers = String.Empty; - string episodeTitles = String.Empty; - - foreach (var episode in episodes) - { - var episodeInDb = _episodeProvider.GetEpisode(seriesId, episode.SeasonNumber, episode.EpisodeNumber); - - if (episodeInDb == null) - { - //Todo: Handle this some other way? - Logger.Debug("Episode Not found in Database, Fake it..."); - //return String.Format("{0} - {1:00}x{2}", series.Title, episode.SeasonNumber, episode.EpisodeNumber); - episodeInDb = new Episode { EpisodeNumber = episode.EpisodeNumber, Title = "TBA" }; - } - - seasonNumber = episodeInDb.SeasonNumber; - episodeNumbers = String.Format("{0}x{1:00}", episodeNumbers, episodeInDb.EpisodeNumber); - episodeTitles = String.Format("{0} + {1}", episodeTitles, episodeInDb.Title); - } - - episodeTitles = episodeTitles.Trim(' ', '+'); - - return String.Format("{0} - {1}{2} - {3}", series.Title, seasonNumber, episodeNumbers, episodeTitles); - } - - #endregion - - private void ProcessStandardItem(NzbInfoModel nzb, Indexer indexer, List<EpisodeParseResult> episodeParseResults) - { - //Will try to match via NormalizeTitle, if that fails it will look for a scene name and do a lookup for your shows - var series = _seriesProvider.FindSeries(episodeParseResults[0].SeriesTitle); - - if (series == null) - { - //If we weren't able to find a title using the clean name, lets try again looking for a scene name - - var sceneId = SceneNameHelper.FindByName(episodeParseResults[0].SeriesTitle); - - if (sceneId != 0) - series = _seriesProvider.GetSeries(sceneId); - - if (series == null) - { - Logger.Debug("Show is not being watched: {0}", episodeParseResults[0].SeriesTitle); - return; - } - } - - Logger.Debug("Show is being watched: {0}", series.Title); - - nzb.Proper = Parser.ParseProper(nzb.Title); - nzb.Quality = Parser.ParseQuality(nzb.Title); - - //Loop through the list of the episodeParseResults to ensure that all the episodes are needed - foreach (var episode in episodeParseResults) - { - //IsEpisodeWanted? - var episodeModel = new EpisodeModel(); - episodeModel.Proper = nzb.Proper; - episodeModel.SeriesId = series.SeriesId; - episodeModel.SeriesTitle = series.Title; - episodeModel.Quality = nzb.Quality; - episodeModel.SeasonNumber = episode.SeasonNumber; - episodeModel.EpisodeNumber = episode.EpisodeNumber; - - if (!_episodeProvider.IsNeeded(episodeModel)) - return; - - var titleFix = GetTitleFix(new List<EpisodeParseResult> { episode }, episodeModel.SeriesId); - titleFix = String.Format("{0} [{1}]", titleFix, nzb.Quality); //Add Quality to the titleFix - - //If it is a PROPER we want to put PROPER in the titleFix - if (nzb.Proper) - titleFix = String.Format("{0} [PROPER]", titleFix); - - if (!Convert.ToBoolean(_configProvider.GetValue("UseBlackhole", true, true))) - if (_sabProvider.IsInQueue(titleFix)) - return; - } - - nzb.TitleFix = GetTitleFix(episodeParseResults, series.SeriesId); //Get the TitleFix so we can use it later - nzb.TitleFix = String.Format("{0} [{1}]", nzb.TitleFix, nzb.Quality); //Add Quality to the titleFix - - //If it is a PROPER we want to put PROPER in the titleFix - if (nzb.Proper) - nzb.TitleFix = String.Format("{0} [PROPER]", nzb.TitleFix); - - if (Convert.ToBoolean(_configProvider.GetValue("UseBlackHole", true, true))) - { - if (DownloadNzb(nzb)) - AddToHistory(episodeParseResults, series, nzb, indexer); - } - - //Send it to SABnzbd - else - { - //Only need to do this check if it contains more than one episode (because we already checked individually before) - if (episodeParseResults.Count > 1) - { - if (_sabProvider.IsInQueue(nzb.TitleFix)) - return; - } - - if (indexer.IndexerName != "Newzbin") - { - if (_sabProvider.AddByUrl(nzb.Link.ToString(), nzb.TitleFix)) - AddToHistory(episodeParseResults, series, nzb, indexer); - } - - else - { - if (_sabProvider.AddById(nzb.Id, nzb.TitleFix)) - AddToHistory(episodeParseResults, series, nzb, indexer); - } - } - } - - private void ProcessFullSeasonItem(NzbInfoModel nzb, Indexer indexer, SeasonParseResult seasonParseResult) - { - //Will try to match via NormalizeTitle, if that fails it will look for a scene name and do a lookup for your shows - var series = _seriesProvider.FindSeries(seasonParseResult.SeriesTitle); - - if (series == null) - { - //If we weren't able to find a title using the clean name, lets try again looking for a scene name - - var sceneId = SceneNameHelper.FindByName(seasonParseResult.SeriesTitle); - - if (sceneId != 0) - series = _seriesProvider.GetSeries(sceneId); - - if (series == null) - { - Logger.Debug("Show is not being watched: {0}", seasonParseResult.SeriesTitle); - return; - } - } - - Logger.Debug("Show is being watched: {0}", series.Title); - - nzb.Proper = Parser.ParseProper(nzb.Title); - nzb.Quality = Parser.ParseQuality(nzb.Title); - - if (!_seriesProvider.QualityWanted(series.SeriesId, nzb.Quality)) - { - Logger.Info("Quality [{0}] is not wanted for: {1}", nzb.Quality, series.Title); - return; - } - - var season = _seasonProvider.GetSeason(series.SeriesId, seasonParseResult.SeasonNumber); - - if (season == null) - return; - - if (_seasonProvider.IsIgnored(season.SeriesId)) - return; - - //Check to see if this is an upgrade for all our files - - var episodesWithoutFiles = season.Episodes.Where(e => e.EpisodeFileId == 0); - - var downloadWholeSeason = false; - - if (season.Episodes.Count() == episodesWithoutFiles.Count()) - { - //We don't have any episodes for this season, so as it stands right now we need the entire NZB - //Download! - downloadWholeSeason = true; - } - - else - { - var episodesNeeded = season.Episodes.Count; - - foreach (var episode in season.Episodes) - { - var episodeModel = new EpisodeModel(); - episodeModel.Proper = nzb.Proper; - episodeModel.SeriesId = series.SeriesId; - episodeModel.SeriesTitle = series.Title; - episodeModel.Quality = nzb.Quality; - episodeModel.SeasonNumber = episode.SeasonNumber; - episodeModel.EpisodeNumber = episode.EpisodeNumber; - - if (!_episodeProvider.IsNeeded(episodeModel)) - { - downloadWholeSeason = false; - episodesNeeded--; //Decrement the number of downloads we need, used if we want to replace all existing episodes if this will upgrade over X% of files - break; //We only want to download this NZB if ALL episodes can be upgraded by this Season NZB - } - downloadWholeSeason = true; - } - } - - if (downloadWholeSeason) - { - //Do the final check to ensure we should download this NZB - - if (Convert.ToBoolean(_configProvider.GetValue("UseBlackHole", true, true))) - { - if (DownloadNzb(nzb)) - { - var episodeParseResults = GetEpisodeParseList(season.Episodes); - AddToHistory(episodeParseResults, series, nzb, indexer); - } - } - - //Send it to SABnzbd - else - { - if (_sabProvider.IsInQueue(nzb.TitleFix)) - return; - - if (indexer.IndexerName != "Newzbin") - { - if (_sabProvider.AddByUrl(nzb.Link.ToString(), nzb.TitleFix)) - { - var episodeParseResults = GetEpisodeParseList(season.Episodes); - AddToHistory(episodeParseResults, series, nzb, indexer); - } - - } - - else - { - if (_sabProvider.AddById(nzb.Id, nzb.TitleFix)) - { - var episodeParseResults = GetEpisodeParseList(season.Episodes); - AddToHistory(episodeParseResults, series, nzb, indexer); - } - } - } - } - - //Possibly grab the whole season if a certain % of the season is missing, rather than for 1 or 2 episodes - } - - private List<EpisodeParseResult> GetEpisodeParseList(List<Episode> episodes) - { - var episodeParseResults = new List<EpisodeParseResult>(); - episodeParseResults.AddRange( - episodes.Select( - e => - new EpisodeParseResult { EpisodeNumber = e.EpisodeNumber, SeasonNumber = e.SeasonNumber })); - - return episodeParseResults; - } - - private void AddToHistory(List<EpisodeParseResult> episodeParseResults, Series series, NzbInfoModel nzb, Indexer indexer) - { - //We need to loop through the episodeParseResults so each episode in the NZB is properly handled - foreach (var epr in episodeParseResults) - { - var episode = _episodeProvider.GetEpisode(series.SeriesId, epr.SeasonNumber, epr.EpisodeNumber); - - if (episode == null) - { - //Not sure how we got this far, so lets throw an exception - throw new ArgumentOutOfRangeException(); - } - - //Set episode status to grabbed - episode.Status = EpisodeStatusType.Grabbed; - - //Add to History - var history = new History(); - history.Date = DateTime.Now; - history.EpisodeId = episode.EpisodeId; - history.IndexerId = indexer.IndexerId; - history.IsProper = nzb.Proper; - history.Quality = nzb.Quality; - history.NzbTitle = nzb.Title; - - _historyProvider.Insert(history); - } - } - - private bool DownloadNzb(NzbInfoModel nzb) - { - var path = _configProvider.GetValue("BlackholeDirectory", String.Empty, true); - - if (String.IsNullOrEmpty(path)) - { - //Use the NZBDrone root Directory + /NZBs - path = CentralDispatch.StartupPath + "NZBs"; - //path = @"C:\Test\NZBs"; - } - - if (_diskProvider.FolderExists(path)) - { - var filename = path + Path.DirectorySeparatorChar + nzb.TitleFix + ".nzb"; - - if (_httpProvider.DownloadFile(nzb.Link.ToString(), filename)) - return true; - } - - Logger.Error("Blackhole Directory doesn't exist, not saving NZB: '{0}'", path); - return false; - } - } -} diff --git a/NzbDrone.Core/Providers/RssProvider.cs b/NzbDrone.Core/Providers/RssProvider.cs deleted file mode 100644 index 495ccf109..000000000 --- a/NzbDrone.Core/Providers/RssProvider.cs +++ /dev/null @@ -1,34 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Linq; -using System.Text; -using NLog; -using NzbDrone.Core.Model; -using Rss; - -namespace NzbDrone.Core.Providers -{ - public class RssProvider : IRssProvider - { - private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); - - #region IRssProvider Members - public IEnumerable<RssItem> GetFeed(FeedInfoModel feedInfo) - { - RssFeed feed = null; - try - { - Logger.Info("INFO: Downloading feed {0} from {1}", feedInfo.Name, feedInfo.Url); - feed = RssFeed.Read(feedInfo.Url); - } - catch (Exception e) - { - Logger.ErrorException(String.Format("ERROR: Could not download feed {0} from {1}", feedInfo.Name, feedInfo.Url), e); - } - if (feed == null || feed.Channels == null || feed.Channels.Count == 0) - return Enumerable.Empty<RssItem>(); - return feed.Channels[0].Items.Cast<RssItem>(); - } - #endregion - } -} diff --git a/NzbDrone.Core/Providers/RssSyncProvider.cs b/NzbDrone.Core/Providers/RssSyncProvider.cs deleted file mode 100644 index d73e73024..000000000 --- a/NzbDrone.Core/Providers/RssSyncProvider.cs +++ /dev/null @@ -1,172 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Linq; -using System.Text; -using System.Threading; -using NLog; -using NzbDrone.Core.Helpers; -using NzbDrone.Core.Model; -using NzbDrone.Core.Model.Notification; -using NzbDrone.Core.Repository; -using NzbDrone.Core.Repository.Quality; -using Rss; - -namespace NzbDrone.Core.Providers -{ - public class RssSyncProvider : IRssSyncProvider - { - //Sync with RSS feeds to download files as needed - - private Thread _rssSyncThread; - private IIndexerProvider _indexerProvider; - private IRssProvider _rss; - private ISeriesProvider _series; - private ISeasonProvider _season; - private IEpisodeProvider _episode; - private IHistoryProvider _history; - private IDownloadProvider _sab; - private IConfigProvider _configProvider; - private IRssItemProcessingProvider _rssItemProcessor; - private readonly INotificationProvider _notificationProvider; - - private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); - - private ProgressNotification _rssSyncNotification; - - public RssSyncProvider(IIndexerProvider indexerProvider, IRssProvider rss, - ISeriesProvider series, ISeasonProvider season, - IEpisodeProvider episode, IHistoryProvider history, - IDownloadProvider sab, INotificationProvider notificationProvider, - IConfigProvider configProvider, IRssItemProcessingProvider rssItemProcessor) - { - _indexerProvider = indexerProvider; - _rss = rss; - _series = series; - _season = season; - _episode = episode; - _history = history; - _sab = sab; - _notificationProvider = notificationProvider; - _configProvider = configProvider; - _rssItemProcessor = rssItemProcessor; - } - - #region IRssSyncProvider Members - - public void Begin() - { - Logger.Debug("RSS Sync Starting"); - if (_rssSyncThread == null || !_rssSyncThread.IsAlive) - { - Logger.Debug("Initializing background sync of RSS Feeds."); - _rssSyncThread = new Thread(SyncWithRss) - { - Name = "RssSync", - Priority = ThreadPriority.Lowest - }; - - _rssSyncThread.Start(); - } - else - { - Logger.Warn("RSS Sync already in progress. Ignoring request."); - } - - } - - #endregion - - private void SyncWithRss() - { - //Get all enabled RSS providers - //Download Feeds - - var indexers = _indexerProvider.EnabledIndexers(); - - using (_rssSyncNotification = new ProgressNotification("RSS Sync")) - { - _notificationProvider.Register(_rssSyncNotification); - _rssSyncNotification.CurrentStatus = "Starting Scan"; - _rssSyncNotification.ProgressMax = indexers.Count(); - - foreach (var i in indexers) - { - Logger.Info("Starting RSS Sync for: {0}", i.IndexerName); - //Need to insert the users information in the the URL before trying to use it - GetUsersUrl(i); //Get the new users specific url (with their information) to use for the Sync - - //If the url still contains '{' & '}' the user probably hasn't configured the indexer settings - if (i.RssUrl.Contains("{") && i.RssUrl.Contains("}")) - { - Logger.Debug("Unable to Sync {0}. User Information has not been configured.", i.IndexerName); - continue; //Skip this indexer - } - - _rssSyncNotification.CurrentStatus = String.Format("Syncing with RSS Feed: {0}", i.IndexerName); - - var indexer = new FeedInfoModel(i.IndexerName, i.RssUrl); - - var feedItems = _rss.GetFeed(indexer); - - if (feedItems.Count() == 0) - { - _rssSyncNotification.CurrentStatus = String.Format("Failed to download RSS Feed: {0}", // - i.IndexerName); - continue; //No need to process anything else - } - - foreach (RssItem item in feedItems) - { - NzbInfoModel nzb = Parser.ParseNzbInfo(indexer, item); - _rssItemProcessor.DownloadIfWanted(nzb, i); - } - } - _rssSyncNotification.CurrentStatus = "RSS Sync Completed"; - Logger.Info("RSS Sync has successfully completed."); - Thread.Sleep(3000); - _rssSyncNotification.Status = ProgressNotificationStatus.Completed; - } - } - - private void GetUsersUrl(Indexer indexer) - { - if (indexer.IndexerName == "NzbMatrix") - { - var nzbMatrixUsername = _configProvider.GetValue("NzbMatrixUsername", String.Empty, false); - var nzbMatrixApiKey = _configProvider.GetValue("NzbMatrixApiKey", String.Empty, false); - - if (!String.IsNullOrEmpty(nzbMatrixUsername) && !String.IsNullOrEmpty(nzbMatrixApiKey)) - indexer.RssUrl = indexer.RssUrl.Replace("{USERNAME}", nzbMatrixUsername).Replace("{APIKEY}", nzbMatrixApiKey); - - //Todo: Perform validation at the config level so a user is unable to enable a provider until user details are provided - return; - } - - if (indexer.IndexerName == "NzbsOrg") - { - var nzbsOrgUId = _configProvider.GetValue("NzbsOrgUId", String.Empty, false); - var nzbsOrgHash = _configProvider.GetValue("NzbsOrgHash", String.Empty, false); - - if (!String.IsNullOrEmpty(nzbsOrgUId) && !String.IsNullOrEmpty(nzbsOrgHash)) - indexer.RssUrl = indexer.RssUrl.Replace("{UID}", nzbsOrgUId).Replace("{HASH}", nzbsOrgHash); - - //Todo: Perform validation at the config level so a user is unable to enable a provider until user details are provided - return; - } - - if (indexer.IndexerName == "NzbsOrg") - { - var nzbsrusUId = _configProvider.GetValue("NzbsrusUId", String.Empty, false); - var nzbsrusHash = _configProvider.GetValue("NzbsrusHash", String.Empty, false); - - if (!String.IsNullOrEmpty(nzbsrusUId) && !String.IsNullOrEmpty(nzbsrusHash)) - indexer.RssUrl = indexer.RssUrl.Replace("{UID}", nzbsrusUId).Replace("{HASH}", nzbsrusHash); - - //Todo: Perform validation at the config level so a user is unable to enable a provider until user details are provided - return; - } - - return; //Currently other providers do not require user information to be substituted, simply return - } - } -} diff --git a/NzbDrone.Core/Providers/SabProvider.cs b/NzbDrone.Core/Providers/SabProvider.cs index 9d49a76f8..d74b731c3 100644 --- a/NzbDrone.Core/Providers/SabProvider.cs +++ b/NzbDrone.Core/Providers/SabProvider.cs @@ -3,6 +3,7 @@ using System.Linq; using System.Web; using System.Xml.Linq; using NLog; +using NzbDrone.Core.Providers.Core; namespace NzbDrone.Core.Providers { diff --git a/NzbDrone.Core/Providers/SeriesProvider.cs b/NzbDrone.Core/Providers/SeriesProvider.cs index 92bbcd4d2..330bc8706 100644 --- a/NzbDrone.Core/Providers/SeriesProvider.cs +++ b/NzbDrone.Core/Providers/SeriesProvider.cs @@ -4,6 +4,7 @@ using System.IO; using System.Linq; using System.Text.RegularExpressions; using NLog; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; using NzbDrone.Core.Repository.Quality; using SubSonic.Repository; @@ -18,17 +19,15 @@ namespace NzbDrone.Core.Providers //Trims all white spaces and separators from the end of the title. private readonly IConfigProvider _config; - private readonly IDiskProvider _diskProvider; private readonly IRepository _sonioRepo; private readonly ITvDbProvider _tvDb; private readonly IQualityProvider _quality; private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); - public SeriesProvider(IDiskProvider diskProvider, IConfigProvider configProvider, + public SeriesProvider(IConfigProvider configProvider, IRepository dataRepository, ITvDbProvider tvDbProvider, IQualityProvider quality) { - _diskProvider = diskProvider; _config = configProvider; _sonioRepo = dataRepository; _tvDb = tvDbProvider; @@ -76,40 +75,45 @@ namespace NzbDrone.Core.Providers return _tvDb.GetSeries(searchResults.Id, false); } - public TvdbSeries MapPathToSeries(int tvDbId) + public Series UpdateSeriesInfo(int seriesId) { - return _tvDb.GetSeries(tvDbId, false); + var tvDbSeries = _tvDb.GetSeries(seriesId, true); + var series = GetSeries(seriesId); + + series.SeriesId = tvDbSeries.Id; + series.Title = tvDbSeries.SeriesName; + series.AirTimes = tvDbSeries.AirsTime; + series.AirsDayOfWeek = tvDbSeries.AirsDayOfWeek; + series.Overview = tvDbSeries.Overview; + series.Status = tvDbSeries.Status; + series.Language = tvDbSeries.Language != null ? tvDbSeries.Language.Abbriviation : string.Empty; + series.CleanTitle = Parser.NormalizeTitle(tvDbSeries.SeriesName); + series.LastInfoSync = DateTime.Now; + + UpdateSeries(series); + return series; } - public void AddSeries(string path, TvdbSeries series, int qualityProfileId) + public void AddSeries(string path, int tvDbSeriesId, int qualityProfileId) { - Logger.Info("Adding Series [{0}]:{1} Path: {2}", series.Id, series.SeriesName, path); + Logger.Info("Adding Series [{0}] Path: [{1}]", tvDbSeriesId, path); + var repoSeries = new Series(); - repoSeries.SeriesId = series.Id; - repoSeries.Title = series.SeriesName; - repoSeries.AirTimes = series.AirsTime; - repoSeries.AirsDayOfWeek = series.AirsDayOfWeek; - repoSeries.Overview = series.Overview; - repoSeries.Status = series.Status; - repoSeries.Language = series.Language != null ? series.Language.Abbriviation : string.Empty; + repoSeries.SeriesId = tvDbSeriesId; repoSeries.Path = path; - repoSeries.CleanTitle = Parser.NormalizeTitle(series.SeriesName); repoSeries.Monitored = true; //New shows should be monitored repoSeries.QualityProfileId = qualityProfileId; if (qualityProfileId == 0) repoSeries.QualityProfileId = Convert.ToInt32(_config.GetValue("DefaultQualityProfile", "1", true)); - - repoSeries.SeasonFolder = true; - if (!Convert.ToBoolean(_config.GetValue("Sorting_SeasonFolder", true, true))) - repoSeries.SeasonFolder = false; + repoSeries.SeasonFolder = _config.UseSeasonFolder; _sonioRepo.Add(repoSeries); } - public Series FindSeries(string cleanTitle) + public Series FindSeries(string title) { - return _sonioRepo.Single<Series>(s => s.CleanTitle == cleanTitle); + return _sonioRepo.Single<Series>(s => s.CleanTitle == Parser.NormalizeTitle(title)); } public void UpdateSeries(Series series) @@ -119,22 +123,35 @@ namespace NzbDrone.Core.Providers public void DeleteSeries(int seriesId) { - var series = _sonioRepo.Single<Series>(seriesId); + Logger.Warn("Deleting Series [{0}]", seriesId); - //Delete Files, Episdes, Seasons then the Series - //Can't use providers because episode provider needs series provider - Cyclic Dependency Injection, this will work + try + { + var series = _sonioRepo.Single<Series>(seriesId); - Logger.Debug("Deleting EpisodeFiles from DB for Series: {0}", series.SeriesId); - _sonioRepo.DeleteMany(series.EpisodeFiles); + //Delete Files, Episdes, Seasons then the Series + //Can't use providers because episode provider needs series provider - Cyclic Dependency Injection, this will work - Logger.Debug("Deleting Episodes from DB for Series: {0}", series.SeriesId); - _sonioRepo.DeleteMany(series.Episodes); + Logger.Debug("Deleting EpisodeFiles from DB for Series: {0}", series.SeriesId); + _sonioRepo.DeleteMany(series.EpisodeFiles); - Logger.Debug("Deleting Seasons from DB for Series: {0}", series.SeriesId); - _sonioRepo.DeleteMany(series.Seasons); + Logger.Debug("Deleting Episodes from DB for Series: {0}", series.SeriesId); + _sonioRepo.DeleteMany(series.Episodes); - Logger.Debug("Deleting Series from DB {0}", series.Title); - _sonioRepo.Delete<Series>(seriesId); + Logger.Debug("Deleting Seasons from DB for Series: {0}", series.SeriesId); + _sonioRepo.DeleteMany(series.Seasons); + + Logger.Debug("Deleting Series from DB {0}", series.Title); + _sonioRepo.Delete<Series>(seriesId); + + Logger.Info("Successfully deleted Series [{0}]", seriesId); + + } + catch (Exception e) + { + Logger.Error("An error has occurred while deleting series.", e); + throw; + } } public bool SeriesPathExists(string cleanPath) @@ -147,10 +164,5 @@ namespace NzbDrone.Core.Providers #endregion - #region Static Helpers - - - - #endregion } } \ No newline at end of file diff --git a/NzbDrone.Core/Providers/SyncProvider.cs b/NzbDrone.Core/Providers/SyncProvider.cs index b0bb106c5..fa8bf8a18 100644 --- a/NzbDrone.Core/Providers/SyncProvider.cs +++ b/NzbDrone.Core/Providers/SyncProvider.cs @@ -7,6 +7,7 @@ using System.Threading; using NLog; using NzbDrone.Core.Model; using NzbDrone.Core.Model.Notification; +using NzbDrone.Core.Providers.Core; namespace NzbDrone.Core.Providers { @@ -20,7 +21,6 @@ namespace NzbDrone.Core.Providers private ProgressNotification _seriesSyncNotification; private Thread _seriesSyncThread; - private List<SeriesMappingModel> _syncList; private static readonly Logger Logger = LogManager.GetCurrentClassLogger(); @@ -46,6 +46,7 @@ namespace NzbDrone.Core.Providers if (!_diskProvider.FolderExists(path)) { Logger.Debug("Path supplied does not exist: {0}", path); + return null; } var results = new List<String>(); @@ -63,55 +64,18 @@ namespace NzbDrone.Core.Providers #endregion - public bool BeginSyncUnmappedFolders(List<SeriesMappingModel> unmapped) + public bool BeginUpdateNewSeries() { - Logger.Debug("User has requested series folder scan"); + Logger.Debug("User has requested a scan of new series"); if (_seriesSyncThread == null || !_seriesSyncThread.IsAlive) { - Logger.Debug("Initializing background scan of series folder."); - _seriesSyncThread = new Thread(SyncUnmappedFolders) + Logger.Debug("Initializing background scan thread"); + _seriesSyncThread = new Thread(SyncNewSeries) { - Name = "SyncUnmappedFolders", + Name = "SyncNewSeries", Priority = ThreadPriority.Lowest }; - _syncList = unmapped; - _seriesSyncThread.Start(); - } - else - { - Logger.Warn("Series folder scan already in progress. Ignoring request."); - - //return false if sync was already running, then we can tell the user to try again later - return false; - } - - //return true if sync has started - return true; - } - - public bool BeginAddNewSeries(string dir, int seriesId, string seriesName, int qualityProfileId) - { - Logger.Debug("User has requested adding of new series"); - if (_seriesSyncThread == null || !_seriesSyncThread.IsAlive) - { - Logger.Debug("Initializing background add of of series folder."); - _seriesSyncThread = new Thread(SyncUnmappedFolders) - { - Name = "SyncUnmappedFolders", - Priority = ThreadPriority.Lowest - }; - - _syncList = new List<SeriesMappingModel>(); - - var path = dir + Path.DirectorySeparatorChar + seriesName; - - //Create a directory for this new series - _diskProvider.CreateDirectory(path); - - //Add it to the list so it will be processed - _syncList.Add(new SeriesMappingModel { Path = path, TvDbId = seriesId, QualityProfileId = qualityProfileId }); - _seriesSyncThread.Start(); } else @@ -126,92 +90,19 @@ namespace NzbDrone.Core.Providers return true; } - public bool BeginAddExistingSeries(string path, int seriesId, int qualityProfileId) + + private void SyncNewSeries() { - Logger.Debug("User has requested adding of new series"); - if (_seriesSyncThread == null || !_seriesSyncThread.IsAlive) - { - Logger.Debug("Initializing background add of of series folder."); - _seriesSyncThread = new Thread(SyncUnmappedFolders) - { - Name = "SyncUnmappedFolders", - Priority = ThreadPriority.Lowest - }; - - _syncList = new List<SeriesMappingModel>(); - - //Add it to the list so it will be processed - _syncList.Add(new SeriesMappingModel { Path = path, TvDbId = seriesId, QualityProfileId = qualityProfileId }); - - _seriesSyncThread.Start(); - } - else - { - Logger.Warn("Series folder scan already in progress. Ignoring request."); - - //return false if sync was already running, then we can tell the user to try again later - return false; - } - - //return true if sync has started - return true; - } - - private void SyncUnmappedFolders() - { - Logger.Info("Starting Series folder scan"); + Logger.Info("Syncing new series"); try { using (_seriesSyncNotification = new ProgressNotification("Series Scan")) { _notificationProvider.Register(_seriesSyncNotification); - _seriesSyncNotification.CurrentStatus = "Analysing Folder"; - _seriesSyncNotification.ProgressMax = _syncList.Count; - foreach (var seriesFolder in _syncList) - { - try - { - _seriesSyncNotification.CurrentStatus = String.Format("Searching For: {0}", new DirectoryInfo(seriesFolder.Path).Name); - - if (_seriesProvider.SeriesPathExists(Parser.NormalizePath(seriesFolder.Path))) - { - Logger.Debug("Folder '{0}' is mapped in the database. Skipping.'", seriesFolder); - continue; - } - - Logger.Debug("Folder '{0}' isn't mapped in the database. Trying to map it.'", seriesFolder); - var mappedSeries = _seriesProvider.MapPathToSeries(seriesFolder.TvDbId); - - if (mappedSeries == null) - { - Logger.Warn("Invalid TVDB ID '{0}' Unable to map: '{1}'", seriesFolder.TvDbId, seriesFolder.Path); - } - else - { - //Check if series is mapped to another folder - if (_seriesProvider.GetSeries(mappedSeries.Id) == null) - { - _seriesSyncNotification.CurrentStatus = String.Format("{0}: downloading series info...", mappedSeries.SeriesName); - _seriesProvider.AddSeries(seriesFolder.Path, mappedSeries, seriesFolder.QualityProfileId); - _episodeProvider.RefreshEpisodeInfo(mappedSeries.Id); - _seriesSyncNotification.CurrentStatus = String.Format("{0}: finding episodes on disk...", mappedSeries.SeriesName); - _mediaFileProvider.Scan(_seriesProvider.GetSeries(mappedSeries.Id)); - //Todo: Launch Backlog search for this series _backlogProvider.StartSearch(mappedSeries.Id); - } - else - { - Logger.Warn("Folder '{0}' mapped to '{1}' which is already another folder assigned to it.'", seriesFolder, mappedSeries.SeriesName); - } - } - } - catch (Exception e) - { - Logger.ErrorException(e.Message, e); - } - _seriesSyncNotification.ProgressValue++; - } + _seriesSyncNotification.CurrentStatus = "Finding New Series"; + ScanSeries(); _seriesSyncNotification.CurrentStatus = "Series Scan Completed"; Logger.Info("Series folders scan has successfully completed."); @@ -224,5 +115,41 @@ namespace NzbDrone.Core.Providers Logger.ErrorException(e.Message, e); } } + + private void ScanSeries() + { + + + var syncList = _seriesProvider.GetAllSeries().Where(s => s.LastInfoSync == null).ToList(); + if (syncList.Count == 0) return; + + _seriesSyncNotification.ProgressMax = syncList.Count; + + foreach (var currentSeries in syncList) + { + try + { + _seriesSyncNotification.CurrentStatus = String.Format("Searching For: {0}", new DirectoryInfo(currentSeries.Path).Name); + var updatedSeries = _seriesProvider.UpdateSeriesInfo(currentSeries.SeriesId); + + _seriesSyncNotification.CurrentStatus = String.Format("Downloading episode info For: {0}", updatedSeries.Title); + _episodeProvider.RefreshEpisodeInfo(updatedSeries.SeriesId); + + _seriesSyncNotification.CurrentStatus = String.Format("Scanning series folder {0}", updatedSeries.Path); + _mediaFileProvider.Scan(_seriesProvider.GetSeries(updatedSeries.SeriesId)); + + //Todo: Launch Backlog search for this series _backlogProvider.StartSearch(mappedSeries.Id); + } + + catch (Exception e) + { + Logger.ErrorException(e.Message, e); + } + _seriesSyncNotification.ProgressValue++; + } + + //Keep scanning until there no more shows left. + ScanSeries(); + } } } diff --git a/NzbDrone.Core/Providers/XbmcProvider.cs b/NzbDrone.Core/Providers/XbmcProvider.cs index 9f7bac7f0..688e4933d 100644 --- a/NzbDrone.Core/Providers/XbmcProvider.cs +++ b/NzbDrone.Core/Providers/XbmcProvider.cs @@ -6,6 +6,7 @@ using System.Text; using System.Xml.Linq; using NLog; using NzbDrone.Core.Helpers; +using NzbDrone.Core.Providers.Core; namespace NzbDrone.Core.Providers { diff --git a/NzbDrone.Core/Repository/Episode.cs b/NzbDrone.Core/Repository/Episode.cs index 5748cbf96..f7197bc02 100644 --- a/NzbDrone.Core/Repository/Episode.cs +++ b/NzbDrone.Core/Repository/Episode.cs @@ -21,6 +21,10 @@ namespace NzbDrone.Core.Repository public string Language { get; set; } public EpisodeStatusType Status { get; set; } + public DayOfWeek? LastInfoSync { get; set; } + + public DayOfWeek? LastDiskSync { get; set; } + [SubSonicToOneRelation(ThisClassContainsJoinKey = true)] public virtual Season Season { get; set; } diff --git a/NzbDrone.Core/Repository/Season.cs b/NzbDrone.Core/Repository/Season.cs index 26d952710..d8fadd580 100644 --- a/NzbDrone.Core/Repository/Season.cs +++ b/NzbDrone.Core/Repository/Season.cs @@ -11,6 +11,10 @@ namespace NzbDrone.Core.Repository public virtual int SeriesId { get; set; } public virtual int SeasonNumber { get; set; } public bool Monitored { get; set; } + + public DayOfWeek? LastInfoSync { get; set; } + + public DayOfWeek? LastDiskSync { get; set; } [SubSonicToManyRelation] public virtual List<Episode> Episodes { get; private set; } diff --git a/NzbDrone.Core/Repository/Series.cs b/NzbDrone.Core/Repository/Series.cs index adbd7b214..011de2d11 100644 --- a/NzbDrone.Core/Repository/Series.cs +++ b/NzbDrone.Core/Repository/Series.cs @@ -11,21 +11,25 @@ namespace NzbDrone.Core.Repository [SubSonicPrimaryKey(false)] public virtual int SeriesId { get; set; } + [SubSonicNullString] public string Title { get; set; } + [SubSonicNullString] public string CleanTitle { get; set; } [SubSonicNullString] public string Status { get; set; } - [SubSonicLongString] + [SubSonicNullString] public string Overview { get; set; } [DisplayName("Air on")] public DayOfWeek? AirsDayOfWeek { get; set; } + [SubSonicNullString] public String AirTimes { get; set; } + [SubSonicNullString] public string Language { get; set; } public string Path { get; set; } @@ -36,6 +40,10 @@ namespace NzbDrone.Core.Repository public bool SeasonFolder { get; set; } + public DateTime? LastInfoSync { get; set; } + + public DateTime? LastDiskSync { get; set; } + [SubSonicToOneRelation(ThisClassContainsJoinKey = true, JoinKeyName = "QualityProfileId")] public virtual QualityProfile QualityProfile { get; private set; } diff --git a/NzbDrone.Web.Test/App.config b/NzbDrone.Web.Test/App.config deleted file mode 100644 index 64ee57c34..000000000 --- a/NzbDrone.Web.Test/App.config +++ /dev/null @@ -1,24 +0,0 @@ -<?xml version="1.0" encoding="utf-8"?> -<!-- - Note: Add entries to the App.config file for configuration settings - that apply only to the Test project. ---> -<configuration> - <appSettings> - <add key="ClientSettingsProvider.ServiceUri" value="" /> - </appSettings> - <connectionStrings> - </connectionStrings> - <system.web> - <membership defaultProvider="ClientAuthenticationMembershipProvider"> - <providers> - <add name="ClientAuthenticationMembershipProvider" type="System.Web.ClientServices.Providers.ClientFormsAuthenticationMembershipProvider, System.Web.Extensions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" serviceUri="" /> - </providers> - </membership> - <roleManager defaultProvider="ClientRoleProvider" enabled="true"> - <providers> - <add name="ClientRoleProvider" type="System.Web.ClientServices.Providers.ClientRoleProvider, System.Web.Extensions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" serviceUri="" cacheTimeout="86400" /> - </providers> - </roleManager> - </system.web> -</configuration> \ No newline at end of file diff --git a/NzbDrone.Web.Test/Controllers/AccountControllerTest.cs b/NzbDrone.Web.Test/Controllers/AccountControllerTest.cs deleted file mode 100644 index bf7e24da3..000000000 --- a/NzbDrone.Web.Test/Controllers/AccountControllerTest.cs +++ /dev/null @@ -1,402 +0,0 @@ -using System; -using System.Security.Principal; -using System.Web; -using System.Web.Mvc; -using System.Web.Routing; -using System.Web.Security; -using Microsoft.VisualStudio.TestTools.UnitTesting; -using NzbDrone.Web; -using NzbDrone.Web.Controllers; -using NzbDrone.Web.Models; - -namespace NzbDrone.Web.Tests.Controllers -{ - - [TestClass] - public class AccountControllerTest - { - - [TestMethod] - public void ChangePassword_Get_ReturnsView() - { - // Arrange - AccountController controller = GetAccountController(); - - // Act - ActionResult result = controller.ChangePassword(); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - Assert.AreEqual(10, ((ViewResult)result).ViewData["PasswordLength"]); - } - - [TestMethod] - public void ChangePassword_Post_ReturnsRedirectOnSuccess() - { - // Arrange - AccountController controller = GetAccountController(); - ChangePasswordModel model = new ChangePasswordModel() - { - OldPassword = "goodOldPassword", - NewPassword = "goodNewPassword", - ConfirmPassword = "goodNewPassword" - }; - - // Act - ActionResult result = controller.ChangePassword(model); - - // Assert - Assert.IsInstanceOfType(result, typeof(RedirectToRouteResult)); - RedirectToRouteResult redirectResult = (RedirectToRouteResult)result; - Assert.AreEqual("ChangePasswordSuccess", redirectResult.RouteValues["action"]); - } - - [TestMethod] - public void ChangePassword_Post_ReturnsViewIfChangePasswordFails() - { - // Arrange - AccountController controller = GetAccountController(); - ChangePasswordModel model = new ChangePasswordModel() - { - OldPassword = "goodOldPassword", - NewPassword = "badNewPassword", - ConfirmPassword = "badNewPassword" - }; - - // Act - ActionResult result = controller.ChangePassword(model); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - ViewResult viewResult = (ViewResult)result; - Assert.AreEqual(model, viewResult.ViewData.Model); - Assert.AreEqual("The current password is incorrect or the new password is invalid.", controller.ModelState[""].Errors[0].ErrorMessage); - Assert.AreEqual(10, viewResult.ViewData["PasswordLength"]); - } - - [TestMethod] - public void ChangePassword_Post_ReturnsViewIfModelStateIsInvalid() - { - // Arrange - AccountController controller = GetAccountController(); - ChangePasswordModel model = new ChangePasswordModel() - { - OldPassword = "goodOldPassword", - NewPassword = "goodNewPassword", - ConfirmPassword = "goodNewPassword" - }; - controller.ModelState.AddModelError("", "Dummy error message."); - - // Act - ActionResult result = controller.ChangePassword(model); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - ViewResult viewResult = (ViewResult)result; - Assert.AreEqual(model, viewResult.ViewData.Model); - Assert.AreEqual(10, viewResult.ViewData["PasswordLength"]); - } - - [TestMethod] - public void ChangePasswordSuccess_ReturnsView() - { - // Arrange - AccountController controller = GetAccountController(); - - // Act - ActionResult result = controller.ChangePasswordSuccess(); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - } - - [TestMethod] - public void LogOff_LogsOutAndRedirects() - { - // Arrange - AccountController controller = GetAccountController(); - - // Act - ActionResult result = controller.LogOff(); - - // Assert - Assert.IsInstanceOfType(result, typeof(RedirectToRouteResult)); - RedirectToRouteResult redirectResult = (RedirectToRouteResult)result; - Assert.AreEqual("Home", redirectResult.RouteValues["controller"]); - Assert.AreEqual("Index", redirectResult.RouteValues["action"]); - Assert.IsTrue(((MockFormsAuthenticationService)controller.FormsService).SignOut_WasCalled); - } - - [TestMethod] - public void LogOn_Get_ReturnsView() - { - // Arrange - AccountController controller = GetAccountController(); - - // Act - ActionResult result = controller.LogOn(); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - } - - [TestMethod] - public void LogOn_Post_ReturnsRedirectOnSuccess_WithoutReturnUrl() - { - // Arrange - AccountController controller = GetAccountController(); - LogOnModel model = new LogOnModel() - { - UserName = "someUser", - Password = "goodPassword", - RememberMe = false - }; - - // Act - ActionResult result = controller.LogOn(model, null); - - // Assert - Assert.IsInstanceOfType(result, typeof(RedirectToRouteResult)); - RedirectToRouteResult redirectResult = (RedirectToRouteResult)result; - Assert.AreEqual("Home", redirectResult.RouteValues["controller"]); - Assert.AreEqual("Index", redirectResult.RouteValues["action"]); - Assert.IsTrue(((MockFormsAuthenticationService)controller.FormsService).SignIn_WasCalled); - } - - [TestMethod] - public void LogOn_Post_ReturnsRedirectOnSuccess_WithReturnUrl() - { - // Arrange - AccountController controller = GetAccountController(); - LogOnModel model = new LogOnModel() - { - UserName = "someUser", - Password = "goodPassword", - RememberMe = false - }; - - // Act - ActionResult result = controller.LogOn(model, "/someUrl"); - - // Assert - Assert.IsInstanceOfType(result, typeof(RedirectResult)); - RedirectResult redirectResult = (RedirectResult)result; - Assert.AreEqual("/someUrl", redirectResult.Url); - Assert.IsTrue(((MockFormsAuthenticationService)controller.FormsService).SignIn_WasCalled); - } - - [TestMethod] - public void LogOn_Post_ReturnsViewIfModelStateIsInvalid() - { - // Arrange - AccountController controller = GetAccountController(); - LogOnModel model = new LogOnModel() - { - UserName = "someUser", - Password = "goodPassword", - RememberMe = false - }; - controller.ModelState.AddModelError("", "Dummy error message."); - - // Act - ActionResult result = controller.LogOn(model, null); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - ViewResult viewResult = (ViewResult)result; - Assert.AreEqual(model, viewResult.ViewData.Model); - } - - [TestMethod] - public void LogOn_Post_ReturnsViewIfValidateUserFails() - { - // Arrange - AccountController controller = GetAccountController(); - LogOnModel model = new LogOnModel() - { - UserName = "someUser", - Password = "badPassword", - RememberMe = false - }; - - // Act - ActionResult result = controller.LogOn(model, null); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - ViewResult viewResult = (ViewResult)result; - Assert.AreEqual(model, viewResult.ViewData.Model); - Assert.AreEqual("The user name or password provided is incorrect.", controller.ModelState[""].Errors[0].ErrorMessage); - } - - [TestMethod] - public void Register_Get_ReturnsView() - { - // Arrange - AccountController controller = GetAccountController(); - - // Act - ActionResult result = controller.Register(); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - Assert.AreEqual(10, ((ViewResult)result).ViewData["PasswordLength"]); - } - - [TestMethod] - public void Register_Post_ReturnsRedirectOnSuccess() - { - // Arrange - AccountController controller = GetAccountController(); - RegisterModel model = new RegisterModel() - { - UserName = "someUser", - Email = "goodEmail", - Password = "goodPassword", - ConfirmPassword = "goodPassword" - }; - - // Act - ActionResult result = controller.Register(model); - - // Assert - Assert.IsInstanceOfType(result, typeof(RedirectToRouteResult)); - RedirectToRouteResult redirectResult = (RedirectToRouteResult)result; - Assert.AreEqual("Home", redirectResult.RouteValues["controller"]); - Assert.AreEqual("Index", redirectResult.RouteValues["action"]); - } - - [TestMethod] - public void Register_Post_ReturnsViewIfRegistrationFails() - { - // Arrange - AccountController controller = GetAccountController(); - RegisterModel model = new RegisterModel() - { - UserName = "duplicateUser", - Email = "goodEmail", - Password = "goodPassword", - ConfirmPassword = "goodPassword" - }; - - // Act - ActionResult result = controller.Register(model); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - ViewResult viewResult = (ViewResult)result; - Assert.AreEqual(model, viewResult.ViewData.Model); - Assert.AreEqual("Username already exists. Please enter a different user name.", controller.ModelState[""].Errors[0].ErrorMessage); - Assert.AreEqual(10, viewResult.ViewData["PasswordLength"]); - } - - [TestMethod] - public void Register_Post_ReturnsViewIfModelStateIsInvalid() - { - // Arrange - AccountController controller = GetAccountController(); - RegisterModel model = new RegisterModel() - { - UserName = "someUser", - Email = "goodEmail", - Password = "goodPassword", - ConfirmPassword = "goodPassword" - }; - controller.ModelState.AddModelError("", "Dummy error message."); - - // Act - ActionResult result = controller.Register(model); - - // Assert - Assert.IsInstanceOfType(result, typeof(ViewResult)); - ViewResult viewResult = (ViewResult)result; - Assert.AreEqual(model, viewResult.ViewData.Model); - Assert.AreEqual(10, viewResult.ViewData["PasswordLength"]); - } - - private static AccountController GetAccountController() - { - AccountController controller = new AccountController() - { - FormsService = new MockFormsAuthenticationService(), - MembershipService = new MockMembershipService() - }; - controller.ControllerContext = new ControllerContext() - { - Controller = controller, - RequestContext = new RequestContext(new MockHttpContext(), new RouteData()) - }; - return controller; - } - - private class MockFormsAuthenticationService : IFormsAuthenticationService - { - public bool SignIn_WasCalled; - public bool SignOut_WasCalled; - - public void SignIn(string userName, bool createPersistentCookie) - { - // verify that the arguments are what we expected - Assert.AreEqual("someUser", userName); - Assert.IsFalse(createPersistentCookie); - - SignIn_WasCalled = true; - } - - public void SignOut() - { - SignOut_WasCalled = true; - } - } - - private class MockHttpContext : HttpContextBase - { - private readonly IPrincipal _user = new GenericPrincipal(new GenericIdentity("someUser"), null /* roles */); - - public override IPrincipal User - { - get - { - return _user; - } - set - { - base.User = value; - } - } - } - - private class MockMembershipService : IMembershipService - { - public int MinPasswordLength - { - get { return 10; } - } - - public bool ValidateUser(string userName, string password) - { - return (userName == "someUser" && password == "goodPassword"); - } - - public MembershipCreateStatus CreateUser(string userName, string password, string email) - { - if (userName == "duplicateUser") - { - return MembershipCreateStatus.DuplicateUserName; - } - - // verify that values are what we expected - Assert.AreEqual("goodPassword", password); - Assert.AreEqual("goodEmail", email); - - return MembershipCreateStatus.Success; - } - - public bool ChangePassword(string userName, string oldPassword, string newPassword) - { - return (userName == "someUser" && oldPassword == "goodOldPassword" && newPassword == "goodNewPassword"); - } - } - - } -} diff --git a/NzbDrone.Web.Test/Controllers/HomeControllerTest.cs b/NzbDrone.Web.Test/Controllers/HomeControllerTest.cs deleted file mode 100644 index 5c7cf67e4..000000000 --- a/NzbDrone.Web.Test/Controllers/HomeControllerTest.cs +++ /dev/null @@ -1,42 +0,0 @@ -using System; -using System.Collections.Generic; -using System.Linq; -using System.Text; -using System.Web.Mvc; -using Microsoft.VisualStudio.TestTools.UnitTesting; -using NzbDrone.Web; -using NzbDrone.Web.Controllers; - -namespace NzbDrone.Web.Tests.Controllers -{ - [TestClass] - public class HomeControllerTest - { - [TestMethod] - public void Index() - { - // Arrange - HomeController controller = new HomeController(); - - // Act - ViewResult result = controller.Index() as ViewResult; - - // Assert - ViewDataDictionary viewData = result.ViewData; - Assert.AreEqual("Welcome to ASP.NET MVC!", viewData["Message"]); - } - - [TestMethod] - public void About() - { - // Arrange - HomeController controller = new HomeController(); - - // Act - ViewResult result = controller.About() as ViewResult; - - // Assert - Assert.IsNotNull(result); - } - } -} diff --git a/NzbDrone.Web.Test/NzbDrone.Web.Tests.csproj b/NzbDrone.Web.Test/NzbDrone.Web.Tests.csproj deleted file mode 100644 index 4315eadbe..000000000 --- a/NzbDrone.Web.Test/NzbDrone.Web.Tests.csproj +++ /dev/null @@ -1,79 +0,0 @@ -<?xml version="1.0" encoding="utf-8"?> -<Project ToolsVersion="4.0" DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003"> - <PropertyGroup> - <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> - <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform> - <ProductVersion> - </ProductVersion> - <SchemaVersion>2.0</SchemaVersion> - <ProjectGuid>{99CDD5DC-698F-4624-B431-2D6381CE3A15}</ProjectGuid> - <OutputType>Library</OutputType> - <AppDesignerFolder>Properties</AppDesignerFolder> - <RootNamespace>NzbDrone.Web.Tests</RootNamespace> - <AssemblyName>NzbDrone.Web.Tests</AssemblyName> - <TargetFrameworkVersion>v4.0</TargetFrameworkVersion> - <FileAlignment>512</FileAlignment> - <ProjectTypeGuids>{3AC096D0-A1C2-E12C-1390-A8335801FDAB};{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}</ProjectTypeGuids> - </PropertyGroup> - <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> - <DebugSymbols>true</DebugSymbols> - <DebugType>full</DebugType> - <Optimize>false</Optimize> - <OutputPath>bin\Debug\</OutputPath> - <DefineConstants>DEBUG;TRACE</DefineConstants> - <ErrorReport>prompt</ErrorReport> - <WarningLevel>4</WarningLevel> - <PlatformTarget>x86</PlatformTarget> - </PropertyGroup> - <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' "> - <DebugType>pdbonly</DebugType> - <Optimize>true</Optimize> - <OutputPath>bin\Release\</OutputPath> - <DefineConstants>TRACE</DefineConstants> - <ErrorReport>prompt</ErrorReport> - <WarningLevel>4</WarningLevel> - </PropertyGroup> - <ItemGroup> - <Reference Include="Microsoft.VisualStudio.QualityTools.UnitTestFramework, Version=10.0.0.0, Culture=neutral, PublicKeyToken=b03f5f7f11d50a3a, processorArchitecture=MSIL" /> - <Reference Include="System" /> - <Reference Include="System.ComponentModel.DataAnnotations"> - <RequiredTargetFramework>3.5</RequiredTargetFramework> - </Reference> - <Reference Include="System.Configuration" /> - <Reference Include="System.Core"> - <RequiredTargetFramework>3.5</RequiredTargetFramework> - </Reference> - <Reference Include="System.Data" /> - <Reference Include="System.Web" /> - <Reference Include="System.Web.ApplicationServices" /> - <Reference Include="System.Web.Extensions"> - <RequiredTargetFramework>3.5</RequiredTargetFramework> - </Reference> - <Reference Include="System.Web.Abstractions" /> - <Reference Include="System.Web.Mvc, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> - <Reference Include="System.Web.Routing" /> - <Reference Include="System.Xml" /> - </ItemGroup> - <ItemGroup> - <Compile Include="Properties\AssemblyInfo.cs" /> - <Compile Include="Controllers\HomeControllerTest.cs" /> - <Compile Include="Controllers\AccountControllerTest.cs" /> - </ItemGroup> - <ItemGroup> - <Content Include="App.config" /> - </ItemGroup> - <ItemGroup> - <ProjectReference Include="..\NzbDrone.Web\NzbDrone.Web.csproj"> - <Project>{43BD3BBD-1531-4D8F-9C08-E1CD544AB2CD}</Project> - <Name>NzbDrone.Web</Name> - </ProjectReference> - </ItemGroup> - <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> - <!-- To modify your build process, add your task inside one of the targets below and uncomment it. - Other similar extension points exist, see Microsoft.Common.targets. - <Target Name="BeforeBuild"> - </Target> - <Target Name="AfterBuild"> - </Target> - --> -</Project> \ No newline at end of file diff --git a/NzbDrone.Web.Test/Properties/AssemblyInfo.cs b/NzbDrone.Web.Test/Properties/AssemblyInfo.cs deleted file mode 100644 index d66b2f586..000000000 --- a/NzbDrone.Web.Test/Properties/AssemblyInfo.cs +++ /dev/null @@ -1,35 +0,0 @@ -using System.Reflection; -using System.Runtime.CompilerServices; -using System.Runtime.InteropServices; - -// General Information about an assembly is controlled through the following -// set of attributes. Change these attribute values to modify the information -// associated with an assembly. -[assembly: AssemblyTitle("NzbDrone.Web.Tests")] -[assembly: AssemblyDescription("")] -[assembly: AssemblyConfiguration("")] -[assembly: AssemblyCompany("Microsoft")] -[assembly: AssemblyProduct("NzbDrone.Web.Tests")] -[assembly: AssemblyCopyright("Copyright © Microsoft 2010")] -[assembly: AssemblyTrademark("")] -[assembly: AssemblyCulture("")] - -// Setting ComVisible to false makes the types in this assembly not visible -// to COM components. If you need to access a type in this assembly from -// COM, set the ComVisible attribute to true on that type. -[assembly: ComVisible(false)] - -// The following GUID is for the ID of the typelib if this project is exposed to COM -[assembly: Guid("c9fcd1a2-85d4-4224-863f-83afe37490d0")] - -// Version information for an assembly consists of the following four values: -// -// Major Version -// Minor Version -// Build Number -// Revision -// -// You can specify all the values or you can default the Revision and Build Numbers -// by using the '*' as shown below: -[assembly: AssemblyVersion("1.0.0.0")] -[assembly: AssemblyFileVersion("1.0.0.0")] diff --git a/NzbDrone.Web/Content/style.css b/NzbDrone.Web/Content/style.css index 762d498b9..1e0e80e92 100644 --- a/NzbDrone.Web/Content/style.css +++ b/NzbDrone.Web/Content/style.css @@ -8,12 +8,19 @@ body { padding: 0; background: #191919 url(images/img07.jpg) no-repeat right top; - font-family: "Segoe UI" , Tahoma, Geneva, sans-serif; + font-family: "Segoe UI" , "Segoe UI Light" , Tahoma, Geneva, sans-serif; font-size: 13px; color: #3C3C3C; background-attachment: fixed; } +fieldset +{ + border-style: solid; + border-color: #065EFE; + border-width: 1px; +} + h1 { font-size: 52px; @@ -138,7 +145,8 @@ hr #logo { - font-family: Segoe UI Light, Tahoma, Geneva, sans-serif; + font-family: "Segoe UI Light" , "Segoe UI" , Tahoma, Geneva, sans-serif; + font-weight: 100; height: 135px; background: url(images/img03.jpg) no-repeat left top; font-size: 90px; @@ -161,6 +169,11 @@ hr border-color: #EEEEEE; } +.t-combobox, .t-dropdown +{ + vertical-align: middle; +} + /* Footer */ .timer { @@ -214,19 +227,9 @@ hr margin-bottom: 10px; } -input[type="text"] -{ - border: 1px solid #006; - background: #CBE8FF; -} -input[type="text"]:hover -{ - border: 1px solid #065EFE; - background: #C0D6FF; -} -input[type="button"], input[type="submit"], input[type="reset"], input[type="file"]::-webkit-file-upload-button, button +button, input[type="button"], input[type="submit"], input[type="reset"] { color: white; background-color: #065EFE; @@ -236,6 +239,13 @@ input[type="button"], input[type="submit"], input[type="reset"], input[type="fil margin: 10px; } +.listButton +{ + padding: 2px 10px 2px 10px; + vertical-align: middle; + margin: 0px; +} + #save_button { } diff --git a/NzbDrone.Web/Controllers/AddSeriesController.cs b/NzbDrone.Web/Controllers/AddSeriesController.cs new file mode 100644 index 000000000..0f4a4a6c1 --- /dev/null +++ b/NzbDrone.Web/Controllers/AddSeriesController.cs @@ -0,0 +1,125 @@ +using System; +using System.Collections.Generic; +using System.IO; +using System.Linq; +using System.Web; +using System.Web.Mvc; +using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; +using NzbDrone.Web.Models; + +namespace NzbDrone.Web.Controllers +{ + public class AddSeriesController : Controller + { + public IConfigProvider ConfigProvider { get; set; } + private readonly ISyncProvider _syncProvider; + private readonly IRootDirProvider _rootFolderProvider; + private readonly IConfigProvider _configProvider; + private readonly IQualityProvider _qualityProvider; + private readonly ITvDbProvider _tvDbProvider; + private readonly ISeriesProvider _seriesProvider; + + public AddSeriesController(ISyncProvider syncProvider, IRootDirProvider rootFolderProvider, IConfigProvider configProvider, + IQualityProvider qualityProvider, ITvDbProvider tvDbProvider, ISeriesProvider seriesProvider) + { + ConfigProvider = configProvider; + _syncProvider = syncProvider; + _rootFolderProvider = rootFolderProvider; + _configProvider = configProvider; + _qualityProvider = qualityProvider; + _tvDbProvider = tvDbProvider; + _seriesProvider = seriesProvider; + } + + [HttpPost] + public JsonResult ScanNewSeries() + { + _syncProvider.BeginUpdateNewSeries(); + return new JsonResult(); + } + + public ActionResult AddNew() + { + ViewData["RootDirs"] = _rootFolderProvider.GetAll(); + ViewData["DirSep"] = Path.DirectorySeparatorChar; + + var profiles = _qualityProvider.GetAllProfiles(); + var selectList = new SelectList(profiles, "QualityProfileId", "Name"); + var defaultQuality = Convert.ToInt32(_configProvider.DefaultQualityProfile); + + var model = new AddNewSeriesModel + { + DirectorySeparatorChar = Path.DirectorySeparatorChar.ToString(), + RootDirectories = _rootFolderProvider.GetAll(), + QualityProfileId = defaultQuality, + QualitySelectList = selectList + }; + + return View(model); + } + + public ActionResult AddExisting() + { + var unmappedList = new List<String>(); + + foreach (var folder in _rootFolderProvider.GetAll()) + { + unmappedList.AddRange(_syncProvider.GetUnmappedFolders(folder.Path)); + } + + return View(unmappedList); + } + + public ActionResult RenderPartial(string path) + { + + var suggestions = GetSuggestionList(new DirectoryInfo(path).Name); + + ViewData["guid"] = Guid.NewGuid(); + ViewData["path"] = path; + ViewData["javaPath"] = path.Replace(Path.DirectorySeparatorChar, '|').Replace(Path.VolumeSeparatorChar, '^'); + + var qualityProfiles = _qualityProvider.GetAllProfiles(); + ViewData["quality"] = new SelectList( + qualityProfiles, + "QualityProfileId", + "Name", + "HD"); + + return PartialView("AddSeriesItem", suggestions); + + } + + public JsonResult AddSeries(string path, int seriesId, int qualityProfileId) + { + //Get TVDB Series Name + //Create new folder for series + //Add the new series to the Database + + _seriesProvider.AddSeries(path.Replace('|', Path.DirectorySeparatorChar).Replace('^', Path.VolumeSeparatorChar), seriesId, qualityProfileId); + ScanNewSeries(); + return new JsonResult() { Data = "ok" }; + } + + [HttpPost] + public ActionResult _textLookUp(string text, int? filterMode) + { + var suggestions = GetSuggestionList(text); + + return new JsonResult + { + JsonRequestBehavior = JsonRequestBehavior.AllowGet, + Data = suggestions + }; + } + + public SelectList GetSuggestionList(string searchString) + { + var dataVal = _tvDbProvider.SearchSeries(searchString); + + return new SelectList(dataVal, "Id", "SeriesName"); + } + + } +} diff --git a/NzbDrone.Web/Controllers/ApiController.cs b/NzbDrone.Web/Controllers/ApiController.cs index ebacc4d6b..7edaa0a65 100644 --- a/NzbDrone.Web/Controllers/ApiController.cs +++ b/NzbDrone.Web/Controllers/ApiController.cs @@ -7,6 +7,7 @@ using System.Xml.Linq; using NLog; using NzbDrone.Core; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; namespace NzbDrone.Web.Controllers { diff --git a/NzbDrone.Web/Controllers/SeriesController.cs b/NzbDrone.Web/Controllers/SeriesController.cs index c98228cc5..07dfa4a7b 100644 --- a/NzbDrone.Web/Controllers/SeriesController.cs +++ b/NzbDrone.Web/Controllers/SeriesController.cs @@ -8,6 +8,7 @@ using System.Web; using System.Web.Mvc; using NzbDrone.Core.Model; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; using NzbDrone.Core.Repository.Quality; using NzbDrone.Web.Models; @@ -61,52 +62,9 @@ namespace NzbDrone.Web.Controllers return View(); } - public ActionResult AddExisting() - { - var defaultQuality = Convert.ToInt32(_configProvider.GetValue("DefaultQualityProfile", "1", true)); - var profiles = _qualityProvider.GetAllProfiles(); - var selectList = new SelectList(profiles, "QualityProfileId", "Name"); + - ViewData["QualityProfileId"] = defaultQuality; - ViewData["QualitySelectList"] = selectList; - return View(); - } - - public ActionResult AddNew() - { - ViewData["RootDirs"] = _rootDirProvider.GetAll(); - ViewData["DirSep"] = Path.DirectorySeparatorChar; - - var profiles = _qualityProvider.GetAllProfiles(); - var selectList = new SelectList(profiles, "QualityProfileId", "Name"); - var defaultQuality = Convert.ToInt32(_configProvider.GetValue("DefaultQualityProfile", "1", true)); - - var model = new AddNewSeriesModel - { - DirectorySeparatorChar = Path.DirectorySeparatorChar.ToString(), - RootDirectories = _rootDirProvider.GetAll(), - QualityProfileId = defaultQuality, - QualitySelectList = selectList - }; - - return View(model); - } - - public ActionResult AddExistingManual(string path) - { - var profiles = _qualityProvider.GetAllProfiles(); - var selectList = new SelectList(profiles, "QualityProfileId", "Name"); - var defaultQuality = Convert.ToInt32(_configProvider.GetValue("DefaultQualityProfile", "1", true)); - - var model = new AddExistingManualModel(); - model.Path = path; - model.FolderName = _diskProvider.GetFolderName(path); - model.QualityProfileId = defaultQuality; - model.QualitySelectList = selectList; - - return View(model); - } public ActionResult RssSync() { @@ -187,53 +145,6 @@ namespace NzbDrone.Web.Controllers return View(new GridModel(unmappedList)); } - public ActionResult SyncSelectedSeries(List<String> checkedRecords) - { - var unmappedList = new List<SeriesMappingModel>(); - - foreach (var checkedRecord in checkedRecords) - { - NameValueCollection nvc = HttpUtility.ParseQueryString(checkedRecord); - - var path = HttpUtility.UrlDecode(nvc["path"]); - var tvDbId = Convert.ToInt32(HttpUtility.UrlDecode(nvc["tvdbid"])); - var qualityProfileId = Convert.ToInt32(HttpUtility.UrlDecode(nvc["qualityProfileId"])); - - //If the TvDbId for this show is 0 then skip it... User made a mistake... They will have to manually map it - if (tvDbId < 1) continue; - - unmappedList.Add(new SeriesMappingModel { Path = path, TvDbId = tvDbId, QualityProfileId = qualityProfileId }); - } - - if (_syncProvider.BeginSyncUnmappedFolders(unmappedList)) - return Content("Sync Started for Selected Series"); - - return Content("Sync already in progress, please wait for it to complete before retrying."); - } - - public ActionResult AddNewSeries(string dir, int seriesId, string seriesName, int qualityProfileId) - { - //Get TVDB Series Name - //Create new folder for series - //Add the new series to the Database - - if (_syncProvider.BeginAddNewSeries(dir, seriesId, seriesName, qualityProfileId)) - return Content("Adding new series has started."); - - return Content("Unable to add new series, please wait for previous scans to complete first."); - } - - public ActionResult AddExistingSeries(string path, int seriesId, int qualityProfileId) - { - //Get TVDB Series Name - //Create new folder for series - //Add the new series to the Database - - if (_syncProvider.BeginAddExistingSeries(path, seriesId, qualityProfileId)) - return Content("Manual adding of existing series has started"); - - return Content("Unable to add existing series, please wait for previous scans to complete first."); - } public ActionResult SearchForSeries(string seriesName) { diff --git a/NzbDrone.Web/Controllers/SettingsController.cs b/NzbDrone.Web/Controllers/SettingsController.cs index 5412434e7..4e6a9856e 100644 --- a/NzbDrone.Web/Controllers/SettingsController.cs +++ b/NzbDrone.Web/Controllers/SettingsController.cs @@ -9,6 +9,7 @@ using NzbDrone.Core; using NzbDrone.Core.Helpers; using NzbDrone.Core.Model; using NzbDrone.Core.Providers; +using NzbDrone.Core.Providers.Core; using NzbDrone.Core.Repository; using NzbDrone.Core.Repository.Quality; using NzbDrone.Web.Models; @@ -162,7 +163,7 @@ namespace NzbDrone.Web.Controllers model.ReplaceSpaces = Convert.ToBoolean(_configProvider.GetValue("Sorting_ReplaceSpaces", false, true)); model.AppendQuality = Convert.ToBoolean(_configProvider.GetValue("Sorting_AppendQuality", false, true)); model.UseAirByDate = Convert.ToBoolean(_configProvider.GetValue("Sorting_UseAirByDate", true, true)); - model.SeasonFolders = Convert.ToBoolean(_configProvider.GetValue("Sorting_SeasonFolder", true, true)); + model.SeasonFolders = _configProvider.UseSeasonFolder; model.SeasonFolderFormat = _configProvider.GetValue("Sorting_SeasonFolderFormat", "Season %s", true); model.SeparatorStyle = Convert.ToInt32(_configProvider.GetValue("Sorting_SeparatorStyle", 0, true)); model.NumberStyle = Convert.ToInt32(_configProvider.GetValue("Sorting_NumberStyle", 2, true)); diff --git a/NzbDrone.Web/NzbDrone.Web.csproj b/NzbDrone.Web/NzbDrone.Web.csproj index f1ed7e26f..48a753080 100644 --- a/NzbDrone.Web/NzbDrone.Web.csproj +++ b/NzbDrone.Web/NzbDrone.Web.csproj @@ -7,13 +7,14 @@ </ProductVersion> <SchemaVersion>2.0</SchemaVersion> <ProjectGuid>{43BD3BBD-1531-4D8F-9C08-E1CD544AB2CD}</ProjectGuid> - <ProjectTypeGuids>{F85E285D-A4E0-4152-9332-AB1D724D3325};{349c5851-65df-11da-9384-00065b846f21};{fae04ec0-301f-11d3-bf4b-00c04f79efbc}</ProjectTypeGuids> + <ProjectTypeGuids>{E53F8FEA-EAE0-44A6-8774-FFD645390401};{349c5851-65df-11da-9384-00065b846f21};{fae04ec0-301f-11d3-bf4b-00c04f79efbc}</ProjectTypeGuids> <OutputType>Library</OutputType> <AppDesignerFolder>Properties</AppDesignerFolder> <RootNamespace>NzbDrone.Web</RootNamespace> <AssemblyName>NzbDrone.Web</AssemblyName> <TargetFrameworkVersion>v4.0</TargetFrameworkVersion> <MvcBuildViews>true</MvcBuildViews> + <EnableUpdateable>false</EnableUpdateable> <TargetFrameworkProfile /> <UseIISExpress>false</UseIISExpress> </PropertyGroup> @@ -27,6 +28,8 @@ <WarningLevel>4</WarningLevel> <PlatformTarget>x86</PlatformTarget> <PublishDatabases>false</PublishDatabases> + <MvcBuildViews>true</MvcBuildViews> + <EnableUpdateable>false</EnableUpdateable> </PropertyGroup> <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' "> <DebugType>pdbonly</DebugType> @@ -35,6 +38,8 @@ <DefineConstants>TRACE</DefineConstants> <ErrorReport>prompt</ErrorReport> <WarningLevel>4</WarningLevel> + <MvcBuildViews>true</MvcBuildViews> + <EnableUpdateable>false</EnableUpdateable> </PropertyGroup> <ItemGroup> <Reference Include="Ninject, Version=2.2.0.0, Culture=neutral, PublicKeyToken=c7192dc5380945e7, processorArchitecture=MSIL"> @@ -64,11 +69,12 @@ <Reference Include="System.Web" /> <Reference Include="System.Web.Abstractions" /> <Reference Include="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> - <Private>True</Private> </Reference> + <Reference Include="System.Web.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> <Reference Include="System.Web.Routing"> <Private>False</Private> </Reference> + <Reference Include="System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> <Reference Include="System.Xml" /> <Reference Include="System.Configuration" /> <Reference Include="System.Web.Services" /> @@ -81,6 +87,8 @@ <SpecificVersion>False</SpecificVersion> <HintPath>..\NzbDrone.Core\Libraries\TvdbLib.dll</HintPath> </Reference> + <Reference Include="System.Web.WebPages" /> + <Reference Include="System.Web.Helpers" /> </ItemGroup> <ItemGroup> <Compile Include="App_GlobalResources\EditorLocalization.bg-BG.designer.cs"> @@ -186,6 +194,7 @@ <Compile Include="Controllers\ApiController.cs" /> <Compile Include="Controllers\HistoryController.cs" /> <Compile Include="Controllers\LogController.cs" /> + <Compile Include="Controllers\AddSeriesController.cs" /> <Compile Include="Controllers\NotificationController.cs" /> <Compile Include="Controllers\SeriesController.cs" /> <Compile Include="Controllers\SettingsController.cs" /> @@ -600,19 +609,16 @@ <Content Include="Scripts\jquery-tgc-countdown-1.0.js" /> <Content Include="Scripts\jquery.simpledropdown.js" /> <Content Include="Scripts\Notification.js" /> + <None Include="Views\AddSeries\AddSeriesItem.cshtml" /> <Content Include="Views\History\Index.aspx" /> - <Content Include="Views\Home\Test.aspx" /> <Content Include="Views\Log\Index.aspx" /> - <Content Include="Views\Series\AddExisting.aspx" /> - <Content Include="Views\Series\AddExistingManual.aspx" /> - <Content Include="Views\Series\AddNew.aspx" /> + <Content Include="Views\AddSeries\AddExisting.aspx" /> + <Content Include="Views\AddSeries\AddNew.aspx" /> <Content Include="Views\Series\Details.aspx" /> <Content Include="Views\Series\Edit.aspx" /> - <Content Include="Views\Series\EpisodeDetail.ascx" /> <Content Include="Views\Series\index.aspx" /> <Content Include="Views\Series\SeriesSearchResults.ascx" /> <Content Include="Views\Series\SubMenu.ascx" /> - <Content Include="Views\Series\Unmapped.aspx" /> <Content Include="Views\Settings\RootDir.ascx" /> <Content Include="Views\Settings\Notifications.ascx" /> <Content Include="Views\Settings\Downloads.ascx" /> @@ -642,14 +648,19 @@ <Content Include="Scripts\MicrosoftMvcAjax.debug.js" /> <Content Include="Scripts\MicrosoftMvcValidation.js" /> <Content Include="Scripts\MicrosoftMvcValidation.debug.js" /> - <Content Include="Views\Home\About.aspx" /> - <Content Include="Views\Home\Index.aspx" /> <Content Include="Views\Shared\Error.aspx" /> <Content Include="Views\Shared\Site.Master" /> + <Content Include="Scripts\jquery-ui.js" /> + <Content Include="Scripts\jquery-ui.min.js" /> + <Content Include="Scripts\jquery.validate.min.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.min.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.min.js" /> + <Content Include="Views\Web.config" /> </ItemGroup> <ItemGroup> <Folder Include="App_Data\" /> - <Folder Include="Views\Series\DisplayTemplates\" /> </ItemGroup> <ItemGroup> <ProjectReference Include="..\NzbDrone.Core\NzbDrone.Core.csproj"> diff --git a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js index 9896f90ae..346ba4818 100644 --- a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js +++ b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js @@ -314,9 +314,11 @@ Sys.Mvc.FormContext.prototype = { var errors = []; for (var i = 0; i < fields.length; i++) { var field = fields[i]; - var thisErrors = field.validate(eventName); - if (thisErrors) { - Array.addRange(errors, thisErrors); + if (!field.elements[0].disabled) { + var thisErrors = field.validate(eventName); + if (thisErrors) { + Array.addRange(errors, thisErrors); + } } } if (this.replaceValidationSummary) { @@ -578,8 +580,8 @@ Sys.Mvc.RangeValidator.create = function Sys_Mvc_RangeValidator$create(rule) { /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> /// </param> /// <returns type="Sys.Mvc.Validator"></returns> - var min = rule.ValidationParameters['minimum']; - var max = rule.ValidationParameters['maximum']; + var min = rule.ValidationParameters['min']; + var max = rule.ValidationParameters['max']; return Function.createDelegate(new Sys.Mvc.RangeValidator(min, max), new Sys.Mvc.RangeValidator(min, max).validate); } Sys.Mvc.RangeValidator.prototype = { @@ -765,8 +767,8 @@ Sys.Mvc.StringLengthValidator.create = function Sys_Mvc_StringLengthValidator$cr /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> /// </param> /// <returns type="Sys.Mvc.Validator"></returns> - var minLength = rule.ValidationParameters['minimumLength']; - var maxLength = rule.ValidationParameters['maximumLength']; + var minLength = (rule.ValidationParameters['min'] || 0); + var maxLength = (rule.ValidationParameters['max'] || Number.MAX_VALUE); return Function.createDelegate(new Sys.Mvc.StringLengthValidator(minLength, maxLength), new Sys.Mvc.StringLengthValidator(minLength, maxLength).validate); } Sys.Mvc.StringLengthValidator.prototype = { @@ -846,7 +848,7 @@ Sys.Mvc.ValidatorRegistry.getValidator = function Sys_Mvc_ValidatorRegistry$getV } Sys.Mvc.ValidatorRegistry._getDefaultValidators = function Sys_Mvc_ValidatorRegistry$_getDefaultValidators() { /// <returns type="Object"></returns> - return { required: Function.createDelegate(null, Sys.Mvc.RequiredValidator.create), stringLength: Function.createDelegate(null, Sys.Mvc.StringLengthValidator.create), regularExpression: Function.createDelegate(null, Sys.Mvc.RegularExpressionValidator.create), range: Function.createDelegate(null, Sys.Mvc.RangeValidator.create), number: Function.createDelegate(null, Sys.Mvc.NumberValidator.create) }; + return { required: Function.createDelegate(null, Sys.Mvc.RequiredValidator.create), length: Function.createDelegate(null, Sys.Mvc.StringLengthValidator.create), regex: Function.createDelegate(null, Sys.Mvc.RegularExpressionValidator.create), range: Function.createDelegate(null, Sys.Mvc.RangeValidator.create), number: Function.createDelegate(null, Sys.Mvc.NumberValidator.create) }; } diff --git a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js index 2d1789ddc..9483492f1 100644 --- a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js +++ b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js @@ -18,11 +18,11 @@ Sys.Mvc.FormContext.getValidationForForm=function(formElement){return formElemen Sys.Mvc.FormContext.$10=function($p0,$p1){while($p1){if($p0===$p1){return true;}$p1=$p1.parentNode;}return false;} Sys.Mvc.FormContext.$12=function($p0){var $0=$get($p0.FormId);var $1=(!Sys.Mvc._ValidationUtil.$1($p0.ValidationSummaryId))?$get($p0.ValidationSummaryId):null;var $2=new Sys.Mvc.FormContext($0,$1);$2.enableDynamicValidation();$2.replaceValidationSummary=$p0.ReplaceValidationSummary;for(var $4=0;$4<$p0.Fields.length;$4++){var $5=$p0.Fields[$4];var $6=Sys.Mvc.FormContext.$F($0,$5.FieldName);var $7=(!Sys.Mvc._ValidationUtil.$1($5.ValidationMessageId))?$get($5.ValidationMessageId):null;var $8=new Sys.Mvc.FieldContext($2);Array.addRange($8.elements,$6);$8.validationMessageElement=$7;$8.replaceValidationMessageContents=$5.ReplaceValidationMessageContents;for(var $9=0;$9<$5.ValidationRules.length;$9++){var $A=$5.ValidationRules[$9];var $B=Sys.Mvc.ValidatorRegistry.getValidator($A);if($B){var $C=Sys.Mvc.$create_Validation();$C.fieldErrorMessage=$A.ErrorMessage;$C.validator=$B;Array.add($8.validations,$C);}}$8.enableDynamicValidation();Array.add($2.fields,$8);}var $3=$0.validationCallbacks;if(!$3){$3=[];$0.validationCallbacks = $3;}$3.push(Function.createDelegate(null,function(){ return Sys.Mvc._ValidationUtil.$0($2.validate('submit'));}));return $2;} -Sys.Mvc.FormContext.prototype={$3:null,$4:null,$6:null,$7:null,$8:null,$9:null,replaceValidationSummary:false,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$5,messages);this.$11();}},clearErrors:function(){Array.clear(this.$5);this.$11();},$A:function(){if(this.$7){if(this.$8){Sys.Mvc._ValidationUtil.$3(this.$8);for(var $0=0;$0<this.$5.length;$0++){var $1=document.createElement('li');Sys.Mvc._ValidationUtil.$4($1,this.$5[$0]);this.$8.appendChild($1);}}Sys.UI.DomElement.removeCssClass(this.$7,'validation-summary-valid');Sys.UI.DomElement.addCssClass(this.$7,'validation-summary-errors');}},$B:function(){var $0=this.$7;if($0){var $1=this.$8;if($1){$1.innerHTML='';}Sys.UI.DomElement.removeCssClass($0,'validation-summary-errors');Sys.UI.DomElement.addCssClass($0,'validation-summary-valid');}},enableDynamicValidation:function(){Sys.UI.DomEvent.addHandler(this.$9,'click',this.$3);Sys.UI.DomEvent.addHandler(this.$9,'submit',this.$4);},$C:function($p0){if($p0.disabled){return null;}var $0=$p0.tagName.toUpperCase();var $1=$p0;if($0==='INPUT'){var $2=$1.type;if($2==='submit'||$2==='image'){return $1;}}else if(($0==='BUTTON')&&($1.type==='submit')){return $1;}return null;},$D:function($p0){this.$6=this.$C($p0.target);},$E:function($p0){var $0=$p0.target;var $1=this.$6;if($1&&$1.disableValidation){return;}var $2=this.validate('submit');if(!Sys.Mvc._ValidationUtil.$0($2)){$p0.preventDefault();}},$11:function(){if(!this.$5.length){this.$B();}else{this.$A();}},validate:function(eventName){var $0=this.fields;var $1=[];for(var $2=0;$2<$0.length;$2++){var $3=$0[$2];var $4=$3.validate(eventName);if($4){Array.addRange($1,$4);}}if(this.replaceValidationSummary){this.clearErrors();this.addErrors($1);}return $1;}} +Sys.Mvc.FormContext.prototype={$3:null,$4:null,$6:null,$7:null,$8:null,$9:null,replaceValidationSummary:false,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$5,messages);this.$11();}},clearErrors:function(){Array.clear(this.$5);this.$11();},$A:function(){if(this.$7){if(this.$8){Sys.Mvc._ValidationUtil.$3(this.$8);for(var $0=0;$0<this.$5.length;$0++){var $1=document.createElement('li');Sys.Mvc._ValidationUtil.$4($1,this.$5[$0]);this.$8.appendChild($1);}}Sys.UI.DomElement.removeCssClass(this.$7,'validation-summary-valid');Sys.UI.DomElement.addCssClass(this.$7,'validation-summary-errors');}},$B:function(){var $0=this.$7;if($0){var $1=this.$8;if($1){$1.innerHTML='';}Sys.UI.DomElement.removeCssClass($0,'validation-summary-errors');Sys.UI.DomElement.addCssClass($0,'validation-summary-valid');}},enableDynamicValidation:function(){Sys.UI.DomEvent.addHandler(this.$9,'click',this.$3);Sys.UI.DomEvent.addHandler(this.$9,'submit',this.$4);},$C:function($p0){if($p0.disabled){return null;}var $0=$p0.tagName.toUpperCase();var $1=$p0;if($0==='INPUT'){var $2=$1.type;if($2==='submit'||$2==='image'){return $1;}}else if(($0==='BUTTON')&&($1.type==='submit')){return $1;}return null;},$D:function($p0){this.$6=this.$C($p0.target);},$E:function($p0){var $0=$p0.target;var $1=this.$6;if($1&&$1.disableValidation){return;}var $2=this.validate('submit');if(!Sys.Mvc._ValidationUtil.$0($2)){$p0.preventDefault();}},$11:function(){if(!this.$5.length){this.$B();}else{this.$A();}},validate:function(eventName){var $0=this.fields;var $1=[];for(var $2=0;$2<$0.length;$2++){var $3=$0[$2];if(!$3.elements[0].disabled){var $4=$3.validate(eventName);if($4){Array.addRange($1,$4);}}}if(this.replaceValidationSummary){this.clearErrors();this.addErrors($1);}return $1;}} Sys.Mvc.FieldContext=function(formContext){this.$A=[];this.elements=new Array(0);this.validations=new Array(0);this.formContext=formContext;this.$6=Function.createDelegate(this,this.$D);this.$7=Function.createDelegate(this,this.$E);this.$8=Function.createDelegate(this,this.$F);this.$9=Function.createDelegate(this,this.$10);} Sys.Mvc.FieldContext.prototype={$6:null,$7:null,$8:null,$9:null,defaultErrorMessage:null,formContext:null,replaceValidationMessageContents:false,validationMessageElement:null,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$A,messages);this.$14();}},clearErrors:function(){Array.clear(this.$A);this.$14();},$B:function(){var $0=this.validationMessageElement;if($0){if(this.replaceValidationMessageContents){Sys.Mvc._ValidationUtil.$4($0,this.$A[0]);}Sys.UI.DomElement.removeCssClass($0,'field-validation-valid');Sys.UI.DomElement.addCssClass($0,'field-validation-error');}var $1=this.elements;for(var $2=0;$2<$1.length;$2++){var $3=$1[$2];Sys.UI.DomElement.removeCssClass($3,'input-validation-valid');Sys.UI.DomElement.addCssClass($3,'input-validation-error');}},$C:function(){var $0=this.validationMessageElement;if($0){if(this.replaceValidationMessageContents){Sys.Mvc._ValidationUtil.$4($0,'');}Sys.UI.DomElement.removeCssClass($0,'field-validation-error');Sys.UI.DomElement.addCssClass($0,'field-validation-valid');}var $1=this.elements;for(var $2=0;$2<$1.length;$2++){var $3=$1[$2];Sys.UI.DomElement.removeCssClass($3,'input-validation-error');Sys.UI.DomElement.addCssClass($3,'input-validation-valid');}},$D:function($p0){if($p0.target['__MVC_HasTextChanged']||$p0.target['__MVC_HasValidationFired']){this.validate('blur');}},$E:function($p0){$p0.target['__MVC_HasTextChanged'] = true;},$F:function($p0){$p0.target['__MVC_HasTextChanged'] = true;if($p0.target['__MVC_HasValidationFired']){this.validate('input');}},$10:function($p0){if($p0.rawEvent.propertyName==='value'){$p0.target['__MVC_HasTextChanged'] = true;if($p0.target['__MVC_HasValidationFired']){this.validate('input');}}},enableDynamicValidation:function(){var $0=this.elements;for(var $1=0;$1<$0.length;$1++){var $2=$0[$1];if(Sys.Mvc._ValidationUtil.$2($2,'onpropertychange')){var $3=document.documentMode;if($3&&$3>=8){Sys.UI.DomEvent.addHandler($2,'propertychange',this.$9);}}else{Sys.UI.DomEvent.addHandler($2,'input',this.$8);}Sys.UI.DomEvent.addHandler($2,'change',this.$7);Sys.UI.DomEvent.addHandler($2,'blur',this.$6);}},$11:function($p0,$p1){var $0=$p1||this.defaultErrorMessage;if(Boolean.isInstanceOfType($p0)){return ($p0)?null:$0;}if(String.isInstanceOfType($p0)){return (($p0).length)?$p0:$0;}return null;},$12:function(){var $0=this.elements;return ($0.length>0)?$0[0].value:null;},$13:function(){var $0=this.elements;for(var $1=0;$1<$0.length;$1++){var $2=$0[$1];$2['__MVC_HasValidationFired'] = true;}},$14:function(){if(!this.$A.length){this.$C();}else{this.$B();}},validate:function(eventName){var $0=this.validations;var $1=[];var $2=this.$12();for(var $3=0;$3<$0.length;$3++){var $4=$0[$3];var $5=Sys.Mvc.$create_ValidationContext();$5.eventName=eventName;$5.fieldContext=this;$5.validation=$4;var $6=$4.validator($2,$5);var $7=this.$11($6,$4.fieldErrorMessage);if(!Sys.Mvc._ValidationUtil.$1($7)){Array.add($1,$7);}}this.$13();this.clearErrors();this.addErrors($1);return $1;}} Sys.Mvc.RangeValidator=function(minimum,maximum){this.$0=minimum;this.$1=maximum;} -Sys.Mvc.RangeValidator.create=function(rule){var $0=rule.ValidationParameters['minimum'];var $1=rule.ValidationParameters['maximum'];return Function.createDelegate(new Sys.Mvc.RangeValidator($0,$1),new Sys.Mvc.RangeValidator($0,$1).validate);} +Sys.Mvc.RangeValidator.create=function(rule){var $0=rule.ValidationParameters['min'];var $1=rule.ValidationParameters['max'];return Function.createDelegate(new Sys.Mvc.RangeValidator($0,$1),new Sys.Mvc.RangeValidator($0,$1).validate);} Sys.Mvc.RangeValidator.prototype={$0:null,$1:null,validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}var $0=Number.parseLocale(value);return (!isNaN($0)&&this.$0<=$0&&$0<=this.$1);}} Sys.Mvc.RegularExpressionValidator=function(pattern){this.$0=pattern;} Sys.Mvc.RegularExpressionValidator.create=function(rule){var $0=rule.ValidationParameters['pattern'];return Function.createDelegate(new Sys.Mvc.RegularExpressionValidator($0),new Sys.Mvc.RegularExpressionValidator($0).validate);} @@ -37,7 +37,7 @@ Sys.Mvc.RequiredValidator.$4=function($p0){for(var $0=0;$0<$p0.length;$0++){var Sys.Mvc.RequiredValidator.$5=function($p0){return (!Sys.Mvc._ValidationUtil.$1($p0.value));} Sys.Mvc.RequiredValidator.prototype={validate:function(value,context){var $0=context.fieldContext.elements;if(!$0.length){return true;}var $1=$0[0];if(Sys.Mvc.RequiredValidator.$2($1)){return Sys.Mvc.RequiredValidator.$5($1);}if(Sys.Mvc.RequiredValidator.$0($1)){return Sys.Mvc.RequiredValidator.$3($0);}if(Sys.Mvc.RequiredValidator.$1($1)){return Sys.Mvc.RequiredValidator.$4(($1).options);}return true;}} Sys.Mvc.StringLengthValidator=function(minLength,maxLength){this.$1=minLength;this.$0=maxLength;} -Sys.Mvc.StringLengthValidator.create=function(rule){var $0=rule.ValidationParameters['minimumLength'];var $1=rule.ValidationParameters['maximumLength'];return Function.createDelegate(new Sys.Mvc.StringLengthValidator($0,$1),new Sys.Mvc.StringLengthValidator($0,$1).validate);} +Sys.Mvc.StringLengthValidator.create=function(rule){var $0=(rule.ValidationParameters['min']||0);var $1=(rule.ValidationParameters['max']||Number.MAX_VALUE);return Function.createDelegate(new Sys.Mvc.StringLengthValidator($0,$1),new Sys.Mvc.StringLengthValidator($0,$1).validate);} Sys.Mvc.StringLengthValidator.prototype={$0:0,$1:0,validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}return (this.$1<=value.length&&value.length<=this.$0);}} Sys.Mvc._ValidationUtil=function(){} Sys.Mvc._ValidationUtil.$0=function($p0){return (!$p0||!$p0.length);} @@ -47,7 +47,7 @@ Sys.Mvc._ValidationUtil.$3=function($p0){while($p0.firstChild){$p0.removeChild($ Sys.Mvc._ValidationUtil.$4=function($p0,$p1){var $0=document.createTextNode($p1);Sys.Mvc._ValidationUtil.$3($p0);$p0.appendChild($0);} Sys.Mvc.ValidatorRegistry=function(){} Sys.Mvc.ValidatorRegistry.getValidator=function(rule){var $0=Sys.Mvc.ValidatorRegistry.validators[rule.ValidationType];return ($0)?$0(rule):null;} -Sys.Mvc.ValidatorRegistry.$0=function(){return {required:Function.createDelegate(null,Sys.Mvc.RequiredValidator.create),stringLength:Function.createDelegate(null,Sys.Mvc.StringLengthValidator.create),regularExpression:Function.createDelegate(null,Sys.Mvc.RegularExpressionValidator.create),range:Function.createDelegate(null,Sys.Mvc.RangeValidator.create),number:Function.createDelegate(null,Sys.Mvc.NumberValidator.create)};} +Sys.Mvc.ValidatorRegistry.$0=function(){return {required:Function.createDelegate(null,Sys.Mvc.RequiredValidator.create),length:Function.createDelegate(null,Sys.Mvc.StringLengthValidator.create),regex:Function.createDelegate(null,Sys.Mvc.RegularExpressionValidator.create),range:Function.createDelegate(null,Sys.Mvc.RangeValidator.create),number:Function.createDelegate(null,Sys.Mvc.NumberValidator.create)};} Sys.Mvc.NumberValidator.registerClass('Sys.Mvc.NumberValidator');Sys.Mvc.FormContext.registerClass('Sys.Mvc.FormContext');Sys.Mvc.FieldContext.registerClass('Sys.Mvc.FieldContext');Sys.Mvc.RangeValidator.registerClass('Sys.Mvc.RangeValidator');Sys.Mvc.RegularExpressionValidator.registerClass('Sys.Mvc.RegularExpressionValidator');Sys.Mvc.RequiredValidator.registerClass('Sys.Mvc.RequiredValidator');Sys.Mvc.StringLengthValidator.registerClass('Sys.Mvc.StringLengthValidator');Sys.Mvc._ValidationUtil.registerClass('Sys.Mvc._ValidationUtil');Sys.Mvc.ValidatorRegistry.registerClass('Sys.Mvc.ValidatorRegistry');Sys.Mvc.ValidatorRegistry.validators=Sys.Mvc.ValidatorRegistry.$0(); // ---- Do not remove this footer ---- // Generated using Script# v0.5.0.0 (http://projects.nikhilk.net) diff --git a/NzbDrone.Web/Scripts/jquery-ui.js b/NzbDrone.Web/Scripts/jquery-ui.js new file mode 100644 index 000000000..01f5d7310 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery-ui.js @@ -0,0 +1,11630 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.7", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr( element, "tabindex" ); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || !isNaN( tabIndex ) + : !isNaN( tabIndex )) + // the element and all of its ancestors must be visible + && visible( element ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ); + return ( isNaN( tabIndex ) || tabIndex >= 0 ) && $( element ).is( ":focusable" ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Widget 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Mouse 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Draggable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue + if(!this.element[0] || !this.element[0].parentNode) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + (o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.7" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Droppable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.7" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Resizable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.7" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Selectable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.7" +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Sortable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are floating + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp(); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.7" +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.each(function() { + $.queue(this, 'fx', function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('className'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('className', className); + + that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + }); + + // $.animate adds a function to the end of the queue + // but we want it at the front + var queue = $.queue(this), + anim = queue.splice(queue.length - 1, 1)[0]; + queue.splice(1, 0, anim); + $.dequeue(this); + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.7", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }); + + element.wrap(wrapper); + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0 }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * Copyright 2008 George McGinley Smith + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * Copyright 2001 Robert Penner + * + */ + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Blind 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Bounce 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Clip 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Drop 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Explode 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Fade 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Fold 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Highlight 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Pulsate 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Scale 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Shake 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Slide 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Transfer 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Accordion 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // switch classes + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + // find elements to show and hide + var toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.7", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Autocomplete 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.attr( "readonly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if (self.xhr) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status, xhr ) { + if ( xhr === self.xhr ) { + response( data ); + } + self.xhr = null; + }, + error: function( xhr ) { + if ( xhr === self.xhr ) { + response( [] ); + } + self.xhr = null; + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.element.removeClass( "ui-autocomplete-loading" ); + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + ul.width( "" ).outerWidth(), + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.attr("scrollTop"), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.attr("scrollTop", scroll + offset); + } else if (offset >= elementHeight) { + this.element.attr("scrollTop", scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element.attr("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Button 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function( event ) { + $( ":ui-button", event.target.form ).each(function() { + var inst = $( this ).data( "button" ); + setTimeout(function() { + inst.refresh(); + }, 1 ); + }); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.attr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + $( this ).addClass( focusClass ); + }) + .bind( "blur.button", function() { + $( this ).removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + self.refresh(); + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", true ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else { + if ( this.element.is(":radio") ) { + this.type = "radio"; + } else { + if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + } + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + this.buttonElement = this.element.parents().last() + .find( "label[for=" + this.element.attr("id") + "]" ); + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.attr( "disabled", true ); + } else { + this.element.removeAttr( "disabled" ); + } + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary; + if ( icons.primary || icons.secondary ) { + buttonElement.addClass( "ui-button-text-icon" + + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + if ( !this.options.text ) { + buttonElement + .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ) + .removeClass( "ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary" ); + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonElement.addClass( "ui-button-text-only" ); + } + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Datepicker 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.7" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false // True to size the input for the date format, false to leave as is + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + inst.dpDiv.show(); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + extendRemove(inst.settings, settings); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDateDatepicker(target, date); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + var borders = $.datepicker._getBorders(inst.dpDiv); + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + else + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear) { + setTimeout(function() { + inst.input.focus(); + }, 0); + } + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + for (var i = 0; i < names.length; i++) { + if (value.substr(iValue, names[i].length).toLowerCase() == names[i].toLowerCase()) { + iValue += names[i].length; + return i + 1; + } + } + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/* + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + //when showing there is no need for later update + if( ! $.browser.mozilla ){ + html += inst.yearshtml; + inst.yearshtml = null; + } else { + // will be replaced later with inst.yearshtml + html += '<select class="ui-datepicker-year"><option value="' + drawYear + '" selected="selected">' + drawYear + '</option></select>'; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - new Date(year, month, 32).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.7"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Dialog 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .attr( props, true ) + .unbind('click') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.7", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Position 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if (options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + parseInt( $.curCSS( this, "marginRight", true ) ) || 0, + collisionHeight = elemHeight + marginTop + + parseInt( $.curCSS( this, "marginBottom", true ) ) || 0, + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Progressbar 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.7" +}); + +})( jQuery ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Slider 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + if ( o.disabled ) { + this.element.addClass( "ui-slider-disabled ui-disabled" ); + } + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + this.range = $( "<div></div>" ); + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } else { + this.range = $( "<div></div>" ); + } + + this.range + .appendTo( this.element ) + .addClass( "ui-slider-range" ); + + if ( o.range === "min" || o.range === "max" ) { + this.range.addClass( "ui-slider-range-" + o.range ); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass( "ui-widget-header" ); + } + + if ( $( ".ui-slider-handle", this.element ).length === 0 ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + + if ( o.values && o.values.length ) { + while ( $(".ui-slider-handle", this.element).length < o.values.length ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + } + + this.handles = $( ".ui-slider-handle", this.element ) + .addClass( "ui-state-default" + + " ui-corner-all" ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.attr( "disabled", "disabled" ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.removeAttr( "disabled" ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step; + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.7" +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Tabs 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ) ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.7" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/NzbDrone.Web/Scripts/jquery-ui.min.js b/NzbDrone.Web/Scripts/jquery-ui.min.js new file mode 100644 index 000000000..7a83f1887 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery-ui.min.js @@ -0,0 +1,409 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI + */ +(function(b,c){function f(g){return!b(g).parents().andSelf().filter(function(){return b.curCSS(this,"visibility")==="hidden"||b.expr.filters.hidden(this)}).length}b.ui=b.ui||{};if(!b.ui.version){b.extend(b.ui,{version:"1.8.7",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});b.fn.extend({_focus:b.fn.focus,focus:function(g,e){return typeof g==="number"?this.each(function(){var a=this;setTimeout(function(){b(a).focus();e&&e.call(a)},g)}):this._focus.apply(this,arguments)},scrollParent:function(){var g;g=b.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(b.curCSS(this, +"position",1))&&/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!g.length?b(document):g},zIndex:function(g){if(g!==c)return this.css("zIndex",g);if(this.length){g=b(this[0]);for(var e;g.length&&g[0]!==document;){e=g.css("position"); +if(e==="absolute"||e==="relative"||e==="fixed"){e=parseInt(g.css("zIndex"),10);if(!isNaN(e)&&e!==0)return e}g=g.parent()}}return 0},disableSelection:function(){return this.bind((b.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(g){g.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});b.each(["Width","Height"],function(g,e){function a(j,n,q,l){b.each(d,function(){n-=parseFloat(b.curCSS(j,"padding"+this,true))||0;if(q)n-=parseFloat(b.curCSS(j, +"border"+this+"Width",true))||0;if(l)n-=parseFloat(b.curCSS(j,"margin"+this,true))||0});return n}var d=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),i={innerWidth:b.fn.innerWidth,innerHeight:b.fn.innerHeight,outerWidth:b.fn.outerWidth,outerHeight:b.fn.outerHeight};b.fn["inner"+e]=function(j){if(j===c)return i["inner"+e].call(this);return this.each(function(){b(this).css(h,a(this,j)+"px")})};b.fn["outer"+e]=function(j,n){if(typeof j!=="number")return i["outer"+e].call(this,j);return this.each(function(){b(this).css(h, +a(this,j,true,n)+"px")})}});b.extend(b.expr[":"],{data:function(g,e,a){return!!b.data(g,a[3])},focusable:function(g){var e=g.nodeName.toLowerCase(),a=b.attr(g,"tabindex");if("area"===e){e=g.parentNode;a=e.name;if(!g.href||!a||e.nodeName.toLowerCase()!=="map")return false;g=b("img[usemap=#"+a+"]")[0];return!!g&&f(g)}return(/input|select|textarea|button|object/.test(e)?!g.disabled:"a"==e?g.href||!isNaN(a):!isNaN(a))&&f(g)},tabbable:function(g){var e=b.attr(g,"tabindex");return(isNaN(e)||e>=0)&&b(g).is(":focusable")}}); +b(function(){var g=document.body,e=g.appendChild(e=document.createElement("div"));b.extend(e.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});b.support.minHeight=e.offsetHeight===100;b.support.selectstart="onselectstart"in e;g.removeChild(e).style.display="none"});b.extend(b.ui,{plugin:{add:function(g,e,a){g=b.ui[g].prototype;for(var d in a){g.plugins[d]=g.plugins[d]||[];g.plugins[d].push([e,a[d]])}},call:function(g,e,a){if((e=g.plugins[e])&&g.element[0].parentNode)for(var d=0;d<e.length;d++)g.options[e[d][0]]&& +e[d][1].apply(g.element,a)}},contains:function(g,e){return document.compareDocumentPosition?g.compareDocumentPosition(e)&16:g!==e&&g.contains(e)},hasScroll:function(g,e){if(b(g).css("overflow")==="hidden")return false;e=e&&e==="left"?"scrollLeft":"scrollTop";var a=false;if(g[e]>0)return true;g[e]=1;a=g[e]>0;g[e]=0;return a},isOverAxis:function(g,e,a){return g>e&&g<e+a},isOver:function(g,e,a,d,h,i){return b.ui.isOverAxis(g,a,h)&&b.ui.isOverAxis(e,d,i)}})}})(jQuery); +(function(b,c){if(b.cleanData){var f=b.cleanData;b.cleanData=function(e){for(var a=0,d;(d=e[a])!=null;a++)b(d).triggerHandler("remove");f(e)}}else{var g=b.fn.remove;b.fn.remove=function(e,a){return this.each(function(){if(!a)if(!e||b.filter(e,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return g.call(b(this),e,a)})}}b.widget=function(e,a,d){var h=e.split(".")[0],i;e=e.split(".")[1];i=h+"-"+e;if(!d){d=a;a=b.Widget}b.expr[":"][i]=function(j){return!!b.data(j, +e)};b[h]=b[h]||{};b[h][e]=function(j,n){arguments.length&&this._createWidget(j,n)};a=new a;a.options=b.extend(true,{},a.options);b[h][e].prototype=b.extend(true,a,{namespace:h,widgetName:e,widgetEventPrefix:b[h][e].prototype.widgetEventPrefix||e,widgetBaseClass:i},d);b.widget.bridge(e,b[h][e])};b.widget.bridge=function(e,a){b.fn[e]=function(d){var h=typeof d==="string",i=Array.prototype.slice.call(arguments,1),j=this;d=!h&&i.length?b.extend.apply(null,[true,d].concat(i)):d;if(h&&d.charAt(0)==="_")return j; +h?this.each(function(){var n=b.data(this,e),q=n&&b.isFunction(n[d])?n[d].apply(n,i):n;if(q!==n&&q!==c){j=q;return false}}):this.each(function(){var n=b.data(this,e);n?n.option(d||{})._init():b.data(this,e,new a(d,this))});return j}};b.Widget=function(e,a){arguments.length&&this._createWidget(e,a)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(e,a){b.data(a,this.widgetName,this);this.element=b(a);this.options=b.extend(true,{},this.options, +this._getCreateOptions(),e);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(e,a){var d=e;if(arguments.length===0)return b.extend({},this.options);if(typeof e==="string"){if(a===c)return this.options[e];d={};d[e]=a}this._setOptions(d);return this},_setOptions:function(e){var a=this;b.each(e,function(d,h){a._setOption(d,h)});return this},_setOption:function(e,a){this.options[e]=a;if(e==="disabled")this.widget()[a?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",a);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,a,d){var h=this.options[e];a=b.Event(a);a.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();d=d||{};if(a.originalEvent){e=b.event.props.length;for(var i;e;){i=b.event.props[--e];a[i]=a.originalEvent[i]}}this.element.trigger(a,d);return!(b.isFunction(h)&&h.call(this.element[0],a,d)===false||a.isDefaultPrevented())}}})(jQuery); +(function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var c=this;this.element.bind("mousedown."+this.widgetName,function(f){return c._mouseDown(f)}).bind("click."+this.widgetName,function(f){if(true===b.data(f.target,c.widgetName+".preventClickEvent")){b.removeData(f.target,c.widgetName+".preventClickEvent");f.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(c){c.originalEvent= +c.originalEvent||{};if(!c.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(c);this._mouseDownEvent=c;var f=this,g=c.which==1,e=typeof this.options.cancel=="string"?b(c.target).parents().add(c.target).filter(this.options.cancel).length:false;if(!g||e||!this._mouseCapture(c))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){f.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c)){this._mouseStarted= +this._mouseStart(c)!==false;if(!this._mouseStarted){c.preventDefault();return true}}this._mouseMoveDelegate=function(a){return f._mouseMove(a)};this._mouseUpDelegate=function(a){return f._mouseUp(a)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.preventDefault();return c.originalEvent.mouseHandled=true}},_mouseMove:function(c){if(b.browser.msie&&!(document.documentMode>=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c); +return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;c.target==this._mouseDownEvent.target&&b.data(c.target,this.widgetName+".preventClickEvent", +true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +(function(b){b.widget("ui.draggable",b.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(c){var f= +this.options;if(this.helper||f.disabled||b(c.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(c);if(!this.handle)return false;return true},_mouseStart:function(c){var f=this.options;this.helper=this._createHelper(c);this._cacheHelperProportions();if(b.ui.ddmanager)b.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};b.extend(this.offset,{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);f.containment&&this._setContainment();if(this._trigger("start",c)===false){this._clear();return false}this._cacheHelperProportions(); +b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(c,true);return true},_mouseDrag:function(c,f){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute");if(!f){f=this._uiHash();if(this._trigger("drag",c,f)===false){this._mouseUp({});return false}this.position=f.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);return false},_mouseStop:function(c){var f=false;if(b.ui.ddmanager&&!this.options.dropBehaviour)f=b.ui.ddmanager.drop(this,c);if(this.dropped){f=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!f||this.options.revert=="valid"&&f||this.options.revert===true||b.isFunction(this.options.revert)&&this.options.revert.call(this.element, +f)){var g=this;b(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){g._trigger("stop",c)!==false&&g._clear()})}else this._trigger("stop",c)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(c){var f=!this.options.handle||!b(this.options.handle,this.element).length?true:false;b(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +c.target)f=true});return f},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c])):f.helper=="clone"?this.element.clone():this.element;c.parents("body").length||c.appendTo(f.appendTo=="parent"?this.element[0].parentNode:f.appendTo);c[0]!=this.element[0]&&!/(fixed|absolute)/.test(c.css("position"))&&c.css("position","absolute");return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]|| +0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0], +this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.element.position();return{top:c.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var c=this.options;if(c.containment== +"parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[(c.containment=="document"?0:b(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(c.containment=="document"?0:b(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(c.containment=="document"?0:b(window).scrollLeft())+b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(c.containment=="document"? +0:b(window).scrollTop())+(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)&&c.containment.constructor!=Array){var f=b(c.containment)[0];if(f){c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"), +10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"),10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(c.containment.constructor== +Array)this.containment=c.containment},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): +e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f=this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName),a=c.pageX,d=c.pageY; +if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/ +f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])?d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top- +this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!= +this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(c,f,g){g=g||this._uiHash();b.ui.plugin.call(this,c,[f,g]);if(c=="drag")this.positionAbs=this._convertPositionTo("absolute");return b.Widget.prototype._trigger.call(this,c,f,g)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});b.extend(b.ui.draggable,{version:"1.8.7"}); +b.ui.plugin.add("draggable","connectToSortable",{start:function(c,f){var g=b(this).data("draggable"),e=g.options,a=b.extend({},f,{item:g.element});g.sortables=[];b(e.connectToSortable).each(function(){var d=b.data(this,"sortable");if(d&&!d.options.disabled){g.sortables.push({instance:d,shouldRevert:d.options.revert});d._refreshItems();d._trigger("activate",c,a)}})},stop:function(c,f){var g=b(this).data("draggable"),e=b.extend({},f,{item:g.element});b.each(g.sortables,function(){if(this.instance.isOver){this.instance.isOver= +0;g.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(c);this.instance.options.helper=this.instance.options._helper;g.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",c,e)}})},drag:function(c,f){var g=b(this).data("draggable"),e=this;b.each(g.sortables,function(){this.instance.positionAbs= +g.positionAbs;this.instance.helperProportions=g.helperProportions;this.instance.offset.click=g.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=b(e).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c, +true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=g.offset.click.top;this.instance.offset.click.left=g.offset.click.left;this.instance.offset.parent.left-=g.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=g.offset.parent.top-this.instance.offset.parent.top;g._trigger("toSortable",c);g.dropped=this.instance.element;g.currentItem=g.element;this.instance.fromOutside=g}this.instance.currentItem&&this.instance._mouseDrag(c)}else if(this.instance.isOver){this.instance.isOver= +0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",c,this.instance._uiHash(this.instance));this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();g._trigger("fromSortable",c);g.dropped=false}})}});b.ui.plugin.add("draggable","cursor",{start:function(){var c=b("body"),f=b(this).data("draggable").options;if(c.css("cursor"))f._cursor= +c.css("cursor");c.css("cursor",f.cursor)},stop:function(){var c=b(this).data("draggable").options;c._cursor&&b("body").css("cursor",c._cursor)}});b.ui.plugin.add("draggable","iframeFix",{start:function(){var c=b(this).data("draggable").options;b(c.iframeFix===true?"iframe":c.iframeFix).each(function(){b('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(b(this).offset()).appendTo("body")})}, +stop:function(){b("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});b.ui.plugin.add("draggable","opacity",{start:function(c,f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("opacity"))f._opacity=c.css("opacity");c.css("opacity",f.opacity)},stop:function(c,f){c=b(this).data("draggable").options;c._opacity&&b(f.helper).css("opacity",c._opacity)}});b.ui.plugin.add("draggable","scroll",{start:function(){var c=b(this).data("draggable");if(c.scrollParent[0]!= +document&&c.scrollParent[0].tagName!="HTML")c.overflowOffset=c.scrollParent.offset()},drag:function(c){var f=b(this).data("draggable"),g=f.options,e=false;if(f.scrollParent[0]!=document&&f.scrollParent[0].tagName!="HTML"){if(!g.axis||g.axis!="x")if(f.overflowOffset.top+f.scrollParent[0].offsetHeight-c.pageY<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop+g.scrollSpeed;else if(c.pageY-f.overflowOffset.top<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop- +g.scrollSpeed;if(!g.axis||g.axis!="y")if(f.overflowOffset.left+f.scrollParent[0].offsetWidth-c.pageX<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft+g.scrollSpeed;else if(c.pageX-f.overflowOffset.left<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft-g.scrollSpeed}else{if(!g.axis||g.axis!="x")if(c.pageY-b(document).scrollTop()<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()-g.scrollSpeed);else if(b(window).height()- +(c.pageY-b(document).scrollTop())<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()+g.scrollSpeed);if(!g.axis||g.axis!="y")if(c.pageX-b(document).scrollLeft()<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()-g.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()+g.scrollSpeed)}e!==false&&b.ui.ddmanager&&!g.dropBehaviour&&b.ui.ddmanager.prepareOffsets(f,c)}});b.ui.plugin.add("draggable", +"snap",{start:function(){var c=b(this).data("draggable"),f=c.options;c.snapElements=[];b(f.snap.constructor!=String?f.snap.items||":data(draggable)":f.snap).each(function(){var g=b(this),e=g.offset();this!=c.element[0]&&c.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:e.top,left:e.left})})},drag:function(c,f){for(var g=b(this).data("draggable"),e=g.options,a=e.snapTolerance,d=f.offset.left,h=d+g.helperProportions.width,i=f.offset.top,j=i+g.helperProportions.height,n= +g.snapElements.length-1;n>=0;n--){var q=g.snapElements[n].left,l=q+g.snapElements[n].width,k=g.snapElements[n].top,m=k+g.snapElements[n].height;if(q-a<d&&d<l+a&&k-a<i&&i<m+a||q-a<d&&d<l+a&&k-a<j&&j<m+a||q-a<h&&h<l+a&&k-a<i&&i<m+a||q-a<h&&h<l+a&&k-a<j&&j<m+a){if(e.snapMode!="inner"){var o=Math.abs(k-j)<=a,p=Math.abs(m-i)<=a,s=Math.abs(q-h)<=a,r=Math.abs(l-d)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k-g.helperProportions.height,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative", +{top:m,left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q-g.helperProportions.width}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l}).left-g.margins.left}var u=o||p||s||r;if(e.snapMode!="outer"){o=Math.abs(k-i)<=a;p=Math.abs(m-j)<=a;s=Math.abs(q-d)<=a;r=Math.abs(l-h)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height, +left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l-g.helperProportions.width}).left-g.margins.left}if(!g.snapElements[n].snapping&&(o||p||s||r||u))g.options.snap.snap&&g.options.snap.snap.call(g.element,c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=o||p||s||r||u}else{g.snapElements[n].snapping&&g.options.snap.release&&g.options.snap.release.call(g.element, +c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=false}}}});b.ui.plugin.add("draggable","stack",{start:function(){var c=b(this).data("draggable").options;c=b.makeArray(b(c.stack)).sort(function(g,e){return(parseInt(b(g).css("zIndex"),10)||0)-(parseInt(b(e).css("zIndex"),10)||0)});if(c.length){var f=parseInt(c[0].style.zIndex)||0;b(c).each(function(g){this.style.zIndex=f+g});this[0].style.zIndex=f+c.length}}});b.ui.plugin.add("draggable","zIndex",{start:function(c, +f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("zIndex"))f._zIndex=c.css("zIndex");c.css("zIndex",f.zIndex)},stop:function(c,f){c=b(this).data("draggable").options;c._zIndex&&b(f.helper).css("zIndex",c._zIndex)}})})(jQuery); +(function(b){b.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var c=this.options,f=c.accept;this.isover=0;this.isout=1;this.accept=b.isFunction(f)?f:function(g){return g.is(f)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};b.ui.ddmanager.droppables[c.scope]=b.ui.ddmanager.droppables[c.scope]||[];b.ui.ddmanager.droppables[c.scope].push(this); +c.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var c=b.ui.ddmanager.droppables[this.options.scope],f=0;f<c.length;f++)c[f]==this&&c.splice(f,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(c,f){if(c=="accept")this.accept=b.isFunction(f)?f:function(g){return g.is(f)};b.Widget.prototype._setOption.apply(this,arguments)},_activate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&& +this.element.addClass(this.options.activeClass);f&&this._trigger("activate",c,this.ui(f))},_deactivate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);f&&this._trigger("deactivate",c,this.ui(f))},_over:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); +this._trigger("over",c,this.ui(f))}},_out:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",c,this.ui(f))}},_drop:function(c,f){var g=f||b.ui.ddmanager.current;if(!g||(g.currentItem||g.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var a= +b.data(this,"droppable");if(a.options.greedy&&!a.options.disabled&&a.options.scope==g.options.scope&&a.accept.call(a.element[0],g.currentItem||g.element)&&b.ui.intersect(g,b.extend(a,{offset:a.element.offset()}),a.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],g.currentItem||g.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", +c,this.ui(g));return this.element}return false},ui:function(c){return{draggable:c.currentItem||c.element,helper:c.helper,position:c.position,offset:c.positionAbs}}});b.extend(b.ui.droppable,{version:"1.8.7"});b.ui.intersect=function(c,f,g){if(!f.offset)return false;var e=(c.positionAbs||c.position.absolute).left,a=e+c.helperProportions.width,d=(c.positionAbs||c.position.absolute).top,h=d+c.helperProportions.height,i=f.offset.left,j=i+f.proportions.width,n=f.offset.top,q=n+f.proportions.height; +switch(g){case "fit":return i<=e&&a<=j&&n<=d&&h<=q;case "intersect":return i<e+c.helperProportions.width/2&&a-c.helperProportions.width/2<j&&n<d+c.helperProportions.height/2&&h-c.helperProportions.height/2<q;case "pointer":return b.ui.isOver((c.positionAbs||c.position.absolute).top+(c.clickOffset||c.offset.click).top,(c.positionAbs||c.position.absolute).left+(c.clickOffset||c.offset.click).left,n,i,f.proportions.height,f.proportions.width);case "touch":return(d>=n&&d<=q||h>=n&&h<=q||d<n&&h>q)&&(e>= +i&&e<=j||a>=i&&a<=j||e<i&&a>j);default:return false}};b.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(c,f){var g=b.ui.ddmanager.droppables[c.options.scope]||[],e=f?f.type:null,a=(c.currentItem||c.element).find(":data(droppable)").andSelf(),d=0;a:for(;d<g.length;d++)if(!(g[d].options.disabled||c&&!g[d].accept.call(g[d].element[0],c.currentItem||c.element))){for(var h=0;h<a.length;h++)if(a[h]==g[d].element[0]){g[d].proportions.height=0;continue a}g[d].visible=g[d].element.css("display")!= +"none";if(g[d].visible){g[d].offset=g[d].element.offset();g[d].proportions={width:g[d].element[0].offsetWidth,height:g[d].element[0].offsetHeight};e=="mousedown"&&g[d]._activate.call(g[d],f)}}},drop:function(c,f){var g=false;b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&b.ui.intersect(c,this,this.options.tolerance))g=g||this._drop.call(this,f);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],c.currentItem|| +c.element)){this.isout=1;this.isover=0;this._deactivate.call(this,f)}}});return g},drag:function(c,f){c.options.refreshPositions&&b.ui.ddmanager.prepareOffsets(c,f);b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var g=b.ui.intersect(c,this,this.options.tolerance);if(g=!g&&this.isover==1?"isout":g&&this.isover==0?"isover":null){var e;if(this.options.greedy){var a=this.element.parents(":data(droppable):eq(0)");if(a.length){e= +b.data(a[0],"droppable");e.greedyChild=g=="isover"?1:0}}if(e&&g=="isover"){e.isover=0;e.isout=1;e._out.call(e,f)}this[g]=1;this[g=="isout"?"isover":"isout"]=0;this[g=="isover"?"_over":"_out"].call(this,f);if(e&&g=="isout"){e.isout=0;e.isover=1;e._over.call(e,f)}}}})}}})(jQuery); +(function(b){b.widget("ui.resizable",b.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var g=this,e=this.options;this.element.addClass("ui-resizable");b.extend(this,{_aspectRatio:!!e.aspectRatio,aspectRatio:e.aspectRatio,originalElement:this.element, +_proportionallyResizeElements:[],_helper:e.helper||e.ghost||e.animate?e.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&b.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(b('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=e.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var a=this.handles.split(",");this.handles={};for(var d=0;d<a.length;d++){var h=b.trim(a[d]),i=b('<div class="ui-resizable-handle '+("ui-resizable-"+h)+'"></div>');/sw|se|ne|nw/.test(h)&&i.css({zIndex:++e.zIndex});"se"==h&&i.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[h]=".ui-resizable-"+h;this.element.append(i)}}this._renderAxis=function(j){j=j||this.element;for(var n in this.handles){if(this.handles[n].constructor== +String)this.handles[n]=b(this.handles[n],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var q=b(this.handles[n],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(n)?q.outerHeight():q.outerWidth();q=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");j.css(q,l);this._proportionallyResize()}b(this.handles[n])}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!g.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);g.axis=j&&j[1]?j[1]:"se"}});if(e.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");g._handles.show()},function(){if(!g.resizing){b(this).addClass("ui-resizable-autohide");g._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var g=function(a){b(a).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; +if(this.elementIsWrapper){g(this.element);var e=this.element;e.after(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);g(this.originalElement);return this},_mouseCapture:function(g){var e=false;for(var a in this.handles)if(b(this.handles[a])[0]==g.target)e=true;return!this.options.disabled&&e},_mouseStart:function(g){var e=this.options,a=this.element.position(), +d=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:a.top,left:a.left});b.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();a=c(this.helper.css("left"));var h=c(this.helper.css("top"));if(e.containment){a+=b(e.containment).scrollLeft()||0;h+=b(e.containment).scrollTop()||0}this.offset= +this.helper.offset();this.position={left:a,top:h};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:a,top:h};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=typeof e.aspectRatio=="number"?e.aspectRatio: +this.originalSize.width/this.originalSize.height||1;e=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",e=="auto"?this.axis+"-resize":e);d.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(g){var e=this.helper,a=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;a=d.apply(this,[g,g.pageX-a.left||0,g.pageY-a.top||0]);if(this._aspectRatio||g.shiftKey)a=this._updateRatio(a,g);a=this._respectSize(a,g);this._propagate("resize", +g);e.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(a);this._trigger("resize",g,this.ui());return false},_mouseStop:function(g){this.resizing=false;var e=this.options,a=this;if(this._helper){var d=this._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName);d=h&&b.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height; +h={width:a.size.width-(h?0:a.sizeDiff.width),height:a.size.height-d};d=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var i=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;e.animate||this.element.css(b.extend(h,{top:i,left:d}));a.helper.height(a.size.height);a.helper.width(a.size.width);this._helper&&!e.animate&&this._proportionallyResize()}b("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop", +g);this._helper&&this.helper.remove();return false},_updateCache:function(g){this.offset=this.helper.offset();if(f(g.left))this.position.left=g.left;if(f(g.top))this.position.top=g.top;if(f(g.height))this.size.height=g.height;if(f(g.width))this.size.width=g.width},_updateRatio:function(g){var e=this.position,a=this.size,d=this.axis;if(g.height)g.width=a.height*this.aspectRatio;else if(g.width)g.height=a.width/this.aspectRatio;if(d=="sw"){g.left=e.left+(a.width-g.width);g.top=null}if(d=="nw"){g.top= +e.top+(a.height-g.height);g.left=e.left+(a.width-g.width)}return g},_respectSize:function(g){var e=this.options,a=this.axis,d=f(g.width)&&e.maxWidth&&e.maxWidth<g.width,h=f(g.height)&&e.maxHeight&&e.maxHeight<g.height,i=f(g.width)&&e.minWidth&&e.minWidth>g.width,j=f(g.height)&&e.minHeight&&e.minHeight>g.height;if(i)g.width=e.minWidth;if(j)g.height=e.minHeight;if(d)g.width=e.maxWidth;if(h)g.height=e.maxHeight;var n=this.originalPosition.left+this.originalSize.width,q=this.position.top+this.size.height, +l=/sw|nw|w/.test(a);a=/nw|ne|n/.test(a);if(i&&l)g.left=n-e.minWidth;if(d&&l)g.left=n-e.maxWidth;if(j&&a)g.top=q-e.minHeight;if(h&&a)g.top=q-e.maxHeight;if((e=!g.width&&!g.height)&&!g.left&&g.top)g.top=null;else if(e&&!g.top&&g.left)g.left=null;return g},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var g=this.helper||this.element,e=0;e<this._proportionallyResizeElements.length;e++){var a=this._proportionallyResizeElements[e];if(!this.borderDif){var d=[a.css("borderTopWidth"), +a.css("borderRightWidth"),a.css("borderBottomWidth"),a.css("borderLeftWidth")],h=[a.css("paddingTop"),a.css("paddingRight"),a.css("paddingBottom"),a.css("paddingLeft")];this.borderDif=b.map(d,function(i,j){i=parseInt(i,10)||0;j=parseInt(h[j],10)||0;return i+j})}b.browser.msie&&(b(g).is(":hidden")||b(g).parents(":hidden").length)||a.css({height:g.height()-this.borderDif[0]-this.borderDif[2]||0,width:g.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var g=this.options;this.elementOffset= +this.element.offset();if(this._helper){this.helper=this.helper||b('<div style="overflow:hidden;"></div>');var e=b.browser.msie&&b.browser.version<7,a=e?1:0;e=e?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+e,height:this.element.outerHeight()+e,position:"absolute",left:this.elementOffset.left-a+"px",top:this.elementOffset.top-a+"px",zIndex:++g.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(g,e){return{width:this.originalSize.width+ +e}},w:function(g,e){return{left:this.originalPosition.left+e,width:this.originalSize.width-e}},n:function(g,e,a){return{top:this.originalPosition.top+a,height:this.originalSize.height-a}},s:function(g,e,a){return{height:this.originalSize.height+a}},se:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,e,a]))},sw:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,e,a]))},ne:function(g,e,a){return b.extend(this._change.n.apply(this, +arguments),this._change.e.apply(this,[g,e,a]))},nw:function(g,e,a){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,e,a]))}},_propagate:function(g,e){b.ui.plugin.call(this,g,[e,this.ui()]);g!="resize"&&this._trigger(g,e,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});b.extend(b.ui.resizable, +{version:"1.8.7"});b.ui.plugin.add("resizable","alsoResize",{start:function(){var g=b(this).data("resizable").options,e=function(a){b(a).each(function(){var d=b(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof g.alsoResize=="object"&&!g.alsoResize.parentNode)if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];e(g.alsoResize)}else b.each(g.alsoResize, +function(a){e(a)});else e(g.alsoResize)},resize:function(g,e){var a=b(this).data("resizable");g=a.options;var d=a.originalSize,h=a.originalPosition,i={height:a.size.height-d.height||0,width:a.size.width-d.width||0,top:a.position.top-h.top||0,left:a.position.left-h.left||0},j=function(n,q){b(n).each(function(){var l=b(this),k=b(this).data("resizable-alsoresize"),m={},o=q&&q.length?q:l.parents(e.originalElement[0]).length?["width","height"]:["width","height","top","left"];b.each(o,function(p,s){if((p= +(k[s]||0)+(i[s]||0))&&p>=0)m[s]=p||null});if(b.browser.opera&&/relative/.test(l.css("position"))){a._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(m)})};typeof g.alsoResize=="object"&&!g.alsoResize.nodeType?b.each(g.alsoResize,function(n,q){j(n,q)}):j(g.alsoResize)},stop:function(){var g=b(this).data("resizable"),e=g.options,a=function(d){b(d).each(function(){var h=b(this);h.css({position:h.data("resizable-alsoresize").position})})};if(g._revertToRelativePosition){g._revertToRelativePosition= +false;typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?b.each(e.alsoResize,function(d){a(d)}):a(e.alsoResize)}b(this).removeData("resizable-alsoresize")}});b.ui.plugin.add("resizable","animate",{stop:function(g){var e=b(this).data("resizable"),a=e.options,d=e._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName),i=h&&b.ui.hasScroll(d[0],"left")?0:e.sizeDiff.height;h={width:e.size.width-(h?0:e.sizeDiff.width),height:e.size.height-i};i=parseInt(e.element.css("left"),10)+(e.position.left- +e.originalPosition.left)||null;var j=parseInt(e.element.css("top"),10)+(e.position.top-e.originalPosition.top)||null;e.element.animate(b.extend(h,j&&i?{top:j,left:i}:{}),{duration:a.animateDuration,easing:a.animateEasing,step:function(){var n={width:parseInt(e.element.css("width"),10),height:parseInt(e.element.css("height"),10),top:parseInt(e.element.css("top"),10),left:parseInt(e.element.css("left"),10)};d&&d.length&&b(d[0]).css({width:n.width,height:n.height});e._updateCache(n);e._propagate("resize", +g)}})}});b.ui.plugin.add("resizable","containment",{start:function(){var g=b(this).data("resizable"),e=g.element,a=g.options.containment;if(e=a instanceof b?a.get(0):/parent/.test(a)?e.parent().get(0):a){g.containerElement=b(e);if(/document/.test(a)||a==document){g.containerOffset={left:0,top:0};g.containerPosition={left:0,top:0};g.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var d=b(e),h=[];b(["Top", +"Right","Left","Bottom"]).each(function(n,q){h[n]=c(d.css("padding"+q))});g.containerOffset=d.offset();g.containerPosition=d.position();g.containerSize={height:d.innerHeight()-h[3],width:d.innerWidth()-h[1]};a=g.containerOffset;var i=g.containerSize.height,j=g.containerSize.width;j=b.ui.hasScroll(e,"left")?e.scrollWidth:j;i=b.ui.hasScroll(e)?e.scrollHeight:i;g.parentData={element:e,left:a.left,top:a.top,width:j,height:i}}}},resize:function(g){var e=b(this).data("resizable"),a=e.options,d=e.containerOffset, +h=e.position;g=e._aspectRatio||g.shiftKey;var i={top:0,left:0},j=e.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))i=d;if(h.left<(e._helper?d.left:0)){e.size.width+=e._helper?e.position.left-d.left:e.position.left-i.left;if(g)e.size.height=e.size.width/a.aspectRatio;e.position.left=a.helper?d.left:0}if(h.top<(e._helper?d.top:0)){e.size.height+=e._helper?e.position.top-d.top:e.position.top;if(g)e.size.width=e.size.height*a.aspectRatio;e.position.top=e._helper?d.top:0}e.offset.left= +e.parentData.left+e.position.left;e.offset.top=e.parentData.top+e.position.top;a=Math.abs((e._helper?e.offset.left-i.left:e.offset.left-i.left)+e.sizeDiff.width);d=Math.abs((e._helper?e.offset.top-i.top:e.offset.top-d.top)+e.sizeDiff.height);h=e.containerElement.get(0)==e.element.parent().get(0);i=/relative|absolute/.test(e.containerElement.css("position"));if(h&&i)a-=e.parentData.left;if(a+e.size.width>=e.parentData.width){e.size.width=e.parentData.width-a;if(g)e.size.height=e.size.width/e.aspectRatio}if(d+ +e.size.height>=e.parentData.height){e.size.height=e.parentData.height-d;if(g)e.size.width=e.size.height*e.aspectRatio}},stop:function(){var g=b(this).data("resizable"),e=g.options,a=g.containerOffset,d=g.containerPosition,h=g.containerElement,i=b(g.helper),j=i.offset(),n=i.outerWidth()-g.sizeDiff.width;i=i.outerHeight()-g.sizeDiff.height;g._helper&&!e.animate&&/relative/.test(h.css("position"))&&b(this).css({left:j.left-d.left-a.left,width:n,height:i});g._helper&&!e.animate&&/static/.test(h.css("position"))&& +b(this).css({left:j.left-d.left-a.left,width:n,height:i})}});b.ui.plugin.add("resizable","ghost",{start:function(){var g=b(this).data("resizable"),e=g.options,a=g.size;g.ghost=g.originalElement.clone();g.ghost.css({opacity:0.25,display:"block",position:"relative",height:a.height,width:a.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:"");g.ghost.appendTo(g.helper)},resize:function(){var g=b(this).data("resizable");g.ghost&&g.ghost.css({position:"relative", +height:g.size.height,width:g.size.width})},stop:function(){var g=b(this).data("resizable");g.ghost&&g.helper&&g.helper.get(0).removeChild(g.ghost.get(0))}});b.ui.plugin.add("resizable","grid",{resize:function(){var g=b(this).data("resizable"),e=g.options,a=g.size,d=g.originalSize,h=g.originalPosition,i=g.axis;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var j=Math.round((a.width-d.width)/(e.grid[0]||1))*(e.grid[0]||1);e=Math.round((a.height-d.height)/(e.grid[1]||1))*(e.grid[1]||1);if(/^(se|s|e)$/.test(i)){g.size.width= +d.width+j;g.size.height=d.height+e}else if(/^(ne)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}else{if(/^(sw)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e}else{g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}g.position.left=h.left-j}}});var c=function(g){return parseInt(g,10)||0},f=function(g){return!isNaN(parseInt(g,10))}})(jQuery); +(function(b){b.widget("ui.selectable",b.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=b(c.options.filter,c.element[0]);f.each(function(){var g=b(this),e=g.offset();b.data(this,"selectable-item",{element:this,$element:g,left:e.left,top:e.top,right:e.left+g.outerWidth(),bottom:e.top+g.outerHeight(),startselected:false,selected:g.hasClass("ui-selected"), +selecting:g.hasClass("ui-selecting"),unselecting:g.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=b("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var g=this.options;this.selectees=b(g.filter,this.element[0]);this._trigger("start",c);b(g.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});g.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var e=b.data(this,"selectable-item");e.startselected=true;if(!c.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;f._trigger("unselecting", +c,{unselecting:e.element})}});b(c.target).parents().andSelf().each(function(){var e=b.data(this,"selectable-item");if(e){var a=!c.metaKey||!e.$element.hasClass("ui-selected");e.$element.removeClass(a?"ui-unselecting":"ui-selected").addClass(a?"ui-selecting":"ui-unselecting");e.unselecting=!a;e.selecting=a;(e.selected=a)?f._trigger("selecting",c,{selecting:e.element}):f._trigger("unselecting",c,{unselecting:e.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var g= +this.options,e=this.opos[0],a=this.opos[1],d=c.pageX,h=c.pageY;if(e>d){var i=d;d=e;e=i}if(a>h){i=h;h=a;a=i}this.helper.css({left:e,top:a,width:d-e,height:h-a});this.selectees.each(function(){var j=b.data(this,"selectable-item");if(!(!j||j.element==f.element[0])){var n=false;if(g.tolerance=="touch")n=!(j.left>d||j.right<e||j.top>h||j.bottom<a);else if(g.tolerance=="fit")n=j.left>e&&j.right<d&&j.top>a&&j.bottom<h;if(n){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting"); +j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;f._trigger("selecting",c,{selecting:j.element})}}else{if(j.selecting)if(c.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}f._trigger("unselecting",c,{unselecting:j.element})}if(j.selected)if(!c.metaKey&& +!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;f._trigger("unselecting",c,{unselecting:j.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;b(".ui-unselecting",this.element[0]).each(function(){var g=b.data(this,"selectable-item");g.$element.removeClass("ui-unselecting");g.unselecting=false;g.startselected=false;f._trigger("unselected",c,{unselected:g.element})});b(".ui-selecting",this.element[0]).each(function(){var g= +b.data(this,"selectable-item");g.$element.removeClass("ui-selecting").addClass("ui-selected");g.selecting=false;g.selected=true;g.startselected=true;f._trigger("selected",c,{selected:g.element})});this._trigger("stop",c);this.helper.remove();return false}});b.extend(b.ui.selectable,{version:"1.8.7"})})(jQuery); +(function(b){b.widget("ui.sortable",b.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var c=this.items.length-1;c>=0;c--)this.items[c].item.removeData("sortable-item");return this},_setOption:function(c,f){if(c==="disabled"){this.options[c]=f;this.widget()[f?"addClass":"removeClass"]("ui-sortable-disabled")}else b.Widget.prototype._setOption.apply(this, +arguments)},_mouseCapture:function(c,f){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(c);var g=null,e=this;b(c.target).parents().each(function(){if(b.data(this,"sortable-item")==e){g=b(this);return false}});if(b.data(c.target,"sortable-item")==e)g=b(c.target);if(!g)return false;if(this.options.handle&&!f){var a=false;b(this.options.handle,g).find("*").andSelf().each(function(){if(this==c.target)a=true});if(!a)return false}this.currentItem= +g;this._removeCurrentsFromItems();return true},_mouseStart:function(c,f,g){f=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(c);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");b.extend(this.offset, +{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();f.containment&&this._setContainment(); +if(f.cursor){if(b("body").css("cursor"))this._storedCursor=b("body").css("cursor");b("body").css("cursor",f.cursor)}if(f.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",f.opacity)}if(f.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",f.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start", +c,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!g)for(g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",c,e._uiHash(this));if(b.ui.ddmanager)b.ui.ddmanager.current=this;b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(c);return true},_mouseDrag:function(c){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute"); +if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var f=this.options,g=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-c.pageY<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop+f.scrollSpeed;else if(c.pageY-this.overflowOffset.top<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop-f.scrollSpeed;if(this.overflowOffset.left+ +this.scrollParent[0].offsetWidth-c.pageX<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft+f.scrollSpeed;else if(c.pageX-this.overflowOffset.left<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft-f.scrollSpeed}else{if(c.pageY-b(document).scrollTop()<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()-f.scrollSpeed);else if(b(window).height()-(c.pageY-b(document).scrollTop())<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()+ +f.scrollSpeed);if(c.pageX-b(document).scrollLeft()<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()-f.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()+f.scrollSpeed)}g!==false&&b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+ +"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(f=this.items.length-1;f>=0;f--){g=this.items[f];var e=g.item[0],a=this._intersectsWithPointer(g);if(a)if(e!=this.currentItem[0]&&this.placeholder[a==1?"next":"prev"]()[0]!=e&&!b.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!b.ui.contains(this.element[0],e):true)){this.direction=a==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(g))this._rearrange(c, +g);else break;this._trigger("change",c,this._uiHash());break}}this._contactContainers(c);b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);this._trigger("sort",c,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,f){if(c){b.ui.ddmanager&&!this.options.dropBehaviour&&b.ui.ddmanager.drop(this,c);if(this.options.revert){var g=this;f=g.placeholder.offset();g.reverting=true;b(this.helper).animate({left:f.left-this.offset.parent.left-g.margins.left+(this.offsetParent[0]== +document.body?0:this.offsetParent[0].scrollLeft),top:f.top-this.offset.parent.top-g.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){g._clear(c)})}else this._clear(c,f);return false}},cancel:function(){var c=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var f=this.containers.length-1;f>=0;f--){this.containers[f]._trigger("deactivate", +null,c._uiHash(this));if(this.containers[f].containerCache.over){this.containers[f]._trigger("out",null,c._uiHash(this));this.containers[f].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();b.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?b(this.domPosition.prev).after(this.currentItem): +b(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};b(f).each(function(){var e=(b(c.item||this).attr(c.attribute||"id")||"").match(c.expression||/(.+)[-=_](.+)/);if(e)g.push((c.key||e[1]+"[]")+"="+(c.key&&c.expression?e[1]:e[2]))});!g.length&&c.key&&g.push(c.key+"=");return g.join("&")},toArray:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};f.each(function(){g.push(b(c.item||this).attr(c.attribute|| +"id")||"")});return g},_intersectsWith:function(c){var f=this.positionAbs.left,g=f+this.helperProportions.width,e=this.positionAbs.top,a=e+this.helperProportions.height,d=c.left,h=d+c.width,i=c.top,j=i+c.height,n=this.offset.click.top,q=this.offset.click.left;n=e+n>i&&e+n<j&&f+q>d&&f+q<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>c[this.floating?"width":"height"]?n:d<f+ +this.helperProportions.width/2&&g-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&a-this.helperProportions.height/2<j},_intersectsWithPointer:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left,c.width);f=f&&c;c=this._getDragVerticalDirection();var g=this._getDragHorizontalDirection();if(!f)return false;return this.floating?g&&g=="right"||c=="down"?2:1:c&&(c=="down"? +2:1)},_intersectsWithSides:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top+c.height/2,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left+c.width/2,c.width);var g=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&c||e=="left"&&!c:g&&(g=="down"&&f||g=="up"&&!f)},_getDragVerticalDirection:function(){var c=this.positionAbs.top-this.lastPositionAbs.top;return c!=0&&(c>0?"down":"up")}, +_getDragHorizontalDirection:function(){var c=this.positionAbs.left-this.lastPositionAbs.left;return c!=0&&(c>0?"right":"left")},refresh:function(c){this._refreshItems(c);this.refreshPositions();return this},_connectWith:function(){var c=this.options;return c.connectWith.constructor==String?[c.connectWith]:c.connectWith},_getItemsAsjQuery:function(c){var f=[],g=[],e=this._connectWith();if(e&&c)for(c=e.length-1;c>=0;c--)for(var a=b(e[c]),d=a.length-1;d>=0;d--){var h=b.data(a[d],"sortable");if(h&&h!= +this&&!h.options.disabled)g.push([b.isFunction(h.options.items)?h.options.items.call(h.element):b(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}g.push([b.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):b(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(c=g.length-1;c>=0;c--)g[c][0].each(function(){f.push(this)});return b(f)},_removeCurrentsFromItems:function(){for(var c= +this.currentItem.find(":data(sortable-item)"),f=0;f<this.items.length;f++)for(var g=0;g<c.length;g++)c[g]==this.items[f].item[0]&&this.items.splice(f,1)},_refreshItems:function(c){this.items=[];this.containers=[this];var f=this.items,g=[[b.isFunction(this.options.items)?this.options.items.call(this.element[0],c,{item:this.currentItem}):b(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var a=e.length-1;a>=0;a--)for(var d=b(e[a]),h=d.length-1;h>=0;h--){var i=b.data(d[h],"sortable"); +if(i&&i!=this&&!i.options.disabled){g.push([b.isFunction(i.options.items)?i.options.items.call(i.element[0],c,{item:this.currentItem}):b(i.options.items,i.element),i]);this.containers.push(i)}}for(a=g.length-1;a>=0;a--){c=g[a][1];e=g[a][0];h=0;for(d=e.length;h<d;h++){i=b(e[h]);i.data("sortable-item",c);f.push({item:i,instance:c,width:0,height:0,left:0,top:0})}}},refreshPositions:function(c){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var f=this.items.length-1;f>= +0;f--){var g=this.items[f],e=this.options.toleranceElement?b(this.options.toleranceElement,g.item):g.item;if(!c){g.width=e.outerWidth();g.height=e.outerHeight()}e=e.offset();g.left=e.left;g.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(f=this.containers.length-1;f>=0;f--){e=this.containers[f].element.offset();this.containers[f].containerCache.left=e.left;this.containers[f].containerCache.top=e.top;this.containers[f].containerCache.width= +this.containers[f].element.outerWidth();this.containers[f].containerCache.height=this.containers[f].element.outerHeight()}return this},_createPlaceholder:function(c){var f=c||this,g=f.options;if(!g.placeholder||g.placeholder.constructor==String){var e=g.placeholder;g.placeholder={element:function(){var a=b(document.createElement(f.currentItem[0].nodeName)).addClass(e||f.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)a.style.visibility="hidden";return a}, +update:function(a,d){if(!(e&&!g.forcePlaceholderSize)){d.height()||d.height(f.currentItem.innerHeight()-parseInt(f.currentItem.css("paddingTop")||0,10)-parseInt(f.currentItem.css("paddingBottom")||0,10));d.width()||d.width(f.currentItem.innerWidth()-parseInt(f.currentItem.css("paddingLeft")||0,10)-parseInt(f.currentItem.css("paddingRight")||0,10))}}}}f.placeholder=b(g.placeholder.element.call(f.element,f.currentItem));f.currentItem.after(f.placeholder);g.placeholder.update(f,f.placeholder)},_contactContainers:function(c){for(var f= +null,g=null,e=this.containers.length-1;e>=0;e--)if(!b.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(f&&b.ui.contains(this.containers[e].element[0],f.element[0]))){f=this.containers[e];g=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",c,this._uiHash(this));this.containers[e].containerCache.over=0}if(f)if(this.containers.length===1){this.containers[g]._trigger("over",c,this._uiHash(this)); +this.containers[g].containerCache.over=1}else if(this.currentContainer!=this.containers[g]){f=1E4;e=null;for(var a=this.positionAbs[this.containers[g].floating?"left":"top"],d=this.items.length-1;d>=0;d--)if(b.ui.contains(this.containers[g].element[0],this.items[d].item[0])){var h=this.items[d][this.containers[g].floating?"left":"top"];if(Math.abs(h-a)<f){f=Math.abs(h-a);e=this.items[d]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[g];e?this._rearrange(c,e,null,true):this._rearrange(c, +null,this.containers[g].element,true);this._trigger("change",c,this._uiHash());this.containers[g]._trigger("change",c,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[g]._trigger("over",c,this._uiHash(this));this.containers[g].containerCache.over=1}}},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c,this.currentItem])):f.helper=="clone"?this.currentItem.clone():this.currentItem;c.parents("body").length|| +b(f.appendTo!="parent"?f.appendTo:this.currentItem[0].parentNode)[0].appendChild(c[0]);if(c[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(c[0].style.width==""||f.forceHelperSize)c.width(this.currentItem.width());if(c[0].style.height==""||f.forceHelperSize)c.height(this.currentItem.height());return c},_adjustOffsetFromHelper:function(c){if(typeof c== +"string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]||0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition== +"absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition== +"relative"){var c=this.currentItem.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}}, +_setContainment:function(){var c=this.options;if(c.containment=="parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height- +this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)){var f=b(c.containment)[0];c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"),10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"), +10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))? +this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f= +this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var a=c.pageX,d=c.pageY;if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+ +this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])? +d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): +e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_rearrange:function(c,f,g,e){g?g[0].appendChild(this.placeholder[0]):f.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?f.item[0]:f.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var a=this,d=this.counter;window.setTimeout(function(){d== +a.counter&&a.refreshPositions(!e)},0)},_clear:function(c,f){this.reverting=false;var g=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!f&&g.push(function(a){this._trigger("receive", +a,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!f)g.push(function(a){this._trigger("update",a,this._uiHash())});if(!b.ui.contains(this.element[0],this.currentItem[0])){f||g.push(function(a){this._trigger("remove",a,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(b.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!f){g.push(function(a){return function(d){a._trigger("receive", +d,this._uiHash(this))}}.call(this,this.containers[e]));g.push(function(a){return function(d){a._trigger("update",d,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){f||g.push(function(a){return function(d){a._trigger("deactivate",d,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){g.push(function(a){return function(d){a._trigger("out",d,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over= +0}}this._storedCursor&&b("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!f){this._trigger("beforeStop",c,this._uiHash());for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}return false}f||this._trigger("beforeStop",c,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]); +this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!f){for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){b.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(c){var f=c||this;return{helper:f.helper,placeholder:f.placeholder||b([]),position:f.position,originalPosition:f.originalPosition,offset:f.positionAbs,item:f.currentItem,sender:c?c.element:null}}}); +b.extend(b.ui.sortable,{version:"1.8.7"})})(jQuery); +jQuery.effects||function(b,c){function f(l){var k;if(l&&l.constructor==Array&&l.length==3)return l;if(k=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(l))return[parseInt(k[1],10),parseInt(k[2],10),parseInt(k[3],10)];if(k=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(l))return[parseFloat(k[1])*2.55,parseFloat(k[2])*2.55,parseFloat(k[3])*2.55];if(k=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(l))return[parseInt(k[1],16), +parseInt(k[2],16),parseInt(k[3],16)];if(k=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(l))return[parseInt(k[1]+k[1],16),parseInt(k[2]+k[2],16),parseInt(k[3]+k[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(l))return j.transparent;return j[b.trim(l).toLowerCase()]}function g(l,k){var m;do{m=b.curCSS(l,k);if(m!=""&&m!="transparent"||b.nodeName(l,"body"))break;k="backgroundColor"}while(l=l.parentNode);return f(m)}function e(){var l=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +k={},m,o;if(l&&l.length&&l[0]&&l[l[0]])for(var p=l.length;p--;){m=l[p];if(typeof l[m]=="string"){o=m.replace(/\-(\w)/g,function(s,r){return r.toUpperCase()});k[o]=l[m]}}else for(m in l)if(typeof l[m]==="string")k[m]=l[m];return k}function a(l){var k,m;for(k in l){m=l[k];if(m==null||b.isFunction(m)||k in q||/scrollbar/.test(k)||!/color/i.test(k)&&isNaN(parseFloat(m)))delete l[k]}return l}function d(l,k){var m={_:0},o;for(o in k)if(l[o]!=k[o])m[o]=k[o];return m}function h(l,k,m,o){if(typeof l=="object"){o= +k;m=null;k=l;l=k.effect}if(b.isFunction(k)){o=k;m=null;k={}}if(typeof k=="number"||b.fx.speeds[k]){o=m;m=k;k={}}if(b.isFunction(m)){o=m;m=null}k=k||{};m=m||k.duration;m=b.fx.off?0:typeof m=="number"?m:m in b.fx.speeds?b.fx.speeds[m]:b.fx.speeds._default;o=o||k.complete;return[l,k,m,o]}function i(l){if(!l||typeof l==="number"||b.fx.speeds[l])return true;if(typeof l==="string"&&!b.effects[l])return true;return false}b.effects={};b.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(l,k){b.fx.step[k]=function(m){if(!m.colorInit){m.start=g(m.elem,k);m.end=f(m.end);m.colorInit=true}m.elem.style[k]="rgb("+Math.max(Math.min(parseInt(m.pos*(m.end[0]-m.start[0])+m.start[0],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[1]-m.start[1])+m.start[1],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[2]-m.start[2])+m.start[2],10),255),0)+")"}});var j={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},n=["add","remove","toggle"],q={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};b.effects.animateClass=function(l,k,m, +o){if(b.isFunction(m)){o=m;m=null}return this.each(function(){b.queue(this,"fx",function(){var p=b(this),s=p.attr("style")||" ",r=a(e.call(this)),u,v=p.attr("className");b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});u=a(e.call(this));p.attr("className",v);p.animate(d(r,u),k,m,function(){b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});if(typeof p.attr("style")=="object"){p.attr("style").cssText="";p.attr("style").cssText=s}else p.attr("style",s);o&&o.apply(this,arguments)});r=b.queue(this);u= +r.splice(r.length-1,1)[0];r.splice(1,0,u);b.dequeue(this)})})};b.fn.extend({_addClass:b.fn.addClass,addClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{add:l},k,m,o]):this._addClass(l)},_removeClass:b.fn.removeClass,removeClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{remove:l},k,m,o]):this._removeClass(l)},_toggleClass:b.fn.toggleClass,toggleClass:function(l,k,m,o,p){return typeof k=="boolean"||k===c?m?b.effects.animateClass.apply(this,[k?{add:l}:{remove:l}, +m,o,p]):this._toggleClass(l,k):b.effects.animateClass.apply(this,[{toggle:l},k,m,o])},switchClass:function(l,k,m,o,p){return b.effects.animateClass.apply(this,[{add:k,remove:l},m,o,p])}});b.extend(b.effects,{version:"1.8.7",save:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.data("ec.storage."+k[m],l[0].style[k[m]])},restore:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.css(k[m],l.data("ec.storage."+k[m]))},setMode:function(l,k){if(k=="toggle")k=l.is(":hidden")?"show":"hide"; +return k},getBaseline:function(l,k){var m;switch(l[0]){case "top":m=0;break;case "middle":m=0.5;break;case "bottom":m=1;break;default:m=l[0]/k.height}switch(l[1]){case "left":l=0;break;case "center":l=0.5;break;case "right":l=1;break;default:l=l[1]/k.width}return{x:l,y:m}},createWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent();var k={width:l.outerWidth(true),height:l.outerHeight(true),"float":l.css("float")},m=b("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%", +background:"transparent",border:"none",margin:0,padding:0});l.wrap(m);m=l.parent();if(l.css("position")=="static"){m.css({position:"relative"});l.css({position:"relative"})}else{b.extend(k,{position:l.css("position"),zIndex:l.css("z-index")});b.each(["top","left","bottom","right"],function(o,p){k[p]=l.css(p);if(isNaN(parseInt(k[p],10)))k[p]="auto"});l.css({position:"relative",top:0,left:0})}return m.css(k).show()},removeWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent().replaceWith(l); +return l},setTransition:function(l,k,m,o){o=o||{};b.each(k,function(p,s){unit=l.cssUnit(s);if(unit[0]>0)o[s]=unit[0]*m+unit[1]});return o}});b.fn.extend({effect:function(l){var k=h.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var o=b.effects[l];if(b.fx.off||!o)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)});return o.call(this,m)},_show:b.fn.show,show:function(l){if(i(l))return this._show.apply(this,arguments); +else{var k=h.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:b.fn.hide,hide:function(l){if(i(l))return this._hide.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:b.fn.toggle,toggle:function(l){if(i(l)||typeof l==="boolean"||b.isFunction(l))return this.__toggle.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(l){var k=this.css(l), +m=[];b.each(["em","px","%","pt"],function(o,p){if(k.indexOf(p)>0)m=[parseFloat(k),p]});return m}});b.easing.jswing=b.easing.swing;b.extend(b.easing,{def:"easeOutQuad",swing:function(l,k,m,o,p){return b.easing[b.easing.def](l,k,m,o,p)},easeInQuad:function(l,k,m,o,p){return o*(k/=p)*k+m},easeOutQuad:function(l,k,m,o,p){return-o*(k/=p)*(k-2)+m},easeInOutQuad:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k+m;return-o/2*(--k*(k-2)-1)+m},easeInCubic:function(l,k,m,o,p){return o*(k/=p)*k*k+m},easeOutCubic:function(l, +k,m,o,p){return o*((k=k/p-1)*k*k+1)+m},easeInOutCubic:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k+m;return o/2*((k-=2)*k*k+2)+m},easeInQuart:function(l,k,m,o,p){return o*(k/=p)*k*k*k+m},easeOutQuart:function(l,k,m,o,p){return-o*((k=k/p-1)*k*k*k-1)+m},easeInOutQuart:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k+m;return-o/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(l,k,m,o,p){return o*(k/=p)*k*k*k*k+m},easeOutQuint:function(l,k,m,o,p){return o*((k=k/p-1)*k*k*k*k+1)+m},easeInOutQuint:function(l, +k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k*k+m;return o/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(l,k,m,o,p){return-o*Math.cos(k/p*(Math.PI/2))+o+m},easeOutSine:function(l,k,m,o,p){return o*Math.sin(k/p*(Math.PI/2))+m},easeInOutSine:function(l,k,m,o,p){return-o/2*(Math.cos(Math.PI*k/p)-1)+m},easeInExpo:function(l,k,m,o,p){return k==0?m:o*Math.pow(2,10*(k/p-1))+m},easeOutExpo:function(l,k,m,o,p){return k==p?m+o:o*(-Math.pow(2,-10*k/p)+1)+m},easeInOutExpo:function(l,k,m,o,p){if(k==0)return m;if(k== +p)return m+o;if((k/=p/2)<1)return o/2*Math.pow(2,10*(k-1))+m;return o/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(l,k,m,o,p){return-o*(Math.sqrt(1-(k/=p)*k)-1)+m},easeOutCirc:function(l,k,m,o,p){return o*Math.sqrt(1-(k=k/p-1)*k)+m},easeInOutCirc:function(l,k,m,o,p){if((k/=p/2)<1)return-o/2*(Math.sqrt(1-k*k)-1)+m;return o/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l= +s/(2*Math.PI)*Math.asin(o/r);return-(r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s))+m},easeOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/r);return r*Math.pow(2,-10*k)*Math.sin((k*p-l)*2*Math.PI/s)+o+m},easeInOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p/2)==2)return m+o;s||(s=p*0.3*1.5);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/ +r);if(k<1)return-0.5*r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)+m;return r*Math.pow(2,-10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)*0.5+o+m},easeInBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*(k/=p)*k*((s+1)*k-s)+m},easeOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*((k=k/p-1)*k*((s+1)*k+s)+1)+m},easeInOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;if((k/=p/2)<1)return o/2*k*k*(((s*=1.525)+1)*k-s)+m;return o/2*((k-=2)*k*(((s*=1.525)+1)*k+s)+2)+m},easeInBounce:function(l, +k,m,o,p){return o-b.easing.easeOutBounce(l,p-k,0,o,p)+m},easeOutBounce:function(l,k,m,o,p){return(k/=p)<1/2.75?o*7.5625*k*k+m:k<2/2.75?o*(7.5625*(k-=1.5/2.75)*k+0.75)+m:k<2.5/2.75?o*(7.5625*(k-=2.25/2.75)*k+0.9375)+m:o*(7.5625*(k-=2.625/2.75)*k+0.984375)+m},easeInOutBounce:function(l,k,m,o,p){if(k<p/2)return b.easing.easeInBounce(l,k*2,0,o,p)*0.5+m;return b.easing.easeOutBounce(l,k*2-p,0,o,p)*0.5+o*0.5+m}})}(jQuery); +(function(b){b.effects.blind=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"}),h=a=="vertical"?"height":"width";a=a=="vertical"?d.height():d.width();e=="show"&&d.css(h,0);var i={};i[h]=e=="show"?a:0;d.animate(i,c.duration,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f); +c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery); +(function(b){b.effects.bounce=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"effect"),a=c.options.direction||"up",d=c.options.distance||20,h=c.options.times||5,i=c.duration||250;/show|hide/.test(e)&&g.push("opacity");b.effects.save(f,g);f.show();b.effects.createWrapper(f);var j=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";d=c.options.distance||(j=="top"?f.outerHeight({margin:true})/3:f.outerWidth({margin:true})/ +3);if(e=="show")f.css("opacity",0).css(j,a=="pos"?-d:d);if(e=="hide")d/=h*2;e!="hide"&&h--;if(e=="show"){var n={opacity:1};n[j]=(a=="pos"?"+=":"-=")+d;f.animate(n,i/2,c.options.easing);d/=2;h--}for(n=0;n<h;n++){var q={},l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing);d=e=="hide"?d*2:d/2}if(e=="hide"){n={opacity:0};n[j]=(a=="pos"?"-=":"+=")+d;f.animate(n,i/2,c.options.easing,function(){f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f); +c.callback&&c.callback.apply(this,arguments)})}else{q={};l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)})}f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery); +(function(b){b.effects.clip=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","height","width"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"});d=f[0].tagName=="IMG"?d:f;var h={size:a=="vertical"?"height":"width",position:a=="vertical"?"top":"left"};a=a=="vertical"?d.height():d.width();if(e=="show"){d.css(h.size,0);d.css(h.position,a/2)}var i={};i[h.size]= +e=="show"?a:0;i[h.position]=e=="show"?0:a/2;d.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.drop=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","opacity"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f);var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true})/2:f.outerWidth({margin:true})/2);if(e=="show")f.css("opacity",0).css(d,a=="pos"?-h:h);var i={opacity:e=="show"?1: +0};i[d]=(e=="show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.explode=function(c){return this.queue(function(){var f=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3,g=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;c.options.mode=c.options.mode=="toggle"?b(this).is(":visible")?"hide":"show":c.options.mode;var e=b(this).show().css("visibility","hidden"),a=e.offset();a.top-=parseInt(e.css("marginTop"),10)||0;a.left-=parseInt(e.css("marginLeft"),10)||0;for(var d=e.outerWidth(true),h=e.outerHeight(true),i=0;i<f;i++)for(var j= +0;j<g;j++)e.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(d/g),top:-i*(h/f)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:d/g,height:h/f,left:a.left+j*(d/g)+(c.options.mode=="show"?(j-Math.floor(g/2))*(d/g):0),top:a.top+i*(h/f)+(c.options.mode=="show"?(i-Math.floor(f/2))*(h/f):0),opacity:c.options.mode=="show"?0:1}).animate({left:a.left+j*(d/g)+(c.options.mode=="show"?0:(j-Math.floor(g/2))*(d/g)),top:a.top+ +i*(h/f)+(c.options.mode=="show"?0:(i-Math.floor(f/2))*(h/f)),opacity:c.options.mode=="show"?1:0},c.duration||500);setTimeout(function(){c.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide();c.callback&&c.callback.apply(e[0]);e.dequeue();b("div.ui-effects-explode").remove()},c.duration||500)})}})(jQuery); +(function(b){b.effects.fade=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide");f.animate({opacity:g},{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.fold=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.size||15,d=!!c.options.horizFirst,h=c.duration?c.duration/2:b.fx.speeds._default/2;b.effects.save(f,g);f.show();var i=b.effects.createWrapper(f).css({overflow:"hidden"}),j=e=="show"!=d,n=j?["width","height"]:["height","width"];j=j?[i.width(),i.height()]:[i.height(),i.width()];var q=/([0-9]+)%/.exec(a);if(q)a=parseInt(q[1],10)/100* +j[e=="hide"?0:1];if(e=="show")i.css(d?{height:0,width:a}:{height:a,width:0});d={};q={};d[n[0]]=e=="show"?j[0]:a;q[n[1]]=e=="show"?j[1]:0;i.animate(d,h,c.options.easing).animate(q,h,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery); +(function(b){b.effects.highlight=function(c){return this.queue(function(){var f=b(this),g=["backgroundImage","backgroundColor","opacity"],e=b.effects.setMode(f,c.options.mode||"show"),a={backgroundColor:f.css("backgroundColor")};if(e=="hide")a.opacity=0;b.effects.save(f,g);f.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(a,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);e=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.pulsate=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"show");times=(c.options.times||5)*2-1;duration=c.duration?c.duration/2:b.fx.speeds._default/2;isVisible=f.is(":visible");animateTo=0;if(!isVisible){f.css("opacity",0).show();animateTo=1}if(g=="hide"&&isVisible||g=="show"&&!isVisible)times--;for(g=0;g<times;g++){f.animate({opacity:animateTo},duration,c.options.easing);animateTo=(animateTo+1)%2}f.animate({opacity:animateTo},duration, +c.options.easing,function(){animateTo==0&&f.hide();c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()}).dequeue()})}})(jQuery); +(function(b){b.effects.puff=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide"),e=parseInt(c.options.percent,10)||150,a=e/100,d={height:f.height(),width:f.width()};b.extend(c.options,{fade:true,mode:g,percent:g=="hide"?e:100,from:g=="hide"?d:{height:d.height*a,width:d.width*a}});f.effect("scale",c.options,c.duration,c.callback);f.dequeue()})};b.effects.scale=function(c){return this.queue(function(){var f=b(this),g=b.extend(true,{},c.options),e=b.effects.setMode(f, +c.options.mode||"effect"),a=parseInt(c.options.percent,10)||(parseInt(c.options.percent,10)==0?0:e=="hide"?0:100),d=c.options.direction||"both",h=c.options.origin;if(e!="effect"){g.origin=h||["middle","center"];g.restore=true}h={height:f.height(),width:f.width()};f.from=c.options.from||(e=="show"?{height:0,width:0}:h);a={y:d!="horizontal"?a/100:1,x:d!="vertical"?a/100:1};f.to={height:h.height*a.y,width:h.width*a.x};if(c.options.fade){if(e=="show"){f.from.opacity=0;f.to.opacity=1}if(e=="hide"){f.from.opacity= +1;f.to.opacity=0}}g.from=f.from;g.to=f.to;g.mode=e;f.effect("size",g,c.duration,c.callback);f.dequeue()})};b.effects.size=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","width","height","overflow","opacity"],e=["position","top","left","overflow","opacity"],a=["width","height","overflow"],d=["fontSize"],h=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],i=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],j=b.effects.setMode(f, +c.options.mode||"effect"),n=c.options.restore||false,q=c.options.scale||"both",l=c.options.origin,k={height:f.height(),width:f.width()};f.from=c.options.from||k;f.to=c.options.to||k;if(l){l=b.effects.getBaseline(l,k);f.from.top=(k.height-f.from.height)*l.y;f.from.left=(k.width-f.from.width)*l.x;f.to.top=(k.height-f.to.height)*l.y;f.to.left=(k.width-f.to.width)*l.x}var m={from:{y:f.from.height/k.height,x:f.from.width/k.width},to:{y:f.to.height/k.height,x:f.to.width/k.width}};if(q=="box"||q=="both"){if(m.from.y!= +m.to.y){g=g.concat(h);f.from=b.effects.setTransition(f,h,m.from.y,f.from);f.to=b.effects.setTransition(f,h,m.to.y,f.to)}if(m.from.x!=m.to.x){g=g.concat(i);f.from=b.effects.setTransition(f,i,m.from.x,f.from);f.to=b.effects.setTransition(f,i,m.to.x,f.to)}}if(q=="content"||q=="both")if(m.from.y!=m.to.y){g=g.concat(d);f.from=b.effects.setTransition(f,d,m.from.y,f.from);f.to=b.effects.setTransition(f,d,m.to.y,f.to)}b.effects.save(f,n?g:e);f.show();b.effects.createWrapper(f);f.css("overflow","hidden").css(f.from); +if(q=="content"||q=="both"){h=h.concat(["marginTop","marginBottom"]).concat(d);i=i.concat(["marginLeft","marginRight"]);a=g.concat(h).concat(i);f.find("*[width]").each(function(){child=b(this);n&&b.effects.save(child,a);var o={height:child.height(),width:child.width()};child.from={height:o.height*m.from.y,width:o.width*m.from.x};child.to={height:o.height*m.to.y,width:o.width*m.to.x};if(m.from.y!=m.to.y){child.from=b.effects.setTransition(child,h,m.from.y,child.from);child.to=b.effects.setTransition(child, +h,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=b.effects.setTransition(child,i,m.from.x,child.from);child.to=b.effects.setTransition(child,i,m.to.x,child.to)}child.css(child.from);child.animate(child.to,c.duration,c.options.easing,function(){n&&b.effects.restore(child,a)})})}f.animate(f.to,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){f.to.opacity===0&&f.css("opacity",f.from.opacity);j=="hide"&&f.hide();b.effects.restore(f,n?g:e);b.effects.removeWrapper(f);c.callback&& +c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.shake=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"];b.effects.setMode(f,c.options.mode||"effect");var e=c.options.direction||"left",a=c.options.distance||20,d=c.options.times||3,h=c.duration||c.options.duration||140;b.effects.save(f,g);f.show();b.effects.createWrapper(f);var i=e=="up"||e=="down"?"top":"left",j=e=="up"||e=="left"?"pos":"neg";e={};var n={},q={};e[i]=(j=="pos"?"-=":"+=")+a;n[i]=(j=="pos"?"+=":"-=")+a*2;q[i]=(j=="pos"?"-=":"+=")+ +a*2;f.animate(e,h,c.options.easing);for(a=1;a<d;a++)f.animate(n,h,c.options.easing).animate(q,h,c.options.easing);f.animate(n,h,c.options.easing).animate(e,h/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery); +(function(b){b.effects.slide=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"show"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f).css({overflow:"hidden"});var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true}):f.outerWidth({margin:true}));if(e=="show")f.css(d,a=="pos"?isNaN(h)?"-"+h:-h:h);var i={};i[d]=(e== +"show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.transfer=function(c){return this.queue(function(){var f=b(this),g=b(c.options.to),e=g.offset();g={top:e.top,left:e.left,height:g.innerHeight(),width:g.innerWidth()};e=f.offset();var a=b('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(c.options.className).css({top:e.top,left:e.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,c.duration,c.options.easing,function(){a.remove();c.callback&&c.callback.apply(f[0],arguments); +f.dequeue()})})}})(jQuery); +(function(b){b.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var c=this,f=c.options;c.running=0;c.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");c.headers= +c.element.find(f.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){f.disabled||b(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){f.disabled||b(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){f.disabled||b(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){f.disabled||b(this).removeClass("ui-state-focus")});c.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(f.navigation){var g=c.element.find("a").filter(f.navigationFilter).eq(0);if(g.length){var e=g.closest(".ui-accordion-header");c.active=e.length?e:g.closest(".ui-accordion-content").prev()}}c.active=c._findActive(c.active||f.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");c.active.next().addClass("ui-accordion-content-active");c._createIcons();c.resize();c.element.attr("role","tablist");c.headers.attr("role","tab").bind("keydown.accordion", +function(a){return c._keydown(a)}).next().attr("role","tabpanel");c.headers.not(c.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();c.active.length?c.active.attr({"aria-expanded":"true",tabIndex:0}):c.headers.eq(0).attr("tabIndex",0);b.browser.safari||c.headers.find("a").attr("tabIndex",-1);f.event&&c.headers.bind(f.event.split(" ").join(".accordion ")+".accordion",function(a){c._clickHandler.call(c,a,this);a.preventDefault()})},_createIcons:function(){var c=this.options;if(c.icons){b("<span></span>").addClass("ui-icon "+ +c.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(c.icons.header).toggleClass(c.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var f=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(c.autoHeight||c.fillHeight)f.css("height","");return b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c=="active"&&this.activate(f);if(c=="icons"){this._destroyIcons(); +f&&this._createIcons()}if(c=="disabled")this.headers.add(this.headers.next())[f?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(c){if(!(this.options.disabled||c.altKey||c.ctrlKey)){var f=b.ui.keyCode,g=this.headers.length,e=this.headers.index(c.target),a=false;switch(c.keyCode){case f.RIGHT:case f.DOWN:a=this.headers[(e+1)%g];break;case f.LEFT:case f.UP:a=this.headers[(e-1+g)%g];break;case f.SPACE:case f.ENTER:this._clickHandler({target:c.target},c.target); +c.preventDefault()}if(a){b(c.target).attr("tabIndex",-1);b(a).attr("tabIndex",0);a.focus();return false}return true}},resize:function(){var c=this.options,f;if(c.fillSpace){if(b.browser.msie){var g=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}f=this.element.parent().height();b.browser.msie&&this.element.parent().css("overflow",g);this.headers.each(function(){f-=b(this).outerHeight(true)});this.headers.next().each(function(){b(this).height(Math.max(0,f-b(this).innerHeight()+ +b(this).height()))}).css("overflow","auto")}else if(c.autoHeight){f=0;this.headers.next().each(function(){f=Math.max(f,b(this).height("").height())}).height(f)}return this},activate:function(c){this.options.active=c;c=this._findActive(c)[0];this._clickHandler({target:c},c);return this},_findActive:function(c){return c?typeof c==="number"?this.headers.filter(":eq("+c+")"):this.headers.not(this.headers.not(c)):c===false?b([]):this.headers.filter(":eq(0)")},_clickHandler:function(c,f){var g=this.options; +if(!g.disabled)if(c.target){c=b(c.currentTarget||f);f=c[0]===this.active[0];g.active=g.collapsible&&f?false:this.headers.index(c);if(!(this.running||!g.collapsible&&f)){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header);if(!f){c.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(g.icons.header).addClass(g.icons.headerSelected); +c.next().addClass("ui-accordion-content-active")}d=c.next();e=this.active.next();a={options:g,newHeader:f&&g.collapsible?b([]):c,oldHeader:this.active,newContent:f&&g.collapsible?b([]):d,oldContent:e};g=this.headers.index(this.active[0])>this.headers.index(c[0]);this.active=f?b([]):c;this._toggle(d,e,a,f,g)}}else if(g.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header); +this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),a={options:g,newHeader:b([]),oldHeader:g.active,newContent:b([]),oldContent:e},d=this.active=b([]);this._toggle(d,e,a)}},_toggle:function(c,f,g,e,a){var d=this,h=d.options;d.toShow=c;d.toHide=f;d.data=g;var i=function(){if(d)return d._completed.apply(d,arguments)};d._trigger("changestart",null,d.data);d.running=f.size()===0?c.size():f.size();if(h.animated){g={};g=h.collapsible&&e?{toShow:b([]),toHide:f,complete:i, +down:a,autoHeight:h.autoHeight||h.fillSpace}:{toShow:c,toHide:f,complete:i,down:a,autoHeight:h.autoHeight||h.fillSpace};if(!h.proxied)h.proxied=h.animated;if(!h.proxiedDuration)h.proxiedDuration=h.duration;h.animated=b.isFunction(h.proxied)?h.proxied(g):h.proxied;h.duration=b.isFunction(h.proxiedDuration)?h.proxiedDuration(g):h.proxiedDuration;e=b.ui.accordion.animations;var j=h.duration,n=h.animated;if(n&&!e[n]&&!b.easing[n])n="slide";e[n]||(e[n]=function(q){this.slide(q,{easing:n,duration:j||700})}); +e[n](g)}else{if(h.collapsible&&e)c.toggle();else{f.hide();c.show()}i(true)}f.prev().attr({"aria-expanded":"false",tabIndex:-1}).blur();c.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(c){this.running=c?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this._trigger("change",null,this.data)}}});b.extend(b.ui.accordion,{version:"1.8.7",animations:{slide:function(c, +f){c=b.extend({easing:"swing",duration:300},c,f);if(c.toHide.size())if(c.toShow.size()){var g=c.toShow.css("overflow"),e=0,a={},d={},h;f=c.toShow;h=f[0].style.width;f.width(parseInt(f.parent().width(),10)-parseInt(f.css("paddingLeft"),10)-parseInt(f.css("paddingRight"),10)-(parseInt(f.css("borderLeftWidth"),10)||0)-(parseInt(f.css("borderRightWidth"),10)||0));b.each(["height","paddingTop","paddingBottom"],function(i,j){d[j]="hide";i=(""+b.css(c.toShow[0],j)).match(/^([\d+-.]+)(.*)$/);a[j]={value:i[1], +unit:i[2]||"px"}});c.toShow.css({height:0,overflow:"hidden"}).show();c.toHide.filter(":hidden").each(c.complete).end().filter(":visible").animate(d,{step:function(i,j){if(j.prop=="height")e=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);c.toShow[0].style[j.prop]=e*a[j.prop].value+a[j.prop].unit},duration:c.duration,easing:c.easing,complete:function(){c.autoHeight||c.toShow.css("height","");c.toShow.css({width:h,overflow:g});c.complete()}})}else c.toHide.animate({height:"hide",paddingTop:"hide", +paddingBottom:"hide"},c);else c.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},c)},bounceslide:function(c){this.slide(c,{easing:c.down?"easeOutBounce":"swing",duration:c.down?1E3:200})}}})})(jQuery); +(function(b){b.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},_create:function(){var c=this,f=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(e){if(!(c.options.disabled||c.element.attr("readonly"))){g=false;var a=b.ui.keyCode;switch(e.keyCode){case a.PAGE_UP:c._move("previousPage", +e);break;case a.PAGE_DOWN:c._move("nextPage",e);break;case a.UP:c._move("previous",e);e.preventDefault();break;case a.DOWN:c._move("next",e);e.preventDefault();break;case a.ENTER:case a.NUMPAD_ENTER:if(c.menu.active){g=true;e.preventDefault()}case a.TAB:if(!c.menu.active)return;c.menu.select(e);break;case a.ESCAPE:c.element.val(c.term);c.close(e);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!=c.element.val()){c.selectedItem=null;c.search(null,e)}},c.options.delay); +break}}}).bind("keypress.autocomplete",function(e){if(g){g=false;e.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(e){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(e);c._change(e)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)};this.menu=b("<ul></ul>").addClass("ui-autocomplete").appendTo(b(this.options.appendTo|| +"body",f)[0]).mousedown(function(e){var a=c.menu.element[0];b(e.target).closest(".ui-menu-item").length||setTimeout(function(){b(document).one("mousedown",function(d){d.target!==c.element[0]&&d.target!==a&&!b.ui.contains(a,d.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(e,a){a=a.item.data("item.autocomplete");false!==c._trigger("focus",e,{item:a})&&/^key/.test(e.originalEvent.type)&&c.element.val(a.value)},selected:function(e,a){var d=a.item.data("item.autocomplete"), +h=c.previous;if(c.element[0]!==f.activeElement){c.element.focus();c.previous=h;setTimeout(function(){c.previous=h;c.selectedItem=d},1)}false!==c._trigger("select",e,{item:d})&&c.element.val(d.value);c.term=c.element.val();c.close(e);c.selectedItem=d},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");b.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"); +this.menu.element.remove();b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(b(f||"body",this.element[0].ownerDocument)[0])},_initSource:function(){var c=this,f,g;if(b.isArray(this.options.source)){f=this.options.source;this.source=function(e,a){a(b.ui.autocomplete.filter(f,e.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source= +function(e,a){c.xhr&&c.xhr.abort();c.xhr=b.ajax({url:g,data:e,dataType:"json",success:function(d,h,i){i===c.xhr&&a(d);c.xhr=null},error:function(d){d===c.xhr&&a([]);c.xhr=null}})}}else this.source=this.options.source},search:function(c,f){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length<this.options.minLength)return this.close(f);clearTimeout(this.closing);if(this._trigger("search",f)!==false)return this._search(c)},_search:function(c){this.element.addClass("ui-autocomplete-loading"); +this.source({term:c},this.response)},_response:function(c){if(c&&c.length){c=this._normalize(c);this._suggest(c);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(c){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",c)}},_change:function(c){this.previous!==this.element.val()&&this._trigger("change",c,{item:this.selectedItem})},_normalize:function(c){if(c.length&& +c[0].label&&c[0].value)return c;return b.map(c,function(f){if(typeof f==="string")return{label:f,value:f};return b.extend({label:f.label||f.value,value:f.value||f.label},f)})},_suggest:function(c){var f=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(f,c);this.menu.deactivate();this.menu.refresh();f.show();this._resizeMenu();f.position(b.extend({of:this.element},this.options.position))},_resizeMenu:function(){var c=this.menu.element;c.outerWidth(Math.max(c.width("").outerWidth(), +this.element.outerWidth()))},_renderMenu:function(c,f){var g=this;b.each(f,function(e,a){g._renderItem(c,a)})},_renderItem:function(c,f){return b("<li></li>").data("item.autocomplete",f).append(b("<a></a>").text(f.label)).appendTo(c)},_move:function(c,f){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](f);else this.search(null,f)},widget:function(){return this.menu.element}}); +b.extend(b.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(c,f){var g=new RegExp(b.ui.autocomplete.escapeRegex(f),"i");return b.grep(c,function(e){return g.test(e.label||e.value||e)})}})})(jQuery); +(function(b){b.widget("ui.menu",{_create:function(){var c=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(f){if(b(f.target).closest(".ui-menu-item a").length){f.preventDefault();c.select(f)}});this.refresh()},refresh:function(){var c=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(f){c.activate(f,b(this).parent())}).mouseleave(function(){c.deactivate()})},activate:function(c,f){this.deactivate();if(this.hasScroll()){var g=f.offset().top-this.element.offset().top,e=this.element.attr("scrollTop"),a=this.element.height();if(g<0)this.element.attr("scrollTop",e+g);else g>=a&&this.element.attr("scrollTop",e+g-a+f.height())}this.active=f.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",c,{item:f})}, +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(c){this.move("next",".ui-menu-item:first",c)},previous:function(c){this.move("prev",".ui-menu-item:last",c)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(c,f,g){if(this.active){c=this.active[c+"All"](".ui-menu-item").eq(0); +c.length?this.activate(g,c):this.activate(g,this.element.children(f))}else this.activate(g,this.element.children(f))},nextPage:function(c){if(this.hasScroll())if(!this.active||this.last())this.activate(c,this.element.children(".ui-menu-item:first"));else{var f=this.active.offset().top,g=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var a=b(this).offset().top-f-g+b(this).height();return a<10&&a>-10});e.length||(e=this.element.children(".ui-menu-item:last"));this.activate(c, +e)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(c){if(this.hasScroll())if(!this.active||this.first())this.activate(c,this.element.children(".ui-menu-item:last"));else{var f=this.active.offset().top,g=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var e=b(this).offset().top-f+g-b(this).height();return e<10&&e>-10});result.length||(result=this.element.children(".ui-menu-item:first")); +this.activate(c,result)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(c){this._trigger("selected",c,{item:this.active})}})})(jQuery); +(function(b){var c,f=function(e){b(":ui-button",e.target.form).each(function(){var a=b(this).data("button");setTimeout(function(){a.refresh()},1)})},g=function(e){var a=e.name,d=e.form,h=b([]);if(a)h=d?b(d).find("[name='"+a+"']"):b("[name='"+a+"']",e.ownerDocument).filter(function(){return!this.form});return h};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button", +f);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var e=this,a=this.options,d=this.type==="checkbox"||this.type==="radio",h="ui-state-hover"+(!d?" ui-state-active":"");if(a.label===null)a.label=this.buttonElement.html();if(this.element.is(":disabled"))a.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button", +function(){if(!a.disabled){b(this).addClass("ui-state-hover");this===c&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){a.disabled||b(this).removeClass(h)}).bind("focus.button",function(){b(this).addClass("ui-state-focus")}).bind("blur.button",function(){b(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){e.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).toggleClass("ui-state-active"); +e.buttonElement.attr("aria-pressed",e.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active");e.buttonElement.attr("aria-pressed",true);var i=e.element[0];g(i).not(i).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active"); +c=this;b(document).one("mouseup",function(){c=null})}).bind("mouseup.button",function(){if(a.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(i){if(a.disabled)return false;if(i.keyCode==b.ui.keyCode.SPACE||i.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(i){i.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled", +a.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var e=this.element.is(":checked");e&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",e)}else this.buttonElement= +this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle|| +this.buttonElement.removeAttr("title");b.Widget.prototype.destroy.call(this)},_setOption:function(e,a){b.Widget.prototype._setOption.apply(this,arguments);if(e==="disabled")a?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var e=this.element.is(":disabled");e!==this.options.disabled&&this._setOption("disabled",e);if(this.type==="radio")g(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed", +true):b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var e=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), +a=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(e.empty()).text(),d=this.options.icons,h=d.primary&&d.secondary;if(d.primary||d.secondary){e.addClass("ui-button-text-icon"+(h?"s":d.primary?"-primary":"-secondary"));d.primary&&e.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&e.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.addClass(h?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary"); +this.hasTitle||e.attr("title",a)}}else e.addClass("ui-button-text-only")}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(e,a){e==="disabled"&&this.buttons.button("option",e,a);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");b.Widget.prototype.destroy.call(this)}})})(jQuery); +(function(b,c){function f(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};b.extend(this._defaults,this.regional[""]);this.dpDiv=b('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function g(a,d){b.extend(a,d);for(var h in d)if(d[h]== +null||d[h]==c)a[h]=d[h];return a}b.extend(b.ui,{datepicker:{version:"1.8.7"}});var e=(new Date).getTime();b.extend(f.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){g(this._defaults,a||{});return this},_attachDatepicker:function(a,d){var h=null;for(var i in this._defaults){var j=a.getAttribute("date:"+i);if(j){h=h||{};try{h[i]=eval(j)}catch(n){h[i]=j}}}i=a.nodeName.toLowerCase(); +j=i=="div"||i=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var q=this._newInst(b(a),j);q.settings=b.extend({},d||{},h||{});if(i=="input")this._connectDatepicker(a,q);else j&&this._inlineDatepicker(a,q)},_newInst:function(a,d){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:d,dpDiv:!d?this.dpDiv:b('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}}, +_connectDatepicker:function(a,d){var h=b(a);d.append=b([]);d.trigger=b([]);if(!h.hasClass(this.markerClassName)){this._attachments(h,d);h.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});this._autoSize(d);b.data(a,"datepicker",d)}},_attachments:function(a,d){var h=this._get(d,"appendText"),i=this._get(d,"isRTL");d.append&& +d.append.remove();if(h){d.append=b('<span class="'+this._appendClass+'">'+h+"</span>");a[i?"before":"after"](d.append)}a.unbind("focus",this._showDatepicker);d.trigger&&d.trigger.remove();h=this._get(d,"showOn");if(h=="focus"||h=="both")a.focus(this._showDatepicker);if(h=="button"||h=="both"){h=this._get(d,"buttonText");var j=this._get(d,"buttonImage");d.trigger=b(this._get(d,"buttonImageOnly")?b("<img/>").addClass(this._triggerClass).attr({src:j,alt:h,title:h}):b('<button type="button"></button>').addClass(this._triggerClass).html(j== +""?h:b("<img/>").attr({src:j,alt:h,title:h})));a[i?"before":"after"](d.trigger);d.trigger.click(function(){b.datepicker._datepickerShowing&&b.datepicker._lastInput==a[0]?b.datepicker._hideDatepicker():b.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var d=new Date(2009,11,20),h=this._get(a,"dateFormat");if(h.match(/[DM]/)){var i=function(j){for(var n=0,q=0,l=0;l<j.length;l++)if(j[l].length>n){n=j[l].length;q=l}return q};d.setMonth(i(this._get(a, +h.match(/MM/)?"monthNames":"monthNamesShort")));d.setDate(i(this._get(a,h.match(/DD/)?"dayNames":"dayNamesShort"))+20-d.getDay())}a.input.attr("size",this._formatDate(a,d).length)}},_inlineDatepicker:function(a,d){var h=b(a);if(!h.hasClass(this.markerClassName)){h.addClass(this.markerClassName).append(d.dpDiv).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});b.data(a,"datepicker",d);this._setDate(d,this._getDefaultDate(d), +true);this._updateDatepicker(d);this._updateAlternate(d);d.dpDiv.show()}},_dialogDatepicker:function(a,d,h,i,j){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=b('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);b("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};b.data(this._dialogInput[0],"datepicker",a)}g(a.settings,i||{}); +d=d&&d.constructor==Date?this._formatDate(a,d):d;this._dialogInput.val(d);this._pos=j?j.length?j:[j.pageX,j.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=h;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); +this._showDatepicker(this._dialogInput[0]);b.blockUI&&b.blockUI(this.dpDiv);b.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();b.removeData(a,"datepicker");if(i=="input"){h.append.remove();h.trigger.remove();d.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", +this._doKeyUp)}else if(i=="div"||i=="span")d.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=false;h.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs, +function(j){return j==a?null:j})}},_disableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=true;h.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs,function(j){return j==a?null: +j});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var d=0;d<this._disabledInputs.length;d++)if(this._disabledInputs[d]==a)return true;return false},_getInst:function(a){try{return b.data(a,"datepicker")}catch(d){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,d,h){var i=this._getInst(a);if(arguments.length==2&&typeof d=="string")return d=="defaults"?b.extend({},b.datepicker._defaults):i?d=="all"?b.extend({}, +i.settings):this._get(i,d):null;var j=d||{};if(typeof d=="string"){j={};j[d]=h}if(i){this._curInst==i&&this._hideDatepicker();var n=this._getDateDatepicker(a,true);g(i.settings,j);this._attachments(b(a),i);this._autoSize(i);this._setDateDatepicker(a,n);this._updateDatepicker(i)}},_changeDatepicker:function(a,d,h){this._optionDatepicker(a,d,h)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,d){if(a=this._getInst(a)){this._setDate(a,d); +this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,d){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,d);return a?this._getDate(a):null},_doKeyDown:function(a){var d=b.datepicker._getInst(a.target),h=true,i=d.dpDiv.is(".ui-datepicker-rtl");d._keyEvent=true;if(b.datepicker._datepickerShowing)switch(a.keyCode){case 9:b.datepicker._hideDatepicker();h=false;break;case 13:h=b("td."+b.datepicker._dayOverClass+":not(."+b.datepicker._currentClass+")",d.dpDiv);h[0]? +b.datepicker._selectDay(a.target,d.selectedMonth,d.selectedYear,h[0]):b.datepicker._hideDatepicker();return false;case 27:b.datepicker._hideDatepicker();break;case 33:b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 34:b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)b.datepicker._clearDate(a.target);h=a.ctrlKey|| +a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)b.datepicker._gotoToday(a.target);h=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,i?+1:-1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,-7,"D");h=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target, +i?-1:+1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,+7,"D");h=a.ctrlKey||a.metaKey;break;default:h=false}else if(a.keyCode==36&&a.ctrlKey)b.datepicker._showDatepicker(this);else h=false;if(h){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var d=b.datepicker._getInst(a.target);if(b.datepicker._get(d, +"constrainInput")){d=b.datepicker._possibleChars(b.datepicker._get(d,"dateFormat"));var h=String.fromCharCode(a.charCode==c?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||h<" "||!d||d.indexOf(h)>-1}},_doKeyUp:function(a){a=b.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,b.datepicker._getFormatConfig(a))){b.datepicker._setDateFromField(a);b.datepicker._updateAlternate(a);b.datepicker._updateDatepicker(a)}}catch(d){b.datepicker.log(d)}return true}, +_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=b("input",a.parentNode)[0];if(!(b.datepicker._isDisabledDatepicker(a)||b.datepicker._lastInput==a)){var d=b.datepicker._getInst(a);b.datepicker._curInst&&b.datepicker._curInst!=d&&b.datepicker._curInst.dpDiv.stop(true,true);var h=b.datepicker._get(d,"beforeShow");g(d.settings,h?h.apply(a,[a,d]):{});d.lastVal=null;b.datepicker._lastInput=a;b.datepicker._setDateFromField(d);if(b.datepicker._inDialog)a.value="";if(!b.datepicker._pos){b.datepicker._pos= +b.datepicker._findPos(a);b.datepicker._pos[1]+=a.offsetHeight}var i=false;b(a).parents().each(function(){i|=b(this).css("position")=="fixed";return!i});if(i&&b.browser.opera){b.datepicker._pos[0]-=document.documentElement.scrollLeft;b.datepicker._pos[1]-=document.documentElement.scrollTop}h={left:b.datepicker._pos[0],top:b.datepicker._pos[1]};b.datepicker._pos=null;d.dpDiv.empty();d.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});b.datepicker._updateDatepicker(d);h=b.datepicker._checkOffset(d, +h,i);d.dpDiv.css({position:b.datepicker._inDialog&&b.blockUI?"static":i?"fixed":"absolute",display:"none",left:h.left+"px",top:h.top+"px"});if(!d.inline){h=b.datepicker._get(d,"showAnim");var j=b.datepicker._get(d,"duration"),n=function(){b.datepicker._datepickerShowing=true;var q=d.dpDiv.find("iframe.ui-datepicker-cover");if(q.length){var l=b.datepicker._getBorders(d.dpDiv);q.css({left:-l[0],top:-l[1],width:d.dpDiv.outerWidth(),height:d.dpDiv.outerHeight()})}};d.dpDiv.zIndex(b(a).zIndex()+1);b.effects&& +b.effects[h]?d.dpDiv.show(h,b.datepicker._get(d,"showOptions"),j,n):d.dpDiv[h||"show"](h?j:null,n);if(!h||!j)n();d.input.is(":visible")&&!d.input.is(":disabled")&&d.input.focus();b.datepicker._curInst=d}}},_updateDatepicker:function(a){var d=this,h=b.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var i=a.dpDiv.find("iframe.ui-datepicker-cover");i.length&&i.css({left:-h[0],top:-h[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout", +function(){b(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&b(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!d._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){b(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!= +-1&&b(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();h=this._getNumberOfMonths(a);i=h[1];i>1?a.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",17*i+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(h[0]!=1||h[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a, +"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==b.datepicker._curInst&&b.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus();if(a.yearshtml){var j=a.yearshtml;setTimeout(function(){j===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);j=a.yearshtml=null},0)}},_getBorders:function(a){var d=function(h){return{thin:1,medium:2,thick:3}[h]||h};return[parseFloat(d(a.css("border-left-width"))),parseFloat(d(a.css("border-top-width")))]}, +_checkOffset:function(a,d,h){var i=a.dpDiv.outerWidth(),j=a.dpDiv.outerHeight(),n=a.input?a.input.outerWidth():0,q=a.input?a.input.outerHeight():0,l=document.documentElement.clientWidth+b(document).scrollLeft(),k=document.documentElement.clientHeight+b(document).scrollTop();d.left-=this._get(a,"isRTL")?i-n:0;d.left-=h&&d.left==a.input.offset().left?b(document).scrollLeft():0;d.top-=h&&d.top==a.input.offset().top+q?b(document).scrollTop():0;d.left-=Math.min(d.left,d.left+i>l&&l>i?Math.abs(d.left+i- +l):0);d.top-=Math.min(d.top,d.top+j>k&&k>j?Math.abs(j+q):0);return d},_findPos:function(a){for(var d=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[d?"previousSibling":"nextSibling"];a=b(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var d=this._curInst;if(!(!d||a&&d!=b.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(d,"showAnim");var h=this._get(d,"duration"),i=function(){b.datepicker._tidyDialog(d);this._curInst=null};b.effects&&b.effects[a]? +d.dpDiv.hide(a,b.datepicker._get(d,"showOptions"),h,i):d.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?h:null,i);a||i();if(a=this._get(d,"onClose"))a.apply(d.input?d.input[0]:null,[d.input?d.input.val():"",d]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(b.blockUI){b.unblockUI();b("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(b.datepicker._curInst){a=b(a.target);a[0].id!=b.datepicker._mainDivId&&a.parents("#"+b.datepicker._mainDivId).length==0&&!a.hasClass(b.datepicker.markerClassName)&&!a.hasClass(b.datepicker._triggerClass)&&b.datepicker._datepickerShowing&&!(b.datepicker._inDialog&&b.blockUI)&&b.datepicker._hideDatepicker()}},_adjustDate:function(a,d,h){a=b(a);var i=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(i,d+(h=="M"?this._get(i,"showCurrentAtPos"): +0),h);this._updateDatepicker(i)}},_gotoToday:function(a){a=b(a);var d=this._getInst(a[0]);if(this._get(d,"gotoCurrent")&&d.currentDay){d.selectedDay=d.currentDay;d.drawMonth=d.selectedMonth=d.currentMonth;d.drawYear=d.selectedYear=d.currentYear}else{var h=new Date;d.selectedDay=h.getDate();d.drawMonth=d.selectedMonth=h.getMonth();d.drawYear=d.selectedYear=h.getFullYear()}this._notifyChange(d);this._adjustDate(a)},_selectMonthYear:function(a,d,h){a=b(a);var i=this._getInst(a[0]);i._selectingMonthYear= +false;i["selected"+(h=="M"?"Month":"Year")]=i["draw"+(h=="M"?"Month":"Year")]=parseInt(d.options[d.selectedIndex].value,10);this._notifyChange(i);this._adjustDate(a)},_clickMonthYear:function(a){var d=this._getInst(b(a)[0]);d.input&&d._selectingMonthYear&&setTimeout(function(){d.input.focus()},0);d._selectingMonthYear=!d._selectingMonthYear},_selectDay:function(a,d,h,i){var j=b(a);if(!(b(i).hasClass(this._unselectableClass)||this._isDisabledDatepicker(j[0]))){j=this._getInst(j[0]);j.selectedDay=j.currentDay= +b("a",i).html();j.selectedMonth=j.currentMonth=d;j.selectedYear=j.currentYear=h;this._selectDate(a,this._formatDate(j,j.currentDay,j.currentMonth,j.currentYear))}},_clearDate:function(a){a=b(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,d){a=this._getInst(b(a)[0]);d=d!=null?d:this._formatDate(a);a.input&&a.input.val(d);this._updateAlternate(a);var h=this._get(a,"onSelect");if(h)h.apply(a.input?a.input[0]:null,[d,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a); +else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var d=this._get(a,"altField");if(d){var h=this._get(a,"altFormat")||this._get(a,"dateFormat"),i=this._getDate(a),j=this.formatDate(h,i,this._getFormatConfig(a));b(d).each(function(){b(this).val(j)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var d= +a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((d-a)/864E5)/7)+1},parseDate:function(a,d,h){if(a==null||d==null)throw"Invalid arguments";d=typeof d=="object"?d.toString():d+"";if(d=="")return null;for(var i=(h?h.shortYearCutoff:null)||this._defaults.shortYearCutoff,j=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,n=(h?h.dayNames:null)||this._defaults.dayNames,q=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort,l=(h?h.monthNames:null)||this._defaults.monthNames, +k=h=-1,m=-1,o=-1,p=false,s=function(x){(x=y+1<a.length&&a.charAt(y+1)==x)&&y++;return x},r=function(x){var C=s(x);x=new RegExp("^\\d{1,"+(x=="@"?14:x=="!"?20:x=="y"&&C?4:x=="o"?3:2)+"}");x=d.substring(w).match(x);if(!x)throw"Missing number at position "+w;w+=x[0].length;return parseInt(x[0],10)},u=function(x,C,J){x=s(x)?J:C;for(C=0;C<x.length;C++)if(d.substr(w,x[C].length).toLowerCase()==x[C].toLowerCase()){w+=x[C].length;return C+1}throw"Unknown name at position "+w;},v=function(){if(d.charAt(w)!= +a.charAt(y))throw"Unexpected literal at position "+w;w++},w=0,y=0;y<a.length;y++)if(p)if(a.charAt(y)=="'"&&!s("'"))p=false;else v();else switch(a.charAt(y)){case "d":m=r("d");break;case "D":u("D",j,n);break;case "o":o=r("o");break;case "m":k=r("m");break;case "M":k=u("M",q,l);break;case "y":h=r("y");break;case "@":var B=new Date(r("@"));h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break;case "!":B=new Date((r("!")-this._ticksTo1970)/1E4);h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break; +case "'":if(s("'"))v();else p=true;break;default:v()}if(h==-1)h=(new Date).getFullYear();else if(h<100)h+=(new Date).getFullYear()-(new Date).getFullYear()%100+(h<=i?0:-100);if(o>-1){k=1;m=o;do{i=this._getDaysInMonth(h,k-1);if(m<=i)break;k++;m-=i}while(1)}B=this._daylightSavingAdjust(new Date(h,k-1,m));if(B.getFullYear()!=h||B.getMonth()+1!=k||B.getDate()!=m)throw"Invalid date";return B},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y", +RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,d,h){if(!d)return"";var i=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,j=(h?h.dayNames:null)||this._defaults.dayNames,n=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort;h=(h?h.monthNames:null)||this._defaults.monthNames;var q=function(s){(s=p+1<a.length&&a.charAt(p+1)==s)&&p++; +return s},l=function(s,r,u){r=""+r;if(q(s))for(;r.length<u;)r="0"+r;return r},k=function(s,r,u,v){return q(s)?v[r]:u[r]},m="",o=false;if(d)for(var p=0;p<a.length;p++)if(o)if(a.charAt(p)=="'"&&!q("'"))o=false;else m+=a.charAt(p);else switch(a.charAt(p)){case "d":m+=l("d",d.getDate(),2);break;case "D":m+=k("D",d.getDay(),i,j);break;case "o":m+=l("o",(d.getTime()-(new Date(d.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":m+=l("m",d.getMonth()+1,2);break;case "M":m+=k("M",d.getMonth(),n,h);break; +case "y":m+=q("y")?d.getFullYear():(d.getYear()%100<10?"0":"")+d.getYear()%100;break;case "@":m+=d.getTime();break;case "!":m+=d.getTime()*1E4+this._ticksTo1970;break;case "'":if(q("'"))m+="'";else o=true;break;default:m+=a.charAt(p)}return m},_possibleChars:function(a){for(var d="",h=false,i=function(n){(n=j+1<a.length&&a.charAt(j+1)==n)&&j++;return n},j=0;j<a.length;j++)if(h)if(a.charAt(j)=="'"&&!i("'"))h=false;else d+=a.charAt(j);else switch(a.charAt(j)){case "d":case "m":case "y":case "@":d+= +"0123456789";break;case "D":case "M":return null;case "'":if(i("'"))d+="'";else h=true;break;default:d+=a.charAt(j)}return d},_get:function(a,d){return a.settings[d]!==c?a.settings[d]:this._defaults[d]},_setDateFromField:function(a,d){if(a.input.val()!=a.lastVal){var h=this._get(a,"dateFormat"),i=a.lastVal=a.input?a.input.val():null,j,n;j=n=this._getDefaultDate(a);var q=this._getFormatConfig(a);try{j=this.parseDate(h,i,q)||n}catch(l){this.log(l);i=d?"":i}a.selectedDay=j.getDate();a.drawMonth=a.selectedMonth= +j.getMonth();a.drawYear=a.selectedYear=j.getFullYear();a.currentDay=i?j.getDate():0;a.currentMonth=i?j.getMonth():0;a.currentYear=i?j.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,d,h){var i=function(n){var q=new Date;q.setDate(q.getDate()+n);return q},j=function(n){try{return b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),n,b.datepicker._getFormatConfig(a))}catch(q){}var l= +(n.toLowerCase().match(/^c/)?b.datepicker._getDate(a):null)||new Date,k=l.getFullYear(),m=l.getMonth();l=l.getDate();for(var o=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,p=o.exec(n);p;){switch(p[2]||"d"){case "d":case "D":l+=parseInt(p[1],10);break;case "w":case "W":l+=parseInt(p[1],10)*7;break;case "m":case "M":m+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break;case "y":case "Y":k+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break}p=o.exec(n)}return new Date(k, +m,l)};if(d=(d=d==null||d===""?h:typeof d=="string"?j(d):typeof d=="number"?isNaN(d)?h:i(d):new Date(d.getTime()))&&d.toString()=="Invalid Date"?h:d){d.setHours(0);d.setMinutes(0);d.setSeconds(0);d.setMilliseconds(0)}return this._daylightSavingAdjust(d)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,d,h){var i=!d,j=a.selectedMonth,n=a.selectedYear;d=this._restrictMinMax(a,this._determineDate(a,d,new Date));a.selectedDay= +a.currentDay=d.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=d.getMonth();a.drawYear=a.selectedYear=a.currentYear=d.getFullYear();if((j!=a.selectedMonth||n!=a.selectedYear)&&!h)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(i?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var d=new Date;d=this._daylightSavingAdjust(new Date(d.getFullYear(), +d.getMonth(),d.getDate()));var h=this._get(a,"isRTL"),i=this._get(a,"showButtonPanel"),j=this._get(a,"hideIfNoPrevNext"),n=this._get(a,"navigationAsDateFormat"),q=this._getNumberOfMonths(a),l=this._get(a,"showCurrentAtPos"),k=this._get(a,"stepMonths"),m=q[0]!=1||q[1]!=1,o=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),p=this._getMinMaxDate(a,"min"),s=this._getMinMaxDate(a,"max");l=a.drawMonth-l;var r=a.drawYear;if(l<0){l+=12;r--}if(s){var u= +this._daylightSavingAdjust(new Date(s.getFullYear(),s.getMonth()-q[0]*q[1]+1,s.getDate()));for(u=p&&u<p?p:u;this._daylightSavingAdjust(new Date(r,l,1))>u;){l--;if(l<0){l=11;r--}}}a.drawMonth=l;a.drawYear=r;u=this._get(a,"prevText");u=!n?u:this.formatDate(u,this._daylightSavingAdjust(new Date(r,l-k,1)),this._getFormatConfig(a));u=this._canAdjustMonth(a,-1,r,l)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+u+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(h?"e":"w")+'">'+u+"</span></a>":j?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+u+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"e":"w")+'">'+u+"</span></a>";var v=this._get(a,"nextText");v=!n?v:this.formatDate(v,this._daylightSavingAdjust(new Date(r,l+k,1)),this._getFormatConfig(a));j=this._canAdjustMonth(a,+1,r,l)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+v+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(h?"w":"e")+'">'+v+"</span></a>":j?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+v+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"w":"e")+'">'+v+"</span></a>";k=this._get(a,"currentText");v=this._get(a,"gotoCurrent")&&a.currentDay?o:d;k=!n?k:this.formatDate(k,v,this._getFormatConfig(a));n=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+e+'.datepicker._hideDatepicker();">'+this._get(a, +"closeText")+"</button>":"";i=i?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(h?n:"")+(this._isInRange(a,v)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(h?"":n)+"</div>":"";n=parseInt(this._get(a,"firstDay"),10);n=isNaN(n)?0:n;k=this._get(a,"showWeek");v=this._get(a,"dayNames");this._get(a,"dayNamesShort");var w=this._get(a,"dayNamesMin"),y= +this._get(a,"monthNames"),B=this._get(a,"monthNamesShort"),x=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),J=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),K="",G=0;G<q[0];G++){for(var N="",H=0;H<q[1];H++){var O=this._daylightSavingAdjust(new Date(r,l,a.selectedDay)),A=" ui-corner-all",D="";if(m){D+='<div class="ui-datepicker-group';if(q[1]>1)switch(H){case 0:D+=" ui-datepicker-group-first";A=" ui-corner-"+(h?"right":"left");break;case q[1]- +1:D+=" ui-datepicker-group-last";A=" ui-corner-"+(h?"left":"right");break;default:D+=" ui-datepicker-group-middle";A="";break}D+='">'}D+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+A+'">'+(/all|left/.test(A)&&G==0?h?j:u:"")+(/all|right/.test(A)&&G==0?h?u:j:"")+this._generateMonthYearHeader(a,l,r,p,s,G>0||H>0,y,B)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var E=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(A=0;A<7;A++){var z= +(A+n)%7;E+="<th"+((A+n+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+v[z]+'">'+w[z]+"</span></th>"}D+=E+"</tr></thead><tbody>";E=this._getDaysInMonth(r,l);if(r==a.selectedYear&&l==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,E);A=(this._getFirstDayOfMonth(r,l)-n+7)%7;E=m?6:Math.ceil((A+E)/7);z=this._daylightSavingAdjust(new Date(r,l,1-A));for(var P=0;P<E;P++){D+="<tr>";var Q=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(z)+"</td>";for(A=0;A<7;A++){var I= +x?x.apply(a.input?a.input[0]:null,[z]):[true,""],F=z.getMonth()!=l,L=F&&!J||!I[0]||p&&z<p||s&&z>s;Q+='<td class="'+((A+n+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(z.getTime()==O.getTime()&&l==a.selectedMonth&&a._keyEvent||M.getTime()==z.getTime()&&M.getTime()==O.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!C?"":" "+I[1]+(z.getTime()==o.getTime()?" "+this._currentClass:"")+(z.getTime()==d.getTime()?" ui-datepicker-today": +""))+'"'+((!F||C)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+e+".datepicker._selectDay('#"+a.id+"',"+z.getMonth()+","+z.getFullYear()+', this);return false;"')+">"+(F&&!C?" ":L?'<span class="ui-state-default">'+z.getDate()+"</span>":'<a class="ui-state-default'+(z.getTime()==d.getTime()?" ui-state-highlight":"")+(z.getTime()==o.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+z.getDate()+"</a>")+"</td>";z.setDate(z.getDate()+1);z=this._daylightSavingAdjust(z)}D+= +Q+"</tr>"}l++;if(l>11){l=0;r++}D+="</tbody></table>"+(m?"</div>"+(q[0]>0&&H==q[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");N+=D}K+=N}K+=i+(b.browser.msie&&parseInt(b.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return K},_generateMonthYearHeader:function(a,d,h,i,j,n,q,l){var k=this._get(a,"changeMonth"),m=this._get(a,"changeYear"),o=this._get(a,"showMonthAfterYear"),p='<div class="ui-datepicker-title">', +s="";if(n||!k)s+='<span class="ui-datepicker-month">'+q[d]+"</span>";else{q=i&&i.getFullYear()==h;var r=j&&j.getFullYear()==h;s+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var u=0;u<12;u++)if((!q||u>=i.getMonth())&&(!r||u<=j.getMonth()))s+='<option value="'+u+'"'+(u==d?' selected="selected"':"")+">"+l[u]+"</option>";s+="</select>"}o||(p+=s+(n||!(k&& +m)?" ":""));a.yearshtml="";if(n||!m)p+='<span class="ui-datepicker-year">'+h+"</span>";else{l=this._get(a,"yearRange").split(":");var v=(new Date).getFullYear();q=function(w){w=w.match(/c[+-].*/)?h+parseInt(w.substring(1),10):w.match(/[+-].*/)?v+parseInt(w,10):parseInt(w,10);return isNaN(w)?v:w};d=q(l[0]);l=Math.max(d,q(l[1]||""));d=i?Math.max(d,i.getFullYear()):d;l=j?Math.min(l,j.getFullYear()):l;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+ +a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";d<=l;d++)a.yearshtml+='<option value="'+d+'"'+(d==h?' selected="selected"':"")+">"+d+"</option>";a.yearshtml+="</select>";if(b.browser.mozilla)p+='<select class="ui-datepicker-year"><option value="'+h+'" selected="selected">'+h+"</option></select>";else{p+=a.yearshtml;a.yearshtml=null}}p+=this._get(a,"yearSuffix");if(o)p+=(n||!(k&&m)?" ":"")+s;p+="</div>";return p},_adjustInstDate:function(a,d,h){var i= +a.drawYear+(h=="Y"?d:0),j=a.drawMonth+(h=="M"?d:0);d=Math.min(a.selectedDay,this._getDaysInMonth(i,j))+(h=="D"?d:0);i=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(i,j,d)));a.selectedDay=i.getDate();a.drawMonth=a.selectedMonth=i.getMonth();a.drawYear=a.selectedYear=i.getFullYear();if(h=="M"||h=="Y")this._notifyChange(a)},_restrictMinMax:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");d=h&&d<h?h:d;return d=a&&d>a?a:d},_notifyChange:function(a){var d=this._get(a, +"onChangeMonthYear");if(d)d.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,d){return this._determineDate(a,this._get(a,d+"Date"),null)},_getDaysInMonth:function(a,d){return 32-(new Date(a,d,32)).getDate()},_getFirstDayOfMonth:function(a,d){return(new Date(a,d,1)).getDay()},_canAdjustMonth:function(a,d,h,i){var j=this._getNumberOfMonths(a); +h=this._daylightSavingAdjust(new Date(h,i+(d<0?d:j[0]*j[1]),1));d<0&&h.setDate(this._getDaysInMonth(h.getFullYear(),h.getMonth()));return this._isInRange(a,h)},_isInRange:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!h||d.getTime()>=h.getTime())&&(!a||d.getTime()<=a.getTime())},_getFormatConfig:function(a){var d=this._get(a,"shortYearCutoff");d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);return{shortYearCutoff:d,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,d,h,i){if(!d){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}d=d?typeof d=="object"?d:this._daylightSavingAdjust(new Date(i,h,d)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),d,this._getFormatConfig(a))}});b.fn.datepicker= +function(a){if(!b.datepicker.initialized){b(document).mousedown(b.datepicker._checkExternalClick).find("body").append(b.datepicker.dpDiv);b.datepicker.initialized=true}var d=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d)); +return this.each(function(){typeof a=="string"?b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this].concat(d)):b.datepicker._attachDatepicker(this,a)})};b.datepicker=new f;b.datepicker.initialized=false;b.datepicker.uuid=(new Date).getTime();b.datepicker.version="1.8.7";window["DP_jQuery_"+e]=b})(jQuery); +(function(b,c){var f={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},g={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};b.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(e){var a=b(this).css(e).offset().top;a<0&& +b(this).css("top",e.top-a)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var e=this,a=e.options,d=a.title||" ",h=b.ui.dialog.getTitleId(e.element),i=(e.uiDialog=b("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a.dialogClass).css({zIndex:a.zIndex}).attr("tabIndex", +-1).css("outline",0).keydown(function(q){if(a.closeOnEscape&&q.keyCode&&q.keyCode===b.ui.keyCode.ESCAPE){e.close(q);q.preventDefault()}}).attr({role:"dialog","aria-labelledby":h}).mousedown(function(q){e.moveToTop(false,q)});e.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(i);var j=(e.uiDialogTitlebar=b("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(i),n=b('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role", +"button").hover(function(){n.addClass("ui-state-hover")},function(){n.removeClass("ui-state-hover")}).focus(function(){n.addClass("ui-state-focus")}).blur(function(){n.removeClass("ui-state-focus")}).click(function(q){e.close(q);return false}).appendTo(j);(e.uiDialogTitlebarCloseText=b("<span></span>")).addClass("ui-icon ui-icon-closethick").text(a.closeText).appendTo(n);b("<span></span>").addClass("ui-dialog-title").attr("id",h).html(d).prependTo(j);if(b.isFunction(a.beforeclose)&&!b.isFunction(a.beforeClose))a.beforeClose= +a.beforeclose;j.find("*").add(j).disableSelection();a.draggable&&b.fn.draggable&&e._makeDraggable();a.resizable&&b.fn.resizable&&e._makeResizable();e._createButtons(a.buttons);e._isOpen=false;b.fn.bgiframe&&i.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var e=this;e.overlay&&e.overlay.destroy();e.uiDialog.hide();e.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");e.uiDialog.remove();e.originalTitle&& +e.element.attr("title",e.originalTitle);return e},widget:function(){return this.uiDialog},close:function(e){var a=this,d,h;if(false!==a._trigger("beforeClose",e)){a.overlay&&a.overlay.destroy();a.uiDialog.unbind("keypress.ui-dialog");a._isOpen=false;if(a.options.hide)a.uiDialog.hide(a.options.hide,function(){a._trigger("close",e)});else{a.uiDialog.hide();a._trigger("close",e)}b.ui.dialog.overlay.resize();if(a.options.modal){d=0;b(".ui-dialog").each(function(){if(this!==a.uiDialog[0]){h=b(this).css("z-index"); +isNaN(h)||(d=Math.max(d,h))}});b.ui.dialog.maxZ=d}return a}},isOpen:function(){return this._isOpen},moveToTop:function(e,a){var d=this,h=d.options;if(h.modal&&!e||!h.stack&&!h.modal)return d._trigger("focus",a);if(h.zIndex>b.ui.dialog.maxZ)b.ui.dialog.maxZ=h.zIndex;if(d.overlay){b.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",b.ui.dialog.overlay.maxZ=b.ui.dialog.maxZ)}e={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};b.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",b.ui.dialog.maxZ); +d.element.attr(e);d._trigger("focus",a);return d},open:function(){if(!this._isOpen){var e=this,a=e.options,d=e.uiDialog;e.overlay=a.modal?new b.ui.dialog.overlay(e):null;e._size();e._position(a.position);d.show(a.show);e.moveToTop(true);a.modal&&d.bind("keypress.ui-dialog",function(h){if(h.keyCode===b.ui.keyCode.TAB){var i=b(":tabbable",this),j=i.filter(":first");i=i.filter(":last");if(h.target===i[0]&&!h.shiftKey){j.focus(1);return false}else if(h.target===j[0]&&h.shiftKey){i.focus(1);return false}}}); +b(e.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();e._isOpen=true;e._trigger("open");return e}},_createButtons:function(e){var a=this,d=false,h=b("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),i=b("<div></div>").addClass("ui-dialog-buttonset").appendTo(h);a.uiDialog.find(".ui-dialog-buttonpane").remove();typeof e==="object"&&e!==null&&b.each(e,function(){return!(d=true)});if(d){b.each(e,function(j, +n){n=b.isFunction(n)?{click:n,text:j}:n;j=b('<button type="button"></button>').attr(n,true).unbind("click").click(function(){n.click.apply(a.element[0],arguments)}).appendTo(i);b.fn.button&&j.button()});h.appendTo(a.uiDialog)}},_makeDraggable:function(){function e(j){return{position:j.position,offset:j.offset}}var a=this,d=a.options,h=b(document),i;a.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(j,n){i= +d.height==="auto"?"auto":b(this).height();b(this).height(b(this).height()).addClass("ui-dialog-dragging");a._trigger("dragStart",j,e(n))},drag:function(j,n){a._trigger("drag",j,e(n))},stop:function(j,n){d.position=[n.position.left-h.scrollLeft(),n.position.top-h.scrollTop()];b(this).removeClass("ui-dialog-dragging").height(i);a._trigger("dragStop",j,e(n));b.ui.dialog.overlay.resize()}})},_makeResizable:function(e){function a(j){return{originalPosition:j.originalPosition,originalSize:j.originalSize, +position:j.position,size:j.size}}e=e===c?this.options.resizable:e;var d=this,h=d.options,i=d.uiDialog.css("position");e=typeof e==="string"?e:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:h.maxWidth,maxHeight:h.maxHeight,minWidth:h.minWidth,minHeight:d._minHeight(),handles:e,start:function(j,n){b(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",j,a(n))},resize:function(j,n){d._trigger("resize",j,a(n))},stop:function(j, +n){b(this).removeClass("ui-dialog-resizing");h.height=b(this).height();h.width=b(this).width();d._trigger("resizeStop",j,a(n));b.ui.dialog.overlay.resize()}}).css("position",i).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var e=this.options;return e.height==="auto"?e.minHeight:Math.min(e.minHeight,e.height)},_position:function(e){var a=[],d=[0,0],h;if(e){if(typeof e==="string"||typeof e==="object"&&"0"in e){a=e.split?e.split(" "):[e[0],e[1]];if(a.length=== +1)a[1]=a[0];b.each(["left","top"],function(i,j){if(+a[i]===a[i]){d[i]=a[i];a[i]=j}});e={my:a.join(" "),at:a.join(" "),offset:d.join(" ")}}e=b.extend({},b.ui.dialog.prototype.options.position,e)}else e=b.ui.dialog.prototype.options.position;(h=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(b.extend({of:window},e));h||this.uiDialog.hide()},_setOptions:function(e){var a=this,d={},h=false;b.each(e,function(i,j){a._setOption(i,j);if(i in f)h=true;if(i in +g)d[i]=j});h&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(e,a){var d=this,h=d.uiDialog;switch(e){case "beforeclose":e="beforeClose";break;case "buttons":d._createButtons(a);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+a);break;case "dialogClass":h.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a);break;case "disabled":a?h.addClass("ui-dialog-disabled"):h.removeClass("ui-dialog-disabled"); +break;case "draggable":var i=h.is(":data(draggable)");i&&!a&&h.draggable("destroy");!i&&a&&d._makeDraggable();break;case "position":d._position(a);break;case "resizable":(i=h.is(":data(resizable)"))&&!a&&h.resizable("destroy");i&&typeof a==="string"&&h.resizable("option","handles",a);!i&&a!==false&&d._makeResizable(a);break;case "title":b(".ui-dialog-title",d.uiDialogTitlebar).html(""+(a||" "));break}b.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var e=this.options,a,d,h= +this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(e.minWidth>e.width)e.width=e.minWidth;a=this.uiDialog.css({height:"auto",width:e.width}).height();d=Math.max(0,e.minHeight-a);if(e.height==="auto")if(b.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();e=this.element.css("height","auto").height();h||this.uiDialog.hide();this.element.height(Math.max(e,d))}else this.element.height(Math.max(e.height-a,0));this.uiDialog.is(":data(resizable)")&& +this.uiDialog.resizable("option","minHeight",this._minHeight())}});b.extend(b.ui.dialog,{version:"1.8.7",uuid:0,maxZ:0,getTitleId:function(e){e=e.attr("id");if(!e){this.uuid+=1;e=this.uuid}return"ui-dialog-title-"+e},overlay:function(e){this.$el=b.ui.dialog.overlay.create(e)}});b.extend(b.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(e){return e+".dialog-overlay"}).join(" "),create:function(e){if(this.instances.length=== +0){setTimeout(function(){b.ui.dialog.overlay.instances.length&&b(document).bind(b.ui.dialog.overlay.events,function(d){if(b(d.target).zIndex()<b.ui.dialog.overlay.maxZ)return false})},1);b(document).bind("keydown.dialog-overlay",function(d){if(e.options.closeOnEscape&&d.keyCode&&d.keyCode===b.ui.keyCode.ESCAPE){e.close(d);d.preventDefault()}});b(window).bind("resize.dialog-overlay",b.ui.dialog.overlay.resize)}var a=(this.oldInstances.pop()||b("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});b.fn.bgiframe&&a.bgiframe();this.instances.push(a);return a},destroy:function(e){var a=b.inArray(e,this.instances);a!=-1&&this.oldInstances.push(this.instances.splice(a,1)[0]);this.instances.length===0&&b([document,window]).unbind(".dialog-overlay");e.remove();var d=0;b.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +a=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return e<a?b(window).height()+"px":e+"px"}else return b(document).height()+"px"},width:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);a=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return e<a?b(window).width()+"px":e+"px"}else return b(document).width()+"px"},resize:function(){var e=b([]);b.each(b.ui.dialog.overlay.instances, +function(){e=e.add(this)});e.css({width:0,height:0}).css({width:b.ui.dialog.overlay.width(),height:b.ui.dialog.overlay.height()})}});b.extend(b.ui.dialog.overlay.prototype,{destroy:function(){b.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +(function(b){b.ui=b.ui||{};var c=/left|center|right/,f=/top|center|bottom/,g=b.fn.position,e=b.fn.offset;b.fn.position=function(a){if(!a||!a.of)return g.apply(this,arguments);a=b.extend({},a);var d=b(a.of),h=d[0],i=(a.collision||"flip").split(" "),j=a.offset?a.offset.split(" "):[0,0],n,q,l;if(h.nodeType===9){n=d.width();q=d.height();l={top:0,left:0}}else if(h.setTimeout){n=d.width();q=d.height();l={top:d.scrollTop(),left:d.scrollLeft()}}else if(h.preventDefault){a.at="left top";n=q=0;l={top:a.of.pageY, +left:a.of.pageX}}else{n=d.outerWidth();q=d.outerHeight();l=d.offset()}b.each(["my","at"],function(){var k=(a[this]||"").split(" ");if(k.length===1)k=c.test(k[0])?k.concat(["center"]):f.test(k[0])?["center"].concat(k):["center","center"];k[0]=c.test(k[0])?k[0]:"center";k[1]=f.test(k[1])?k[1]:"center";a[this]=k});if(i.length===1)i[1]=i[0];j[0]=parseInt(j[0],10)||0;if(j.length===1)j[1]=j[0];j[1]=parseInt(j[1],10)||0;if(a.at[0]==="right")l.left+=n;else if(a.at[0]==="center")l.left+=n/2;if(a.at[1]==="bottom")l.top+= +q;else if(a.at[1]==="center")l.top+=q/2;l.left+=j[0];l.top+=j[1];return this.each(function(){var k=b(this),m=k.outerWidth(),o=k.outerHeight(),p=parseInt(b.curCSS(this,"marginLeft",true))||0,s=parseInt(b.curCSS(this,"marginTop",true))||0,r=m+p+parseInt(b.curCSS(this,"marginRight",true))||0,u=o+s+parseInt(b.curCSS(this,"marginBottom",true))||0,v=b.extend({},l),w;if(a.my[0]==="right")v.left-=m;else if(a.my[0]==="center")v.left-=m/2;if(a.my[1]==="bottom")v.top-=o;else if(a.my[1]==="center")v.top-=o/2; +v.left=Math.round(v.left);v.top=Math.round(v.top);w={left:v.left-p,top:v.top-s};b.each(["left","top"],function(y,B){b.ui.position[i[y]]&&b.ui.position[i[y]][B](v,{targetWidth:n,targetHeight:q,elemWidth:m,elemHeight:o,collisionPosition:w,collisionWidth:r,collisionHeight:u,offset:j,my:a.my,at:a.at})});b.fn.bgiframe&&k.bgiframe();k.offset(b.extend(v,{using:a.using}))})};b.ui.position={fit:{left:function(a,d){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();a.left= +h>0?a.left-h:Math.max(a.left-d.collisionPosition.left,a.left)},top:function(a,d){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();a.top=h>0?a.top-h:Math.max(a.top-d.collisionPosition.top,a.top)}},flip:{left:function(a,d){if(d.at[0]!=="center"){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();var i=d.my[0]==="left"?-d.elemWidth:d.my[0]==="right"?d.elemWidth:0,j=d.at[0]==="left"?d.targetWidth:-d.targetWidth,n=-2*d.offset[0];a.left+= +d.collisionPosition.left<0?i+j+n:h>0?i+j+n:0}},top:function(a,d){if(d.at[1]!=="center"){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();var i=d.my[1]==="top"?-d.elemHeight:d.my[1]==="bottom"?d.elemHeight:0,j=d.at[1]==="top"?d.targetHeight:-d.targetHeight,n=-2*d.offset[1];a.top+=d.collisionPosition.top<0?i+j+n:h>0?i+j+n:0}}}};if(!b.offset.setOffset){b.offset.setOffset=function(a,d){if(/static/.test(b.curCSS(a,"position")))a.style.position="relative";var h=b(a), +i=h.offset(),j=parseInt(b.curCSS(a,"top",true),10)||0,n=parseInt(b.curCSS(a,"left",true),10)||0;i={top:d.top-i.top+j,left:d.left-i.left+n};"using"in d?d.using.call(a,i):h.css(i)};b.fn.offset=function(a){var d=this[0];if(!d||!d.ownerDocument)return null;if(a)return this.each(function(){b.offset.setOffset(this,a)});return e.call(this)}}})(jQuery); +(function(b,c){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(f){if(f===c)return this._value();this._setOption("value",f);return this},_setOption:function(f,g){if(f==="value"){this.options.value=g;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var f=this.options.value;if(typeof f!=="number")f=0;return Math.min(this.options.max,Math.max(this.min,f))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var f=this.value(),g=this._percentage();if(this.oldValue!==f){this.oldValue=f;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",f===this.options.max).width(g.toFixed(0)+"%");this.element.attr("aria-valuenow",f)}});b.extend(b.ui.progressbar,{version:"1.8.7"})})(jQuery); +(function(b){b.widget("ui.slider",b.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var c=this,f=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");f.disabled&&this.element.addClass("ui-slider-disabled ui-disabled"); +this.range=b([]);if(f.range){if(f.range===true){this.range=b("<div></div>");if(!f.values)f.values=[this._valueMin(),this._valueMin()];if(f.values.length&&f.values.length!==2)f.values=[f.values[0],f.values[0]]}else this.range=b("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(f.range==="min"||f.range==="max")this.range.addClass("ui-slider-range-"+f.range);this.range.addClass("ui-widget-header")}b(".ui-slider-handle",this.element).length===0&&b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle"); +if(f.values&&f.values.length)for(;b(".ui-slider-handle",this.element).length<f.values.length;)b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=b(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){f.disabled||b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){if(f.disabled)b(this).blur(); +else{b(".ui-slider .ui-state-focus").removeClass("ui-state-focus");b(this).addClass("ui-state-focus")}}).blur(function(){b(this).removeClass("ui-state-focus")});this.handles.each(function(g){b(this).data("index.ui-slider-handle",g)});this.handles.keydown(function(g){var e=true,a=b(this).data("index.ui-slider-handle"),d,h,i;if(!c.options.disabled){switch(g.keyCode){case b.ui.keyCode.HOME:case b.ui.keyCode.END:case b.ui.keyCode.PAGE_UP:case b.ui.keyCode.PAGE_DOWN:case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:e= +false;if(!c._keySliding){c._keySliding=true;b(this).addClass("ui-state-active");d=c._start(g,a);if(d===false)return}break}i=c.options.step;d=c.options.values&&c.options.values.length?(h=c.values(a)):(h=c.value());switch(g.keyCode){case b.ui.keyCode.HOME:h=c._valueMin();break;case b.ui.keyCode.END:h=c._valueMax();break;case b.ui.keyCode.PAGE_UP:h=c._trimAlignValue(d+(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.PAGE_DOWN:h=c._trimAlignValue(d-(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:if(d=== +c._valueMax())return;h=c._trimAlignValue(d+i);break;case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:if(d===c._valueMin())return;h=c._trimAlignValue(d-i);break}c._slide(g,a,h);return e}}).keyup(function(g){var e=b(this).data("index.ui-slider-handle");if(c._keySliding){c._keySliding=false;c._stop(g,e);c._change(g,e);b(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); +this._mouseDestroy();return this},_mouseCapture:function(c){var f=this.options,g,e,a,d,h;if(f.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();g=this._normValueFromMouse({x:c.pageX,y:c.pageY});e=this._valueMax()-this._valueMin()+1;d=this;this.handles.each(function(i){var j=Math.abs(g-d.values(i));if(e>j){e=j;a=b(this);h=i}});if(f.range===true&&this.values(1)===f.min){h+=1;a=b(this.handles[h])}if(this._start(c, +h)===false)return false;this._mouseSliding=true;d._handleIndex=h;a.addClass("ui-state-active").focus();f=a.offset();this._clickOffset=!b(c.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:c.pageX-f.left-a.width()/2,top:c.pageY-f.top-a.height()/2-(parseInt(a.css("borderTopWidth"),10)||0)-(parseInt(a.css("borderBottomWidth"),10)||0)+(parseInt(a.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(c,h,g);return this._animateOff=true},_mouseStart:function(){return true}, +_mouseDrag:function(c){var f=this._normValueFromMouse({x:c.pageX,y:c.pageY});this._slide(c,this._handleIndex,f);return false},_mouseStop:function(c){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(c,this._handleIndex);this._change(c,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(c){var f; +if(this.orientation==="horizontal"){f=this.elementSize.width;c=c.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{f=this.elementSize.height;c=c.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}f=c/f;if(f>1)f=1;if(f<0)f=0;if(this.orientation==="vertical")f=1-f;c=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+f*c)},_start:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value= +this.values(f);g.values=this.values()}return this._trigger("start",c,g)},_slide:function(c,f,g){var e;if(this.options.values&&this.options.values.length){e=this.values(f?0:1);if(this.options.values.length===2&&this.options.range===true&&(f===0&&g>e||f===1&&g<e))g=e;if(g!==this.values(f)){e=this.values();e[f]=g;c=this._trigger("slide",c,{handle:this.handles[f],value:g,values:e});this.values(f?0:1);c!==false&&this.values(f,g,true)}}else if(g!==this.value()){c=this._trigger("slide",c,{handle:this.handles[f], +value:g});c!==false&&this.value(g)}},_stop:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("stop",c,g)},_change:function(c,f){if(!this._keySliding&&!this._mouseSliding){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("change",c,g)}},value:function(c){if(arguments.length){this.options.value= +this._trimAlignValue(c);this._refreshValue();this._change(null,0)}return this._value()},values:function(c,f){var g,e,a;if(arguments.length>1){this.options.values[c]=this._trimAlignValue(f);this._refreshValue();this._change(null,c)}if(arguments.length)if(b.isArray(arguments[0])){g=this.options.values;e=arguments[0];for(a=0;a<g.length;a+=1){g[a]=this._trimAlignValue(e[a]);this._change(null,a)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(c):this.value(); +else return this._values()},_setOption:function(c,f){var g,e=0;if(b.isArray(this.options.values))e=this.options.values.length;b.Widget.prototype._setOption.apply(this,arguments);switch(c){case "disabled":if(f){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(g=0;g<e;g+=1)this._change(null,g);this._animateOff=false;break}},_value:function(){var c=this.options.value;return c=this._trimAlignValue(c)},_values:function(c){var f,g;if(arguments.length){f=this.options.values[c]; +return f=this._trimAlignValue(f)}else{f=this.options.values.slice();for(g=0;g<f.length;g+=1)f[g]=this._trimAlignValue(f[g]);return f}},_trimAlignValue:function(c){if(c<=this._valueMin())return this._valueMin();if(c>=this._valueMax())return this._valueMax();var f=this.options.step>0?this.options.step:1,g=(c-this._valueMin())%f;alignValue=c-g;if(Math.abs(g)*2>=f)alignValue+=g>0?f:-f;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var c=this.options.range,f=this.options,g=this,e=!this._animateOff?f.animate:false,a,d={},h,i,j,n;if(this.options.values&&this.options.values.length)this.handles.each(function(q){a=(g.values(q)-g._valueMin())/(g._valueMax()-g._valueMin())*100;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";b(this).stop(1,1)[e?"animate":"css"](d,f.animate);if(g.options.range===true)if(g.orientation==="horizontal"){if(q===0)g.range.stop(1,1)[e?"animate":"css"]({left:a+"%"},f.animate); +if(q===1)g.range[e?"animate":"css"]({width:a-h+"%"},{queue:false,duration:f.animate})}else{if(q===0)g.range.stop(1,1)[e?"animate":"css"]({bottom:a+"%"},f.animate);if(q===1)g.range[e?"animate":"css"]({height:a-h+"%"},{queue:false,duration:f.animate})}h=a});else{i=this.value();j=this._valueMin();n=this._valueMax();a=n!==j?(i-j)/(n-j)*100:0;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";this.handle.stop(1,1)[e?"animate":"css"](d,f.animate);if(c==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[e?"animate":"css"]({width:a+"%"},f.animate);if(c==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-a+"%"},{queue:false,duration:f.animate});if(c==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:a+"%"},f.animate);if(c==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-a+"%"},{queue:false,duration:f.animate})}}});b.extend(b.ui.slider,{version:"1.8.7"})})(jQuery); +(function(b,c){function f(){return++e}function g(){return++a}var e=0,a=0;b.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(d,h){if(d=="selected")this.options.collapsible&& +h==this.options.selected||this.select(h);else{this.options[d]=h;this._tabify()}},_tabId:function(d){return d.title&&d.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+f()},_sanitizeSelector:function(d){return d.replace(/:/g,"\\:")},_cookie:function(){var d=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+g());return b.cookie.apply(null,[d].concat(b.makeArray(arguments)))},_ui:function(d,h){return{tab:d,panel:h,index:this.anchors.index(d)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var d= +b(this);d.html(d.data("label.tabs")).removeData("label.tabs")})},_tabify:function(d){function h(r,u){r.css("display","");!b.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var i=this,j=this.options,n=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=b(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return b("a",this)[0]});this.panels=b([]);this.anchors.each(function(r,u){var v=b(u).attr("href"),w=v.split("#")[0],y;if(w&&(w===location.toString().split("#")[0]|| +(y=b("base")[0])&&w===y.href)){v=u.hash;u.href=v}if(n.test(v))i.panels=i.panels.add(i.element.find(i._sanitizeSelector(v)));else if(v&&v!=="#"){b.data(u,"href.tabs",v);b.data(u,"load.tabs",v.replace(/#.*$/,""));v=i._tabId(u);u.href="#"+v;u=i.element.find("#"+v);if(!u.length){u=b(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(i.panels[r-1]||i.list);u.data("destroy.tabs",true)}i.panels=i.panels.add(u)}else j.disabled.push(r)});if(d){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===c){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(i._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=b.unique(j.disabled.concat(b.map(this.lis.filter(".ui-state-disabled"),function(r){return i.lis.index(r)}))).sort();b.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(b.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(j.selected>=0&&this.anchors.length){i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");i.element.queue("tabs",function(){i._trigger("show",null,i._ui(i.anchors[j.selected],i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash))))});this.load(j.selected)}b(window).bind("unload",function(){i.lis.add(i.anchors).unbind(".tabs");i.lis=i.anchors=i.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);d=0;for(var q;q=this.lis[d];d++)b(q)[b.inArray(d,j.disabled)!=-1&&!b(q).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var l=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ +r)};this.lis.bind("mouseover.tabs",function(){l("hover",b(this))});this.lis.bind("mouseout.tabs",function(){k("hover",b(this))});this.anchors.bind("focus.tabs",function(){l("focus",b(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",b(this).closest("li"))})}var m,o;if(j.fx)if(b.isArray(j.fx)){m=j.fx[0];o=j.fx[1]}else m=o=j.fx;var p=o?function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){h(u,o);i._trigger("show",null,i._ui(r,u[0]))})}:function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");i._trigger("show",null,i._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");h(u,m);i.element.dequeue("tabs")})}:function(r,u){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");i.element.dequeue("tabs")}; +this.anchors.bind(j.event+".tabs",function(){var r=this,u=b(r).closest("li"),v=i.panels.filter(":not(.ui-tabs-hide)"),w=i.element.find(i._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||i.panels.filter(":animated").length||i._trigger("select",null,i._ui(this,w[0]))===false){this.blur();return false}j.selected=i.anchors.index(this);i.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= +-1;j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this));this.blur();return false}j.cookie&&i._cookie(j.selected,j.cookie);if(w.length){v.length&&i.element.queue("tabs",function(){s(r,v)});i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +b.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(d){if(typeof d=="string")d=this.anchors.index(this.anchors.filter("[href$="+d+"]"));return d},destroy:function(){var d=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var h= +b.data(this,"href.tabs");if(h)this.href=h;var i=b(this).unbind(".tabs");b.each(["href","load","cache"],function(j,n){i.removeData(n+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){b.data(this,"destroy.tabs")?b(this).remove():b(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});d.cookie&&this._cookie(null,d.cookie);return this},add:function(d, +h,i){if(i===c)i=this.anchors.length;var j=this,n=this.options;h=b(n.tabTemplate.replace(/#\{href\}/g,d).replace(/#\{label\}/g,h));d=!d.indexOf("#")?d.replace("#",""):this._tabId(b("a",h)[0]);h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var q=j.element.find("#"+d);q.length||(q=b(n.panelTemplate).attr("id",d).data("destroy.tabs",true));q.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(i>=this.lis.length){h.appendTo(this.list);q.appendTo(this.list[0].parentNode)}else{h.insertBefore(this.lis[i]); +q.insertBefore(this.panels[i])}n.disabled=b.map(n.disabled,function(l){return l>=i?++l:l});this._tabify();if(this.anchors.length==1){n.selected=0;h.addClass("ui-tabs-selected ui-state-active");q.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[i],this.panels[i]));return this},remove:function(d){d=this._getIndex(d);var h=this.options,i=this.lis.eq(d).remove(),j=this.panels.eq(d).remove(); +if(i.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(d+(d+1<this.anchors.length?1:-1));h.disabled=b.map(b.grep(h.disabled,function(n){return n!=d}),function(n){return n>=d?--n:n});this._tabify();this._trigger("remove",null,this._ui(i.find("a")[0],j[0]));return this},enable:function(d){d=this._getIndex(d);var h=this.options;if(b.inArray(d,h.disabled)!=-1){this.lis.eq(d).removeClass("ui-state-disabled");h.disabled=b.grep(h.disabled,function(i){return i!=d});this._trigger("enable",null, +this._ui(this.anchors[d],this.panels[d]));return this}},disable:function(d){d=this._getIndex(d);var h=this.options;if(d!=h.selected){this.lis.eq(d).addClass("ui-state-disabled");h.disabled.push(d);h.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[d],this.panels[d]))}return this},select:function(d){d=this._getIndex(d);if(d==-1)if(this.options.collapsible&&this.options.selected!=-1)d=this.options.selected;else return this;this.anchors.eq(d).trigger(this.options.event+".tabs");return this}, +load:function(d){d=this._getIndex(d);var h=this,i=this.options,j=this.anchors.eq(d)[0],n=b.data(j,"load.tabs");this.abort();if(!n||this.element.queue("tabs").length!==0&&b.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(d).addClass("ui-state-processing");if(i.spinner){var q=b("span",j);q.data("label.tabs",q.html()).html(i.spinner)}this.xhr=b.ajax(b.extend({},i.ajaxOptions,{url:n,success:function(l,k){h.element.find(h._sanitizeSelector(j.hash)).html(l);h._cleanup();i.cache&&b.data(j, +"cache.tabs",true);h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.success(l,k)}catch(m){}},error:function(l,k){h._cleanup();h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.error(l,k,d,j)}catch(m){}}}));h.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(d,h){this.anchors.eq(d).removeData("cache.tabs").data("load.tabs",h);return this},length:function(){return this.anchors.length}});b.extend(b.ui.tabs,{version:"1.8.7"});b.extend(b.ui.tabs.prototype,{rotation:null,rotate:function(d,h){var i=this,j=this.options,n=i._rotate||(i._rotate=function(q){clearTimeout(i.rotation);i.rotation=setTimeout(function(){var l=j.selected;i.select(++l<i.anchors.length?l:0)},d);q&&q.stopPropagation()});h=i._unrotate||(i._unrotate=!h?function(q){q.clientX&& +i.rotate(null)}:function(){t=j.selected;n()});if(d){this.element.bind("tabsshow",n);this.anchors.bind(j.event+".tabs",h);n()}else{clearTimeout(i.rotation);this.element.unbind("tabsshow",n);this.anchors.unbind(j.event+".tabs",h);delete this._rotate;delete this._unrotate}return this}})})(jQuery); diff --git a/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.js b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.js new file mode 100644 index 000000000..73df9a493 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.js @@ -0,0 +1,165 @@ +/// <reference path="jquery-1.4.4.js" /> + +/*! +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global window: false, jQuery: false */ + +(function ($) { + var data_click = "unobtrusiveAjaxClick", + data_validation = "unobtrusiveValidation"; + + function getFunction(code, argNames) { + var fn = window, parts = (code || "").split("."); + while (fn && parts.length) { + fn = fn[parts.shift()]; + } + if (typeof (fn) === "function") { + return fn; + } + argNames.push(code); + return Function.constructor.apply(null, argNames); + } + + function isMethodProxySafe(method) { + return method === "GET" || method === "POST"; + } + + function asyncOnBeforeSend(xhr, method) { + if (!isMethodProxySafe(method)) { + xhr.setRequestHeader("X-HTTP-Method-Override", method); + } + } + + function asyncOnSuccess(element, data, contentType) { + var mode; + + if (contentType.indexOf("application/x-javascript") !== -1) { // jQuery already executes JavaScript for us + return; + } + + mode = (element.getAttribute("data-ajax-mode") || "").toUpperCase(); + $(element.getAttribute("data-ajax-update")).each(function (i, update) { + var top; + + switch (mode) { + case "BEFORE": + top = update.firstChild; + $("<div />").html(data).contents().each(function () { + update.insertBefore(this, top); + }); + break; + case "AFTER": + $("<div />").html(data).contents().each(function () { + update.appendChild(this); + }); + break; + default: + $(update).html(data); + break; + } + }); + } + + function asyncRequest(element, options) { + var confirm, loading, method, duration; + + confirm = element.getAttribute("data-ajax-confirm"); + if (confirm && !window.confirm(confirm)) { + return; + } + + loading = $(element.getAttribute("data-ajax-loading")); + duration = element.getAttribute("data-ajax-loading-duration") || 0; + + $.extend(options, { + type: element.getAttribute("data-ajax-method") || undefined, + url: element.getAttribute("data-ajax-url") || undefined, + beforeSend: function (xhr) { + var result; + asyncOnBeforeSend(xhr, method); + result = getFunction(element.getAttribute("data-ajax-begin"), ["xhr"]).apply(this, arguments); + if (result !== false) { + loading.show(duration); + } + return result; + }, + complete: function () { + loading.hide(duration); + getFunction(element.getAttribute("data-ajax-complete"), ["xhr", "status"]).apply(this, arguments); + }, + success: function (data, status, xhr) { + asyncOnSuccess(element, data, xhr.getResponseHeader("Content-Type") || "text/html"); + getFunction(element.getAttribute("data-ajax-success"), ["data", "status", "xhr"]).apply(this, arguments); + }, + error: getFunction(element.getAttribute("data-ajax-failure"), ["xhr", "status", "error"]) + }); + + options.data.push({ name: "X-Requested-With", value: "XMLHttpRequest" }); + + method = options.type.toUpperCase(); + if (!isMethodProxySafe(method)) { + options.type = "POST"; + options.data.push({ name: "X-HTTP-Method-Override", value: method }); + } + + $.ajax(options); + } + + function validate(form) { + var validationInfo = $(form).data(data_validation); + return !validationInfo || !validationInfo.validate || validationInfo.validate(); + } + + $("a[data-ajax=true]").live("click", function (evt) { + evt.preventDefault(); + asyncRequest(this, { + url: this.href, + type: "GET", + data: [] + }); + }); + + $("form[data-ajax=true] input[type=image]").live("click", function (evt) { + var name = evt.target.name, + $target = $(evt.target), + form = $target.parents("form")[0], + offset = $target.offset(); + + $(form).data(data_click, [ + { name: name + ".x", value: Math.round(evt.pageX - offset.left) }, + { name: name + ".y", value: Math.round(evt.pageY - offset.top) } + ]); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true] :submit").live("click", function (evt) { + var name = evt.target.name, + form = $(evt.target).parents("form")[0]; + + $(form).data(data_click, name ? [{ name: name, value: evt.target.value }] : []); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true]").live("submit", function (evt) { + var clickInfo = $(this).data(data_click) || []; + evt.preventDefault(); + if (!validate(this)) { + return; + } + asyncRequest(this, { + url: this.action, + type: this.method || "GET", + data: clickInfo.concat($(this).serializeArray()) + }); + }); +}(jQuery)); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.min.js b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.min.js new file mode 100644 index 000000000..3542991c1 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var b="unobtrusiveAjaxClick",g="unobtrusiveValidation";function c(d,b){var a=window,c=(d||"").split(".");while(a&&c.length)a=a[c.shift()];if(typeof a==="function")return a;b.push(d);return Function.constructor.apply(null,b)}function d(a){return a==="GET"||a==="POST"}function f(b,a){!d(a)&&b.setRequestHeader("X-HTTP-Method-Override",a)}function h(c,b,e){var d;if(e.indexOf("application/x-javascript")!==-1)return;d=(c.getAttribute("data-ajax-mode")||"").toUpperCase();a(c.getAttribute("data-ajax-update")).each(function(f,c){var e;switch(d){case"BEFORE":e=c.firstChild;a("<div />").html(b).contents().each(function(){c.insertBefore(this,e)});break;case"AFTER":a("<div />").html(b).contents().each(function(){c.appendChild(this)});break;default:a(c).html(b)}})}function e(b,e){var j,k,g,i;j=b.getAttribute("data-ajax-confirm");if(j&&!window.confirm(j))return;k=a(b.getAttribute("data-ajax-loading"));i=b.getAttribute("data-ajax-loading-duration")||0;a.extend(e,{type:b.getAttribute("data-ajax-method")||undefined,url:b.getAttribute("data-ajax-url")||undefined,beforeSend:function(d){var a;f(d,g);a=c(b.getAttribute("data-ajax-begin"),["xhr"]).apply(this,arguments);a!==false&&k.show(i);return a},complete:function(){k.hide(i);c(b.getAttribute("data-ajax-complete"),["xhr","status"]).apply(this,arguments)},success:function(a,e,d){h(b,a,d.getResponseHeader("Content-Type")||"text/html");c(b.getAttribute("data-ajax-success"),["data","status","xhr"]).apply(this,arguments)},error:c(b.getAttribute("data-ajax-failure"),["xhr","status","error"])});e.data.push({name:"X-Requested-With",value:"XMLHttpRequest"});g=e.type.toUpperCase();if(!d(g)){e.type="POST";e.data.push({name:"X-HTTP-Method-Override",value:g})}a.ajax(e)}function i(c){var b=a(c).data(g);return!b||!b.validate||b.validate()}a("a[data-ajax=true]").live("click",function(a){a.preventDefault();e(this,{url:this.href,type:"GET",data:[]})});a("form[data-ajax=true] input[type=image]").live("click",function(c){var g=c.target.name,d=a(c.target),f=d.parents("form")[0],e=d.offset();a(f).data(b,[{name:g+".x",value:Math.round(c.pageX-e.left)},{name:g+".y",value:Math.round(c.pageY-e.top)}]);setTimeout(function(){a(f).removeData(b)},0)});a("form[data-ajax=true] :submit").live("click",function(c){var e=c.target.name,d=a(c.target).parents("form")[0];a(d).data(b,e?[{name:e,value:c.target.value}]:[]);setTimeout(function(){a(d).removeData(b)},0)});a("form[data-ajax=true]").live("submit",function(d){var c=a(this).data(b)||[];d.preventDefault();if(!i(this))return;e(this,{url:this.action,type:this.method||"GET",data:c.concat(a(this).serializeArray())})})})(jQuery); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.validate.min.js b/NzbDrone.Web/Scripts/jquery.validate.min.js new file mode 100644 index 000000000..f55991702 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.validate.min.js @@ -0,0 +1,20 @@ +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery validation plug-in 1.7 + * + * http://bassistance.de/jquery-plugins/jquery-plugin-validation/ + * http://docs.jquery.com/Plugins/Validation + * + * Copyright (c) 2006 - 2008 Jörn Zaefferer + * + * $Id: jquery.validate.js 6403 2009-06-17 14:27:16Z joern.zaefferer $ + * + */ +(function($){$.extend($.fn,{validate:function(options){if(!this.length){options&&options.debug&&window.console&&console.warn("nothing selected, can't validate, returning nothing");return;}var validator=$.data(this[0],'validator');if(validator){return validator;}validator=new $.validator(options,this[0]);$.data(this[0],'validator',validator);if(validator.settings.onsubmit){this.find("input, button").filter(".cancel").click(function(){validator.cancelSubmit=true;});if(validator.settings.submitHandler){this.find("input, button").filter(":submit").click(function(){validator.submitButton=this;});}this.submit(function(event){if(validator.settings.debug)event.preventDefault();function handle(){if(validator.settings.submitHandler){if(validator.submitButton){var hidden=$("<input type='hidden'/>").attr("name",validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm);}validator.settings.submitHandler.call(validator,validator.currentForm);if(validator.submitButton){hidden.remove();}return false;}return true;}if(validator.cancelSubmit){validator.cancelSubmit=false;return handle();}if(validator.form()){if(validator.pendingRequest){validator.formSubmitted=true;return false;}return handle();}else{validator.focusInvalid();return false;}});}return validator;},valid:function(){if($(this[0]).is('form')){return this.validate().form();}else{var valid=true;var validator=$(this[0].form).validate();this.each(function(){valid&=validator.element(this);});return valid;}},removeAttrs:function(attributes){var result={},$element=this;$.each(attributes.split(/\s/),function(index,value){result[value]=$element.attr(value);$element.removeAttr(value);});return result;},rules:function(command,argument){var element=this[0];if(command){var settings=$.data(element.form,'validator').settings;var staticRules=settings.rules;var existingRules=$.validator.staticRules(element);switch(command){case"add":$.extend(existingRules,$.validator.normalizeRule(argument));staticRules[element.name]=existingRules;if(argument.messages)settings.messages[element.name]=$.extend(settings.messages[element.name],argument.messages);break;case"remove":if(!argument){delete staticRules[element.name];return existingRules;}var filtered={};$.each(argument.split(/\s/),function(index,method){filtered[method]=existingRules[method];delete existingRules[method];});return filtered;}}var data=$.validator.normalizeRules($.extend({},$.validator.metadataRules(element),$.validator.classRules(element),$.validator.attributeRules(element),$.validator.staticRules(element)),element);if(data.required){var param=data.required;delete data.required;data=$.extend({required:param},data);}return data;}});$.extend($.expr[":"],{blank:function(a){return!$.trim(""+a.value);},filled:function(a){return!!$.trim(""+a.value);},unchecked:function(a){return!a.checked;}});$.validator=function(options,form){this.settings=$.extend(true,{},$.validator.defaults,options);this.currentForm=form;this.init();};$.validator.format=function(source,params){if(arguments.length==1)return function(){var args=$.makeArray(arguments);args.unshift(source);return $.validator.format.apply(this,args);};if(arguments.length>2&¶ms.constructor!=Array){params=$.makeArray(arguments).slice(1);}if(params.constructor!=Array){params=[params];}$.each(params,function(i,n){source=source.replace(new RegExp("\\{"+i+"\\}","g"),n);});return source;};$.extend($.validator,{defaults:{messages:{},groups:{},rules:{},errorClass:"error",validClass:"valid",errorElement:"label",focusInvalid:true,errorContainer:$([]),errorLabelContainer:$([]),onsubmit:true,ignore:[],ignoreTitle:false,onfocusin:function(element){this.lastActive=element;if(this.settings.focusCleanup&&!this.blockFocusCleanup){this.settings.unhighlight&&this.settings.unhighlight.call(this,element,this.settings.errorClass,this.settings.validClass);this.errorsFor(element).hide();}},onfocusout:function(element){if(!this.checkable(element)&&(element.name in this.submitted||!this.optional(element))){this.element(element);}},onkeyup:function(element){if(element.name in this.submitted||element==this.lastElement){this.element(element);}},onclick:function(element){if(element.name in this.submitted)this.element(element);else if(element.parentNode.name in this.submitted)this.element(element.parentNode);},highlight:function(element,errorClass,validClass){$(element).addClass(errorClass).removeClass(validClass);},unhighlight:function(element,errorClass,validClass){$(element).removeClass(errorClass).addClass(validClass);}},setDefaults:function(settings){$.extend($.validator.defaults,settings);},messages:{required:"This field is required.",remote:"Please fix this field.",email:"Please enter a valid email address.",url:"Please enter a valid URL.",date:"Please enter a valid date.",dateISO:"Please enter a valid date (ISO).",number:"Please enter a valid number.",digits:"Please enter only digits.",creditcard:"Please enter a valid credit card number.",equalTo:"Please enter the same value again.",accept:"Please enter a value with a valid extension.",maxlength:$.validator.format("Please enter no more than {0} characters."),minlength:$.validator.format("Please enter at least {0} characters."),rangelength:$.validator.format("Please enter a value between {0} and {1} characters long."),range:$.validator.format("Please enter a value between {0} and {1}."),max:$.validator.format("Please enter a value less than or equal to {0}."),min:$.validator.format("Please enter a value greater than or equal to {0}.")},autoCreateRanges:false,prototype:{init:function(){this.labelContainer=$(this.settings.errorLabelContainer);this.errorContext=this.labelContainer.length&&this.labelContainer||$(this.currentForm);this.containers=$(this.settings.errorContainer).add(this.settings.errorLabelContainer);this.submitted={};this.valueCache={};this.pendingRequest=0;this.pending={};this.invalid={};this.reset();var groups=(this.groups={});$.each(this.settings.groups,function(key,value){$.each(value.split(/\s/),function(index,name){groups[name]=key;});});var rules=this.settings.rules;$.each(rules,function(key,value){rules[key]=$.validator.normalizeRule(value);});function delegate(event){var validator=$.data(this[0].form,"validator"),eventType="on"+event.type.replace(/^validate/,"");validator.settings[eventType]&&validator.settings[eventType].call(validator,this[0]);}$(this.currentForm).validateDelegate(":text, :password, :file, select, textarea","focusin focusout keyup",delegate).validateDelegate(":radio, :checkbox, select, option","click",delegate);if(this.settings.invalidHandler)$(this.currentForm).bind("invalid-form.validate",this.settings.invalidHandler);},form:function(){this.checkForm();$.extend(this.submitted,this.errorMap);this.invalid=$.extend({},this.errorMap);if(!this.valid())$(this.currentForm).triggerHandler("invalid-form",[this]);this.showErrors();return this.valid();},checkForm:function(){this.prepareForm();for(var i=0,elements=(this.currentElements=this.elements());elements[i];i++){this.check(elements[i]);}return this.valid();},element:function(element){element=this.clean(element);this.lastElement=element;this.prepareElement(element);this.currentElements=$(element);var result=this.check(element);if(result){delete this.invalid[element.name];}else{this.invalid[element.name]=true;}if(!this.numberOfInvalids()){this.toHide=this.toHide.add(this.containers);}this.showErrors();return result;},showErrors:function(errors){if(errors){$.extend(this.errorMap,errors);this.errorList=[];for(var name in errors){this.errorList.push({message:errors[name],element:this.findByName(name)[0]});}this.successList=$.grep(this.successList,function(element){return!(element.name in errors);});}this.settings.showErrors?this.settings.showErrors.call(this,this.errorMap,this.errorList):this.defaultShowErrors();},resetForm:function(){if($.fn.resetForm)$(this.currentForm).resetForm();this.submitted={};this.prepareForm();this.hideErrors();this.elements().removeClass(this.settings.errorClass);},numberOfInvalids:function(){return this.objectLength(this.invalid);},objectLength:function(obj){var count=0;for(var i in obj)count++;return count;},hideErrors:function(){this.addWrapper(this.toHide).hide();},valid:function(){return this.size()==0;},size:function(){return this.errorList.length;},focusInvalid:function(){if(this.settings.focusInvalid){try{$(this.findLastActive()||this.errorList.length&&this.errorList[0].element||[]).filter(":visible").focus().trigger("focusin");}catch(e){}}},findLastActive:function(){var lastActive=this.lastActive;return lastActive&&$.grep(this.errorList,function(n){return n.element.name==lastActive.name;}).length==1&&lastActive;},elements:function(){var validator=this,rulesCache={};return $([]).add(this.currentForm.elements).filter(":input").not(":submit, :reset, :image, [disabled]").not(this.settings.ignore).filter(function(){!this.name&&validator.settings.debug&&window.console&&console.error("%o has no name assigned",this);if(this.name in rulesCache||!validator.objectLength($(this).rules()))return false;rulesCache[this.name]=true;return true;});},clean:function(selector){return $(selector)[0];},errors:function(){return $(this.settings.errorElement+"."+this.settings.errorClass,this.errorContext);},reset:function(){this.successList=[];this.errorList=[];this.errorMap={};this.toShow=$([]);this.toHide=$([]);this.currentElements=$([]);},prepareForm:function(){this.reset();this.toHide=this.errors().add(this.containers);},prepareElement:function(element){this.reset();this.toHide=this.errorsFor(element);},check:function(element){element=this.clean(element);if(this.checkable(element)){element=this.findByName(element.name)[0];}var rules=$(element).rules();var dependencyMismatch=false;for(method in rules){var rule={method:method,parameters:rules[method]};try{var result=$.validator.methods[method].call(this,element.value.replace(/\r/g,""),element,rule.parameters);if(result=="dependency-mismatch"){dependencyMismatch=true;continue;}dependencyMismatch=false;if(result=="pending"){this.toHide=this.toHide.not(this.errorsFor(element));return;}if(!result){this.formatAndAdd(element,rule);return false;}}catch(e){this.settings.debug&&window.console&&console.log("exception occured when checking element "+element.id ++", check the '"+rule.method+"' method",e);throw e;}}if(dependencyMismatch)return;if(this.objectLength(rules))this.successList.push(element);return true;},customMetaMessage:function(element,method){if(!$.metadata)return;var meta=this.settings.meta?$(element).metadata()[this.settings.meta]:$(element).metadata();return meta&&meta.messages&&meta.messages[method];},customMessage:function(name,method){var m=this.settings.messages[name];return m&&(m.constructor==String?m:m[method]);},findDefined:function(){for(var i=0;i<arguments.length;i++){if(arguments[i]!==undefined)return arguments[i];}return undefined;},defaultMessage:function(element,method){return this.findDefined(this.customMessage(element.name,method),this.customMetaMessage(element,method),!this.settings.ignoreTitle&&element.title||undefined,$.validator.messages[method],"<strong>Warning: No message defined for "+element.name+"</strong>");},formatAndAdd:function(element,rule){var message=this.defaultMessage(element,rule.method),theregex=/\$?\{(\d+)\}/g;if(typeof message=="function"){message=message.call(this,rule.parameters,element);}else if(theregex.test(message)){message=jQuery.format(message.replace(theregex,'{$1}'),rule.parameters);}this.errorList.push({message:message,element:element});this.errorMap[element.name]=message;this.submitted[element.name]=message;},addWrapper:function(toToggle){if(this.settings.wrapper)toToggle=toToggle.add(toToggle.parent(this.settings.wrapper));return toToggle;},defaultShowErrors:function(){for(var i=0;this.errorList[i];i++){var error=this.errorList[i];this.settings.highlight&&this.settings.highlight.call(this,error.element,this.settings.errorClass,this.settings.validClass);this.showLabel(error.element,error.message);}if(this.errorList.length){this.toShow=this.toShow.add(this.containers);}if(this.settings.success){for(var i=0;this.successList[i];i++){this.showLabel(this.successList[i]);}}if(this.settings.unhighlight){for(var i=0,elements=this.validElements();elements[i];i++){this.settings.unhighlight.call(this,elements[i],this.settings.errorClass,this.settings.validClass);}}this.toHide=this.toHide.not(this.toShow);this.hideErrors();this.addWrapper(this.toShow).show();},validElements:function(){return this.currentElements.not(this.invalidElements());},invalidElements:function(){return $(this.errorList).map(function(){return this.element;});},showLabel:function(element,message){var label=this.errorsFor(element);if(label.length){label.removeClass().addClass(this.settings.errorClass);label.attr("generated")&&label.html(message);}else{label=$("<"+this.settings.errorElement+"/>").attr({"for":this.idOrName(element),generated:true}).addClass(this.settings.errorClass).html(message||"");if(this.settings.wrapper){label=label.hide().show().wrap("<"+this.settings.wrapper+"/>").parent();}if(!this.labelContainer.append(label).length)this.settings.errorPlacement?this.settings.errorPlacement(label,$(element)):label.insertAfter(element);}if(!message&&this.settings.success){label.text("");typeof this.settings.success=="string"?label.addClass(this.settings.success):this.settings.success(label);}this.toShow=this.toShow.add(label);},errorsFor:function(element){var name=this.idOrName(element);return this.errors().filter(function(){return $(this).attr('for')==name;});},idOrName:function(element){return this.groups[element.name]||(this.checkable(element)?element.name:element.id||element.name);},checkable:function(element){return/radio|checkbox/i.test(element.type);},findByName:function(name){var form=this.currentForm;return $(document.getElementsByName(name)).map(function(index,element){return element.form==form&&element.name==name&&element||null;});},getLength:function(value,element){switch(element.nodeName.toLowerCase()){case'select':return $("option:selected",element).length;case'input':if(this.checkable(element))return this.findByName(element.name).filter(':checked').length;}return value.length;},depend:function(param,element){return this.dependTypes[typeof param]?this.dependTypes[typeof param](param,element):true;},dependTypes:{"boolean":function(param,element){return param;},"string":function(param,element){return!!$(param,element.form).length;},"function":function(param,element){return param(element);}},optional:function(element){return!$.validator.methods.required.call(this,$.trim(element.value),element)&&"dependency-mismatch";},startRequest:function(element){if(!this.pending[element.name]){this.pendingRequest++;this.pending[element.name]=true;}},stopRequest:function(element,valid){this.pendingRequest--;if(this.pendingRequest<0)this.pendingRequest=0;delete this.pending[element.name];if(valid&&this.pendingRequest==0&&this.formSubmitted&&this.form()){$(this.currentForm).submit();this.formSubmitted=false;}else if(!valid&&this.pendingRequest==0&&this.formSubmitted){$(this.currentForm).triggerHandler("invalid-form",[this]);this.formSubmitted=false;}},previousValue:function(element){return $.data(element,"previousValue")||$.data(element,"previousValue",{old:null,valid:true,message:this.defaultMessage(element,"remote")});}},classRuleSettings:{required:{required:true},email:{email:true},url:{url:true},date:{date:true},dateISO:{dateISO:true},dateDE:{dateDE:true},number:{number:true},numberDE:{numberDE:true},digits:{digits:true},creditcard:{creditcard:true}},addClassRules:function(className,rules){className.constructor==String?this.classRuleSettings[className]=rules:$.extend(this.classRuleSettings,className);},classRules:function(element){var rules={};var classes=$(element).attr('class');classes&&$.each(classes.split(' '),function(){if(this in $.validator.classRuleSettings){$.extend(rules,$.validator.classRuleSettings[this]);}});return rules;},attributeRules:function(element){var rules={};var $element=$(element);for(method in $.validator.methods){var value=$element.attr(method);if(value){rules[method]=value;}}if(rules.maxlength&&/-1|2147483647|524288/.test(rules.maxlength)){delete rules.maxlength;}return rules;},metadataRules:function(element){if(!$.metadata)return{};var meta=$.data(element.form,'validator').settings.meta;return meta?$(element).metadata()[meta]:$(element).metadata();},staticRules:function(element){var rules={};var validator=$.data(element.form,'validator');if(validator.settings.rules){rules=$.validator.normalizeRule(validator.settings.rules[element.name])||{};}return rules;},normalizeRules:function(rules,element){$.each(rules,function(prop,val){if(val===false){delete rules[prop];return;}if(val.param||val.depends){var keepRule=true;switch(typeof val.depends){case"string":keepRule=!!$(val.depends,element.form).length;break;case"function":keepRule=val.depends.call(element,element);break;}if(keepRule){rules[prop]=val.param!==undefined?val.param:true;}else{delete rules[prop];}}});$.each(rules,function(rule,parameter){rules[rule]=$.isFunction(parameter)?parameter(element):parameter;});$.each(['minlength','maxlength','min','max'],function(){if(rules[this]){rules[this]=Number(rules[this]);}});$.each(['rangelength','range'],function(){if(rules[this]){rules[this]=[Number(rules[this][0]),Number(rules[this][1])];}});if($.validator.autoCreateRanges){if(rules.min&&rules.max){rules.range=[rules.min,rules.max];delete rules.min;delete rules.max;}if(rules.minlength&&rules.maxlength){rules.rangelength=[rules.minlength,rules.maxlength];delete rules.minlength;delete rules.maxlength;}}if(rules.messages){delete rules.messages;}return rules;},normalizeRule:function(data){if(typeof data=="string"){var transformed={};$.each(data.split(/\s/),function(){transformed[this]=true;});data=transformed;}return data;},addMethod:function(name,method,message){$.validator.methods[name]=method;$.validator.messages[name]=message!=undefined?message:$.validator.messages[name];if(method.length<3){$.validator.addClassRules(name,$.validator.normalizeRule(name));}},methods:{required:function(value,element,param){if(!this.depend(param,element))return"dependency-mismatch";switch(element.nodeName.toLowerCase()){case'select':var val=$(element).val();return val&&val.length>0;case'input':if(this.checkable(element))return this.getLength(value,element)>0;default:return $.trim(value).length>0;}},remote:function(value,element,param){if(this.optional(element))return"dependency-mismatch";var previous=this.previousValue(element);if(!this.settings.messages[element.name])this.settings.messages[element.name]={};previous.originalMessage=this.settings.messages[element.name].remote;this.settings.messages[element.name].remote=previous.message;param=typeof param=="string"&&{url:param}||param;if(previous.old!==value){previous.old=value;var validator=this;this.startRequest(element);var data={};data[element.name]=value;$.ajax($.extend(true,{url:param,mode:"abort",port:"validate"+element.name,dataType:"json",data:data,success:function(response){validator.settings.messages[element.name].remote=previous.originalMessage;var valid=response===true;if(valid){var submitted=validator.formSubmitted;validator.prepareElement(element);validator.formSubmitted=submitted;validator.successList.push(element);validator.showErrors();}else{var errors={};var message=(previous.message=response||validator.defaultMessage(element,"remote"));errors[element.name]=$.isFunction(message)?message(value):message;validator.showErrors(errors);}previous.valid=valid;validator.stopRequest(element,valid);}},param));return"pending";}else if(this.pending[element.name]){return"pending";}return previous.valid;},minlength:function(value,element,param){return this.optional(element)||this.getLength($.trim(value),element)>=param;},maxlength:function(value,element,param){return this.optional(element)||this.getLength($.trim(value),element)<=param;},rangelength:function(value,element,param){var length=this.getLength($.trim(value),element);return this.optional(element)||(length>=param[0]&&length<=param[1]);},min:function(value,element,param){return this.optional(element)||value>=param;},max:function(value,element,param){return this.optional(element)||value<=param;},range:function(value,element,param){return this.optional(element)||(value>=param[0]&&value<=param[1]);},email:function(value,element){return this.optional(element)||/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value);},url:function(value,element){return this.optional(element)||/^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value);},date:function(value,element){return this.optional(element)||!/Invalid|NaN/.test(new Date(value));},dateISO:function(value,element){return this.optional(element)||/^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value);},number:function(value,element){return this.optional(element)||/^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value);},digits:function(value,element){return this.optional(element)||/^\d+$/.test(value);},creditcard:function(value,element){if(this.optional(element))return"dependency-mismatch";if(/[^0-9-]+/.test(value))return false;var nCheck=0,nDigit=0,bEven=false;value=value.replace(/\D/g,"");for(var n=value.length-1;n>=0;n--){var cDigit=value.charAt(n);var nDigit=parseInt(cDigit,10);if(bEven){if((nDigit*=2)>9)nDigit-=9;}nCheck+=nDigit;bEven=!bEven;}return(nCheck%10)==0;},accept:function(value,element,param){param=typeof param=="string"?param.replace(/,/g,'|'):"png|jpe?g|gif";return this.optional(element)||value.match(new RegExp(".("+param+")$","i"));},equalTo:function(value,element,param){var target=$(param).unbind(".validate-equalTo").bind("blur.validate-equalTo",function(){$(element).valid();});return value==target.val();}}});$.format=$.validator.format;})(jQuery);;(function($){var ajax=$.ajax;var pendingRequests={};$.ajax=function(settings){settings=$.extend(settings,$.extend({},$.ajaxSettings,settings));var port=settings.port;if(settings.mode=="abort"){if(pendingRequests[port]){pendingRequests[port].abort();}return(pendingRequests[port]=ajax.apply(this,arguments));}return ajax.apply(this,arguments);};})(jQuery);;(function($){if(!jQuery.event.special.focusin&&!jQuery.event.special.focusout&&document.addEventListener){$.each({focus:'focusin',blur:'focusout'},function(original,fix){$.event.special[fix]={setup:function(){this.addEventListener(original,handler,true);},teardown:function(){this.removeEventListener(original,handler,true);},handler:function(e){arguments[0]=$.event.fix(e);arguments[0].type=fix;return $.event.handle.apply(this,arguments);}};function handler(e){e=$.event.fix(e);e.type=fix;return $.event.handle.call(this,e);}});};$.extend($.fn,{validateDelegate:function(delegate,type,handler){return this.bind(type,function(event){var target=$(event.target);if(target.is(delegate)){return handler.apply(target,arguments);}});}});})(jQuery); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.js b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.js new file mode 100644 index 000000000..1c33e59d6 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.js @@ -0,0 +1,319 @@ +/// <reference path="jquery-1.4.4.js" /> +/// <reference path="jquery.validate.js" /> + +/*! +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global document: false, jQuery: false */ + +(function ($) { + var $jQval = $.validator, + adapters, + data_validation = "unobtrusiveValidation"; + + function setValidationValues(options, ruleName, value) { + options.rules[ruleName] = value; + if (options.message) { + options.messages[ruleName] = options.message; + } + } + + function splitAndTrim(value) { + return value.replace(/^\s+|\s+$/g, "").split(/\s*,\s*/g); + } + + function getModelPrefix(fieldName) { + return fieldName.substr(0, fieldName.lastIndexOf(".") + 1); + } + + function appendModelPrefix(value, prefix) { + if (value.indexOf("*.") === 0) { + value = value.replace("*.", prefix); + } + return value; + } + + function onError(error, inputElement) { // 'this' is the form element + var container = $(this).find("[data-valmsg-for='" + inputElement[0].name + "']"), + replace = $.parseJSON(container.attr("data-valmsg-replace")) !== false; + + container.removeClass("field-validation-valid").addClass("field-validation-error"); + error.data("unobtrusiveContainer", container); + + if (replace) { + container.empty(); + error.removeClass("input-validation-error").appendTo(container); + } + else { + error.hide(); + } + } + + function onErrors(form, validator) { // 'this' is the form element + var container = $(this).find("[data-valmsg-summary=true]"), + list = container.find("ul"); + + if (list && list.length && validator.errorList.length) { + list.empty(); + container.addClass("validation-summary-errors").removeClass("validation-summary-valid"); + + $.each(validator.errorList, function () { + $("<li />").html(this.message).appendTo(list); + }); + } + } + + function onSuccess(error) { // 'this' is the form element + var container = error.data("unobtrusiveContainer"), + replace = $.parseJSON(container.attr("data-valmsg-replace")); + + if (container) { + container.addClass("field-validation-valid").removeClass("field-validation-error"); + error.removeData("unobtrusiveContainer"); + + if (replace) { + container.empty(); + } + } + } + + function validationInfo(form) { + var $form = $(form), + result = $form.data(data_validation); + + if (!result) { + result = { + options: { // options structure passed to jQuery Validate's validate() method + errorClass: "input-validation-error", + errorElement: "span", + errorPlacement: $.proxy(onError, form), + invalidHandler: $.proxy(onErrors, form), + messages: {}, + rules: {}, + success: $.proxy(onSuccess, form) + }, + attachValidation: function () { + $form.validate(this.options); + }, + validate: function () { // a validation function that is called by unobtrusive Ajax + $form.validate(); + return $form.valid(); + } + }; + $form.data(data_validation, result); + } + + return result; + } + + $jQval.unobtrusive = { + adapters: [], + + parseElement: function (element, skipAttach) { + /// <summary> + /// Parses a single HTML element for unobtrusive validation attributes. + /// </summary> + /// <param name="element" domElement="true">The HTML element to be parsed.</param> + /// <param name="skipAttach" type="Boolean">[Optional] true to skip attaching the + /// validation to the form. If parsing just this single element, you should specify true. + /// If parsing several elements, you should specify false, and manually attach the validation + /// to the form when you are finished. The default is false.</param> + var $element = $(element), + form = $element.parents("form")[0], + valInfo, rules, messages; + + if (!form) { // Cannot do client-side validation without a form + return; + } + + valInfo = validationInfo(form); + valInfo.options.rules[element.name] = rules = {}; + valInfo.options.messages[element.name] = messages = {}; + + $.each(this.adapters, function () { + var prefix = "data-val-" + this.name, + message = $element.attr(prefix), + paramValues = {}; + + if (message !== undefined) { // Compare against undefined, because an empty message is legal (and falsy) + prefix += "-"; + + $.each(this.params, function () { + paramValues[this] = $element.attr(prefix + this); + }); + + this.adapt({ + element: element, + form: form, + message: message, + params: paramValues, + rules: rules, + messages: messages + }); + } + }); + + jQuery.extend(rules, { "__dummy__": true }); + + if (!skipAttach) { + valInfo.attachValidation(); + } + }, + + parse: function (selector) { + /// <summary> + /// Parses all the HTML elements in the specified selector. It looks for input elements decorated + /// with the [data-val=true] attribute value and enables validation according to the data-val-* + /// attribute values. + /// </summary> + /// <param name="selector" type="String">Any valid jQuery selector.</param> + $(selector).find(":input[data-val=true]").each(function () { + $jQval.unobtrusive.parseElement(this, true); + }); + + $("form").each(function () { + var info = validationInfo(this); + if (info) { + info.attachValidation(); + } + }); + } + }; + + adapters = $jQval.unobtrusive.adapters; + + adapters.add = function (adapterName, params, fn) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="params" type="Array" optional="true">[Optional] An array of parameter names (strings) that will + /// be extracted from the data-val-nnnn-mmmm HTML attributes (where nnnn is the adapter name, and + /// mmmm is the parameter name).</param> + /// <param name="fn" type="Function">The function to call, which adapts the values from the HTML + /// attributes into jQuery Validate rules and/or messages.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + if (!fn) { // Called with no params, just a function + fn = params; + params = []; + } + this.push({ name: adapterName, params: params, adapt: fn }); + return this; + }; + + adapters.addBool = function (adapterName, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has no parameter values.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, function (options) { + setValidationValues(options, ruleName || adapterName, true); + }); + }; + + adapters.addMinMax = function (adapterName, minRuleName, maxRuleName, minMaxRuleName, minAttribute, maxAttribute) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation has three potential rules (one for min-only, one for max-only, and + /// one for min-and-max). The HTML parameters are expected to be named -min and -max.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="minRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a minimum value.</param> + /// <param name="maxRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a maximum value.</param> + /// <param name="minMaxRuleName" type="String">The name of the jQuery Validate rule to be used when you + /// have both a minimum and maximum value.</param> + /// <param name="minAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the minimum value. The default is "min".</param> + /// <param name="maxAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the maximum value. The default is "max".</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [minAttribute || "min", maxAttribute || "max"], function (options) { + var min = options.params.min, + max = options.params.max; + + if (min && max) { + setValidationValues(options, minMaxRuleName, [min, max]); + } + else if (min) { + setValidationValues(options, minRuleName, min); + } + else if (max) { + setValidationValues(options, maxRuleName, max); + } + }); + }; + + adapters.addSingleVal = function (adapterName, attribute, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has a single value.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute(where nnnn is the adapter name).</param> + /// <param name="attribute" type="String">[Optional] The name of the HTML attribute that contains the value. + /// The default is "val".</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [attribute || "val"], function (options) { + setValidationValues(options, ruleName || adapterName, options.params[attribute]); + }); + }; + + $jQval.addMethod("__dummy__", function (value, element, params) { + return true; + }); + + $jQval.addMethod("regex", function (value, element, params) { + var match; + if (this.optional(element)) { + return true; + } + + match = new RegExp(params).exec(value); + return (match && (match.index === 0) && (match[0].length === value.length)); + }); + + adapters.addSingleVal("accept", "exts").addSingleVal("regex", "pattern"); + adapters.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url"); + adapters.addMinMax("length", "minlength", "maxlength", "rangelength").addMinMax("range", "min", "max", "range"); + adapters.add("equalto", ["other"], function (options) { + var prefix = getModelPrefix(options.element.name), + other = options.params.other, + fullOtherName = appendModelPrefix(other, prefix), + element = $(options.form).find(":input[name=" + fullOtherName + "]")[0]; + + setValidationValues(options, "equalTo", element); + }); + adapters.add("required", function (options) { + // jQuery Validate equates "required" with "mandatory" for checkbox elements + if (options.element.tagName.toUpperCase() !== "INPUT" || options.element.type.toUpperCase() !== "CHECKBOX") { + setValidationValues(options, "required", true); + } + }); + adapters.add("remote", ["url", "type", "additionalfields"], function (options) { + var value = { + url: options.params.url, + type: options.params.type || "GET", + data: {} + }, + prefix = getModelPrefix(options.element.name); + + $.each(splitAndTrim(options.params.additionalfields || options.element.name), function (i, fieldName) { + var paramName = appendModelPrefix(fieldName, prefix); + value.data[paramName] = function () { + return $(options.form).find(":input[name='" + paramName + "']").val(); + }; + }); + + setValidationValues(options, "remote", value); + }); + + $(function () { + $jQval.unobtrusive.parse(document); + }); +}(jQuery)); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.min.js b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.min.js new file mode 100644 index 000000000..e0d8fd5c1 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var d=a.validator,b,f="unobtrusiveValidation";function c(a,b,c){a.rules[b]=c;if(a.message)a.messages[b]=a.message}function i(a){return a.replace(/^\s+|\s+$/g,"").split(/\s*,\s*/g)}function g(a){return a.substr(0,a.lastIndexOf(".")+1)}function e(a,b){if(a.indexOf("*.")===0)a=a.replace("*.",b);return a}function l(c,d){var b=a(this).find("[data-valmsg-for='"+d[0].name+"']"),e=a.parseJSON(b.attr("data-valmsg-replace"))!==false;b.removeClass("field-validation-valid").addClass("field-validation-error");c.data("unobtrusiveContainer",b);if(e){b.empty();c.removeClass("input-validation-error").appendTo(b)}else c.hide()}function k(e,d){var c=a(this).find("[data-valmsg-summary=true]"),b=c.find("ul");if(b&&b.length&&d.errorList.length){b.empty();c.addClass("validation-summary-errors").removeClass("validation-summary-valid");a.each(d.errorList,function(){a("<li />").html(this.message).appendTo(b)})}}function j(c){var b=c.data("unobtrusiveContainer"),d=a.parseJSON(b.attr("data-valmsg-replace"));if(b){b.addClass("field-validation-valid").removeClass("field-validation-error");c.removeData("unobtrusiveContainer");d&&b.empty()}}function h(d){var b=a(d),c=b.data(f);if(!c){c={options:{errorClass:"input-validation-error",errorElement:"span",errorPlacement:a.proxy(l,d),invalidHandler:a.proxy(k,d),messages:{},rules:{},success:a.proxy(j,d)},attachValidation:function(){b.validate(this.options)},validate:function(){b.validate();return b.valid()}};b.data(f,c)}return c}d.unobtrusive={adapters:[],parseElement:function(b,i){var d=a(b),f=d.parents("form")[0],c,e,g;if(!f)return;c=h(f);c.options.rules[b.name]=e={};c.options.messages[b.name]=g={};a.each(this.adapters,function(){var c="data-val-"+this.name,i=d.attr(c),h={};if(i!==undefined){c+="-";a.each(this.params,function(){h[this]=d.attr(c+this)});this.adapt({element:b,form:f,message:i,params:h,rules:e,messages:g})}});jQuery.extend(e,{__dummy__:true});!i&&c.attachValidation()},parse:function(b){a(b).find(":input[data-val=true]").each(function(){d.unobtrusive.parseElement(this,true)});a("form").each(function(){var a=h(this);a&&a.attachValidation()})}};b=d.unobtrusive.adapters;b.add=function(c,a,b){if(!b){b=a;a=[]}this.push({name:c,params:a,adapt:b});return this};b.addBool=function(a,b){return this.add(a,function(d){c(d,b||a,true)})};b.addMinMax=function(e,g,f,a,d,b){return this.add(e,[d||"min",b||"max"],function(b){var e=b.params.min,d=b.params.max;if(e&&d)c(b,a,[e,d]);else if(e)c(b,g,e);else d&&c(b,f,d)})};b.addSingleVal=function(a,b,d){return this.add(a,[b||"val"],function(e){c(e,d||a,e.params[b])})};d.addMethod("__dummy__",function(){return true});d.addMethod("regex",function(b,c,d){var a;if(this.optional(c))return true;a=(new RegExp(d)).exec(b);return a&&a.index===0&&a[0].length===b.length});b.addSingleVal("accept","exts").addSingleVal("regex","pattern");b.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url");b.addMinMax("length","minlength","maxlength","rangelength").addMinMax("range","min","max","range");b.add("equalto",["other"],function(b){var h=g(b.element.name),i=b.params.other,d=e(i,h),f=a(b.form).find(":input[name="+d+"]")[0];c(b,"equalTo",f)});b.add("required",function(a){(a.element.tagName.toUpperCase()!=="INPUT"||a.element.type.toUpperCase()!=="CHECKBOX")&&c(a,"required",true)});b.add("remote",["url","type","additionalfields"],function(b){var d={url:b.params.url,type:b.params.type||"GET",data:{}},f=g(b.element.name);a.each(i(b.params.additionalfields||b.element.name),function(h,g){var c=e(g,f);d.data[c]=function(){return a(b.form).find(":input[name='"+c+"']").val()}});c(b,"remote",d)});a(function(){d.unobtrusive.parse(document)})})(jQuery); \ No newline at end of file diff --git a/NzbDrone.Web/Views/AddSeries/AddExisting.aspx b/NzbDrone.Web/Views/AddSeries/AddExisting.aspx new file mode 100644 index 000000000..fab8a8da8 --- /dev/null +++ b/NzbDrone.Web/Views/AddSeries/AddExisting.aspx @@ -0,0 +1,16 @@ +<%@ Page Title="" Language="C#" MasterPageFile="~/Views/Shared/Site.Master" Inherits="System.Web.Mvc.ViewPage<IEnumerable<String>>" %> + +<%@ Import Namespace="Telerik.Web.Mvc.UI" %> +<%@ Import Namespace="NzbDrone.Web.Models" %> +<asp:Content ID="Content1" ContentPlaceHolderID="TitleContent" runat="server"> + Add Existing Series +</asp:Content> +<asp:Content ID="Content2" ContentPlaceHolderID="MainContent" runat="server"> + <% + foreach (var path in Model) + { + Html.RenderAction("RenderPartial", "AddSeries", new { path }); + } + + %> +</asp:Content> diff --git a/NzbDrone.Web/Views/Series/AddNew.aspx b/NzbDrone.Web/Views/AddSeries/AddNew.aspx similarity index 94% rename from NzbDrone.Web/Views/Series/AddNew.aspx rename to NzbDrone.Web/Views/AddSeries/AddNew.aspx index 82ca63d0c..c2f72eaef 100644 --- a/NzbDrone.Web/Views/Series/AddNew.aspx +++ b/NzbDrone.Web/Views/AddSeries/AddNew.aspx @@ -11,11 +11,6 @@ }); </script> </asp:Content> -<asp:Content ID="Menu" ContentPlaceHolderID="ActionMenu" runat="server"> - <% - Html.RenderPartial("SubMenu"); - %> -</asp:Content> <asp:Content ID="Content2" ContentPlaceHolderID="MainContent" runat="server"> <div style="width: 60%"> <div style="display: inline"> @@ -83,7 +78,7 @@ var seriesName = $(id).val(); var qualityProfileId = $("#QualityProfileId").val(); - $("#addResult").load('<%=Url.Action("AddNewSeries", "Series") %>', { + $("#addResult").load('<%=Url.Action("AddSeries", "Series") %>', { dir: checkedDir, seriesId: checkedSeries, seriesName: seriesName, diff --git a/NzbDrone.Web/Views/AddSeries/AddSeriesItem.cshtml b/NzbDrone.Web/Views/AddSeries/AddSeriesItem.cshtml new file mode 100644 index 000000000..7fd70a03c --- /dev/null +++ b/NzbDrone.Web/Views/AddSeries/AddSeriesItem.cshtml @@ -0,0 +1,43 @@ +@using NzbDrone.Core.Repository.Quality +@model SelectList +<div padding: 10px" id="div_@(ViewData["guid"])"> + <fieldset> + <legend>@ViewData["path"].ToString()</legend> + <div> + @{Html.Telerik().ComboBox() + .Name("seriesList_" + ViewData["guid"].ToString()) + .BindTo(Model) + .DataBinding(binding => binding.Ajax().Select("_textLookUp", "AddSeries").Delay(400).Cache(false)) + .Filterable(f => f.FilterMode(AutoCompleteFilterMode.Contains)) + .HighlightFirstMatch(true) + .HtmlAttributes(new { style = "width: 300px;" }) + .SelectedIndex(0).Render();} + @Html.Telerik().DropDownList().Name("qualityList_" + ViewData["guid"].ToString()).BindTo((SelectList)ViewData["quality"]).HtmlAttributes(new { style = "width: 100px;" }) + <button class="listButton" onclick="addSeries('@ViewData["guid"]','@ViewData["javaPath"].ToString()' )"> + Add</button> + </div> + </fieldset> +</div> +<script type="text/javascript" language="javascript"> + + var addSeriesUrl = '@Url.Action("AddSeries", "AddSeries")'; + + function addSeries(guid, path) { + var seriesComboBox = $("#seriesList_" + guid).data("tComboBox"); + var qualityComboBox = $("#qualityList_" + guid).data("tDropDownList"); + sendToServer(seriesComboBox.value(), path, qualityComboBox.value()); + $("#div_" + guid).hide(); + } + + function sendToServer(id, path, quality) { + $.ajax({ + type: "POST", + url: addSeriesUrl, + data: jQuery.param({ path: path, seriesId: id, qualityProfileId: quality }), + error: function (req, status, error) { + alert("Sorry! We could not add " + path + " at this time. " + error); + } + }); + } + +</script> diff --git a/NzbDrone.Web/Views/Home/About.aspx b/NzbDrone.Web/Views/Home/About.aspx deleted file mode 100644 index 335c141b7..000000000 --- a/NzbDrone.Web/Views/Home/About.aspx +++ /dev/null @@ -1,12 +0,0 @@ -<%@ Page Language="C#" MasterPageFile="~/Views/Shared/Site.Master" Inherits="System.Web.Mvc.ViewPage" %> - -<asp:Content ID="aboutTitle" ContentPlaceHolderID="TitleContent" runat="server"> - About Us -</asp:Content> - -<asp:Content ID="aboutContent" ContentPlaceHolderID="MainContent" runat="server"> - <h2>About</h2> - <p> - Put content here. - </p> -</asp:Content> diff --git a/NzbDrone.Web/Views/Home/Index.aspx b/NzbDrone.Web/Views/Home/Index.aspx deleted file mode 100644 index 495767f1e..000000000 --- a/NzbDrone.Web/Views/Home/Index.aspx +++ /dev/null @@ -1,19 +0,0 @@ -<%@ Page Language="C#" MasterPageFile="~/Views/Shared/Site.Master" Inherits="System.Web.Mvc.ViewPage" %> - -<%@ Import Namespace="Telerik.Web.Mvc.UI" %> -<asp:Content ID="Content1" ContentPlaceHolderID="TitleContent" runat="server"> - Logs -</asp:Content> -<asp:Content ID="Menu" ContentPlaceHolderID="ActionMenu" runat="server"> - <% - Html.Telerik().Menu().Name("logMenu").Items(items => items.Add().Text("Clear Logs").Action("Clear", "Log")).Render(); - %> -</asp:Content> -<asp:Content ID="Content2" ContentPlaceHolderID="MainContent" runat="server"> - <h2> - <%: ViewData["Message"] %></h2> - <p> - To learn more about ASP.NET MVC visit <a href="http://asp.net/mvc" title="ASP.NET MVC Website"> - http://asp.net/mvc</a>. - </p> -</asp:Content> diff --git a/NzbDrone.Web/Views/Home/Test.aspx b/NzbDrone.Web/Views/Home/Test.aspx deleted file mode 100644 index 608b60db6..000000000 --- a/NzbDrone.Web/Views/Home/Test.aspx +++ /dev/null @@ -1,31 +0,0 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/Views/Shared/Site.Master" Inherits="System.Web.Mvc.ViewPage<NzbDrone.Web.Models.TestModel>" %> - -<asp:Content ID="Content1" ContentPlaceHolderID="TitleContent" runat="server"> - Test -</asp:Content> - -<asp:Content ID="Content2" ContentPlaceHolderID="MainContent" runat="server"> - - <h2>Test</h2> - - <% using (Html.BeginForm("Test", "Home", FormMethod.Post, new { id = "form", name = "form" })) - {%> - - <div>One: <%=Html.RadioButtonFor(t => t.Number, 1)%></div> - <div>Two: <%=Html.RadioButtonFor(t => t.Number, 2)%></div> - <div>Three: <%=Html.RadioButtonFor(t => t.Number, 3)%></div> - <div>Four: <%=Html.RadioButtonFor(t => t.Number, 4)%></div> - - <input type="submit" class="button" value="Save" /> - <% } %> - -</asp:Content> - -<asp:Content ID="Content3" ContentPlaceHolderID="headerContent" runat="server"> -</asp:Content> - -<asp:Content ID="Content4" ContentPlaceHolderID="ActionMenu" runat="server"> -</asp:Content> - -<asp:Content ID="Content5" ContentPlaceHolderID="Scripts" runat="server"> -</asp:Content> diff --git a/NzbDrone.Web/Views/Series/AddExisting.aspx b/NzbDrone.Web/Views/Series/AddExisting.aspx deleted file mode 100644 index b39133a17..000000000 --- a/NzbDrone.Web/Views/Series/AddExisting.aspx +++ /dev/null @@ -1,126 +0,0 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/Views/Shared/Site.Master" Inherits="System.Web.Mvc.ViewPage<dynamic>" %> - -<%@ Import Namespace="Telerik.Web.Mvc.UI" %> -<%@ Import Namespace="NzbDrone.Web.Models" %> - -<asp:Content ID="Content1" ContentPlaceHolderID="TitleContent" runat="server"> - Add Existing Series -</asp:Content> -<asp:Content ID="Menu" ContentPlaceHolderID="ActionMenu" runat="server"> - <% - Html.RenderPartial("SubMenu"); - %> -</asp:Content> -<asp:Content ID="Content2" ContentPlaceHolderID="MainContent" runat="server"> - - <script type="text/javascript"> - $(document).ready(function () { - $('#mastercheckbox').attr("checked", "checked"); - document.getElementById('unmappedGrid').style.display = 'block'; - }); - - function Grid_onRowDataBound(e) { - //the DOM element (<tr>) representing the row which is being databound - var row = e.row; - //the data item - JavaScript object. - var tvDbId = e.dataItem.TvDbId; - - $(row).attr('id', 'row_' + tvDbId); - - //var info = row.cells[1].text(); - //row.cells[1].innerHTML = '<strong>' + dataItem + '</strong>'; - //You can use the OnRowDataBound event to customize the way data is presented on the client-side - }; - - function Grid_onLoad(e) { - $('.t-no-data').text("Loading..."); - }; - - </script> - - <%= Html.Label("Quality Profile")%> - <%: Html.DropDownList("qualityProfileId", (SelectList)ViewData["QualitySelectList"], ViewData["QualityProfileId"])%> - - <div id="unmappedGrid" style="display:none"> - <% - Html.Telerik().Grid<AddExistingSeriesModel>().Name("Unmapped_Series_Folders") - .TableHtmlAttributes(new { id = "UnmappedSeriesGrid" }) - .Columns(columns => - { - columns.Bound(c => c.IsWanted).ClientTemplate("<input type='checkbox' name='<#= Path #>' class='checkedSeries' value='<#= TvDbId #>' checked='true'/>") - .Width(20).Title("<input id='mastercheckbox' type='checkbox' style='margin-left:5px'/>") - .HtmlAttributes(new { style = "text-align:center" }); - - columns.Bound(c => c.Path).ClientTemplate("<a href=" + Url.Action("AddExistingManual", "Series", new { path = "<#= PathEncoded #>" }) + "><#= Path #></a>") - .Template(c => - { %> - <%:Html.ActionLink(c.Path, "AddExistingManual", new { path = c.Path })%> - <% }).Title("Path"); - columns.Bound(c => c.TvDbName); - }) - .DataBinding(d => d.Ajax().Select("_AjaxUnmappedFoldersGrid", "Series")) - .ClientEvents(events => events.OnRowDataBound("Grid_onRowDataBound")) - .ClientEvents(events => events.OnLoad("Grid_onLoad")) - .Footer(false) - .Render(); - %> - - <p> - <button class="t.button" onclick="syncSelected ()">Sync Selected Series</button> - </p> - - </div> - - <div id="result"></div> - -<script type="text/javascript" language="javascript"> - - // MasterCheckBox functionality - $('#mastercheckbox').click(function () { - if ($(this).attr('checked')) { - $('.checkedSeries').attr('checked', true); - } else { - $('.checkedSeries').attr('checked', false); - } - }); - - //Unchecking a 'normal' checkbox should clear the mastercheckbox as well - - $(".checkedSeries").live("click", function () { - var numChkBoxes = $('.checkedSeries').length; - var numChkBoxesChecked = $('.checkedSeries:checked').length; - - if (numChkBoxes == numChkBoxesChecked & numChkBoxes > 0) { - $('#mastercheckbox').attr('checked', true); - } - else { - $('#mastercheckbox').attr('checked', false); - } - }); - - //Sync for selected series - function syncSelected() { - - var $checkedRecords = $('.checkedSeries:checked'); - - if ($checkedRecords.length < 1) { - alert("Check one or more series first"); - return; - } - - var qualityProfileId = $("#qualityProfileId").val(); - - - $("#result").load('<%=Url.Action("SyncSelectedSeries", "Series") %>', { - checkedRecords: $checkedRecords.map(function () { return jQuery.param({ path: this.name, tvdbid: this.value, qualityProfileId: qualityProfileId }) }) - }); - - //Hide the series that we just tried to sync up (uncheck them too, otherwise they will be re-sync'd if we sync again) - $checkedRecords.each(function () { - var id = "#row_" + this.value; - $(this).attr("checked", false); - $(id).hide(); - }); - } -</script> -</asp:Content> diff --git a/NzbDrone.Web/Views/Series/AddExistingManual.aspx b/NzbDrone.Web/Views/Series/AddExistingManual.aspx deleted file mode 100644 index 1e792bb7f..000000000 --- a/NzbDrone.Web/Views/Series/AddExistingManual.aspx +++ /dev/null @@ -1,99 +0,0 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/Views/Shared/Site.Master" Inherits="System.Web.Mvc.ViewPage<NzbDrone.Web.Models.AddExistingManualModel>" %> - -<asp:Content ID="Content1" ContentPlaceHolderID="TitleContent" runat="server"> - Add Series Manually - - <script type="text/javascript"> - jQuery(document).ready(function () { - $('#searchButton').click(); - $('#searchButton').attr('disabled', ''); - }); - </script> - -</asp:Content> -<asp:Content ID="Menu" ContentPlaceHolderID="ActionMenu" runat="server"> - <% - Html.RenderPartial("SubMenu"); - %> -</asp:Content> -<asp:Content ID="Content2" ContentPlaceHolderID="MainContent" runat="server"> - - <div> - <h4><%= Html.Label(Model.Path) %></h4> - </div> - - <div style="width: 60%"> - <div style="display:inline"> - <%= Html.Label("Enter a Series Name") %> - <%= Html.TextBoxFor(m => m.FolderName, new { id="existing_series_id" }) %> - <%= Html.TextBoxFor(m => m.Path, new { id ="series_path", style="display:none" }) %> - </div> - - <div style="display:inline; float:right;"> - <%= Html.LabelFor(m => m.QualityProfileId)%> - <%: Html.DropDownListFor(m => m.QualityProfileId, Model.QualitySelectList)%> - </div> - </div> - - <p> - <button class="t.button" id="searchButton" disabled="disabled" onclick="searchSeries ()">Search</button> - </p> - - <div id="result"></div> - - <div id="addSeriesControls" style="display:none"> - <button class="t.button" onclick="addSeries ()">Add Series</button> - </div> - - <div id="addResult"></div> - - <script type="text/javascript" language="javascript"> - - $('#existing_series_id').bind('keydown', function (e) { - if (e.keyCode == 13) { - $('#searchButton').click(); - } - }); - - function searchSeries() { - var seriesSearch = $('#existing_series_id'); - - $("#result").text("Searching..."); //Tell the user that we're performing the search - document.getElementById('addSeriesControls').style.display = 'none'; //Hide the add button - $("#result").load('<%=Url.Action("SearchForSeries", "Series") %>', { - seriesName: seriesSearch.val() - }); - } - - $(".searchRadio").live("change", function () { - var checked = $(this).attr('checked'); - - if (checked) { - document.getElementById('addSeriesControls').style.display = 'inline'; - } - }); - - function addSeries() { - //Get the selected tvdbid + selected root folder - //jquery bit below doesn't want to work... - - var checkedSeries = $("input[name='selectedSeries']:checked").val(); - - var id = "#" + checkedSeries + "_text"; - var seriesName = $(id).val(); - var qualityProfileId = $("#QualityProfileId").val(); - - var pathTest = $('#series_path').val(); - $('#tester').text(pathTest); - - $("#addResult").load('<%=Url.Action("AddExistingSeries", "Series") %>', { - path: pathTest, - seriesId: checkedSeries, - qualityProfileId: qualityProfileId - }); - } - - </script> - <div id="tester"></div> - -</asp:Content> diff --git a/NzbDrone.Web/Views/Series/Details.aspx b/NzbDrone.Web/Views/Series/Details.aspx index 7c96fe1da..662c4778a 100644 --- a/NzbDrone.Web/Views/Series/Details.aspx +++ b/NzbDrone.Web/Views/Series/Details.aspx @@ -66,9 +66,9 @@ .HtmlAttributes(new { style = "text-align:center" }); columns.Bound(c => c.EpisodeNumber).Width(10).Title("Episode"); - columns.Bound(c => c.Title).Title("Title"); - columns.Bound(c => c.AirDate).Format("{0:d}").Width(0); - columns.Bound(c => c.Quality); + columns.Bound(c => c.Title).Title("Title").Width(300); + columns.Bound(c => c.AirDate).Format("{0:d}").Width(10); + columns.Bound(c => c.Quality).Width(10); columns.Bound(c => c.Path); }) //.DetailView(detailView => detailView.Template(e => Html.RenderPartial("EpisodeDetail", e))) diff --git a/NzbDrone.Web/Views/Series/EpisodeDetail.ascx b/NzbDrone.Web/Views/Series/EpisodeDetail.ascx deleted file mode 100644 index 67d7fc94a..000000000 --- a/NzbDrone.Web/Views/Series/EpisodeDetail.ascx +++ /dev/null @@ -1,14 +0,0 @@ -<%@ Control Language="C#" Inherits="System.Web.Mvc.ViewUserControl<NzbDrone.Core.Repository.Episode>" %> -<%@ Import Namespace="Telerik.Web.Mvc.UI" %> -<%: Model.Overview %> -<%--<%: - Html.Telerik().Grid(Model.Files) - .Name("files_" + Model.EpisodeId) - .Columns(columns => - { - columns.Bound(c => c.Path); - columns.Bound(c => c.Quality); - columns.Bound(c => c.DateAdded); - }) - .Footer(false) -%>--%> \ No newline at end of file diff --git a/NzbDrone.Web/Views/Series/SubMenu.ascx b/NzbDrone.Web/Views/Series/SubMenu.ascx index a0cb233a9..d7ddd8ebb 100644 --- a/NzbDrone.Web/Views/Series/SubMenu.ascx +++ b/NzbDrone.Web/Views/Series/SubMenu.ascx @@ -1,12 +1,12 @@ <%@ Control Language="C#" Inherits="System.Web.Mvc.ViewUserControl<dynamic>" %> -<%@ Import Namespace="Telerik.Web.Mvc.UI" %> +<%@ Import Namespace="NzbDrone.Web.Controllers" %> <% Html.Telerik().Menu().Name("telerikGrid").Items(items => { items.Add().Text("Add Series") - .Items(subItem => subItem.Add().Text("New Series").Action("AddNew", "Series")) - .Items(subItem => subItem.Add().Text("Existing Series").Action("AddExisting", "Series")); + .Items(subItem => subItem.Add().Text("New Series").Action<AddSeriesController>(c => c.AddNew())) + .Items(subItem => subItem.Add().Text("Existing Series").Action<AddSeriesController>(c => c.AddExisting())); - items.Add().Text("Start RSS Sync").Action("RssSync", "Series"); - items.Add().Text("Rename All").Action("RenameAll", "Series"); + items.Add().Text("Start RSS Sync").Action<SeriesController>(c => c.RssSync()); + items.Add().Text("Rename All").Action<SeriesController>(c => c.RenameAll()); }).Render(); %> \ No newline at end of file diff --git a/NzbDrone.Web/Views/Series/Unmapped.aspx b/NzbDrone.Web/Views/Series/Unmapped.aspx deleted file mode 100644 index 8255d7470..000000000 --- a/NzbDrone.Web/Views/Series/Unmapped.aspx +++ /dev/null @@ -1,28 +0,0 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/Views/Shared/Site.Master" Inherits="System.Web.Mvc.ViewPage<List<NzbDrone.Web.Models.MappingModel>>" %> - -<%@ Import Namespace="Telerik.Web.Mvc.UI" %> -<asp:Content ID="Content1" ContentPlaceHolderID="TitleContent" runat="server"> - Unmapped -</asp:Content> -<asp:Content ID="Content2" ContentPlaceHolderID="MainContent" runat="server"> - <h2> - The following folders aren't currently mapped to any Series.</h2> - <h3> - Please Re-sync your folders. If the problem persists try renaming your folders to - something more similar to the name of series they contain.</h3> - <%= Html.Telerik().Grid(Model) - .Name("Grid") - .DataKeys(dataKeys => dataKeys.Add(c => c.Id)) - .DataBinding(dataBinding => dataBinding - //Server binding - .Ajax() - .Select("UnMapped", "Series") - .Update("Update", "Home") - ) - .Columns(columns => - { - columns.Bound(c => c.Path); - columns.Command(commands => commands.Edit()); - }) - %> -</asp:Content> diff --git a/NzbDrone.Web/Views/Series/index.aspx b/NzbDrone.Web/Views/Series/index.aspx index f10b8df90..d103bd73c 100644 --- a/NzbDrone.Web/Views/Series/index.aspx +++ b/NzbDrone.Web/Views/Series/index.aspx @@ -19,14 +19,14 @@ columns.Template(c => { %> - <%:Html.ActionLink(c.Title, "Details", new {seriesId =c.SeriesId}) %> + <%:Html.ActionLink(c.Title??"New Series", "Details", new {seriesId =c.SeriesId}) %> <% - }).Title("Title"); - columns.Bound(o => o.Seasons.Count).Title("Seasons"); - columns.Bound(o => o.QualityProfile.Name).Title("Quality"); - columns.Bound(o => o.Status); - columns.Bound(o => o.AirsDayOfWeek); - columns.Bound(o => o.Path); + }).Title("Title"); + columns.Bound(o => o.Seasons.Count).Title("Seasons"); + columns.Bound(o => o.QualityProfile.Name).Title("Quality"); + columns.Bound(o => o.Status); + columns.Bound(o => o.AirsDayOfWeek); + columns.Bound(o => o.Path); }) .Sortable(sort => sort.OrderBy(order => order.Add(o => o.Title).Ascending()).Enabled(false)) diff --git a/NzbDrone.Web/Views/Web.config b/NzbDrone.Web/Views/Web.config new file mode 100644 index 000000000..24337f62b --- /dev/null +++ b/NzbDrone.Web/Views/Web.config @@ -0,0 +1,21 @@ +<?xml version="1.0"?> +<configuration> + <configSections> + <sectionGroup name="system.web.webPages.razor" type="System.Web.WebPages.Razor.Configuration.RazorWebSectionGroup, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <section name="host" type="System.Web.WebPages.Razor.Configuration.HostSection, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + <section name="pages" type="System.Web.WebPages.Razor.Configuration.RazorPagesSection, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + </sectionGroup> + </configSections> + <system.web.webPages.razor> + <host factoryType="System.Web.Mvc.MvcWebRazorHostFactory, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <pages pageBaseType="System.Web.Mvc.WebViewPage"> + <namespaces> + <add namespace="System.Web.Mvc" /> + <add namespace="System.Web.Mvc.Ajax" /> + <add namespace="System.Web.Mvc.Html" /> + <add namespace="System.Web.Routing" /> + <add namespace="Telerik.Web.Mvc.UI" /> + </namespaces> + </pages> + </system.web.webPages.razor> +</configuration> diff --git a/NzbDrone.Web/Web.config b/NzbDrone.Web/Web.config index 48e0f25bb..7a6e98f0d 100644 --- a/NzbDrone.Web/Web.config +++ b/NzbDrone.Web/Web.config @@ -3,7 +3,10 @@ <startup useLegacyV2RuntimeActivationPolicy="true"> <supportedRuntime version="v4.0" /> </startup> - <appSettings /> + <appSettings> + <add key="ClientValidationEnabled" value="false" /> + <add key="UnobtrusiveJavaScriptEnabled" value="false" /> + </appSettings> <system.web> <compilation debug="true" targetFramework="4.0"> <assemblies> @@ -11,31 +14,28 @@ <add assembly="System.Web.Abstractions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> <add assembly="System.Web.Routing, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> <add assembly="System.Data.Linq, Version=4.0.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> - <!-- <add assembly="NzbDrone.Core"/>--> + <add assembly="System.Web.Helpers, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Web.WebPages, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> </assemblies> </compilation> - - - <pages - validateRequest="false" - pageParserFilterType="System.Web.Mvc.ViewTypeParserFilter, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" - pageBaseType="System.Web.Mvc.ViewPage, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" - userControlBaseType="System.Web.Mvc.ViewUserControl, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <pages validateRequest="false" + pageParserFilterType="System.Web.Mvc.ViewTypeParserFilter, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" + pageBaseType="System.Web.Mvc.ViewPage, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" + userControlBaseType="System.Web.Mvc.ViewUserControl, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35"> <controls> <add assembly="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" namespace="System.Web.Mvc" tagPrefix="mvc" /> </controls> - <!-- rest of your pages section --> <namespaces> <add namespace="System.Web.Mvc" /> <add namespace="System.Web.Mvc.Ajax" /> <add namespace="System.Web.Mvc.Html" /> <add namespace="System.Web.Routing" /> <add namespace="Telerik.Web.Mvc" /> - <!--<add namespace="NzbDrone.Core.Repository"/>--> <add namespace="Telerik.Web.Mvc.UI" /> + <add namespace="System.Web.Helpers" /> + <add namespace="System.Web.WebPages" /> </namespaces> </pages> - <customErrors mode="Off" /> <httpHandlers> <add verb="GET,HEAD" path="asset.axd" validate="false" type="Telerik.Web.Mvc.WebAssetHttpHandler, Telerik.Web.Mvc" /> @@ -56,7 +56,7 @@ <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> <dependentAssembly> <assemblyIdentity name="System.Web.Mvc" publicKeyToken="31bf3856ad364e35" /> - <bindingRedirect oldVersion="3.0.0.0" newVersion="3.0.0.0" /> + <bindingRedirect oldVersion="1.0.0.0-2.0.0.0" newVersion="3.0.0.0" /> </dependentAssembly> </assemblyBinding> </runtime> diff --git a/NzbDrone.sln b/NzbDrone.sln index 038273ff3..0cfcfbde7 100644 --- a/NzbDrone.sln +++ b/NzbDrone.sln @@ -27,7 +27,6 @@ Global GlobalSection(ProjectConfigurationPlatforms) = postSolution {D12F7F2F-8A3C-415F-88FA-6DD061A84869}.Debug|Any CPU.ActiveCfg = Debug|x86 {D12F7F2F-8A3C-415F-88FA-6DD061A84869}.Debug|Mixed Platforms.ActiveCfg = Debug|x86 - {D12F7F2F-8A3C-415F-88FA-6DD061A84869}.Debug|Mixed Platforms.Build.0 = Debug|x86 {D12F7F2F-8A3C-415F-88FA-6DD061A84869}.Debug|x64.ActiveCfg = Debug|x86 {D12F7F2F-8A3C-415F-88FA-6DD061A84869}.Debug|x86.ActiveCfg = Debug|x86 {D12F7F2F-8A3C-415F-88FA-6DD061A84869}.Debug|x86.Build.0 = Debug|x86 @@ -39,8 +38,8 @@ Global {D12F7F2F-8A3C-415F-88FA-6DD061A84869}.Release|x86.Build.0 = Release|x86 {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|Any CPU.ActiveCfg = Debug|Any CPU {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|Any CPU.Build.0 = Debug|Any CPU - {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|Mixed Platforms.ActiveCfg = Debug|x86 - {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|Mixed Platforms.Build.0 = Debug|x86 + {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|Mixed Platforms.ActiveCfg = Debug|Any CPU + {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|Mixed Platforms.Build.0 = Debug|Any CPU {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|x64.ActiveCfg = Debug|x64 {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|x64.Build.0 = Debug|x64 {FF5EE3B6-913B-47CE-9CEB-11C51B4E1205}.Debug|x86.ActiveCfg = Debug|x86 @@ -81,7 +80,6 @@ Global {193ADD3B-792B-4173-8E4C-5A3F8F0237F0}.Release|x86.ActiveCfg = Release|Any CPU {0C679573-736D-4F77-B934-FD8931AC1AA1}.Debug|Any CPU.ActiveCfg = Debug|x86 {0C679573-736D-4F77-B934-FD8931AC1AA1}.Debug|Mixed Platforms.ActiveCfg = Debug|x86 - {0C679573-736D-4F77-B934-FD8931AC1AA1}.Debug|Mixed Platforms.Build.0 = Debug|x86 {0C679573-736D-4F77-B934-FD8931AC1AA1}.Debug|x64.ActiveCfg = Debug|x86 {0C679573-736D-4F77-B934-FD8931AC1AA1}.Debug|x86.ActiveCfg = Debug|x86 {0C679573-736D-4F77-B934-FD8931AC1AA1}.Debug|x86.Build.0 = Debug|x86